![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[TXT]](/icons/text.gif) | (425) 822-5251.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | 7 hour war.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | 9MM pistol.html | 2021-04-09 11:12 | 121 | |
![[TXT]](/icons/text.gif) | 200-.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | 202-.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | 314 URB-LOC 0017.html | 2021-04-09 11:12 | 5.1K | |
![[TXT]](/icons/text.gif) | 314 URB-LOC 0017 Advisor.html | 2021-04-09 11:12 | 5.4K | |
![[TXT]](/icons/text.gif) | 357.html | 2021-04-09 11:12 | 3.6K | |
![[TXT]](/icons/text.gif) | 357 Magnum.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | 1500 Megawatt Aperture Science Heavy Duty Super-Colliding Super Button.html | 2021-04-09 11:12 | 9.0K | |
![[TXT]](/icons/text.gif) | 1940s.html | 2021-04-09 11:12 | 127 | |
![[TXT]](/icons/text.gif) | 1943.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1944.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | 1947.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1949.html | 2021-04-09 11:12 | 3.6K | |
![[TXT]](/icons/text.gif) | 1950s.html | 2021-04-09 11:12 | 127 | |
![[TXT]](/icons/text.gif) | 1952.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1953.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1954.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1955.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1956.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1957.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | 1958.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | 1960s.html | 2021-04-09 11:12 | 127 | |
![[TXT]](/icons/text.gif) | 1961.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1968.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1970s.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | 1971.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | 1972.html | 2021-04-09 11:12 | 35K | |
![[TXT]](/icons/text.gif) | 1973.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1974.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | 1975.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | 1976.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | 1977.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1978.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1979.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1980s.html | 2021-04-09 11:12 | 127 | |
![[TXT]](/icons/text.gif) | 1981.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1982.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1983.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1985.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1986.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1990s.html | 2021-04-09 11:12 | 127 | |
![[TXT]](/icons/text.gif) | 1996.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1997.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 1998.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | 2000s.html | 2021-04-09 11:12 | 127 | |
![[TXT]](/icons/text.gif) | 2003 leak.html | 2021-04-09 11:12 | 113 | |
![[TXT]](/icons/text.gif) | 2010 Portal updates.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | 2020s.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | A.M.G..html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | A. Shephard.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | AH-64 Apache.html | 2021-04-09 11:12 | 7.2K | |
![[TXT]](/icons/text.gif) | AK-47.html | 2021-04-09 11:12 | 2.9K | |
![[TXT]](/icons/text.gif) | AK47.html | 2021-04-09 11:12 | 42K | |
![[TXT]](/icons/text.gif) | A Leap of Faith.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | AMG.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | APC.html | 2021-04-09 11:12 | 161 | |
![[TXT]](/icons/text.gif) | APC garage.html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | AR-1.html | 2021-04-09 11:12 | 122 | |
![[TXT]](/icons/text.gif) | AR1.html | 2021-04-09 11:12 | 121 | |
![[TXT]](/icons/text.gif) | AR2 (disambiguation).html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | AR2.html | 2021-04-09 11:12 | 1.8K | |
![[TXT]](/icons/text.gif) | AR2 Pulse Rifle.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | AR3.html | 2021-04-09 11:12 | 2.3K | |
![[TXT]](/icons/text.gif) | AR3 Guy.html | 2021-04-09 11:12 | 7.8K | |
![[TXT]](/icons/text.gif) | ARG (disambiguation).html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | ARG.html | 2021-04-09 11:12 | 111 | |
![[TXT]](/icons/text.gif) | A Red Letter Day.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | ASHPD.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | ATLAS and P-body.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | Aaron Barber.html | 2021-04-09 11:12 | 8.5K | |
![[TXT]](/icons/text.gif) | Abby (Portal Prelude).html | 2021-04-09 11:12 | 202 | |
![[TXT]](/icons/text.gif) | Abby.html | 2021-04-09 11:12 | 846 | |
![[TXT]](/icons/text.gif) | About.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Abrams.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Abridge.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | Absolute Redemption.html | 2021-04-09 11:12 | 9.5K | |
![[TXT]](/icons/text.gif) | Achievement.html | 2021-04-09 11:12 | 8.5K | |
![[TXT]](/icons/text.gif) | Achievements (disambiguation).html | 2021-04-09 11:12 | 384 | |
![[TXT]](/icons/text.gif) | Achievements.html | 2021-04-09 11:12 | 129 | |
![[TXT]](/icons/text.gif) | Acid Worker Antlion.html | 2021-04-09 11:12 | 640 | |
![[TXT]](/icons/text.gif) | Adam Baldwin.html | 2021-04-09 11:12 | 6.1K | |
![[TXT]](/icons/text.gif) | Admin.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Administration.html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | Administrator.html | 2021-04-09 11:12 | 165 | |
![[TXT]](/icons/text.gif) | Administrators.html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | Admins.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Adrian.html | 2021-04-09 11:12 | 2.9K | |
![[TXT]](/icons/text.gif) | Adrian Shepard.html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | Adrian Shephard.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Advanced Biological Research Lab.html | 2021-04-09 11:12 | 8.0K | |
![[TXT]](/icons/text.gif) | Advanced Knee Replacement.html | 2021-04-09 11:12 | 6.3K | |
![[TXT]](/icons/text.gif) | Adventure Core.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Advisor.html | 2021-04-09 11:12 | 621 | |
![[TXT]](/icons/text.gif) | Advisor Platform.html | 2021-04-09 11:12 | 1.8K | |
![[TXT]](/icons/text.gif) | Advisor Pod.html | 2021-04-09 11:12 | 6.2K | |
![[TXT]](/icons/text.gif) | Aerial Faith Plate.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Aftermath.html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | Agrunt.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Air Boat.html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | Air Conditioner.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Air Ex.html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | AirEx.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | AirEx Truck.html | 2021-04-09 11:12 | 3.1K | |
![[TXT]](/icons/text.gif) | Air Exchange.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Airboat.html | 2021-04-09 11:12 | 7.2K | |
![[TXT]](/icons/text.gif) | Alésia Glidewell.html | 2021-04-09 11:12 | 5.1K | |
![[TXT]](/icons/text.gif) | Al Anderson.html | 2021-04-09 11:12 | 362 | |
![[TXT]](/icons/text.gif) | Aleph.html | 2021-04-09 11:12 | 74K | |
![[TXT]](/icons/text.gif) | Alesia Glidewell.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Alex.html | 2021-04-09 11:12 | 132 | |
![[TXT]](/icons/text.gif) | Alex Vance.html | 2021-04-09 11:12 | 9.1K | |
![[TXT]](/icons/text.gif) | Alien Aircraft.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | Alien Assassin.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | Alien Combine Soldier.html | 2021-04-09 11:12 | 4.8K | |
![[TXT]](/icons/text.gif) | Alien Controller.html | 2021-04-09 11:12 | 5.7K | |
![[TXT]](/icons/text.gif) | Alien Controllers.html | 2021-04-09 11:12 | 157 | |
![[TXT]](/icons/text.gif) | Alien Fauna.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | Alien Grunt.html | 2021-04-09 11:12 | 9.3K | |
![[TXT]](/icons/text.gif) | Alien Organic Assault Rifle.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Alien Organic Chainsaw.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Alien Quarantine Labs.html | 2021-04-09 11:12 | 3.5K | |
![[TXT]](/icons/text.gif) | Alien Slave.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Alix.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | All-Knowing Vortigaunt.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | Alyx's Gun.html | 2021-04-09 11:12 | 7.4K | |
![[TXT]](/icons/text.gif) | Alyx's Home.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | Alyx's Multitool.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Alyx's Tool.html | 2021-04-09 11:12 | 135 | |
![[TXT]](/icons/text.gif) | Alyx's cache.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Alyx.html | 2021-04-09 11:12 | 129 | |
![[TXT]](/icons/text.gif) | Alyx Gun.html | 2021-04-09 11:12 | 604 | |
![[TXT]](/icons/text.gif) | Alyx Multitool.html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | Alyx Tool.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | Alyx Vance.html | 2021-04-09 11:12 | 43K | |
![[TXT]](/icons/text.gif) | Anabelle Shotgun.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Andrea Wicklund.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | Android.html | 2021-04-09 11:12 | 181 | |
![[TXT]](/icons/text.gif) | Anger Core.html | 2021-04-09 11:12 | 194 | |
![[TXT]](/icons/text.gif) | Animal-King.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Animal.html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | Animal King.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Animal King Turret.html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | Annabelle.html | 2021-04-09 11:12 | 8.7K | |
![[TXT]](/icons/text.gif) | Annabelle Shotgun.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Announcement System.html | 2021-04-09 11:12 | 37K | |
![[TXT]](/icons/text.gif) | Announcer.html | 2021-04-09 11:12 | 189 | |
![[TXT]](/icons/text.gif) | Anomalous Materials.html | 2021-04-09 11:12 | 185 | |
![[TXT]](/icons/text.gif) | Anomalous Materials Lab.html | 2021-04-09 11:12 | 129 | |
![[TXT]](/icons/text.gif) | Ant Lion.html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | Anti-Mass Spectrometer.html | 2021-04-09 11:12 | 6.1K | |
![[TXT]](/icons/text.gif) | Anticitizen.html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | Anticitizen One.html | 2021-04-09 11:12 | 128 | |
![[TXT]](/icons/text.gif) | Antlion.html | 2021-04-09 11:12 | 7.9K | |
![[TXT]](/icons/text.gif) | Antlion Detector.html | 2021-04-09 11:12 | 1.8K | |
![[TXT]](/icons/text.gif) | Antlion Grub.html | 2021-04-09 11:12 | 8.9K | |
![[TXT]](/icons/text.gif) | Antlion Guard.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | Antlion Guardian.html | 2021-04-09 11:12 | 7.2K | |
![[TXT]](/icons/text.gif) | Antlion Hill.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Antlion King.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | Antlion Nest.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Antlion Soldier.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Antlion Warrior.html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | Antlion Worker.html | 2021-04-09 11:12 | 9.2K | |
![[TXT]](/icons/text.gif) | Antlion caverns.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Antlion caves.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Antlion nugget.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Antonov.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | Apache.html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | Aperture (disambiguation).html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | Aperture.html | 2021-04-09 11:12 | 5.4K | |
![[TXT]](/icons/text.gif) | Aperture Fixtures.html | 2021-04-09 11:12 | 4.6K | |
![[TXT]](/icons/text.gif) | Aperture Image Format.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | ApertureLaboratories.com.html | 2021-04-09 11:12 | 170 | |
![[TXT]](/icons/text.gif) | Aperture Laboratories.html | 2021-04-09 11:12 | 197 | |
![[TXT]](/icons/text.gif) | ApertureLabratories.com.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Aperture Labs.html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | Aperture Picture Format.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | ApertureScience.com.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | Aperture Science.html | 2021-04-09 11:12 | 45K | |
![[TXT]](/icons/text.gif) | Aperture Science Aerial Faith Plate.html | 2021-04-09 11:12 | 8.8K | |
![[TXT]](/icons/text.gif) | Aperture Science Announcement System.html | 2021-04-09 11:12 | 8.3K | |
![[TXT]](/icons/text.gif) | Aperture Science Announcer.html | 2021-04-09 11:12 | 206 | |
![[TXT]](/icons/text.gif) | Aperture Science Annouoncer.html | 2021-04-09 11:12 | 207 | |
![[TXT]](/icons/text.gif) | Aperture Science Bomb.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | Aperture Science Bombs.html | 2021-04-09 11:12 | 172 | |
![[TXT]](/icons/text.gif) | Aperture Science Collaborative Disposition Test.html | 2021-04-09 11:12 | 7.4K | |
![[TXT]](/icons/text.gif) | Aperture Science Cooperative Testing Initiative (disambiguation).html | 2021-04-09 11:12 | 445 | |
![[TXT]](/icons/text.gif) | Aperture Science Cooperative Testing Initiative.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Aperture Science Core Input Receptacle.html | 2021-04-09 11:12 | 7.9K | |
![[TXT]](/icons/text.gif) | Aperture Science Core Transfer Receptacle.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | Aperture Science Crusher.html | 2021-04-09 11:12 | 5.5K | |
![[TXT]](/icons/text.gif) | Aperture Science Cube Button.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | Aperture Science Discouragement Redirection Cube.html | 2021-04-09 11:12 | 172 | |
![[TXT]](/icons/text.gif) | Aperture Science Discouragment Field.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Aperture Science Edgeless Safety Cube.html | 2021-04-09 11:12 | 185 | |
![[TXT]](/icons/text.gif) | Aperture Science Edgeless Safety Cube Receptacle.html | 2021-04-09 11:12 | 2.4K | |
![[TXT]](/icons/text.gif) | Aperture Science Emergency Intelligence Incinerator.html | 2021-04-09 11:12 | 5.3K | |
![[TXT]](/icons/text.gif) | Aperture Science Enrichment Center.html | 2021-04-09 11:12 | 33K | |
![[TXT]](/icons/text.gif) | Aperture Science Excursion Funnel.html | 2021-04-09 11:12 | 5.1K | |
![[TXT]](/icons/text.gif) | Aperture Science Extended Relaxation Annex.html | 2021-04-09 11:12 | 5.1K | |
![[TXT]](/icons/text.gif) | Aperture Science Extended Relaxation Center.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Aperture Science Handheld Portal Device.html | 2021-04-09 11:12 | 31K | |
![[TXT]](/icons/text.gif) | Aperture Science Hard Light Bridge.html | 2021-04-09 11:12 | 6.2K | |
![[TXT]](/icons/text.gif) | Aperture Science High Energy Pellet.html | 2021-04-09 11:12 | 6.6K | |
![[TXT]](/icons/text.gif) | Aperture Science Innovators.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | Aperture Science Laboratories.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | Aperture Science Laser Field.html | 2021-04-09 11:12 | 4.7K | |
![[TXT]](/icons/text.gif) | Aperture Science Laser Grill.html | 2021-04-09 11:12 | 192 | |
![[TXT]](/icons/text.gif) | Aperture Science Long Fall Boots.html | 2021-04-09 11:12 | 168 | |
![[TXT]](/icons/text.gif) | Aperture Science Material Emancipation Grid.html | 2021-04-09 11:12 | 175 | |
![[TXT]](/icons/text.gif) | Aperture Science Material Emancipation Grill.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Aperture Science Military Android.html | 2021-04-09 11:12 | 5.6K | |
![[TXT]](/icons/text.gif) | Aperture Science Multitasking Arm.html | 2021-04-09 11:12 | 8.5K | |
![[TXT]](/icons/text.gif) | Aperture Science Paint.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | Aperture Science Panel.html | 2021-04-09 11:12 | 8.7K | |
![[TXT]](/icons/text.gif) | Aperture Science Panels.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Aperture Science Personality Construct.html | 2021-04-09 11:12 | 30K | |
![[TXT]](/icons/text.gif) | Aperture Science Personality Core.html | 2021-04-09 11:12 | 217 | |
![[TXT]](/icons/text.gif) | Aperture Science Pipe Network.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Aperture Science Pneumatic Diversity Vent.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Aperture Science Portal Project.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Aperture Science Pressure Plate.html | 2021-04-09 11:12 | 230 | |
![[TXT]](/icons/text.gif) | Aperture Science Propulsion Gel.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | Aperture Science Psychoacoustics Laboratory.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Aperture Science Radio.html | 2021-04-09 11:12 | 8.8K | |
![[TXT]](/icons/text.gif) | Aperture Science Repulsion Gel.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | Aperture Science Robot Worker.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | Aperture Science Security Camera.html | 2021-04-09 11:12 | 6.5K | |
![[TXT]](/icons/text.gif) | Aperture Science Sentry Turret.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | Aperture Science Shredder.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | Aperture Science Speaker System.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Aperture Science Switch.html | 2021-04-09 11:12 | 2.3K | |
![[TXT]](/icons/text.gif) | Aperture Science Thermal Discouragement Beam.html | 2021-04-09 11:12 | 206 | |
![[TXT]](/icons/text.gif) | Aperture Science Thing We Don't Know What It Does.html | 2021-04-09 11:12 | 180 | |
![[TXT]](/icons/text.gif) | Aperture Science Unstationary Scaffold.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | Aperture Science Vital Apparatus Vent.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Aperture Science Weighted Pivot Cube.html | 2021-04-09 11:12 | 5.6K | |
![[TXT]](/icons/text.gif) | Aperture Science Weighted Storage Cube.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Aperture Science Weighted Storage Cube Receptacle.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Aperture Turret.html | 2021-04-09 11:12 | 183 | |
![[TXT]](/icons/text.gif) | Apprehension.html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | Apreture Science Annouoncer.html | 2021-04-09 11:12 | 207 | |
![[TXT]](/icons/text.gif) | Arcade.html | 2021-04-09 11:12 | 2.6K | |
![[TXT]](/icons/text.gif) | Archer.html | 2021-04-09 11:12 | 3.2K | |
![[TXT]](/icons/text.gif) | Area 3 Medium Security Facilities.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | Area 7 Recreational Facilities.html | 2021-04-09 11:12 | 172 | |
![[TXT]](/icons/text.gif) | Area 8 Topside Dormitories.html | 2021-04-09 11:12 | 3.4K | |
![[TXT]](/icons/text.gif) | Area 9 Central Transit Hub.html | 2021-04-09 11:12 | 161 | |
![[TXT]](/icons/text.gif) | Area 9 Security Checkpoint.html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | Arlene.html | 2021-04-09 11:12 | 321 | |
![[TXT]](/icons/text.gif) | Armor Vest and Helmet.html | 2021-04-09 11:12 | 6.6K | |
![[TXT]](/icons/text.gif) | Armored Personnel Carrier.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | Armor vest.html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | Armoured Personnel Carrier.html | 2021-04-09 11:12 | 184 | |
![[TXT]](/icons/text.gif) | Armstrong.html | 2021-04-09 11:12 | 374 | |
![[TXT]](/icons/text.gif) | Arne.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Arne Magnusson.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Arsenio Navarro.html | 2021-04-09 11:12 | 366 | |
![[TXT]](/icons/text.gif) | Asbestos.html | 2021-04-09 11:12 | 182 | |
![[TXT]](/icons/text.gif) | Assassin (disambiguation).html | 2021-04-09 11:12 | 310 | |
![[TXT]](/icons/text.gif) | Assassin.html | 2021-04-09 11:12 | 1.6K | |
![[TXT]](/icons/text.gif) | Atlas.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Atomic bomb.html | 2021-04-09 11:12 | 5.2K | |
![[TXT]](/icons/text.gif) | Attack on White Forest.html | 2021-04-09 11:12 | 6.5K | |
![[TXT]](/icons/text.gif) | August 15.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Autogun.html | 2021-04-09 11:12 | 4.7K | |
![[TXT]](/icons/text.gif) | Automatic Diagnostic and Announcement System.html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | Axel Gembe.html | 2021-04-09 11:12 | 34K | |
![[TXT]](/icons/text.gif) | Azian.html | 2021-04-09 11:12 | 4.7K | |
![[TXT]](/icons/text.gif) | Azian Vance.html | 2021-04-09 11:12 | 3.4K | |
![[TXT]](/icons/text.gif) | B. Martel.html | 2021-04-09 11:12 | 407 | |
![[TXT]](/icons/text.gif) | BBS.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | BM.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | BME.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | BMI.html | 2021-04-09 11:12 | 9.0K | |
![[TXT]](/icons/text.gif) | BMRF.html | 2021-04-09 11:12 | 64K | |
![[TXT]](/icons/text.gif) | BS.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Backman (disambiguation).html | 2021-04-09 11:12 | 355 | |
![[TXT]](/icons/text.gif) | Backman (scientist).html | 2021-04-09 11:12 | 4.8K | |
![[TXT]](/icons/text.gif) | Backman (security guard).html | 2021-04-09 11:12 | 434 | |
![[TXT]](/icons/text.gif) | Backman.html | 2021-04-09 11:12 | 119 | |
![[TXT]](/icons/text.gif) | Bahl (disambiguation).html | 2021-04-09 11:12 | 566 | |
![[TXT]](/icons/text.gif) | Bahl (scientist).html | 2021-04-09 11:12 | 381 | |
![[TXT]](/icons/text.gif) | Bahl.html | 2021-04-09 11:12 | 113 | |
![[TXT]](/icons/text.gif) | Bailey (disambiguation).html | 2021-04-09 11:12 | 353 | |
![[TXT]](/icons/text.gif) | Bailey (scientist).html | 2021-04-09 11:12 | 418 | |
![[TXT]](/icons/text.gif) | Bailey (security guard).html | 2021-04-09 11:12 | 433 | |
![[TXT]](/icons/text.gif) | Bailey.html | 2021-04-09 11:12 | 117 | |
![[TXT]](/icons/text.gif) | Barn Advisor.html | 2021-04-09 11:12 | 5.5K | |
![[TXT]](/icons/text.gif) | Barnacle.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | Barnacle Grapple.html | 2021-04-09 11:12 | 5.6K | |
![[TXT]](/icons/text.gif) | Barnacle Gun.html | 2021-04-09 11:12 | 893 | |
![[TXT]](/icons/text.gif) | Barnes.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Barney.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Barney Calhoun.html | 2021-04-09 11:12 | 28K | |
![[TXT]](/icons/text.gif) | Barricade.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Base.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | Bass.html | 2021-04-09 11:12 | 377 | |
![[TXT]](/icons/text.gif) | Battery.html | 2021-04-09 11:12 | 6.9K | |
![[TXT]](/icons/text.gif) | Battle of City 17.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Bean Cube.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Beancube.html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | Beegun.html | 2021-04-09 11:12 | 127 | |
![[TXT]](/icons/text.gif) | Beier.html | 2021-04-09 11:12 | 378 | |
![[TXT]](/icons/text.gif) | Ben Houge.html | 2021-04-09 11:12 | 4.8K | |
![[TXT]](/icons/text.gif) | Bennet.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Bennett.html | 2021-04-09 11:12 | 5.6K | |
![[TXT]](/icons/text.gif) | Beretta.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | Beretta M9.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Bernier.html | 2021-04-09 11:12 | 425 | |
![[TXT]](/icons/text.gif) | Beth.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Beyond Black Mesa.html | 2021-04-09 11:12 | 6.1K | |
![[TXT]](/icons/text.gif) | Big Momma.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | Big Momma Pod.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | Big Rat.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | Bigrat.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Bill Van Buren.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | Bingo Mod.html | 2021-04-09 11:12 | 5.2K | |
![[TXT]](/icons/text.gif) | Binoculars (cut item).html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | Binoculars (cut weapon).html | 2021-04-09 11:12 | 703 | |
![[TXT]](/icons/text.gif) | Binoculars (disambiguation).html | 2021-04-09 11:12 | 434 | |
![[TXT]](/icons/text.gif) | Binoculars.html | 2021-04-09 11:12 | 125 | |
![[TXT]](/icons/text.gif) | Biodome Complex.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Biological Waste Processing Plant.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Bird (Crow, Portal 2).html | 2021-04-09 11:12 | 124 | |
![[TXT]](/icons/text.gif) | Bird (Portal 2).html | 2021-04-09 11:12 | 4.0K | |
![[TXT]](/icons/text.gif) | Bird.html | 2021-04-09 11:12 | 761 | |
![[TXT]](/icons/text.gif) | Birds.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Birdwell.html | 2021-04-09 11:12 | 408 | |
![[TXT]](/icons/text.gif) | Birkutgrad.html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | Birther.html | 2021-04-09 11:12 | 63K | |
![[TXT]](/icons/text.gif) | Black.html | 2021-04-09 11:12 | 356 | |
![[TXT]](/icons/text.gif) | Black Hole Grenade.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | Black Hole Gun.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | Black Hole Hopwire.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Black Mesa (corporation).html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | Black Mesa (disambiguation).html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | Black Mesa (mod).html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | Black Mesa.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Black Mesa Air Control.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | Black Mesa Announcement System.html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | Black Mesa Ceiling Turret.html | 2021-04-09 11:12 | 5.8K | |
![[TXT]](/icons/text.gif) | Black Mesa Crossbow.html | 2021-04-09 11:12 | 9.0K | |
![[TXT]](/icons/text.gif) | Black Mesa Dam.html | 2021-04-09 11:12 | 692 | |
![[TXT]](/icons/text.gif) | Black Mesa East (Chapter).html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Black Mesa East.html | 2021-04-09 11:12 | 22K | |
![[TXT]](/icons/text.gif) | Black Mesa Facility.html | 2021-04-09 11:12 | 180 | |
![[TXT]](/icons/text.gif) | Black Mesa Hydro-Electric Dam.html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | Black Mesa Inbound.html | 2021-04-09 11:12 | 190 | |
![[TXT]](/icons/text.gif) | Black Mesa Incident.html | 2021-04-09 11:12 | 165 | |
![[TXT]](/icons/text.gif) | Black Mesa Infirmary.html | 2021-04-09 11:12 | 4.0K | |
![[TXT]](/icons/text.gif) | Black Mesa Medical Lab.html | 2021-04-09 11:12 | 4.7K | |
![[TXT]](/icons/text.gif) | Black Mesa Personnel.html | 2021-04-09 11:12 | 168 | |
![[TXT]](/icons/text.gif) | Black Mesa Research Facility.html | 2021-04-09 11:12 | 43K | |
![[TXT]](/icons/text.gif) | Black Mesa Research Incident.html | 2021-04-09 11:12 | 33K | |
![[TXT]](/icons/text.gif) | Black Mesa SPAS-12.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Black Mesa SUV.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | Black Mesa Science Team.html | 2021-04-09 11:12 | 26K | |
![[TXT]](/icons/text.gif) | Black Mesa Scientist.html | 2021-04-09 11:12 | 174 | |
![[TXT]](/icons/text.gif) | Black Mesa Security Force.html | 2021-04-09 11:12 | 27K | |
![[TXT]](/icons/text.gif) | Black Mesa Security Guard.html | 2021-04-09 11:12 | 183 | |
![[TXT]](/icons/text.gif) | Black Mesa Source.html | 2021-04-09 11:12 | 121 | |
![[TXT]](/icons/text.gif) | Black Mesa South Access.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | Black Mesa South Access Tunnel.html | 2021-04-09 11:12 | 184 | |
![[TXT]](/icons/text.gif) | Black Mesa South Exit.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | Black Mesa Times.html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | Black Mesa Transit.html | 2021-04-09 11:12 | 176 | |
![[TXT]](/icons/text.gif) | Black Mesa Transit Authority.html | 2021-04-09 11:12 | 186 | |
![[TXT]](/icons/text.gif) | Black Mesa Transit System.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Black Mesa desert.html | 2021-04-09 11:12 | 7.3K | |
![[TXT]](/icons/text.gif) | Black Mesa public announcement system.html | 2021-04-09 11:12 | 205 | |
![[TXT]](/icons/text.gif) | Black Mesa rocket.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Black Mesa truck.html | 2021-04-09 11:12 | 5.4K | |
![[TXT]](/icons/text.gif) | Black Op.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Black Operator.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Black Operators.html | 2021-04-09 11:12 | 817 | |
![[TXT]](/icons/text.gif) | Black Ops.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | Black Ops Mortar.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | Blackhole Grenade.html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | Blackhole Hopwire.html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | Blast Pit.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | BlogHalf-Life news.html | 2021-04-09 11:12 | 896 | |
![[TXT]](/icons/text.gif) | BlogRecent posts.html | 2021-04-09 11:12 | 6.5K | |
![[TXT]](/icons/text.gif) | Blue.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Blue Portals.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | Blue Shift.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Blue and Orange.html | 2021-04-09 11:12 | 155 | |
![[TXT]](/icons/text.gif) | Blue shift storyline.html | 2021-04-09 11:12 | 7.9K | |
![[TXT]](/icons/text.gif) | Bob.html | 2021-04-09 11:12 | 275 | |
![[TXT]](/icons/text.gif) | Boid.html | 2021-04-09 11:12 | 7.2K | |
![[TXT]](/icons/text.gif) | Bomb.html | 2021-04-09 11:12 | 168 | |
![[TXT]](/icons/text.gif) | Bond.html | 2021-04-09 11:12 | 404 | |
![[TXT]](/icons/text.gif) | Boot.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Boot Camp.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Boots.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Borealis (cut).html | 2021-04-09 11:12 | 4.0K | |
![[TXT]](/icons/text.gif) | Borealis (cut location).html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Borealis.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Box Car Joe.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | BoxCar Joe.html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | Bradley.html | 2021-04-09 11:12 | 3.9K | |
![[TXT]](/icons/text.gif) | Brainboy.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | Breeder.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Breen.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Breencast.html | 2021-04-09 11:12 | 24K | |
![[TXT]](/icons/text.gif) | Brenda Bogenschutz.html | 2021-04-09 11:12 | 373 | |
![[TXT]](/icons/text.gif) | Brett Johnson.html | 2021-04-09 11:12 | 24K | |
![[TXT]](/icons/text.gif) | Brian Hess.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | Brickbat.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Bridge Point.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Bug Bait.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Bugbait.html | 2021-04-09 11:12 | 8.6K | |
![[TXT]](/icons/text.gif) | Buggy.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | Bull Chicken.html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | Bullsquid.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Bureaucrat.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Bureaucrats.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | Bus.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | Butcher.html | 2021-04-09 11:12 | 155 | |
![[TXT]](/icons/text.gif) | Button.html | 2021-04-09 11:12 | 164 | |
![[TXT]](/icons/text.gif) | C-130.html | 2021-04-09 11:12 | 8.0K | |
![[TXT]](/icons/text.gif) | C. 1943.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | C. 1961.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | C. 1967.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | C. 1971.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | C. 1976.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | C. 2018.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | C17.html | 2021-04-09 11:12 | 125 | |
![[TXT]](/icons/text.gif) | CATO.html | 2021-04-09 11:12 | 865 | |
![[TXT]](/icons/text.gif) | CIA.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | CIA Brainboy.html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | CIA Female Soldier.html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | CIA Soldier.html | 2021-04-09 11:12 | 159 | |
![[TXT]](/icons/text.gif) | CJohnson.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | CODLEAK.html | 2021-04-09 11:12 | 835 | |
![[TXT]](/icons/text.gif) | CODRL.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | CP.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Cabin.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Cake.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Calhoun.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Calibration Course.html | 2021-04-09 11:12 | 180 | |
![[TXT]](/icons/text.gif) | Camera (disambiguation).html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Camera.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | Canal.html | 2021-04-09 11:12 | 125 | |
![[TXT]](/icons/text.gif) | Canals.html | 2021-04-09 11:12 | 9.4K | |
![[TXT]](/icons/text.gif) | Cannon.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Canon.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Canonical.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Canonicity.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Canyon.html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | Captain Johanson.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Captain Johanssen.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Captain Vance.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | Captive Freight.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Car Trap.html | 2021-04-09 11:12 | 2.6K | |
![[TXT]](/icons/text.gif) | Cara Bel.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Cara Mia.html | 2021-04-09 11:12 | 25K | |
![[TXT]](/icons/text.gif) | Car battery.html | 2021-04-09 11:12 | 2.4K | |
![[TXT]](/icons/text.gif) | Caroline.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Casali.html | 2021-04-09 11:12 | 406 | |
![[TXT]](/icons/text.gif) | Cassello.html | 2021-04-09 11:12 | 381 | |
![[TXT]](/icons/text.gif) | Cat.html | 2021-04-09 11:12 | 6.3K | |
![[TXT]](/icons/text.gif) | CategoryAH-64 Apache images.html | 2021-04-09 11:12 | 822 | |
![[TXT]](/icons/text.gif) | CategoryAH-64 Apache missile images.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | CategoryAK-47 images.html | 2021-04-09 11:12 | 258 | |
![[TXT]](/icons/text.gif) | CategoryAPC garage images.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | CategoryAPC images.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | CategoryAPCs.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | CategoryARG images.html | 2021-04-09 11:12 | 226 | |
![[TXT]](/icons/text.gif) | CategoryARGs.html | 2021-04-09 11:12 | 634 | |
![[TXT]](/icons/text.gif) | CategoryATLAS and P-body images.html | 2021-04-09 11:12 | 4.8K | |
![[TXT]](/icons/text.gif) | CategoryAbsolute Redemption images.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | CategoryAccurized weapons.html | 2021-04-09 11:12 | 181 | |
![[TXT]](/icons/text.gif) | CategoryAchievements.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | CategoryAdministration.html | 2021-04-09 11:12 | 256 | |
![[TXT]](/icons/text.gif) | CategoryAdrian Shephard images.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | CategoryAdvanced Biological Research Lab images.html | 2021-04-09 11:12 | 270 | |
![[TXT]](/icons/text.gif) | CategoryAdvisor Pod images.html | 2021-04-09 11:12 | 224 | |
![[TXT]](/icons/text.gif) | CategoryAdvisor images.html | 2021-04-09 11:12 | 286 | |
![[TXT]](/icons/text.gif) | CategoryAdvisors.html | 2021-04-09 11:12 | 208 | |
![[TXT]](/icons/text.gif) | CategoryAirEx Truck images.html | 2021-04-09 11:12 | 2.6K | |
![[TXT]](/icons/text.gif) | CategoryAir Exchange images.html | 2021-04-09 11:12 | 404 | |
![[TXT]](/icons/text.gif) | CategoryAirboat images.html | 2021-04-09 11:12 | 222 | |
![[TXT]](/icons/text.gif) | CategoryAircraft.html | 2021-04-09 11:12 | 205 | |
![[TXT]](/icons/text.gif) | CategoryAircraft images.html | 2021-04-09 11:12 | 262 | |
![[TXT]](/icons/text.gif) | CategoryAlésia Glidewell images.html | 2021-04-09 11:12 | 5.4K | |
![[TXT]](/icons/text.gif) | CategoryAlien Aircraft images.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | CategoryAlien Assassin images.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | CategoryAlien Combine Soldier images.html | 2021-04-09 11:12 | 345 | |
![[TXT]](/icons/text.gif) | CategoryAlien Controller images.html | 2021-04-09 11:12 | 255 | |
![[TXT]](/icons/text.gif) | CategoryAlien Fauna images.html | 2021-04-09 11:12 | 301 | |
![[TXT]](/icons/text.gif) | CategoryAlien Grunt images.html | 2021-04-09 11:12 | 240 | |
![[TXT]](/icons/text.gif) | CategoryAlien Quarantine Labs images.html | 2021-04-09 11:12 | 237 | |
![[TXT]](/icons/text.gif) | CategoryAlien weapons.html | 2021-04-09 11:12 | 332 | |
![[TXT]](/icons/text.gif) | CategoryAll-Knowing Vortigaunt images.html | 2021-04-09 11:12 | 267 | |
![[TXT]](/icons/text.gif) | CategoryAllies.html | 2021-04-09 11:12 | 186 | |
![[TXT]](/icons/text.gif) | CategoryAlyx's Gun images.html | 2021-04-09 11:12 | 925 | |
![[TXT]](/icons/text.gif) | CategoryAlyx Vance images.html | 2021-04-09 11:12 | 233 | |
![[TXT]](/icons/text.gif) | CategoryAmmunition images.html | 2021-04-09 11:12 | 194 | |
![[TXT]](/icons/text.gif) | CategoryAndrea Wicklund images.html | 2021-04-09 11:12 | 8.7K | |
![[TXT]](/icons/text.gif) | CategoryAnnabelle images.html | 2021-04-09 11:12 | 299 | |
![[TXT]](/icons/text.gif) | CategoryAnti-Mass Spectrometer images.html | 2021-04-09 11:12 | 291 | |
![[TXT]](/icons/text.gif) | CategoryAntlion Grub images.html | 2021-04-09 11:12 | 231 | |
![[TXT]](/icons/text.gif) | CategoryAntlion Guardian images.html | 2021-04-09 11:12 | 243 | |
![[TXT]](/icons/text.gif) | CategoryAntlion Guard images.html | 2021-04-09 11:12 | 234 | |
![[TXT]](/icons/text.gif) | CategoryAntlion Hill images.html | 2021-04-09 11:12 | 231 | |
![[TXT]](/icons/text.gif) | CategoryAntlion Soldier images.html | 2021-04-09 11:12 | 240 | |
![[TXT]](/icons/text.gif) | CategoryAntlion Worker images.html | 2021-04-09 11:12 | 237 | |
![[TXT]](/icons/text.gif) | CategoryAntlion images.html | 2021-04-09 11:12 | 299 | |
![[TXT]](/icons/text.gif) | CategoryAntlions.html | 2021-04-09 11:12 | 257 | |
![[TXT]](/icons/text.gif) | CategoryApertureScience.com screenshots.html | 2021-04-09 11:12 | 339 | |
![[TXT]](/icons/text.gif) | CategoryAperture Science.html | 2021-04-09 11:12 | 368 | |
![[TXT]](/icons/text.gif) | CategoryAperture Science Collaborative Disposition Test images.html | 2021-04-09 11:12 | 228 | |
![[TXT]](/icons/text.gif) | CategoryAperture Science Enrichment Center images.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | CategoryAperture Science Extended Relaxation Center images.html | 2021-04-09 11:12 | 246 | |
![[TXT]](/icons/text.gif) | CategoryAperture Science Gels.html | 2021-04-09 11:12 | 373 | |
![[TXT]](/icons/text.gif) | CategoryAperture Science Handheld Portal Device images.html | 2021-04-09 11:12 | 328 | |
![[TXT]](/icons/text.gif) | CategoryAperture Science Radio images.html | 2021-04-09 11:12 | 267 | |
![[TXT]](/icons/text.gif) | CategoryAperture Science Robot Worker images.html | 2021-04-09 11:12 | 288 | |
![[TXT]](/icons/text.gif) | CategoryAperture Science Sentry Turret images.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | CategoryAperture Science Sentry Turrets.html | 2021-04-09 11:12 | 441 | |
![[TXT]](/icons/text.gif) | CategoryAperture Science Weighted Storage Cube images.html | 2021-04-09 11:12 | 9.9K | |
![[TXT]](/icons/text.gif) | CategoryAperture Science cubes.html | 2021-04-09 11:12 | 5.2K | |
![[TXT]](/icons/text.gif) | CategoryAperture Science diagrams.html | 2021-04-09 11:12 | 3.4K | |
![[TXT]](/icons/text.gif) | CategoryAperture Science images.html | 2021-04-09 11:12 | 314 | |
![[TXT]](/icons/text.gif) | CategoryAperture Science locations.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | CategoryAperture Science personnel.html | 2021-04-09 11:12 | 328 | |
![[TXT]](/icons/text.gif) | CategoryAperture Science portraits.html | 2021-04-09 11:12 | 8.8K | |
![[TXT]](/icons/text.gif) | CategoryAperture Science robots.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | CategoryAperture Science technology.html | 2021-04-09 11:12 | 312 | |
![[TXT]](/icons/text.gif) | CategoryAperture Science testing elements.html | 2021-04-09 11:12 | 290 | |
![[TXT]](/icons/text.gif) | CategoryAperture Science weapons.html | 2021-04-09 11:12 | 391 | |
![[TXT]](/icons/text.gif) | CategoryAppearance templates.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | CategoryApplication questionnaires.html | 2021-04-09 11:12 | 217 | |
![[TXT]](/icons/text.gif) | CategoryArcher images.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | CategoryArchives.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | CategoryArctic locations.html | 2021-04-09 11:12 | 377 | |
![[TXT]](/icons/text.gif) | CategoryArctic locations images.html | 2021-04-09 11:12 | 348 | |
![[TXT]](/icons/text.gif) | CategoryArea 8 Topside Dormitories images.html | 2021-04-09 11:12 | 835 | |
![[TXT]](/icons/text.gif) | CategoryArlene images.html | 2021-04-09 11:12 | 209 | |
![[TXT]](/icons/text.gif) | CategoryArmored Personnel Carrier images.html | 2021-04-09 11:12 | 344 | |
![[TXT]](/icons/text.gif) | CategoryArne Magnusson images.html | 2021-04-09 11:12 | 284 | |
![[TXT]](/icons/text.gif) | CategoryArticle logos.html | 2021-04-09 11:12 | 201 | |
![[TXT]](/icons/text.gif) | CategoryArticle management tag logos.html | 2021-04-09 11:12 | 231 | |
![[TXT]](/icons/text.gif) | CategoryArticle management tags (permanent).html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | CategoryArticle management tags (temporary).html | 2021-04-09 11:12 | 268 | |
![[TXT]](/icons/text.gif) | CategoryArticle management tags.html | 2021-04-09 11:12 | 268 | |
![[TXT]](/icons/text.gif) | CategoryArticles containing spoilers.html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | CategoryArticles for clean up.html | 2021-04-09 11:12 | 281 | |
![[TXT]](/icons/text.gif) | CategoryArticles needing one or more images.html | 2021-04-09 11:12 | 3.0K | |
![[TXT]](/icons/text.gif) | CategoryArticles that may contain original research.html | 2021-04-09 11:12 | 829 | |
![[TXT]](/icons/text.gif) | CategoryArticles to be Wikified.html | 2021-04-09 11:12 | 27K | |
![[TXT]](/icons/text.gif) | CategoryArticles to be merged.html | 2021-04-09 11:12 | 201 | |
![[TXT]](/icons/text.gif) | CategoryArticles to be split.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | CategoryArticles under construction.html | 2021-04-09 11:12 | 210 | |
![[TXT]](/icons/text.gif) | CategoryArticles using the second person singular.html | 2021-04-09 11:12 | 965 | |
![[TXT]](/icons/text.gif) | CategoryArticles with conjectural titles.html | 2021-04-09 11:12 | 233 | |
![[TXT]](/icons/text.gif) | CategoryArticles with unsourced statements.html | 2021-04-09 11:12 | 336 | |
![[TXT]](/icons/text.gif) | CategoryArticle templates.html | 2021-04-09 11:12 | 207 | |
![[TXT]](/icons/text.gif) | CategoryArtists.html | 2021-04-09 11:12 | 676 | |
![[TXT]](/icons/text.gif) | CategoryAutogun images.html | 2021-04-09 11:12 | 226 | |
![[TXT]](/icons/text.gif) | CategoryAutomatic weapons.html | 2021-04-09 11:12 | 181 | |
![[TXT]](/icons/text.gif) | CategoryAzian Vance images.html | 2021-04-09 11:12 | 833 | |
![[TXT]](/icons/text.gif) | CategoryBarnacle images.html | 2021-04-09 11:12 | 294 | |
![[TXT]](/icons/text.gif) | CategoryBarney Calhoun images.html | 2021-04-09 11:12 | 457 | |
![[TXT]](/icons/text.gif) | CategoryBattery images.html | 2021-04-09 11:12 | 220 | |
![[TXT]](/icons/text.gif) | CategoryBeretta M9 images.html | 2021-04-09 11:12 | 194 | |
![[TXT]](/icons/text.gif) | CategoryBinoculars (cut item) images.html | 2021-04-09 11:12 | 317 | |
![[TXT]](/icons/text.gif) | CategoryBiodome Complex images.html | 2021-04-09 11:12 | 199 | |
![[TXT]](/icons/text.gif) | CategoryBiological Waste Processing Plant images.html | 2021-04-09 11:12 | 273 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa (mod) images.html | 2021-04-09 11:12 | 219 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa (mod) screenshots.html | 2021-04-09 11:12 | 271 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa.html | 2021-04-09 11:12 | 278 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa Air Control images.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa Ceiling Turret images.html | 2021-04-09 11:12 | 902 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa Crossbow images.html | 2021-04-09 11:12 | 250 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa East images.html | 2021-04-09 11:12 | 864 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa Hydro-Electric Dam images.html | 2021-04-09 11:12 | 241 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa Medical Lab images.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa Personnel images.html | 2021-04-09 11:12 | 1.5K | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa Research Facility images.html | 2021-04-09 11:12 | 408 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa Research Facility locations.html | 2021-04-09 11:12 | 339 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa Research Facility residents.html | 2021-04-09 11:12 | 863 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa SUV images.html | 2021-04-09 11:12 | 238 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa Science Team images.html | 2021-04-09 11:12 | 291 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa Sectors.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa Security Force images.html | 2021-04-09 11:12 | 296 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa Security Guards.html | 2021-04-09 11:12 | 2.6K | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa South Access images.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa Transit System images.html | 2021-04-09 11:12 | 329 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa Vehicles.html | 2021-04-09 11:12 | 358 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa desert images.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa images.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa personnel.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa scientists.html | 2021-04-09 11:12 | 400 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa technology.html | 2021-04-09 11:12 | 282 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa truck images.html | 2021-04-09 11:12 | 240 | |
![[TXT]](/icons/text.gif) | CategoryBlack Mesa weapons.html | 2021-04-09 11:12 | 349 | |
![[TXT]](/icons/text.gif) | CategoryBlack Ops.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | CategoryBlack Ops Mortar images.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | CategoryBlack Ops Vehicles.html | 2021-04-09 11:12 | 28K | |
![[TXT]](/icons/text.gif) | CategoryBlack Ops images.html | 2021-04-09 11:12 | 6.8K | |
![[TXT]](/icons/text.gif) | CategoryBlack Ops technology.html | 2021-04-09 11:12 | 278 | |
![[TXT]](/icons/text.gif) | CategoryBlack Ops voice actors.html | 2021-04-09 11:12 | 571 | |
![[TXT]](/icons/text.gif) | CategoryBlack Ops weapons.html | 2021-04-09 11:12 | 266 | |
![[TXT]](/icons/text.gif) | CategoryBlocked Users.html | 2021-04-09 11:12 | 1.5K | |
![[TXT]](/icons/text.gif) | CategoryBlogListingPage.html | 2021-04-09 11:12 | 123 | |
![[TXT]](/icons/text.gif) | CategoryBlog posts.html | 2021-04-09 11:12 | 181 | |
![[TXT]](/icons/text.gif) | CategoryBoid images.html | 2021-04-09 11:12 | 219 | |
![[TXT]](/icons/text.gif) | CategoryBooks.html | 2021-04-09 11:12 | 175 | |
![[TXT]](/icons/text.gif) | CategoryBorealis (cut location) images.html | 2021-04-09 11:12 | 4.0K | |
![[TXT]](/icons/text.gif) | CategoryBorealis images.html | 2021-04-09 11:12 | 386 | |
![[TXT]](/icons/text.gif) | CategoryBosses.html | 2021-04-09 11:12 | 367 | |
![[TXT]](/icons/text.gif) | CategoryBots.html | 2021-04-09 11:12 | 239 | |
![[TXT]](/icons/text.gif) | CategoryBreencast images.html | 2021-04-09 11:12 | 396 | |
![[TXT]](/icons/text.gif) | CategoryBrickbat images.html | 2021-04-09 11:12 | 2.4K | |
![[TXT]](/icons/text.gif) | CategoryBridge Point images.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | CategoryBrush entities.html | 2021-04-09 11:12 | 24K | |
![[TXT]](/icons/text.gif) | CategoryBrush images.html | 2021-04-09 11:12 | 871 | |
![[TXT]](/icons/text.gif) | CategoryBullsquid images.html | 2021-04-09 11:12 | 234 | |
![[TXT]](/icons/text.gif) | CategoryCake images.html | 2021-04-09 11:12 | 225 | |
![[TXT]](/icons/text.gif) | CategoryCanals images.html | 2021-04-09 11:12 | 876 | |
![[TXT]](/icons/text.gif) | CategoryCanals locations.html | 2021-04-09 11:12 | 309 | |
![[TXT]](/icons/text.gif) | CategoryCandidates for deletion.html | 2021-04-09 11:12 | 413 | |
![[TXT]](/icons/text.gif) | CategoryCar images.html | 2021-04-09 11:12 | 244 | |
![[TXT]](/icons/text.gif) | CategoryCars.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | CategoryCave Johnson images.html | 2021-04-09 11:12 | 235 | |
![[TXT]](/icons/text.gif) | CategoryCentral AI Chamber images.html | 2021-04-09 11:12 | 9.2K | |
![[TXT]](/icons/text.gif) | CategoryCharacter images.html | 2021-04-09 11:12 | 276 | |
![[TXT]](/icons/text.gif) | CategoryCharacter models.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | CategoryCharacter models images.html | 2021-04-09 11:12 | 740 | |
![[TXT]](/icons/text.gif) | CategoryCharacters.html | 2021-04-09 11:12 | 261 | |
![[TXT]](/icons/text.gif) | CategoryCharacters aware of the G-Man.html | 2021-04-09 11:12 | 303 | |
![[TXT]](/icons/text.gif) | CategoryCharacters by gender.html | 2021-04-09 11:12 | 193 | |
![[TXT]](/icons/text.gif) | CategoryCharger (Xen creature) images.html | 2021-04-09 11:12 | 308 | |
![[TXT]](/icons/text.gif) | CategoryCharger (equipment) images.html | 2021-04-09 11:12 | 239 | |
![[TXT]](/icons/text.gif) | CategoryChell images.html | 2021-04-09 11:12 | 5.6K | |
![[TXT]](/icons/text.gif) | CategoryChildren images.html | 2021-04-09 11:12 | 305 | |
![[TXT]](/icons/text.gif) | CategoryChuck Jones designs.html | 2021-04-09 11:12 | 244 | |
![[TXT]](/icons/text.gif) | CategoryChuck Jones images.html | 2021-04-09 11:12 | 308 | |
![[TXT]](/icons/text.gif) | CategoryChumtoad images.html | 2021-04-09 11:12 | 344 | |
![[TXT]](/icons/text.gif) | CategoryCitadel images.html | 2021-04-09 11:12 | 311 | |
![[TXT]](/icons/text.gif) | CategoryCitizen images.html | 2021-04-09 11:12 | 24K | |
![[TXT]](/icons/text.gif) | CategoryCitizens.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | CategoryCity 17 Episode One images.html | 2021-04-09 11:12 | 249 | |
![[TXT]](/icons/text.gif) | CategoryCity 17 Episode One screenshots.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | CategoryCity 17 Trainstation images.html | 2021-04-09 11:12 | 290 | |
![[TXT]](/icons/text.gif) | CategoryCity 17 Underground images.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | CategoryCity 17 images.html | 2021-04-09 11:12 | 355 | |
![[TXT]](/icons/text.gif) | CategoryCity 17 locations.html | 2021-04-09 11:12 | 213 | |
![[TXT]](/icons/text.gif) | CategoryCity 17 trainstations images.html | 2021-04-09 11:12 | 299 | |
![[TXT]](/icons/text.gif) | CategoryCity Scanner images.html | 2021-04-09 11:12 | 318 | |
![[TXT]](/icons/text.gif) | CategoryCivil Protection images.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | CategoryCleaned up articles to be reviewed.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | CategoryClean up.html | 2021-04-09 11:12 | 285 | |
![[TXT]](/icons/text.gif) | CategoryCleanup project templates.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | CategoryCo-op Test Shaft images.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | CategoryCo-op characters.html | 2021-04-09 11:12 | 32K | |
![[TXT]](/icons/text.gif) | CategoryColette Green images.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | CategoryColt Python (HL1) images.html | 2021-04-09 11:12 | 191 | |
![[TXT]](/icons/text.gif) | CategoryColt Python (HL2) images.html | 2021-04-09 11:12 | 191 | |
![[TXT]](/icons/text.gif) | CategoryColt Python images.html | 2021-04-09 11:12 | 227 | |
![[TXT]](/icons/text.gif) | CategoryCombat Knife images.html | 2021-04-09 11:12 | 229 | |
![[TXT]](/icons/text.gif) | CategoryCombine.html | 2021-04-09 11:12 | 227 | |
![[TXT]](/icons/text.gif) | CategoryCombine Assassin images.html | 2021-04-09 11:12 | 330 | |
![[TXT]](/icons/text.gif) | CategoryCombine Binoculars images.html | 2021-04-09 11:12 | 271 | |
![[TXT]](/icons/text.gif) | CategoryCombine Ceiling Turret images.html | 2021-04-09 11:12 | 334 | |
![[TXT]](/icons/text.gif) | CategoryCombine Dropship images.html | 2021-04-09 11:12 | 243 | |
![[TXT]](/icons/text.gif) | CategoryCombine Factories images.html | 2021-04-09 11:12 | 36K | |
![[TXT]](/icons/text.gif) | CategoryCombine Ground Turret images.html | 2021-04-09 11:12 | 1.5K | |
![[TXT]](/icons/text.gif) | CategoryCombine Guard (Synth) images.html | 2021-04-09 11:12 | 38K | |
![[TXT]](/icons/text.gif) | CategoryCombine Guard (human) images.html | 2021-04-09 11:12 | 262 | |
![[TXT]](/icons/text.gif) | CategoryCombine Guard Gun images.html | 2021-04-09 11:12 | 7.2K | |
![[TXT]](/icons/text.gif) | CategoryCombine Gunship images.html | 2021-04-09 11:12 | 315 | |
![[TXT]](/icons/text.gif) | CategoryCombine Laser Tripmine images.html | 2021-04-09 11:12 | 259 | |
![[TXT]](/icons/text.gif) | CategoryCombine Launcher images.html | 2021-04-09 11:12 | 2.6K | |
![[TXT]](/icons/text.gif) | CategoryCombine SPAS-12 images.html | 2021-04-09 11:12 | 241 | |
![[TXT]](/icons/text.gif) | CategoryCombine Sentry Gun images.html | 2021-04-09 11:12 | 322 | |
![[TXT]](/icons/text.gif) | CategoryCombine Super Soldier images.html | 2021-04-09 11:12 | 640 | |
![[TXT]](/icons/text.gif) | CategoryCombine Synth Elite Soldier images.html | 2021-04-09 11:12 | 513 | |
![[TXT]](/icons/text.gif) | CategoryCombine Units.html | 2021-04-09 11:12 | 269 | |
![[TXT]](/icons/text.gif) | CategoryCombine Vehicles.html | 2021-04-09 11:12 | 2.3K | |
![[TXT]](/icons/text.gif) | CategoryCombine elite units images.html | 2021-04-09 11:12 | 183 | |
![[TXT]](/icons/text.gif) | CategoryCombine humanoid images.html | 2021-04-09 11:12 | 341 | |
![[TXT]](/icons/text.gif) | CategoryCombine images.html | 2021-04-09 11:12 | 199 | |
![[TXT]](/icons/text.gif) | CategoryCombine locations.html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | CategoryCombine technology.html | 2021-04-09 11:12 | 284 | |
![[TXT]](/icons/text.gif) | CategoryCombine technology images.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | CategoryCombine voice actors.html | 2021-04-09 11:12 | 590 | |
![[TXT]](/icons/text.gif) | CategoryCombine weapons.html | 2021-04-09 11:12 | 370 | |
![[TXT]](/icons/text.gif) | CategoryCombot images.html | 2021-04-09 11:12 | 292 | |
![[TXT]](/icons/text.gif) | CategoryCommunication.html | 2021-04-09 11:12 | 164 | |
![[TXT]](/icons/text.gif) | CategoryCompilations.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | CategoryComposers.html | 2021-04-09 11:12 | 201 | |
![[TXT]](/icons/text.gif) | CategoryComposite images.html | 2021-04-09 11:12 | 187 | |
![[TXT]](/icons/text.gif) | CategoryConcept art.html | 2021-04-09 11:12 | 221 | |
![[TXT]](/icons/text.gif) | CategoryConceptual Artists.html | 2021-04-09 11:12 | 328 | |
![[TXT]](/icons/text.gif) | CategoryConcerned The Half-Life and Death of Gordon Frohman images.html | 2021-04-09 11:12 | 294 | |
![[TXT]](/icons/text.gif) | CategoryConflicts.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | CategoryConscripts images.html | 2021-04-09 11:12 | 312 | |
![[TXT]](/icons/text.gif) | CategoryConsoling Couple images.html | 2021-04-09 11:12 | 856 | |
![[TXT]](/icons/text.gif) | CategoryCopyright-Copyleft logos.html | 2021-04-09 11:12 | 227 | |
![[TXT]](/icons/text.gif) | CategoryCopyrighted Media.html | 2021-04-09 11:12 | 8.7K | |
![[TXT]](/icons/text.gif) | CategoryCopyright templates.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | CategoryCovers.html | 2021-04-09 11:12 | 265 | |
![[TXT]](/icons/text.gif) | CategoryCrab Synth images.html | 2021-04-09 11:12 | 226 | |
![[TXT]](/icons/text.gif) | CategoryCreative Commons images.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | CategoryCreatures.html | 2021-04-09 11:12 | 258 | |
![[TXT]](/icons/text.gif) | CategoryCreatures images.html | 2021-04-09 11:12 | 275 | |
![[TXT]](/icons/text.gif) | CategoryCremator images.html | 2021-04-09 11:12 | 19K | |
![[TXT]](/icons/text.gif) | CategoryCrossbows.html | 2021-04-09 11:12 | 236 | |
![[TXT]](/icons/text.gif) | CategoryCrowbar (HL1) images.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | CategoryCrowbar (HL2) images.html | 2021-04-09 11:12 | 226 | |
![[TXT]](/icons/text.gif) | CategoryCrowbar images.html | 2021-04-09 11:12 | 214 | |
![[TXT]](/icons/text.gif) | CategoryCut allies.html | 2021-04-09 11:12 | 212 | |
![[TXT]](/icons/text.gif) | CategoryCut ally images.html | 2021-04-09 11:12 | 256 | |
![[TXT]](/icons/text.gif) | CategoryCut character images.html | 2021-04-09 11:12 | 274 | |
![[TXT]](/icons/text.gif) | CategoryCut characters.html | 2021-04-09 11:12 | 240 | |
![[TXT]](/icons/text.gif) | CategoryCut content.html | 2021-04-09 11:12 | 524 | |
![[TXT]](/icons/text.gif) | CategoryCut content images.html | 2021-04-09 11:12 | 240 | |
![[TXT]](/icons/text.gif) | CategoryCut enemies.html | 2021-04-09 11:12 | 228 | |
![[TXT]](/icons/text.gif) | CategoryCut enemy images.html | 2021-04-09 11:12 | 260 | |
![[TXT]](/icons/text.gif) | CategoryCut item images.html | 2021-04-09 11:12 | 254 | |
![[TXT]](/icons/text.gif) | CategoryCut items.html | 2021-04-09 11:12 | 230 | |
![[TXT]](/icons/text.gif) | CategoryCut location images.html | 2021-04-09 11:12 | 270 | |
![[TXT]](/icons/text.gif) | CategoryCut locations.html | 2021-04-09 11:12 | 221 | |
![[TXT]](/icons/text.gif) | CategoryCut technology.html | 2021-04-09 11:12 | 1.8K | |
![[TXT]](/icons/text.gif) | CategoryCut vehicles.html | 2021-04-09 11:12 | 230 | |
![[TXT]](/icons/text.gif) | CategoryCut weapon images.html | 2021-04-09 11:12 | 326 | |
![[TXT]](/icons/text.gif) | CategoryCut weapons.html | 2021-04-09 11:12 | 245 | |
![[TXT]](/icons/text.gif) | CategoryDLC.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | CategoryDamarcus Holbrook images.html | 2021-04-09 11:12 | 250 | |
![[TXT]](/icons/text.gif) | CategoryDaniel Dociu images.html | 2021-04-09 11:12 | 360 | |
![[TXT]](/icons/text.gif) | CategoryDeathmatch Classic images.html | 2021-04-09 11:12 | 258 | |
![[TXT]](/icons/text.gif) | CategoryDeathmatch Classic item images.html | 2021-04-09 11:12 | 418 | |
![[TXT]](/icons/text.gif) | CategoryDeathmatch Classic screenshots.html | 2021-04-09 11:12 | 388 | |
![[TXT]](/icons/text.gif) | CategoryDeathmatch Classic weapon images.html | 2021-04-09 11:12 | 274 | |
![[TXT]](/icons/text.gif) | CategoryDelivery cart images.html | 2021-04-09 11:12 | 241 | |
![[TXT]](/icons/text.gif) | CategoryDepot images.html | 2021-04-09 11:12 | 391 | |
![[TXT]](/icons/text.gif) | CategoryDesert Eagle images.html | 2021-04-09 11:12 | 221 | |
![[TXT]](/icons/text.gif) | CategoryDesert Launcher images.html | 2021-04-09 11:12 | 309 | |
![[TXT]](/icons/text.gif) | CategoryDhabih Eng designs.html | 2021-04-09 11:12 | 241 | |
![[TXT]](/icons/text.gif) | CategoryDhabih Eng images.html | 2021-04-09 11:12 | 303 | |
![[TXT]](/icons/text.gif) | CategoryDigger images.html | 2021-04-09 11:12 | 8.2K | |
![[TXT]](/icons/text.gif) | CategoryDisambiguation.html | 2021-04-09 11:12 | 275 | |
![[TXT]](/icons/text.gif) | CategoryDisplacement Beacon Focus Emitter images.html | 2021-04-09 11:12 | 371 | |
![[TXT]](/icons/text.gif) | CategoryDisplacer Cannon images.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | CategoryDock 137 images.html | 2021-04-09 11:12 | 223 | |
![[TXT]](/icons/text.gif) | CategoryDocuments images.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | CategoryDog images.html | 2021-04-09 11:12 | 212 | |
![[TXT]](/icons/text.gif) | CategoryDoug Rattmann images.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | CategoryDr. Breen's Private Reserve images.html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | CategoryDrainage Canal images.html | 2021-04-09 11:12 | 197 | |
![[TXT]](/icons/text.gif) | CategoryDynamic Environmental Interaction images.html | 2021-04-09 11:12 | 25K | |
![[TXT]](/icons/text.gif) | CategoryDynamite images.html | 2021-04-09 11:12 | 217 | |
![[TXT]](/icons/text.gif) | CategoryDystopia images.html | 2021-04-09 11:12 | 220 | |
![[TXT]](/icons/text.gif) | CategoryDystopia screenshots.html | 2021-04-09 11:12 | 307 | |
![[TXT]](/icons/text.gif) | CategoryEMP Tool images.html | 2021-04-09 11:12 | 294 | |
![[TXT]](/icons/text.gif) | CategoryEarth creature images.html | 2021-04-09 11:12 | 305 | |
![[TXT]](/icons/text.gif) | CategoryEarth images.html | 2021-04-09 11:12 | 8.2K | |
![[TXT]](/icons/text.gif) | CategoryEaster eggs.html | 2021-04-09 11:12 | 259 | |
![[TXT]](/icons/text.gif) | CategoryEaster eggs images.html | 2021-04-09 11:12 | 191 | |
![[TXT]](/icons/text.gif) | CategoryEdgeless Safety Cube Receptacle images.html | 2021-04-09 11:12 | 294 | |
![[TXT]](/icons/text.gif) | CategoryEdgeless Safety Cube images.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | CategoryEli Maxwell images.html | 2021-04-09 11:12 | 29K | |
![[TXT]](/icons/text.gif) | CategoryEli Vance images.html | 2021-04-09 11:12 | 269 | |
![[TXT]](/icons/text.gif) | CategoryEmergency flare images.html | 2021-04-09 11:12 | 313 | |
![[TXT]](/icons/text.gif) | CategoryEmplacement Gun images.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | CategoryEnd message images.html | 2021-04-09 11:12 | 1.6K | |
![[TXT]](/icons/text.gif) | CategoryEnemies.html | 2021-04-09 11:12 | 239 | |
![[TXT]](/icons/text.gif) | CategoryEnrichment Shaft images.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | CategoryEnrichment Shafts.html | 2021-04-09 11:12 | 232 | |
![[TXT]](/icons/text.gif) | CategoryEquipment.html | 2021-04-09 11:12 | 181 | |
![[TXT]](/icons/text.gif) | CategoryEquipment images.html | 2021-04-09 11:12 | 8.0K | |
![[TXT]](/icons/text.gif) | CategoryEric Kirchmer designs.html | 2021-04-09 11:12 | 251 | |
![[TXT]](/icons/text.gif) | CategoryEric Kirchmer images.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | CategoryExperimental weapons.html | 2021-04-09 11:12 | 187 | |
![[TXT]](/icons/text.gif) | CategoryExplosives.html | 2021-04-09 11:12 | 280 | |
![[TXT]](/icons/text.gif) | CategoryFIM-92 Stinger images.html | 2021-04-09 11:12 | 306 | |
![[TXT]](/icons/text.gif) | CategoryFactions.html | 2021-04-09 11:12 | 241 | |
![[TXT]](/icons/text.gif) | CategoryFactions images.html | 2021-04-09 11:12 | 2.3K | |
![[TXT]](/icons/text.gif) | CategoryFair use images.html | 2021-04-09 11:12 | 878 | |
![[TXT]](/icons/text.gif) | CategoryFakeFactory's Cinematic Mod images.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | CategoryFakeFactory's Cinematic Mod screenshots.html | 2021-04-09 11:12 | 402 | |
![[TXT]](/icons/text.gif) | CategoryFan content.html | 2021-04-09 11:12 | 249 | |
![[TXT]](/icons/text.gif) | CategoryFan content images.html | 2021-04-09 11:12 | 240 | |
![[TXT]](/icons/text.gif) | CategoryFan content screenshots.html | 2021-04-09 11:12 | 274 | |
![[TXT]](/icons/text.gif) | CategoryFan films.html | 2021-04-09 11:12 | 220 | |
![[TXT]](/icons/text.gif) | CategoryFast Headcrab images.html | 2021-04-09 11:12 | 237 | |
![[TXT]](/icons/text.gif) | CategoryFast Zombie images.html | 2021-04-09 11:12 | 352 | |
![[TXT]](/icons/text.gif) | CategoryFather Grigori images.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | CategoryFeatured articles.html | 2021-04-09 11:12 | 305 | |
![[TXT]](/icons/text.gif) | CategoryFemales.html | 2021-04-09 11:12 | 197 | |
![[TXT]](/icons/text.gif) | CategoryFilms.html | 2021-04-09 11:12 | 9.6K | |
![[TXT]](/icons/text.gif) | CategoryFire Extinguisher images.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | CategoryFlammable weapons.html | 2021-04-09 11:12 | 197 | |
![[TXT]](/icons/text.gif) | CategoryFlare Gun images.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | CategoryFlares.html | 2021-04-09 11:12 | 239 | |
![[TXT]](/icons/text.gif) | CategoryFlash Grenade images.html | 2021-04-09 11:12 | 5.7K | |
![[TXT]](/icons/text.gif) | CategoryFlocking Floater images.html | 2021-04-09 11:12 | 324 | |
![[TXT]](/icons/text.gif) | CategoryForums.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | CategoryFreight Yard images.html | 2021-04-09 11:12 | 916 | |
![[TXT]](/icons/text.gif) | CategoryGFDL images.html | 2021-04-09 11:12 | 268 | |
![[TXT]](/icons/text.gif) | CategoryGLaDOS' screen images.html | 2021-04-09 11:12 | 397 | |
![[TXT]](/icons/text.gif) | CategoryGLaDOS images.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | CategoryGR9 images.html | 2021-04-09 11:12 | 273 | |
![[TXT]](/icons/text.gif) | CategoryGame developers.html | 2021-04-09 11:12 | 201 | |
![[TXT]](/icons/text.gif) | CategoryGame engines.html | 2021-04-09 11:12 | 195 | |
![[TXT]](/icons/text.gif) | CategoryGame menus images.html | 2021-04-09 11:12 | 917 | |
![[TXT]](/icons/text.gif) | CategoryGames.html | 2021-04-09 11:12 | 383 | |
![[TXT]](/icons/text.gif) | CategoryGame series.html | 2021-04-09 11:12 | 165 | |
![[TXT]](/icons/text.gif) | CategoryGame soundtracks.html | 2021-04-09 11:12 | 232 | |
![[TXT]](/icons/text.gif) | CategoryGamma Labs images.html | 2021-04-09 11:12 | 204 | |
![[TXT]](/icons/text.gif) | CategoryGargantua images.html | 2021-04-09 11:12 | 234 | |
![[TXT]](/icons/text.gif) | CategoryGarry's Mod images.html | 2021-04-09 11:12 | 229 | |
![[TXT]](/icons/text.gif) | CategoryGarry's Mod screenshots.html | 2021-04-09 11:12 | 322 | |
![[TXT]](/icons/text.gif) | CategoryGas Mask Citizen images.html | 2021-04-09 11:12 | 235 | |
![[TXT]](/icons/text.gif) | CategoryGearbox employees.html | 2021-04-09 11:12 | 250 | |
![[TXT]](/icons/text.gif) | CategoryGene Worm images.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | CategoryGeneral wiki templates.html | 2021-04-09 11:12 | 9.2K | |
![[TXT]](/icons/text.gif) | CategoryGenerators.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | CategoryGenerator trailer images.html | 2021-04-09 11:12 | 261 | |
![[TXT]](/icons/text.gif) | CategoryGet Your Free TVs screenshots.html | 2021-04-09 11:12 | 203 | |
![[TXT]](/icons/text.gif) | CategoryGina Cross images.html | 2021-04-09 11:12 | 271 | |
![[TXT]](/icons/text.gif) | CategoryGlasses wearers.html | 2021-04-09 11:12 | 8.8K | |
![[TXT]](/icons/text.gif) | CategoryGlock 17 images.html | 2021-04-09 11:12 | 3.0K | |
![[TXT]](/icons/text.gif) | CategoryGluon Gun images.html | 2021-04-09 11:12 | 220 | |
![[TXT]](/icons/text.gif) | CategoryGoldSrc model images.html | 2021-04-09 11:12 | 8.2K | |
![[TXT]](/icons/text.gif) | CategoryGoldSrc mods.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | CategoryGonarch images.html | 2021-04-09 11:12 | 219 | |
![[TXT]](/icons/text.gif) | CategoryGonome images.html | 2021-04-09 11:12 | 250 | |
![[TXT]](/icons/text.gif) | CategoryGood articles.html | 2021-04-09 11:12 | 4.6K | |
![[TXT]](/icons/text.gif) | CategoryGordon Freeman images.html | 2021-04-09 11:12 | 284 | |
![[TXT]](/icons/text.gif) | CategoryGravity manipulators.html | 2021-04-09 11:12 | 407 | |
![[TXT]](/icons/text.gif) | CategoryGreg Coomer images.html | 2021-04-09 11:12 | 701 | |
![[TXT]](/icons/text.gif) | CategoryGrenade images.html | 2021-04-09 11:12 | 194 | |
![[TXT]](/icons/text.gif) | CategoryGrenades.html | 2021-04-09 11:12 | 220 | |
![[TXT]](/icons/text.gif) | CategoryHECU.html | 2021-04-09 11:12 | 266 | |
![[TXT]](/icons/text.gif) | CategoryHECU Dam Turret images.html | 2021-04-09 11:12 | 238 | |
![[TXT]](/icons/text.gif) | CategoryHECU Double Turret images.html | 2021-04-09 11:12 | 247 | |
![[TXT]](/icons/text.gif) | CategoryHECU Engineer images.html | 2021-04-09 11:12 | 228 | |
![[TXT]](/icons/text.gif) | CategoryHECU Laser Tripmine images.html | 2021-04-09 11:12 | 805 | |
![[TXT]](/icons/text.gif) | CategoryHECU Medic images.html | 2021-04-09 11:12 | 219 | |
![[TXT]](/icons/text.gif) | CategoryHECU RPG images.html | 2021-04-09 11:12 | 274 | |
![[TXT]](/icons/text.gif) | CategoryHECU Radio images.html | 2021-04-09 11:12 | 905 | |
![[TXT]](/icons/text.gif) | CategoryHECU Recruits.html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | CategoryHECU SPAS-12 images.html | 2021-04-09 11:12 | 238 | |
![[TXT]](/icons/text.gif) | CategoryHECU Sentry Gun images.html | 2021-04-09 11:12 | 238 | |
![[TXT]](/icons/text.gif) | CategoryHECU Sniper images.html | 2021-04-09 11:12 | 222 | |
![[TXT]](/icons/text.gif) | CategoryHECU Vehicles.html | 2021-04-09 11:12 | 824 | |
![[TXT]](/icons/text.gif) | CategoryHECU classes.html | 2021-04-09 11:12 | 1.8K | |
![[TXT]](/icons/text.gif) | CategoryHECU images.html | 2021-04-09 11:12 | 255 | |
![[TXT]](/icons/text.gif) | CategoryHECU members.html | 2021-04-09 11:12 | 222 | |
![[TXT]](/icons/text.gif) | CategoryHECU technology.html | 2021-04-09 11:12 | 8.8K | |
![[TXT]](/icons/text.gif) | CategoryHECU voice actors.html | 2021-04-09 11:12 | 557 | |
![[TXT]](/icons/text.gif) | CategoryHECU weapons.html | 2021-04-09 11:12 | 9.2K | |
![[TXT]](/icons/text.gif) | CategoryHEV Charger images.html | 2021-04-09 11:12 | 265 | |
![[TXT]](/icons/text.gif) | CategoryHEV Suit images.html | 2021-04-09 11:12 | 223 | |
![[TXT]](/icons/text.gif) | CategoryHEV Suit users.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | CategoryHUD images.html | 2021-04-09 11:12 | 34K | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life.html | 2021-04-09 11:12 | 285 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Beta.html | 2021-04-09 11:12 | 299 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Beta images.html | 2021-04-09 11:12 | 285 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Beta official screenshots.html | 2021-04-09 11:12 | 314 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Beta screenshots.html | 2021-04-09 11:12 | 510 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Beta textures.html | 2021-04-09 11:12 | 269 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Deathmatch.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Deathmatch images.html | 2021-04-09 11:12 | 4.6K | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Deathmatch screenshots.html | 2021-04-09 11:12 | 416 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Deathmatch textures.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Episode One.html | 2021-04-09 11:12 | 261 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Episode One concept art.html | 2021-04-09 11:12 | 301 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Episode One images.html | 2021-04-09 11:12 | 435 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Episode One screenshots.html | 2021-04-09 11:12 | 365 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Episode One textures.html | 2021-04-09 11:12 | 316 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Episode Three.html | 2021-04-09 11:12 | 267 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Episode Three concept art.html | 2021-04-09 11:12 | 310 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Episode Three images.html | 2021-04-09 11:12 | 366 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Episode Two.html | 2021-04-09 11:12 | 261 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Episode Two Beta images.html | 2021-04-09 11:12 | 318 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Episode Two Beta screenshots.html | 2021-04-09 11:12 | 8.5K | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Episode Two Beta textures.html | 2021-04-09 11:12 | 867 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Episode Two concept art.html | 2021-04-09 11:12 | 344 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Episode Two images.html | 2021-04-09 11:12 | 435 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Episode Two screenshots.html | 2021-04-09 11:12 | 365 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Episode Two textures.html | 2021-04-09 11:12 | 316 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Episodes.html | 2021-04-09 11:12 | 234 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Lost Coast.html | 2021-04-09 11:12 | 258 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Lost Coast concept art.html | 2021-04-09 11:12 | 296 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Lost Coast images.html | 2021-04-09 11:12 | 351 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Lost Coast screenshots.html | 2021-04-09 11:12 | 359 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Raising the Bar.html | 2021-04-09 11:12 | 2.1K | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Raising the Bar images.html | 2021-04-09 11:12 | 384 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Raising the Bar images for clean up (HL1).html | 2021-04-09 11:12 | 58K | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Raising the Bar images for clean up (other).html | 2021-04-09 11:12 | 207 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Survivor.html | 2021-04-09 11:12 | 252 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Survivor images.html | 2021-04-09 11:12 | 341 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 Survivor screenshots.html | 2021-04-09 11:12 | 402 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 concept art.html | 2021-04-09 11:12 | 323 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 images.html | 2021-04-09 11:12 | 375 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 screenshots.html | 2021-04-09 11:12 | 293 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life 2 textures.html | 2021-04-09 11:12 | 268 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Beta.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Beta Project screenshots.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Beta images.html | 2021-04-09 11:12 | 371 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Beta screenshots.html | 2021-04-09 11:12 | 5.1K | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Beta textures.html | 2021-04-09 11:12 | 324 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Blue Shift.html | 2021-04-09 11:12 | 291 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Blue Shift images.html | 2021-04-09 11:12 | 341 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Blue Shift screenshots.html | 2021-04-09 11:12 | 402 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Blue Shift textures.html | 2021-04-09 11:12 | 359 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Day One screenshots.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Decay.html | 2021-04-09 11:12 | 266 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Decay Beta screenshots.html | 2021-04-09 11:12 | 350 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Decay images.html | 2021-04-09 11:12 | 404 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Decay screenshots.html | 2021-04-09 11:12 | 458 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Decay textures.html | 2021-04-09 11:12 | 334 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Expansions.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Further Data images.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life News.html | 2021-04-09 11:12 | 745 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Opposing Force.html | 2021-04-09 11:12 | 311 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Opposing Force Beta images.html | 2021-04-09 11:12 | 385 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Opposing Force Beta screenshots.html | 2021-04-09 11:12 | 505 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Opposing Force concept art.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Opposing Force images.html | 2021-04-09 11:12 | 361 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Opposing Force screenshots.html | 2021-04-09 11:12 | 430 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Opposing Force textures.html | 2021-04-09 11:12 | 8.3K | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Preliminary Findings images.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Source images.html | 2021-04-09 11:12 | 252 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Source screenshots.html | 2021-04-09 11:12 | 452 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Source textures.html | 2021-04-09 11:12 | 339 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Uplink.html | 2021-04-09 11:12 | 326 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Uplink images.html | 2021-04-09 11:12 | 321 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Uplink screenshots.html | 2021-04-09 11:12 | 374 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Wiki.html | 2021-04-09 11:12 | 230 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life Wiki images.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life concept art.html | 2021-04-09 11:12 | 324 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life images.html | 2021-04-09 11:12 | 286 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life screenshots.html | 2021-04-09 11:12 | 325 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life series.html | 2021-04-09 11:12 | 198 | |
![[TXT]](/icons/text.gif) | CategoryHalf-Life textures.html | 2021-04-09 11:12 | 304 | |
![[TXT]](/icons/text.gif) | CategoryHandguns.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | CategoryHarpoon images.html | 2021-04-09 11:12 | 806 | |
![[TXT]](/icons/text.gif) | CategoryHeadcrab Shell images.html | 2021-04-09 11:12 | 302 | |
![[TXT]](/icons/text.gif) | CategoryHeadcrab images.html | 2021-04-09 11:12 | 328 | |
![[TXT]](/icons/text.gif) | CategoryHeadcrabs.html | 2021-04-09 11:12 | 294 | |
![[TXT]](/icons/text.gif) | CategoryHealth Charger images.html | 2021-04-09 11:12 | 180 | |
![[TXT]](/icons/text.gif) | CategoryHeckler & Koch weapons.html | 2021-04-09 11:12 | 808 | |
![[TXT]](/icons/text.gif) | CategoryHelena Mossman images.html | 2021-04-09 11:12 | 464 | |
![[TXT]](/icons/text.gif) | CategoryHelp.html | 2021-04-09 11:12 | 184 | |
![[TXT]](/icons/text.gif) | CategoryHenry images.html | 2021-04-09 11:12 | 4.9K | |
![[TXT]](/icons/text.gif) | CategoryHidden categories.html | 2021-04-09 11:12 | 857 | |
![[TXT]](/icons/text.gif) | CategoryHigh Altitude Launch Center images.html | 2021-04-09 11:12 | 235 | |
![[TXT]](/icons/text.gif) | CategoryHivehand images.html | 2021-04-09 11:12 | 294 | |
![[TXT]](/icons/text.gif) | CategoryHopper Mine images.html | 2021-04-09 11:12 | 226 | |
![[TXT]](/icons/text.gif) | CategoryHopwire Grenade images.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | CategoryHospital images.html | 2021-04-09 11:12 | 219 | |
![[TXT]](/icons/text.gif) | CategoryHoundeye images.html | 2021-04-09 11:12 | 231 | |
![[TXT]](/icons/text.gif) | CategoryHuman Sergeant images.html | 2021-04-09 11:12 | 300 | |
![[TXT]](/icons/text.gif) | CategoryHunter-Chopper Bomb images.html | 2021-04-09 11:12 | 329 | |
![[TXT]](/icons/text.gif) | CategoryHunter-Chopper images.html | 2021-04-09 11:12 | 321 | |
![[TXT]](/icons/text.gif) | CategoryHunter images.html | 2021-04-09 11:12 | 276 | |
![[TXT]](/icons/text.gif) | CategoryHydra images.html | 2021-04-09 11:12 | 283 | |
![[TXT]](/icons/text.gif) | CategoryIce Axe images.html | 2021-04-09 11:12 | 285 | |
![[TXT]](/icons/text.gif) | CategoryIchthyosaur images.html | 2021-04-09 11:12 | 240 | |
![[TXT]](/icons/text.gif) | CategoryImage maintenance.html | 2021-04-09 11:12 | 3.9K | |
![[TXT]](/icons/text.gif) | CategoryImage management tag logos.html | 2021-04-09 11:12 | 1.6K | |
![[TXT]](/icons/text.gif) | CategoryImagery.html | 2021-04-09 11:12 | 184 | |
![[TXT]](/icons/text.gif) | CategoryImages.html | 2021-04-09 11:12 | 5.5K | |
![[TXT]](/icons/text.gif) | CategoryImages by author.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | CategoryImages by game.html | 2021-04-09 11:12 | 220 | |
![[TXT]](/icons/text.gif) | CategoryImages by license.html | 2021-04-09 11:12 | 5.6K | |
![[TXT]](/icons/text.gif) | CategoryImages for clean up (Half-Life).html | 2021-04-09 11:12 | 334 | |
![[TXT]](/icons/text.gif) | CategoryImages for clean up (Half-Life 2).html | 2021-04-09 11:12 | 298 | |
![[TXT]](/icons/text.gif) | CategoryImages for clean up (Half-Life 2 Beta).html | 2021-04-09 11:12 | 299 | |
![[TXT]](/icons/text.gif) | CategoryImages for clean up (Half-Life 2 Episode One).html | 2021-04-09 11:12 | 346 | |
![[TXT]](/icons/text.gif) | CategoryImages for clean up (Half-Life 2 Episode Two).html | 2021-04-09 11:12 | 346 | |
![[TXT]](/icons/text.gif) | CategoryImages for clean up (Half-Life 2 Lost Coast).html | 2021-04-09 11:12 | 342 | |
![[TXT]](/icons/text.gif) | CategoryImages for clean up (Half-Life 2 Raising the Bar).html | 2021-04-09 11:12 | 327 | |
![[TXT]](/icons/text.gif) | CategoryImages for clean up (Half-Life Blue Shift).html | 2021-04-09 11:12 | 389 | |
![[TXT]](/icons/text.gif) | CategoryImages for clean up (Half-Life Opposing Force).html | 2021-04-09 11:12 | 409 | |
![[TXT]](/icons/text.gif) | CategoryImages for clean up (Portal).html | 2021-04-09 11:12 | 319 | |
![[TXT]](/icons/text.gif) | CategoryImages for clean up (Portal 2).html | 2021-04-09 11:12 | 285 | |
![[TXT]](/icons/text.gif) | CategoryImages for clean up (all).html | 2021-04-09 11:12 | 219 | |
![[TXT]](/icons/text.gif) | CategoryImages for clean up (other).html | 2021-04-09 11:12 | 223 | |
![[TXT]](/icons/text.gif) | CategoryImages for clean up.html | 2021-04-09 11:12 | 540 | |
![[TXT]](/icons/text.gif) | CategoryImages to sort.html | 2021-04-09 11:12 | 136K | |
![[TXT]](/icons/text.gif) | CategoryImages with no information template.html | 2021-04-09 11:12 | 397 | |
![[TXT]](/icons/text.gif) | CategoryImages with unknown licence.html | 2021-04-09 11:12 | 235 | |
![[TXT]](/icons/text.gif) | CategoryImages with unknown source.html | 2021-04-09 11:12 | 233 | |
![[TXT]](/icons/text.gif) | CategoryImage templates.html | 2021-04-09 11:12 | 231 | |
![[TXT]](/icons/text.gif) | CategoryImmolator images.html | 2021-04-09 11:12 | 358 | |
![[TXT]](/icons/text.gif) | CategoryIn-universe subjects images.html | 2021-04-09 11:12 | 369 | |
![[TXT]](/icons/text.gif) | CategoryIncendiary Rifle images.html | 2021-04-09 11:12 | 312 | |
![[TXT]](/icons/text.gif) | CategoryIncomplete articles.html | 2021-04-09 11:12 | 218 | |
![[TXT]](/icons/text.gif) | CategoryInfoboxes.html | 2021-04-09 11:12 | 256 | |
![[TXT]](/icons/text.gif) | CategoryIsaac Kleiner images.html | 2021-04-09 11:12 | 281 | |
![[TXT]](/icons/text.gif) | CategoryIvan the Space Biker images.html | 2021-04-09 11:12 | 346 | |
![[TXT]](/icons/text.gif) | CategoryJalopy images.html | 2021-04-09 11:12 | 7.2K | |
![[TXT]](/icons/text.gif) | CategoryJamil Mullen images.html | 2021-04-09 11:12 | 320 | |
![[TXT]](/icons/text.gif) | CategoryJeremy Bennett designs.html | 2021-04-09 11:12 | 253 | |
![[TXT]](/icons/text.gif) | CategoryJeremy Bennett images.html | 2021-04-09 11:12 | 323 | |
![[TXT]](/icons/text.gif) | CategoryJet Ski images.html | 2021-04-09 11:12 | 222 | |
![[TXT]](/icons/text.gif) | CategoryJudith Mossman images.html | 2021-04-09 11:12 | 245 | |
![[TXT]](/icons/text.gif) | CategoryKingpin images.html | 2021-04-09 11:12 | 297 | |
![[TXT]](/icons/text.gif) | CategoryKleiner's Lab images.html | 2021-04-09 11:12 | 238 | |
![[TXT]](/icons/text.gif) | CategoryKraken Base images.html | 2021-04-09 11:12 | 324 | |
![[TXT]](/icons/text.gif) | CategoryKraken Base submarine images.html | 2021-04-09 11:12 | 7.9K | |
![[TXT]](/icons/text.gif) | CategoryLamarr images.html | 2021-04-09 11:12 | 31K | |
![[TXT]](/icons/text.gif) | CategoryLambda Reactor Complex images.html | 2021-04-09 11:12 | 220 | |
![[TXT]](/icons/text.gif) | CategoryLand Mine images.html | 2021-04-09 11:12 | 220 | |
![[TXT]](/icons/text.gif) | CategoryLaura Dubuk images.html | 2021-04-09 11:12 | 233 | |
![[TXT]](/icons/text.gif) | CategoryLeech images.html | 2021-04-09 11:12 | 222 | |
![[TXT]](/icons/text.gif) | CategoryLevel 3 Dormitories images.html | 2021-04-09 11:12 | 5.4K | |
![[TXT]](/icons/text.gif) | CategoryLight Stalk images.html | 2021-04-09 11:12 | 202 | |
![[TXT]](/icons/text.gif) | CategoryLighthouse Point images.html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | CategoryLink logos.html | 2021-04-09 11:12 | 195 | |
![[TXT]](/icons/text.gif) | CategoryLink templates.html | 2021-04-09 11:12 | 216 | |
![[TXT]](/icons/text.gif) | CategoryLocations.html | 2021-04-09 11:12 | 258 | |
![[TXT]](/icons/text.gif) | CategoryLocations images.html | 2021-04-09 11:12 | 275 | |
![[TXT]](/icons/text.gif) | CategoryLogos.html | 2021-04-09 11:12 | 43K | |
![[TXT]](/icons/text.gif) | CategoryLost Concept screenshots.html | 2021-04-09 11:12 | 245 | |
![[TXT]](/icons/text.gif) | CategoryM1A1 Abrams images.html | 2021-04-09 11:12 | 229 | |
![[TXT]](/icons/text.gif) | CategoryM2A3 Bradley images.html | 2021-04-09 11:12 | 236 | |
![[TXT]](/icons/text.gif) | CategoryM2 Browning Machine Gun images.html | 2021-04-09 11:12 | 261 | |
![[TXT]](/icons/text.gif) | CategoryM4 images.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | CategoryM35 cargo truck images.html | 2021-04-09 11:12 | 237 | |
![[TXT]](/icons/text.gif) | CategoryM40A1 Sniper Rifle images.html | 2021-04-09 11:12 | 247 | |
![[TXT]](/icons/text.gif) | CategoryM202A1 FLASH images.html | 2021-04-09 11:12 | 229 | |
![[TXT]](/icons/text.gif) | CategoryM249 Squad Automatic Weapon images.html | 2021-04-09 11:12 | 274 | |
![[TXT]](/icons/text.gif) | CategoryMINERVA images.html | 2021-04-09 11:12 | 217 | |
![[TXT]](/icons/text.gif) | CategoryMINERVA screenshots.html | 2021-04-09 11:12 | 302 | |
![[TXT]](/icons/text.gif) | CategoryMIRT images.html | 2021-04-09 11:12 | 203 | |
![[TXT]](/icons/text.gif) | CategoryMK3A2 Grenade images.html | 2021-04-09 11:12 | 244 | |
![[TXT]](/icons/text.gif) | CategoryMP5K images.html | 2021-04-09 11:12 | 276 | |
![[TXT]](/icons/text.gif) | CategoryMP5 images.html | 2021-04-09 11:12 | 227 | |
![[TXT]](/icons/text.gif) | CategoryMP7 (HL2) images.html | 2021-04-09 11:12 | 265 | |
![[TXT]](/icons/text.gif) | CategoryMP7 (cut weapon) images.html | 2021-04-09 11:12 | 333 | |
![[TXT]](/icons/text.gif) | CategoryMP7 images.html | 2021-04-09 11:12 | 179 | |
![[TXT]](/icons/text.gif) | CategoryMTM 8 images.html | 2021-04-09 11:12 | 216 | |
![[TXT]](/icons/text.gif) | CategoryMagnusson Device images.html | 2021-04-09 11:12 | 33K | |
![[TXT]](/icons/text.gif) | CategoryMain Page logos.html | 2021-04-09 11:12 | 234 | |
![[TXT]](/icons/text.gif) | CategoryMaintenance.html | 2021-04-09 11:12 | 239 | |
![[TXT]](/icons/text.gif) | CategoryMales.html | 2021-04-09 11:12 | 193 | |
![[TXT]](/icons/text.gif) | CategoryManhack Arcade images.html | 2021-04-09 11:12 | 471 | |
![[TXT]](/icons/text.gif) | CategoryManhack images.html | 2021-04-09 11:12 | 214 | |
![[TXT]](/icons/text.gif) | CategoryManhacks.html | 2021-04-09 11:12 | 222 | |
![[TXT]](/icons/text.gif) | CategoryMark IV Thermonuclear Device images.html | 2021-04-09 11:12 | 277 | |
![[TXT]](/icons/text.gif) | CategoryMatt images.html | 2021-04-09 11:12 | 3.9K | |
![[TXT]](/icons/text.gif) | CategoryMedkit images.html | 2021-04-09 11:12 | 224 | |
![[TXT]](/icons/text.gif) | CategoryMelee weapons.html | 2021-04-09 11:12 | 173 | |
![[TXT]](/icons/text.gif) | CategoryMel images.html | 2021-04-09 11:12 | 9.0K | |
![[TXT]](/icons/text.gif) | CategoryMerge tags.html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | CategoryMerkava images.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | CategoryMichael Avon Oeming images.html | 2021-04-09 11:12 | 257 | |
![[TXT]](/icons/text.gif) | CategoryMil Mi-8 images.html | 2021-04-09 11:12 | 221 | |
![[TXT]](/icons/text.gif) | CategoryMilitary conflicts.html | 2021-04-09 11:12 | 272 | |
![[TXT]](/icons/text.gif) | CategoryMinigun images.html | 2021-04-09 11:12 | 8.2K | |
![[TXT]](/icons/text.gif) | CategoryMissing Information images.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | CategoryMissing Information screenshots.html | 2021-04-09 11:12 | 399 | |
![[TXT]](/icons/text.gif) | CategoryMk 2 Grenade images.html | 2021-04-09 11:12 | 209 | |
![[TXT]](/icons/text.gif) | CategoryMobility Gels.html | 2021-04-09 11:12 | 350 | |
![[TXT]](/icons/text.gif) | CategoryMoby Francke designs.html | 2021-04-09 11:12 | 247 | |
![[TXT]](/icons/text.gif) | CategoryMoby Francke images.html | 2021-04-09 11:12 | 313 | |
![[TXT]](/icons/text.gif) | CategoryModel images.html | 2021-04-09 11:12 | 4.7K | |
![[TXT]](/icons/text.gif) | CategoryMod images.html | 2021-04-09 11:12 | 316 | |
![[TXT]](/icons/text.gif) | CategoryMods.html | 2021-04-09 11:12 | 308 | |
![[TXT]](/icons/text.gif) | CategoryMod screenshots.html | 2021-04-09 11:12 | 358 | |
![[TXT]](/icons/text.gif) | CategoryMolotov Cocktail images.html | 2021-04-09 11:12 | 386 | |
![[TXT]](/icons/text.gif) | CategoryMonaco images.html | 2021-04-09 11:12 | 221 | |
![[TXT]](/icons/text.gif) | CategoryMortar Synth images.html | 2021-04-09 11:12 | 227 | |
![[TXT]](/icons/text.gif) | CategoryMortars.html | 2021-04-09 11:12 | 8.6K | |
![[TXT]](/icons/text.gif) | CategoryMr. Friendly images.html | 2021-04-09 11:12 | 312 | |
![[TXT]](/icons/text.gif) | CategoryMr. Valve images.html | 2021-04-09 11:12 | 273 | |
![[TXT]](/icons/text.gif) | CategoryMultiplayer player model images.html | 2021-04-09 11:12 | 6.2K | |
![[TXT]](/icons/text.gif) | CategoryMuscle Car images.html | 2021-04-09 11:12 | 217 | |
![[TXT]](/icons/text.gif) | CategoryNarbacular Drop images.html | 2021-04-09 11:12 | 248 | |
![[TXT]](/icons/text.gif) | CategoryNarbacular Drop screenshots.html | 2021-04-09 11:12 | 333 | |
![[TXT]](/icons/text.gif) | CategoryNavigation templates.html | 2021-04-09 11:12 | 276 | |
![[TXT]](/icons/text.gif) | CategoryNeoTokyo images.html | 2021-04-09 11:12 | 220 | |
![[TXT]](/icons/text.gif) | CategoryNeoTokyo screenshots.html | 2021-04-09 11:12 | 307 | |
![[TXT]](/icons/text.gif) | CategoryNew Little Odessa images.html | 2021-04-09 11:12 | 251 | |
![[TXT]](/icons/text.gif) | CategoryNewspaper images.html | 2021-04-09 11:12 | 3.3K | |
![[TXT]](/icons/text.gif) | CategoryNewspapers.html | 2021-04-09 11:12 | 173 | |
![[TXT]](/icons/text.gif) | CategoryNihilanth images.html | 2021-04-09 11:12 | 234 | |
![[TXT]](/icons/text.gif) | CategoryNon-canon articles.html | 2021-04-09 11:12 | 925 | |
![[TXT]](/icons/text.gif) | CategoryNon-canon games.html | 2021-04-09 11:12 | 410 | |
![[TXT]](/icons/text.gif) | CategoryNon-canon material.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | CategoryNon-orphaned images.html | 2021-04-09 11:12 | 44K | |
![[TXT]](/icons/text.gif) | CategoryNova Prospekt images.html | 2021-04-09 11:12 | 242 | |
![[TXT]](/icons/text.gif) | CategoryObsidian Conflict images.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | CategoryObsidian Conflict screenshots.html | 2021-04-09 11:12 | 352 | |
![[TXT]](/icons/text.gif) | CategoryOdell images.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | CategoryOdessa Cubbage images.html | 2021-04-09 11:12 | 245 | |
![[TXT]](/icons/text.gif) | CategoryOfficial images.html | 2021-04-09 11:12 | 308 | |
![[TXT]](/icons/text.gif) | CategoryOfficial logos.html | 2021-04-09 11:12 | 238 | |
![[TXT]](/icons/text.gif) | CategoryOfficial screenshots.html | 2021-04-09 11:12 | 263 | |
![[TXT]](/icons/text.gif) | CategoryOperation Black Mesa images.html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | CategoryOperation Black Mesa screenshots.html | 2021-04-09 11:12 | 950 | |
![[TXT]](/icons/text.gif) | CategoryOrange Box Achievements logos.html | 2021-04-09 11:12 | 325 | |
![[TXT]](/icons/text.gif) | CategoryOrdinance Storage Facility images.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | CategoryOrphaned articles.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | CategoryOverwatch Elite images.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | CategoryOverwatch Nexus images.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | CategoryOverwatch Sniper Rifle images.html | 2021-04-09 11:12 | 368 | |
![[TXT]](/icons/text.gif) | CategoryOverwatch Sniper images.html | 2021-04-09 11:12 | 261 | |
![[TXT]](/icons/text.gif) | CategoryOverwatch Soldier images.html | 2021-04-09 11:12 | 265 | |
![[TXT]](/icons/text.gif) | CategoryOverwatch Standard Issue Pulse Rifle images.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | CategoryPC.html | 2021-04-09 11:12 | 171 | |
![[TXT]](/icons/text.gif) | CategoryPages For Further Review.html | 2021-04-09 11:12 | 2.6K | |
![[TXT]](/icons/text.gif) | CategoryPages containing wikitables.html | 2021-04-09 11:12 | 234 | |
![[TXT]](/icons/text.gif) | CategoryPages with broken file links.html | 2021-04-09 11:12 | 8.9K | |
![[TXT]](/icons/text.gif) | CategoryPalace images.html | 2021-04-09 11:12 | 251 | |
![[TXT]](/icons/text.gif) | CategoryPanther Eye images.html | 2021-04-09 11:12 | 23K | |
![[TXT]](/icons/text.gif) | CategoryPersonality Core images.html | 2021-04-09 11:12 | 28K | |
![[TXT]](/icons/text.gif) | CategoryPersonality Cores.html | 2021-04-09 11:12 | 7.6K | |
![[TXT]](/icons/text.gif) | CategoryPetroleum Station images.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | CategoryPheropods images.html | 2021-04-09 11:12 | 285 | |
![[TXT]](/icons/text.gif) | CategoryPhysgun images.html | 2021-04-09 11:12 | 285 | |
![[TXT]](/icons/text.gif) | CategoryPipe Wrench images.html | 2021-04-09 11:12 | 227 | |
![[TXT]](/icons/text.gif) | CategoryPistol (HL1) images.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | CategoryPit Drone images.html | 2021-04-09 11:12 | 184 | |
![[TXT]](/icons/text.gif) | CategoryPit Worm images.html | 2021-04-09 11:12 | 184 | |
![[TXT]](/icons/text.gif) | CategoryPlasticine modelings images.html | 2021-04-09 11:12 | 6.6K | |
![[TXT]](/icons/text.gif) | CategoryPlayStation 3.html | 2021-04-09 11:12 | 193 | |
![[TXT]](/icons/text.gif) | CategoryPlayable characters.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | CategoryPoison Headcrab images.html | 2021-04-09 11:12 | 243 | |
![[TXT]](/icons/text.gif) | CategoryPoison Zombie images.html | 2021-04-09 11:12 | 358 | |
![[TXT]](/icons/text.gif) | CategoryPolicy.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | CategoryPortal (gateway) images.html | 2021-04-09 11:12 | 277 | |
![[TXT]](/icons/text.gif) | CategoryPortal.html | 2021-04-09 11:12 | 214 | |
![[TXT]](/icons/text.gif) | CategoryPortal 2.html | 2021-04-09 11:12 | 225 | |
![[TXT]](/icons/text.gif) | CategoryPortal 2 Achievements logos.html | 2021-04-09 11:12 | 243 | |
![[TXT]](/icons/text.gif) | CategoryPortal 2 Beta images.html | 2021-04-09 11:12 | 258 | |
![[TXT]](/icons/text.gif) | CategoryPortal 2 Beta screenshots.html | 2021-04-09 11:12 | 301 | |
![[TXT]](/icons/text.gif) | CategoryPortal 2 Beta textures.html | 2021-04-09 11:12 | 271 | |
![[TXT]](/icons/text.gif) | CategoryPortal 2 Game Elements.html | 2021-04-09 11:12 | 237 | |
![[TXT]](/icons/text.gif) | CategoryPortal 2 Lab Rat.html | 2021-04-09 11:12 | 304 | |
![[TXT]](/icons/text.gif) | CategoryPortal 2 Lab Rat images.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | CategoryPortal 2 concept art.html | 2021-04-09 11:12 | 280 | |
![[TXT]](/icons/text.gif) | CategoryPortal 2 images.html | 2021-04-09 11:12 | 276 | |
![[TXT]](/icons/text.gif) | CategoryPortal 2 screenshots.html | 2021-04-09 11:12 | 251 | |
![[TXT]](/icons/text.gif) | CategoryPortal 2 textures.html | 2021-04-09 11:12 | 251 | |
![[TXT]](/icons/text.gif) | CategoryPortal ARG images.html | 2021-04-09 11:12 | 334 | |
![[TXT]](/icons/text.gif) | CategoryPortal Beta screenshots.html | 2021-04-09 11:12 | 781 | |
![[TXT]](/icons/text.gif) | CategoryPortal Storm images.html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | CategoryPortal The Flash Version MapPack images.html | 2021-04-09 11:12 | 218 | |
![[TXT]](/icons/text.gif) | CategoryPortal The Flash Version images.html | 2021-04-09 11:12 | 284 | |
![[TXT]](/icons/text.gif) | CategoryPortal The Flash Version screenshots.html | 2021-04-09 11:12 | 323 | |
![[TXT]](/icons/text.gif) | CategoryPortal concept art.html | 2021-04-09 11:12 | 303 | |
![[TXT]](/icons/text.gif) | CategoryPortal creators.html | 2021-04-09 11:12 | 30K | |
![[TXT]](/icons/text.gif) | CategoryPortal images.html | 2021-04-09 11:12 | 350 | |
![[TXT]](/icons/text.gif) | CategoryPortal is Free images.html | 2021-04-09 11:12 | 274 | |
![[TXT]](/icons/text.gif) | CategoryPortal screenshots.html | 2021-04-09 11:12 | 304 | |
![[TXT]](/icons/text.gif) | CategoryPortal series.html | 2021-04-09 11:12 | 192 | |
![[TXT]](/icons/text.gif) | CategoryPortal textures.html | 2021-04-09 11:12 | 224 | |
![[TXT]](/icons/text.gif) | CategoryPosters.html | 2021-04-09 11:12 | 173 | |
![[TXT]](/icons/text.gif) | CategoryPotatoFoolsDay ARG images.html | 2021-04-09 11:12 | 311 | |
![[TXT]](/icons/text.gif) | CategoryPowered Combat Vest images.html | 2021-04-09 11:12 | 246 | |
![[TXT]](/icons/text.gif) | CategoryPowerup Bottle images.html | 2021-04-09 11:12 | 271 | |
![[TXT]](/icons/text.gif) | CategoryPre-release builds.html | 2021-04-09 11:12 | 341 | |
![[TXT]](/icons/text.gif) | CategoryProduction staff.html | 2021-04-09 11:12 | 234 | |
![[TXT]](/icons/text.gif) | CategoryProduction staff images.html | 2021-04-09 11:12 | 369 | |
![[TXT]](/icons/text.gif) | CategoryProspero concept art.html | 2021-04-09 11:12 | 317 | |
![[TXT]](/icons/text.gif) | CategoryProspero images.html | 2021-04-09 11:12 | 228 | |
![[TXT]](/icons/text.gif) | CategoryProtected pages.html | 2021-04-09 11:12 | 191 | |
![[TXT]](/icons/text.gif) | CategoryProtozoan images.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | CategoryPsyche images.html | 2021-04-09 11:12 | 236 | |
![[TXT]](/icons/text.gif) | CategoryPublic address systems.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | CategoryPublic domain images.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | CategoryPulse weapon images.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | CategoryPulse weapons.html | 2021-04-09 11:12 | 273 | |
![[TXT]](/icons/text.gif) | CategoryQuality articles.html | 2021-04-09 11:12 | 222 | |
![[TXT]](/icons/text.gif) | CategoryQuantum events.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | CategoryQuantums.html | 2021-04-09 11:12 | 168 | |
![[TXT]](/icons/text.gif) | CategoryQuote templates.html | 2021-04-09 11:12 | 190 | |
![[TXT]](/icons/text.gif) | CategoryRPG images.html | 2021-04-09 11:12 | 201 | |
![[TXT]](/icons/text.gif) | CategoryRace X.html | 2021-04-09 11:12 | 267 | |
![[TXT]](/icons/text.gif) | CategoryRace X creatures.html | 2021-04-09 11:12 | 315 | |
![[TXT]](/icons/text.gif) | CategoryRace X images.html | 2021-04-09 11:12 | 284 | |
![[TXT]](/icons/text.gif) | CategoryRace X weapons.html | 2021-04-09 11:12 | 321 | |
![[TXT]](/icons/text.gif) | CategoryRail transport.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | CategoryRail transport images.html | 2021-04-09 11:12 | 316 | |
![[TXT]](/icons/text.gif) | CategoryRandy Lundeen images.html | 2021-04-09 11:12 | 239 | |
![[TXT]](/icons/text.gif) | CategoryRavenholm images.html | 2021-04-09 11:12 | 238 | |
![[TXT]](/icons/text.gif) | CategoryRavenholm tombs images.html | 2021-04-09 11:12 | 238 | |
![[TXT]](/icons/text.gif) | CategoryRavenholm trap images.html | 2021-04-09 11:12 | 313 | |
![[TXT]](/icons/text.gif) | CategoryRazor Train images.html | 2021-04-09 11:12 | 915 | |
![[TXT]](/icons/text.gif) | CategoryRealm Lovejoy images.html | 2021-04-09 11:12 | 239 | |
![[TXT]](/icons/text.gif) | CategoryReal world.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | CategoryReal world images.html | 2021-04-09 11:12 | 250 | |
![[TXT]](/icons/text.gif) | CategoryReal world people.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | CategoryRebel images.html | 2021-04-09 11:12 | 360 | |
![[TXT]](/icons/text.gif) | CategoryRebels.html | 2021-04-09 11:12 | 6.1K | |
![[TXT]](/icons/text.gif) | CategoryRecurring themes.html | 2021-04-09 11:12 | 274 | |
![[TXT]](/icons/text.gif) | CategoryRedirect tags.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | CategoryReferences to Nineteen Eighty-Four.html | 2021-04-09 11:12 | 347 | |
![[TXT]](/icons/text.gif) | CategoryRefreshGame Images.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | CategoryResistance.html | 2021-04-09 11:12 | 286 | |
![[TXT]](/icons/text.gif) | CategoryResistance Crossbow images.html | 2021-04-09 11:12 | 250 | |
![[TXT]](/icons/text.gif) | CategoryResistance RPG images.html | 2021-04-09 11:12 | 1.8K | |
![[TXT]](/icons/text.gif) | CategoryResistance locations.html | 2021-04-09 11:12 | 278 | |
![[TXT]](/icons/text.gif) | CategoryResistance technology.html | 2021-04-09 11:12 | 282 | |
![[TXT]](/icons/text.gif) | CategoryResistance vehicles.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | CategoryResistance voice actors.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | CategoryResistance weapons.html | 2021-04-09 11:12 | 349 | |
![[TXT]](/icons/text.gif) | CategoryRetinal scanner images.html | 2021-04-09 11:12 | 247 | |
![[TXT]](/icons/text.gif) | CategoryRichard Keller images.html | 2021-04-09 11:12 | 211 | |
![[TXT]](/icons/text.gif) | CategoryRobot Enrichment.html | 2021-04-09 11:12 | 330 | |
![[TXT]](/icons/text.gif) | CategoryRobot Enrichment images.html | 2021-04-09 11:12 | 425 | |
![[TXT]](/icons/text.gif) | CategoryRobot Grunt images.html | 2021-04-09 11:12 | 9.9K | |
![[TXT]](/icons/text.gif) | CategoryRobots.html | 2021-04-09 11:12 | 249 | |
![[TXT]](/icons/text.gif) | CategoryRocket Propelled Grenades.html | 2021-04-09 11:12 | 205 | |
![[TXT]](/icons/text.gif) | CategoryRocket Sentry images.html | 2021-04-09 11:12 | 315 | |
![[TXT]](/icons/text.gif) | CategoryRocket images.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | CategoryRollback.html | 2021-04-09 11:12 | 7.1K | |
![[TXT]](/icons/text.gif) | CategoryRollermine images.html | 2021-04-09 11:12 | 223 | |
![[TXT]](/icons/text.gif) | CategoryRosenberg images.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | CategoryS.L.A.M images.html | 2021-04-09 11:12 | 286 | |
![[TXT]](/icons/text.gif) | CategorySMG (HL1) images.html | 2021-04-09 11:12 | 173 | |
![[TXT]](/icons/text.gif) | CategorySPAS-12 images.html | 2021-04-09 11:12 | 187 | |
![[TXT]](/icons/text.gif) | CategorySafe articles.html | 2021-04-09 11:12 | 23K | |
![[TXT]](/icons/text.gif) | CategorySamuel images.html | 2021-04-09 11:12 | 357 | |
![[TXT]](/icons/text.gif) | CategorySand Barnacle images.html | 2021-04-09 11:12 | 3.5K | |
![[TXT]](/icons/text.gif) | CategorySantego Military Base images.html | 2021-04-09 11:12 | 382 | |
![[TXT]](/icons/text.gif) | CategorySatchel Charge images.html | 2021-04-09 11:12 | 236 | |
![[TXT]](/icons/text.gif) | CategorySatellite Communications Center images.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | CategoryScanner images.html | 2021-04-09 11:12 | 264 | |
![[TXT]](/icons/text.gif) | CategoryScanners.html | 2021-04-09 11:12 | 165 | |
![[TXT]](/icons/text.gif) | CategorySchool Bus images.html | 2021-04-09 11:12 | 239 | |
![[TXT]](/icons/text.gif) | CategoryScientists.html | 2021-04-09 11:12 | 187 | |
![[TXT]](/icons/text.gif) | CategoryScientist voice actors.html | 2021-04-09 11:12 | 712 | |
![[TXT]](/icons/text.gif) | CategoryScott Klintworth designs.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | CategoryScout Car images.html | 2021-04-09 11:12 | 2.1K | |
![[TXT]](/icons/text.gif) | CategoryScreenshots.html | 2021-04-09 11:12 | 191 | |
![[TXT]](/icons/text.gif) | CategorySection A-17 Prototype Labs images.html | 2021-04-09 11:12 | 255 | |
![[TXT]](/icons/text.gif) | CategorySector A images.html | 2021-04-09 11:12 | 198 | |
![[TXT]](/icons/text.gif) | CategorySector B Line images.html | 2021-04-09 11:12 | 179 | |
![[TXT]](/icons/text.gif) | CategorySector B images.html | 2021-04-09 11:12 | 198 | |
![[TXT]](/icons/text.gif) | CategorySector C Line images.html | 2021-04-09 11:12 | 201 | |
![[TXT]](/icons/text.gif) | CategorySector C images.html | 2021-04-09 11:12 | 198 | |
![[TXT]](/icons/text.gif) | CategorySector D images.html | 2021-04-09 11:12 | 198 | |
![[TXT]](/icons/text.gif) | CategorySector E Line images.html | 2021-04-09 11:12 | 201 | |
![[TXT]](/icons/text.gif) | CategorySector E Materials Transport images.html | 2021-04-09 11:12 | 269 | |
![[TXT]](/icons/text.gif) | CategorySector E images.html | 2021-04-09 11:12 | 198 | |
![[TXT]](/icons/text.gif) | CategorySector F images.html | 2021-04-09 11:12 | 198 | |
![[TXT]](/icons/text.gif) | CategorySector G images.html | 2021-04-09 11:12 | 198 | |
![[TXT]](/icons/text.gif) | CategorySecurity cameras.html | 2021-04-09 11:12 | 721 | |
![[TXT]](/icons/text.gif) | CategorySentry weapons.html | 2021-04-09 11:12 | 175 | |
![[TXT]](/icons/text.gif) | CategoryShield Scanner images.html | 2021-04-09 11:12 | 249 | |
![[TXT]](/icons/text.gif) | CategoryShip images.html | 2021-04-09 11:12 | 193 | |
![[TXT]](/icons/text.gif) | CategoryShock Roach images.html | 2021-04-09 11:12 | 226 | |
![[TXT]](/icons/text.gif) | CategoryShock Trooper images.html | 2021-04-09 11:12 | 196 | |
![[TXT]](/icons/text.gif) | CategoryShorepoint Base images.html | 2021-04-09 11:12 | 6.5K | |
![[TXT]](/icons/text.gif) | CategoryShotguns.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | CategorySilo D images.html | 2021-04-09 11:12 | 173 | |
![[TXT]](/icons/text.gif) | CategorySimmons images.html | 2021-04-09 11:12 | 190 | |
![[TXT]](/icons/text.gif) | CategorySkitch images.html | 2021-04-09 11:12 | 292 | |
![[TXT]](/icons/text.gif) | CategorySkyscraper images.html | 2021-04-09 11:12 | 4.0K | |
![[TXT]](/icons/text.gif) | CategorySnark Mine images.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | CategorySnark images.html | 2021-04-09 11:12 | 285 | |
![[TXT]](/icons/text.gif) | CategorySniper Rifle (HL2) images.html | 2021-04-09 11:12 | 209 | |
![[TXT]](/icons/text.gif) | CategorySniper Rifle (cut weapon) images.html | 2021-04-09 11:12 | 328 | |
![[TXT]](/icons/text.gif) | CategorySniper rifles.html | 2021-04-09 11:12 | 244 | |
![[TXT]](/icons/text.gif) | CategorySocket Wrench images.html | 2021-04-09 11:12 | 303 | |
![[TXT]](/icons/text.gif) | CategorySoftware images.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | CategorySoftwares.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | CategorySongs.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | CategorySounds.html | 2021-04-09 11:12 | 8.2K | |
![[TXT]](/icons/text.gif) | CategorySource Particle Benchmark images.html | 2021-04-09 11:12 | 833 | |
![[TXT]](/icons/text.gif) | CategorySource Particle Benchmark screenshots.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | CategorySource Particle Benchmark textures.html | 2021-04-09 11:12 | 6.6K | |
![[TXT]](/icons/text.gif) | CategorySource SDK images.html | 2021-04-09 11:12 | 178 | |
![[TXT]](/icons/text.gif) | CategorySource demonstrational rooms images.html | 2021-04-09 11:12 | 530 | |
![[TXT]](/icons/text.gif) | CategorySource model images.html | 2021-04-09 11:12 | 222 | |
![[TXT]](/icons/text.gif) | CategorySource mods.html | 2021-04-09 11:12 | 6.8K | |
![[TXT]](/icons/text.gif) | CategorySpitters.html | 2021-04-09 11:12 | 2.9K | |
![[TXT]](/icons/text.gif) | CategorySpore Launcher images.html | 2021-04-09 11:12 | 235 | |
![[TXT]](/icons/text.gif) | CategorySprite images.html | 2021-04-09 11:12 | 175 | |
![[TXT]](/icons/text.gif) | CategorySt. Olga images.html | 2021-04-09 11:12 | 5.3K | |
![[TXT]](/icons/text.gif) | CategoryStalker images.html | 2021-04-09 11:12 | 235 | |
![[TXT]](/icons/text.gif) | CategoryStandard Headcrab images.html | 2021-04-09 11:12 | 248 | |
![[TXT]](/icons/text.gif) | CategoryStandard Zombie images.html | 2021-04-09 11:12 | 503 | |
![[TXT]](/icons/text.gif) | CategoryStation 6 images.html | 2021-04-09 11:12 | 220 | |
![[TXT]](/icons/text.gif) | CategoryStation 7 images.html | 2021-04-09 11:12 | 27K | |
![[TXT]](/icons/text.gif) | CategoryStation 12 images.html | 2021-04-09 11:12 | 816 | |
![[TXT]](/icons/text.gif) | CategorySteam images.html | 2021-04-09 11:12 | 213 | |
![[TXT]](/icons/text.gif) | CategorySterilizer images.html | 2021-04-09 11:12 | 208 | |
![[TXT]](/icons/text.gif) | CategorySticky Launcher images.html | 2021-04-09 11:12 | 377 | |
![[TXT]](/icons/text.gif) | CategoryStill Alive images.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | CategoryStoryline articles.html | 2021-04-09 11:12 | 194 | |
![[TXT]](/icons/text.gif) | CategoryStrider images.html | 2021-04-09 11:12 | 291 | |
![[TXT]](/icons/text.gif) | CategoryStubs.html | 2021-04-09 11:12 | 231 | |
![[TXT]](/icons/text.gif) | CategoryStukabat images.html | 2021-04-09 11:12 | 412 | |
![[TXT]](/icons/text.gif) | CategoryStun Baton images.html | 2021-04-09 11:12 | 223 | |
![[TXT]](/icons/text.gif) | CategorySubjects by designers.html | 2021-04-09 11:12 | 180 | |
![[TXT]](/icons/text.gif) | CategorySubmachine guns.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | CategorySubmarine images.html | 2021-04-09 11:12 | 203 | |
![[TXT]](/icons/text.gif) | CategorySuper 8 Interactive Teaser screenshots.html | 2021-04-09 11:12 | 232 | |
![[TXT]](/icons/text.gif) | CategorySuperportal images.html | 2021-04-09 11:12 | 240 | |
![[TXT]](/icons/text.gif) | CategorySuppression Device images.html | 2021-04-09 11:12 | 322 | |
![[TXT]](/icons/text.gif) | CategorySven Co-op images.html | 2021-04-09 11:12 | 226 | |
![[TXT]](/icons/text.gif) | CategorySven Co-op screenshots.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | CategorySynth Scanner images.html | 2021-04-09 11:12 | 328 | |
![[TXT]](/icons/text.gif) | CategorySynth Scanners.html | 2021-04-09 11:12 | 210 | |
![[TXT]](/icons/text.gif) | CategorySynth images.html | 2021-04-09 11:12 | 4.8K | |
![[TXT]](/icons/text.gif) | CategorySynths.html | 2021-04-09 11:12 | 19K | |
![[TXT]](/icons/text.gif) | CategoryTactical Map images.html | 2021-04-09 11:12 | 235 | |
![[TXT]](/icons/text.gif) | CategoryTag The Power of Paint images.html | 2021-04-09 11:12 | 754 | |
![[TXT]](/icons/text.gif) | CategoryTag The Power of Paint screenshots.html | 2021-04-09 11:12 | 26K | |
![[TXT]](/icons/text.gif) | CategoryTank images.html | 2021-04-09 11:12 | 201 | |
![[TXT]](/icons/text.gif) | CategoryTanks.html | 2021-04-09 11:12 | 171 | |
![[TXT]](/icons/text.gif) | CategoryTau Cannon images.html | 2021-04-09 11:12 | 223 | |
![[TXT]](/icons/text.gif) | CategoryTeam Fortress 2 concept art.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | CategoryTechnical Trainstation images.html | 2021-04-09 11:12 | 297 | |
![[TXT]](/icons/text.gif) | CategoryTechnology.html | 2021-04-09 11:12 | 245 | |
![[TXT]](/icons/text.gif) | CategoryTechnology demos.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | CategoryTechnology images.html | 2021-04-09 11:12 | 282 | |
![[TXT]](/icons/text.gif) | CategoryTed Backman designs.html | 2021-04-09 11:12 | 244 | |
![[TXT]](/icons/text.gif) | CategoryTed Backman images.html | 2021-04-09 11:12 | 308 | |
![[TXT]](/icons/text.gif) | CategoryTeleportation images.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | CategoryTeleport images.html | 2021-04-09 11:12 | 207 | |
![[TXT]](/icons/text.gif) | CategoryTemplates.html | 2021-04-09 11:12 | 1.5K | |
![[TXT]](/icons/text.gif) | CategoryTemplatesSignatures.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | CategoryTentacle images.html | 2021-04-09 11:12 | 231 | |
![[TXT]](/icons/text.gif) | CategoryTest Shaft 09 images.html | 2021-04-09 11:12 | 32K | |
![[TXT]](/icons/text.gif) | CategoryTest Subject images.html | 2021-04-09 11:12 | 801 | |
![[TXT]](/icons/text.gif) | CategoryTest Subjects.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | CategoryTesting Tracks.html | 2021-04-09 11:12 | 466 | |
![[TXT]](/icons/text.gif) | CategoryTesting supervisors.html | 2021-04-09 11:12 | 9.1K | |
![[TXT]](/icons/text.gif) | CategoryTexture images.html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | CategoryThe Coast images.html | 2021-04-09 11:12 | 341 | |
![[TXT]](/icons/text.gif) | CategoryThe Coast locations.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | CategoryThe Consul images.html | 2021-04-09 11:12 | 386 | |
![[TXT]](/icons/text.gif) | CategoryThe Final Hours.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | CategoryThe Final Hours of Portal 2.html | 2021-04-09 11:12 | 295 | |
![[TXT]](/icons/text.gif) | CategoryThe Final Hours of Portal 2 images.html | 2021-04-09 11:12 | 407 | |
![[TXT]](/icons/text.gif) | CategoryThe Fisherman images.html | 2021-04-09 11:12 | 316 | |
![[TXT]](/icons/text.gif) | CategoryThe G-Man images.html | 2021-04-09 11:12 | 793 | |
![[TXT]](/icons/text.gif) | CategoryThe Mesa Times images.html | 2021-04-09 11:12 | 316 | |
![[TXT]](/icons/text.gif) | CategoryThe Orange Box.html | 2021-04-09 11:12 | 245 | |
![[TXT]](/icons/text.gif) | CategoryThe Orange Box images.html | 2021-04-09 11:12 | 299 | |
![[TXT]](/icons/text.gif) | CategoryThe Outlands images.html | 2021-04-09 11:12 | 296 | |
![[TXT]](/icons/text.gif) | CategoryThe Outlands locations.html | 2021-04-09 11:12 | 269 | |
![[TXT]](/icons/text.gif) | CategoryThe Terminal images.html | 2021-04-09 11:12 | 326 | |
![[TXT]](/icons/text.gif) | CategoryThe Wasteland images.html | 2021-04-09 11:12 | 418 | |
![[TXT]](/icons/text.gif) | CategoryThe Wasteland locations.html | 2021-04-09 11:12 | 269 | |
![[TXT]](/icons/text.gif) | CategoryThe White Forest Inn images.html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | CategoryThey Hunger images.html | 2021-04-09 11:12 | 229 | |
![[TXT]](/icons/text.gif) | CategoryThey Hunger screenshots.html | 2021-04-09 11:12 | 322 | |
![[TXT]](/icons/text.gif) | CategoryThumpers.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | CategoryTopside Motorpool images.html | 2021-04-09 11:12 | 225 | |
![[TXT]](/icons/text.gif) | CategoryTowns and cities.html | 2021-04-09 11:12 | 183 | |
![[TXT]](/icons/text.gif) | CategoryTraining Facility images.html | 2021-04-09 11:12 | 205 | |
![[TXT]](/icons/text.gif) | CategoryTrainstation images.html | 2021-04-09 11:12 | 437 | |
![[TXT]](/icons/text.gif) | CategoryTrainstations.html | 2021-04-09 11:12 | 274 | |
![[TXT]](/icons/text.gif) | CategoryTranshumans.html | 2021-04-09 11:12 | 238 | |
![[TXT]](/icons/text.gif) | CategoryTransportation.html | 2021-04-09 11:12 | 295 | |
![[TXT]](/icons/text.gif) | CategoryTransportation images.html | 2021-04-09 11:12 | 274 | |
![[TXT]](/icons/text.gif) | CategoryTri Nguyen designs.html | 2021-04-09 11:12 | 242 | |
![[TXT]](/icons/text.gif) | CategoryTri Nguyen images.html | 2021-04-09 11:12 | 303 | |
![[TXT]](/icons/text.gif) | CategoryTripods.html | 2021-04-09 11:12 | 195 | |
![[TXT]](/icons/text.gif) | CategoryTristan Reidford images.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | CategoryTruck images.html | 2021-04-09 11:12 | 253 | |
![[TXT]](/icons/text.gif) | CategoryTrucks.html | 2021-04-09 11:12 | 173 | |
![[TXT]](/icons/text.gif) | CategoryUSP Match images.html | 2021-04-09 11:12 | 229 | |
![[TXT]](/icons/text.gif) | CategoryUnnamed Sector E industrial area images.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | CategoryUnsourced quotes.html | 2021-04-09 11:12 | 218 | |
![[TXT]](/icons/text.gif) | CategoryUriah images.html | 2021-04-09 11:12 | 8.2K | |
![[TXT]](/icons/text.gif) | CategoryUser-related images.html | 2021-04-09 11:12 | 213 | |
![[TXT]](/icons/text.gif) | CategoryUserboxes.html | 2021-04-09 11:12 | 6.3K | |
![[TXT]](/icons/text.gif) | CategoryUser images.html | 2021-04-09 11:12 | 227 | |
![[TXT]](/icons/text.gif) | CategoryUser templates.html | 2021-04-09 11:12 | 188 | |
![[TXT]](/icons/text.gif) | CategoryUtility templates.html | 2021-04-09 11:12 | 679 | |
![[TXT]](/icons/text.gif) | CategoryV-22 Osprey images.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | CategoryValve employees.html | 2021-04-09 11:12 | 244 | |
![[TXT]](/icons/text.gif) | CategoryVance Headquarters images.html | 2021-04-09 11:12 | 384 | |
![[TXT]](/icons/text.gif) | CategoryVance images.html | 2021-04-09 11:12 | 457 | |
![[TXT]](/icons/text.gif) | CategoryVector images.html | 2021-04-09 11:12 | 218 | |
![[TXT]](/icons/text.gif) | CategoryVertigo images.html | 2021-04-09 11:12 | 253 | |
![[TXT]](/icons/text.gif) | CategoryVictory Mine Vortigaunt images.html | 2021-04-09 11:12 | 270 | |
![[TXT]](/icons/text.gif) | CategoryVictory Mine images.html | 2021-04-09 11:12 | 313 | |
![[TXT]](/icons/text.gif) | CategoryVideos.html | 2021-04-09 11:12 | 173 | |
![[TXT]](/icons/text.gif) | CategoryViktor Antonov designs.html | 2021-04-09 11:12 | 253 | |
![[TXT]](/icons/text.gif) | CategoryViktor Antonov images.html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | CategoryVoice actors.html | 2021-04-09 11:12 | 209 | |
![[TXT]](/icons/text.gif) | CategoryVoice actors images.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | CategoryVoltigore images.html | 2021-04-09 11:12 | 184 | |
![[TXT]](/icons/text.gif) | CategoryVortex Hopwire images.html | 2021-04-09 11:12 | 842 | |
![[TXT]](/icons/text.gif) | CategoryVortigaunt Camp images.html | 2021-04-09 11:12 | 245 | |
![[TXT]](/icons/text.gif) | CategoryVortigaunt images.html | 2021-04-09 11:12 | 297 | |
![[TXT]](/icons/text.gif) | CategoryVortigaunts.html | 2021-04-09 11:12 | 339 | |
![[TXT]](/icons/text.gif) | CategoryWallace Breen images.html | 2021-04-09 11:12 | 281 | |
![[TXT]](/icons/text.gif) | CategoryWalter Bennet images.html | 2021-04-09 11:12 | 208 | |
![[TXT]](/icons/text.gif) | CategoryWaste Processing Area 3 images.html | 2021-04-09 11:12 | 243 | |
![[TXT]](/icons/text.gif) | CategoryWasteland Scanner images.html | 2021-04-09 11:12 | 19K | |
![[TXT]](/icons/text.gif) | CategoryWasteland submarine images.html | 2021-04-09 11:12 | 248 | |
![[TXT]](/icons/text.gif) | CategoryWatercraft images.html | 2021-04-09 11:12 | 272 | |
![[TXT]](/icons/text.gif) | CategoryWatercrafts.html | 2021-04-09 11:12 | 183 | |
![[TXT]](/icons/text.gif) | CategoryWeapon Box images.html | 2021-04-09 11:12 | 857 | |
![[TXT]](/icons/text.gif) | CategoryWeapon images.html | 2021-04-09 11:12 | 296 | |
![[TXT]](/icons/text.gif) | CategoryWeapons.html | 2021-04-09 11:12 | 299 | |
![[TXT]](/icons/text.gif) | CategoryWelding Torch images.html | 2021-04-09 11:12 | 238 | |
![[TXT]](/icons/text.gif) | CategoryWheatley's Testing Track images.html | 2021-04-09 11:12 | 4.6K | |
![[TXT]](/icons/text.gif) | CategoryWheatley images.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | CategoryWhite Forest images.html | 2021-04-09 11:12 | 792 | |
![[TXT]](/icons/text.gif) | CategoryWikia Chat logs.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | CategoryWiki cake images.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | CategoryWorlds.html | 2021-04-09 11:12 | 260 | |
![[TXT]](/icons/text.gif) | CategoryWriters.html | 2021-04-09 11:12 | 193 | |
![[TXT]](/icons/text.gif) | CategoryXM29 OICW images.html | 2021-04-09 11:12 | 291 | |
![[TXT]](/icons/text.gif) | CategoryXbox 360.html | 2021-04-09 11:12 | 183 | |
![[TXT]](/icons/text.gif) | CategoryXen.html | 2021-04-09 11:12 | 271 | |
![[TXT]](/icons/text.gif) | CategoryXen Ceiling Turret images.html | 2021-04-09 11:12 | 247 | |
![[TXT]](/icons/text.gif) | CategoryXen Fungus images.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | CategoryXen Healing Pool images.html | 2021-04-09 11:12 | 216 | |
![[TXT]](/icons/text.gif) | CategoryXen Sentry Cannon images.html | 2021-04-09 11:12 | 244 | |
![[TXT]](/icons/text.gif) | CategoryXen Thumper images.html | 2021-04-09 11:12 | 242 | |
![[TXT]](/icons/text.gif) | CategoryXen Tree images.html | 2021-04-09 11:12 | 193 | |
![[TXT]](/icons/text.gif) | CategoryXen creatures.html | 2021-04-09 11:12 | 354 | |
![[TXT]](/icons/text.gif) | CategoryXen creatures images.html | 2021-04-09 11:12 | 355 | |
![[TXT]](/icons/text.gif) | CategoryXen crystal images.html | 2021-04-09 11:12 | 201 | |
![[TXT]](/icons/text.gif) | CategoryXen flora and minerals.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | CategoryXen flora and minerals images.html | 2021-04-09 11:12 | 326 | |
![[TXT]](/icons/text.gif) | CategoryXen images.html | 2021-04-09 11:12 | 212 | |
![[TXT]](/icons/text.gif) | CategoryXen technology.html | 2021-04-09 11:12 | 3.0K | |
![[TXT]](/icons/text.gif) | CategoryXen technology images.html | 2021-04-09 11:12 | 283 | |
![[TXT]](/icons/text.gif) | CategoryXen weapons.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | CategoryZentraedi Tactical Battle Pod images.html | 2021-04-09 11:12 | 438 | |
![[TXT]](/icons/text.gif) | CategoryZero Point Energy Field Manipulator images.html | 2021-04-09 11:12 | 243 | |
![[TXT]](/icons/text.gif) | CategoryZombie images.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | CategoryZombies.html | 2021-04-09 11:12 | 191 | |
![[TXT]](/icons/text.gif) | CategoryZombine images.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Category talkAircraft.html | 2021-04-09 11:12 | 450 | |
![[TXT]](/icons/text.gif) | Category talkAlyx Vance images.html | 2021-04-09 11:12 | 482 | |
![[TXT]](/icons/text.gif) | Category talkAperture Science.html | 2021-04-09 11:12 | 7.1K | |
![[TXT]](/icons/text.gif) | Category talkBlog posts.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Category talkCharacters.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | Category talkCut Characters.html | 2021-04-09 11:12 | 5.6K | |
![[TXT]](/icons/text.gif) | Category talkCut Enemies.html | 2021-04-09 11:12 | 568 | |
![[TXT]](/icons/text.gif) | Category talkEnemies.html | 2021-04-09 11:12 | 3.6K | |
![[TXT]](/icons/text.gif) | Category talkEquipment.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | Category talkG-Man images.html | 2021-04-09 11:12 | 477 | |
![[TXT]](/icons/text.gif) | Category talkGame soundtracks.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | Category talkGordon Freeman images.html | 2021-04-09 11:12 | 504 | |
![[TXT]](/icons/text.gif) | Category talkHalf-Life 2 Episode One.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | Category talkImages to sort.html | 2021-04-09 11:12 | 8.3K | |
![[TXT]](/icons/text.gif) | Category talkMilitary Conflicts.html | 2021-04-09 11:12 | 241 | |
![[TXT]](/icons/text.gif) | Category talkQuantum events.html | 2021-04-09 11:12 | 8.3K | |
![[TXT]](/icons/text.gif) | Category talkResistance Vehicles.html | 2021-04-09 11:12 | 447 | |
![[TXT]](/icons/text.gif) | Category talkVoice actors.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Cats.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Caughley.html | 2021-04-09 11:12 | 426 | |
![[TXT]](/icons/text.gif) | Cavanaugh.html | 2021-04-09 11:12 | 1.6K | |
![[TXT]](/icons/text.gif) | Cave.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Cave Johnson.html | 2021-04-09 11:12 | 25K | |
![[TXT]](/icons/text.gif) | CaveJohnson.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Ceiling Turret.html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | Central AI Chamber.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Central Core Room.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | Characters.html | 2021-04-09 11:12 | 59K | |
![[TXT]](/icons/text.gif) | Charger (Xen creature).html | 2021-04-09 11:12 | 3.2K | |
![[TXT]](/icons/text.gif) | Charger.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | Charging Station.html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | Charles Cardoze.html | 2021-04-09 11:12 | 366 | |
![[TXT]](/icons/text.gif) | Cheating.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | Chell (Bring-Your-Daughter-to-Work-Day).html | 2021-04-09 11:12 | 157 | |
![[TXT]](/icons/text.gif) | Chell.html | 2021-04-09 11:12 | 45K | |
![[TXT]](/icons/text.gif) | Chell a possible Prisoner.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | Chet Faliszek.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | Chevrolet Caprice sedan (car01).html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Chicken.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Child.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Child Factories.html | 2021-04-09 11:12 | 191 | |
![[TXT]](/icons/text.gif) | Child Factory.html | 2021-04-09 11:12 | 189 | |
![[TXT]](/icons/text.gif) | Children.html | 2021-04-09 11:12 | 768 | |
![[TXT]](/icons/text.gif) | Chopper.html | 2021-04-09 11:12 | 122 | |
![[TXT]](/icons/text.gif) | Chort.html | 2021-04-09 11:12 | 161 | |
![[TXT]](/icons/text.gif) | Chris Jensen.html | 2021-04-09 11:12 | 5.0K | |
![[TXT]](/icons/text.gif) | Christopher M. Pham.html | 2021-04-09 11:12 | 370 | |
![[TXT]](/icons/text.gif) | Chronology.html | 2021-04-09 11:12 | 132 | |
![[TXT]](/icons/text.gif) | Chubtoad.html | 2021-04-09 11:12 | 57K | |
![[TXT]](/icons/text.gif) | Chuck Jones.html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | Chumtoad's Lair.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | Chumtoad.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Cinematic Mod.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Citadel.html | 2021-04-09 11:12 | 38K | |
![[TXT]](/icons/text.gif) | Citadel Core.html | 2021-04-09 11:12 | 6.7K | |
![[TXT]](/icons/text.gif) | Citizen.html | 2021-04-09 11:12 | 31K | |
![[TXT]](/icons/text.gif) | Citizens.html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | City 8.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | City 11.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | City 12.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | City 13.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | City 14.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | City 15.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | City 16.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | City 17.html | 2021-04-09 11:12 | 51K | |
![[TXT]](/icons/text.gif) | City 17 Episode 1.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | City17 Episode 1.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | City 17 Episode One.html | 2021-04-09 11:12 | 4.8K | |
![[TXT]](/icons/text.gif) | City 17 Trainstation (disambiguation).html | 2021-04-09 11:12 | 8.6K | |
![[TXT]](/icons/text.gif) | City 17 Trainstation.html | 2021-04-09 11:12 | 168 | |
![[TXT]](/icons/text.gif) | City 17 Underground.html | 2021-04-09 11:12 | 165 | |
![[TXT]](/icons/text.gif) | City 17 train stations.html | 2021-04-09 11:12 | 872 | |
![[TXT]](/icons/text.gif) | City 17 uprising.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | City 24.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | City 27.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | City 40.html | 2021-04-09 11:12 | 5.2K | |
![[TXT]](/icons/text.gif) | City 49.html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | City Scanner.html | 2021-04-09 11:12 | 9.9K | |
![[TXT]](/icons/text.gif) | City Seventeen.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Civil Protection.html | 2021-04-09 11:12 | 23K | |
![[TXT]](/icons/text.gif) | Civilian Militia.html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | Clean up.html | 2021-04-09 11:12 | 164 | |
![[TXT]](/icons/text.gif) | Cleanup.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | Cleveland.html | 2021-04-09 11:12 | 751 | |
![[TXT]](/icons/text.gif) | Cloaking device.html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | Co-op Test Shaft.html | 2021-04-09 11:12 | 6.8K | |
![[TXT]](/icons/text.gif) | Coast.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | Cockroach.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Code Green.html | 2021-04-09 11:12 | 180 | |
![[TXT]](/icons/text.gif) | Codename Gordon.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Cohrt.html | 2021-04-09 11:12 | 161 | |
![[TXT]](/icons/text.gif) | Colette.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Colette Green.html | 2021-04-09 11:12 | 9.7K | |
![[TXT]](/icons/text.gif) | Colt.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | Colt Python.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Combat Knife.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Combine.html | 2021-04-09 11:12 | 35K | |
![[TXT]](/icons/text.gif) | Combine APC.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | Combine Advisor.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Combine Advisor Pod.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Combine Alien Assassin.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | Combine Assassin.html | 2021-04-09 11:12 | 4.8K | |
![[TXT]](/icons/text.gif) | Combine Assassin tank.html | 2021-04-09 11:12 | 2.1K | |
![[TXT]](/icons/text.gif) | Combine Ball.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Combine Barricade.html | 2021-04-09 11:12 | 3.9K | |
![[TXT]](/icons/text.gif) | Combine Big Momma Pod.html | 2021-04-09 11:12 | 3.2K | |
![[TXT]](/icons/text.gif) | Combine Binoculars.html | 2021-04-09 11:12 | 3.6K | |
![[TXT]](/icons/text.gif) | Combine Bunker.html | 2021-04-09 11:12 | 3.8K | |
![[TXT]](/icons/text.gif) | Combine Camera.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Combine Ceiling Turret.html | 2021-04-09 11:12 | 6.5K | |
![[TXT]](/icons/text.gif) | Combine Cell.html | 2021-04-09 11:12 | 7.3K | |
![[TXT]](/icons/text.gif) | Combine Citadel.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Combine Computer.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | Combine Core.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Combine Depot.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | Combine Destiny.html | 2021-04-09 11:12 | 3.4K | |
![[TXT]](/icons/text.gif) | Combine Dispatcher.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | Combine Dispenser.html | 2021-04-09 11:12 | 3.4K | |
![[TXT]](/icons/text.gif) | Combine Door.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | Combine Door Lock.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Combine Dropgate.html | 2021-04-09 11:12 | 692 | |
![[TXT]](/icons/text.gif) | Combine Dropship.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | Combine Dropship Container.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | Combine Elite.html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | Combine Emitter.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | Combine Factories.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Combine Factory.html | 2021-04-09 11:12 | 157 | |
![[TXT]](/icons/text.gif) | Combine Fortification.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | Combine Ground Turret.html | 2021-04-09 11:12 | 5.3K | |
![[TXT]](/icons/text.gif) | Combine Guard (human).html | 2021-04-09 11:12 | 173 | |
![[TXT]](/icons/text.gif) | Combine Guard.html | 2021-04-09 11:12 | 6.8K | |
![[TXT]](/icons/text.gif) | Combine Guard Gun.html | 2021-04-09 11:12 | 3.8K | |
![[TXT]](/icons/text.gif) | Combine Gunship.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Combine Heavy Door.html | 2021-04-09 11:12 | 2.4K | |
![[TXT]](/icons/text.gif) | Combine Hunters.html | 2021-04-09 11:12 | 135 | |
![[TXT]](/icons/text.gif) | Combine Imagery.html | 2021-04-09 11:12 | 3.5K | |
![[TXT]](/icons/text.gif) | Combine Interface.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | Combine Laser Tripmine.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Combine Launcher.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | Combine Light.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Combine Mobile Wall.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | Combine Monitor.html | 2021-04-09 11:12 | 1.8K | |
![[TXT]](/icons/text.gif) | Combine OverWiki.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | Combine Overwatch.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Combine Overworld.html | 2021-04-09 11:12 | 5.0K | |
![[TXT]](/icons/text.gif) | Combine Pod.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Combine Power Generator.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Combine Prison Guard.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Combine Pulse Sniper Rifle.html | 2021-04-09 11:12 | 178 | |
![[TXT]](/icons/text.gif) | Combine Ration Dispenser.html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | Combine SPAS-12.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Combine SWAT Truck.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | Combine Scanner.html | 2021-04-09 11:12 | 127 | |
![[TXT]](/icons/text.gif) | Combine Security Camera.html | 2021-04-09 11:12 | 159 | |
![[TXT]](/icons/text.gif) | Combine Security Door.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | Combine Sentry Gun.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Combine Sentry Turret.html | 2021-04-09 11:12 | 173 | |
![[TXT]](/icons/text.gif) | Combine Smart Barrier.html | 2021-04-09 11:12 | 6.7K | |
![[TXT]](/icons/text.gif) | Combine Sniper Rifle.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | Combine Soldier.html | 2021-04-09 11:12 | 240 | |
![[TXT]](/icons/text.gif) | Combine Super Soldier.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Combine Synth Elite Soldier.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | Combine Turret.html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | Combine Wall.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | Combine War.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | Combine Watchtower.html | 2021-04-09 11:12 | 3.9K | |
![[TXT]](/icons/text.gif) | Combine Weather Control.html | 2021-04-09 11:12 | 161 | |
![[TXT]](/icons/text.gif) | Combine Zombie.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | Combine elevator.html | 2021-04-09 11:12 | 5.6K | |
![[TXT]](/icons/text.gif) | Combine guard (Civil Protection).html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Combine homeworld.html | 2021-04-09 11:12 | 159 | |
![[TXT]](/icons/text.gif) | Combine lock.html | 2021-04-09 11:12 | 3.1K | |
![[TXT]](/icons/text.gif) | Combine logo.html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | Combot.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Command and Communication Center.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Commentaries.html | 2021-04-09 11:12 | 898 | |
![[TXT]](/icons/text.gif) | Commentary.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Commentary Notes.html | 2021-04-09 11:12 | 164 | |
![[TXT]](/icons/text.gif) | Commentary node.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Commentary nodes.html | 2021-04-09 11:12 | 164 | |
![[TXT]](/icons/text.gif) | Companion Cube.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Complimentary Victory Lift.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Concept art.html | 2021-04-09 11:12 | 157 | |
![[TXT]](/icons/text.gif) | Concerned.html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | Concerned The Half-Life and Death of Gordon Frohman.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | Conclusion.html | 2021-04-09 11:12 | 132 | |
![[TXT]](/icons/text.gif) | Confiscation Field.html | 2021-04-09 11:12 | 3.3K | |
![[TXT]](/icons/text.gif) | Conscript.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Conscripts.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | Consoling Couple.html | 2021-04-09 11:12 | 6.6K | |
![[TXT]](/icons/text.gif) | Consul.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Consulcast.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Continuity.html | 2021-04-09 11:12 | 915 | |
![[TXT]](/icons/text.gif) | Controller.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Conversion.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Conversion Gel.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Cook.html | 2021-04-09 11:12 | 422 | |
![[TXT]](/icons/text.gif) | Coomer (disambiguation).html | 2021-04-09 11:12 | 350 | |
![[TXT]](/icons/text.gif) | Coomer (scientist).html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | Coomer (security guard).html | 2021-04-09 11:12 | 1.6K | |
![[TXT]](/icons/text.gif) | Coomer.html | 2021-04-09 11:12 | 117 | |
![[TXT]](/icons/text.gif) | Cooper.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | Cooperative Testing Courses.html | 2021-04-09 11:12 | 6.4K | |
![[TXT]](/icons/text.gif) | Cooperative Testing Initiative.html | 2021-04-09 11:12 | 182 | |
![[TXT]](/icons/text.gif) | Cooperative Trial.html | 2021-04-09 11:12 | 35K | |
![[TXT]](/icons/text.gif) | Core (disambiguation).html | 2021-04-09 11:12 | 471 | |
![[TXT]](/icons/text.gif) | Core.html | 2021-04-09 11:12 | 6.1K | |
![[TXT]](/icons/text.gif) | Corporal Adrian Shephard.html | 2021-04-09 11:12 | 159 | |
![[TXT]](/icons/text.gif) | Couch couple.html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | Crab.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Crab Synth.html | 2021-04-09 11:12 | 135 | |
![[TXT]](/icons/text.gif) | Crabs.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | Crap Turret.html | 2021-04-09 11:12 | 697 | |
![[TXT]](/icons/text.gif) | Cremator.html | 2021-04-09 11:12 | 9.4K | |
![[TXT]](/icons/text.gif) | Cremator Factory.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | Cross.html | 2021-04-09 11:12 | 587 | |
![[TXT]](/icons/text.gif) | Crossbow (HL1).html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | Crossbow (HL2).html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | Crossbow (disambiguation).html | 2021-04-09 11:12 | 478 | |
![[TXT]](/icons/text.gif) | Crossbow.html | 2021-04-09 11:12 | 121 | |
![[TXT]](/icons/text.gif) | Crossfire.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | Crow.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Crowbar.html | 2021-04-09 11:12 | 22K | |
![[TXT]](/icons/text.gif) | Crows.html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | Crush Depth.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Crusher.html | 2021-04-09 11:12 | 5.1K | |
![[TXT]](/icons/text.gif) | Cryo-chamber.html | 2021-04-09 11:12 | 5.0K | |
![[TXT]](/icons/text.gif) | Crystal.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Crystal cart.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Cubbage.html | 2021-04-09 11:12 | 706 | |
![[TXT]](/icons/text.gif) | Cube.html | 2021-04-09 11:12 | 732 | |
![[TXT]](/icons/text.gif) | Cyril.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | DØG.html | 2021-04-09 11:12 | 105 | |
![[TXT]](/icons/text.gif) | D. Mertz.html | 2021-04-09 11:12 | 406 | |
![[TXT]](/icons/text.gif) | DM.html | 2021-04-09 11:12 | 5.7K | |
![[TXT]](/icons/text.gif) | DMC.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | DYSTOPIA.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Dam.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | Damarcus Holbrook.html | 2021-04-09 11:12 | 5.1K | |
![[TXT]](/icons/text.gif) | Daniel.html | 2021-04-09 11:12 | 317 | |
![[TXT]](/icons/text.gif) | Daniel Dociu.html | 2021-04-09 11:12 | 129 | |
![[TXT]](/icons/text.gif) | Dark Energy (Chapter).html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | Dark Energy.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Dark Energy Reactor.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Dark Fusion Reactor.html | 2021-04-09 11:12 | 590 | |
![[TXT]](/icons/text.gif) | Dave Riller.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | David C. Self.html | 2021-04-09 11:12 | 364 | |
![[TXT]](/icons/text.gif) | David Mertz.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | David Speyrer.html | 2021-04-09 11:12 | 36K | |
![[TXT]](/icons/text.gif) | Day One.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Deaf.html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | Deathmatch (disambiguation).html | 2021-04-09 11:12 | 629 | |
![[TXT]](/icons/text.gif) | Deathmatch.html | 2021-04-09 11:12 | 125 | |
![[TXT]](/icons/text.gif) | Deathmatch Classic.html | 2021-04-09 11:12 | 5.4K | |
![[TXT]](/icons/text.gif) | Decay.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Deckard8t88.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Dee Bradley Baker.html | 2021-04-09 11:12 | 885 | |
![[TXT]](/icons/text.gif) | Defective Aperture Science Sentry Turret.html | 2021-04-09 11:12 | 180 | |
![[TXT]](/icons/text.gif) | Defective Turret.html | 2021-04-09 11:12 | 6.4K | |
![[TXT]](/icons/text.gif) | Deletion.html | 2021-04-09 11:12 | 178 | |
![[TXT]](/icons/text.gif) | Deliverance.html | 2021-04-09 11:12 | 129 | |
![[TXT]](/icons/text.gif) | Delivery cart.html | 2021-04-09 11:12 | 6.4K | |
![[TXT]](/icons/text.gif) | Depot.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | Desert Eagle.html | 2021-04-09 11:12 | 7.1K | |
![[TXT]](/icons/text.gif) | Desert Launcher.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | Deupree.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | Developer commentary.html | 2021-04-09 11:12 | 168 | |
![[TXT]](/icons/text.gif) | Development of Half-Life 2.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | Dhabih Eng.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Diablo.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Diesel generator.html | 2021-04-09 11:12 | 26K | |
![[TXT]](/icons/text.gif) | Different Turret.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Digger.html | 2021-04-09 11:12 | 4.9K | |
![[TXT]](/icons/text.gif) | Dimensional rift.html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | Dino.html | 2021-04-09 11:12 | 6.1K | |
![[TXT]](/icons/text.gif) | Dinosaur.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Direct Intervention.html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | Directed Design Experiments.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Disambig.html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | Discouragement Redirection Cube.html | 2021-04-09 11:12 | 155 | |
![[TXT]](/icons/text.gif) | Dispatcher.html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | Dispenser.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | Displacement.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Displacement Beacon Focus Emitter.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Displacer.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Displacer Cannon.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | Diversity.html | 2021-04-09 11:12 | 3.8K | |
![[TXT]](/icons/text.gif) | Diversity Vent.html | 2021-04-09 11:12 | 8.7K | |
![[TXT]](/icons/text.gif) | Dock 137.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | Dockyards Station.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Doctor Breen.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Doctor Colette Green.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Doctor Eli Vance.html | 2021-04-09 11:12 | 830 | |
![[TXT]](/icons/text.gif) | Doctor Freeman.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Doctor Gina Cross.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Doctor Isaac Kleiner.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Doctor Judith Mossman.html | 2021-04-09 11:12 | 157 | |
![[TXT]](/icons/text.gif) | Doctor Kleiner.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Doctor Magnusson.html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | Doctor Mossman.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Doctor Richard Keller.html | 2021-04-09 11:12 | 154 | |
![[TXT]](/icons/text.gif) | Doctor Rosenberg.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Doctor Vance.html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | Doctor Wallace Breen.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Documents.html | 2021-04-09 11:12 | 1.5K | |
![[TXT]](/icons/text.gif) | Dodge Charger.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Dog (Half-Life 2).html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | Dog.html | 2021-04-09 11:12 | 22K | |
![[TXT]](/icons/text.gif) | Domestic Violence.html | 2021-04-09 11:12 | 193 | |
![[TXT]](/icons/text.gif) | Donaldson.html | 2021-04-09 11:12 | 427 | |
![[TXT]](/icons/text.gif) | Door Tower.html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | Doug Hopper.html | 2021-04-09 11:12 | 362 | |
![[TXT]](/icons/text.gif) | Doug Lombardi.html | 2021-04-09 11:12 | 2.3K | |
![[TXT]](/icons/text.gif) | Doug Rattmann.html | 2021-04-09 11:12 | 32K | |
![[TXT]](/icons/text.gif) | Doug Wood.html | 2021-04-09 11:12 | 27K | |
![[TXT]](/icons/text.gif) | Douglas R. Wood.html | 2021-04-09 11:12 | 3.4K | |
![[TXT]](/icons/text.gif) | Dove.html | 2021-04-09 11:12 | 9.4K | |
![[TXT]](/icons/text.gif) | Dr. Breen's Private Reserve.html | 2021-04-09 11:12 | 8.2K | |
![[TXT]](/icons/text.gif) | Dr. Breen.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Dr. Colette Green.html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | Dr. Eli Vance.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Dr. Freeman.html | 2021-04-09 11:12 | 7.6K | |
![[TXT]](/icons/text.gif) | Dr. Gina Cross.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Dr. Gordon Freeman.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Dr. Isaac Kleiner.html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | Dr. Judith Mossman.html | 2021-04-09 11:12 | 154 | |
![[TXT]](/icons/text.gif) | Dr. Keller.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Dr. Kleiner.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Dr.Kleiner.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Dr. Mossman.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Dr. Richard Keller.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Dr. Rosenberg.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | Dr. Rosenburg.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Dr. Wallace Breen.html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | Dr Breen.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Dr Rosenberg.html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | Drainage Canal.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | Drawbridge.html | 2021-04-09 11:12 | 2.4K | |
![[TXT]](/icons/text.gif) | Dropship.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Dropship Container.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Dual Access.html | 2021-04-09 11:12 | 183 | |
![[TXT]](/icons/text.gif) | Dune buggy.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Dunn.html | 2021-04-09 11:12 | 1.6K | |
![[TXT]](/icons/text.gif) | Duty Calls.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Dwight T. Barnes.html | 2021-04-09 11:12 | 2.6K | |
![[TXT]](/icons/text.gif) | Dynamite.html | 2021-04-09 11:12 | 4.6K | |
![[TXT]](/icons/text.gif) | Dyson Poincaré.html | 2021-04-09 11:12 | 173 | |
![[TXT]](/icons/text.gif) | Dyson Poincare.html | 2021-04-09 11:12 | 172 | |
![[TXT]](/icons/text.gif) | E3.html | 2021-04-09 11:12 | 114 | |
![[TXT]](/icons/text.gif) | E3 2003.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | E3 industrial.html | 2021-04-09 11:12 | 760 | |
![[TXT]](/icons/text.gif) | E3 terminal.html | 2021-04-09 11:12 | 179 | |
![[TXT]](/icons/text.gif) | EMP Tool.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | EP-0021.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | EP1.html | 2021-04-09 11:12 | 157 | |
![[TXT]](/icons/text.gif) | EP2.html | 2021-04-09 11:12 | 157 | |
![[TXT]](/icons/text.gif) | Eagle.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Earth.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | Earth Resistance.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Earth creatures.html | 2021-04-09 11:12 | 24K | |
![[TXT]](/icons/text.gif) | Earth occupation.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | East Personnel Entrance.html | 2021-04-09 11:12 | 154 | |
![[TXT]](/icons/text.gif) | Edgeless Safety Cube.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | Edgeless Safety Cube Receptacle.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | Edificatory lifeswivel story told through game by VALVers.html | 2021-04-09 11:12 | 3.4K | |
![[TXT]](/icons/text.gif) | Egon Gun.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Elaine.html | 2021-04-09 11:12 | 22K | |
![[TXT]](/icons/text.gif) | Elaine Mossman.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Electric Trap.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Eli's Lab.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Eli's den.html | 2021-04-09 11:12 | 123 | |
![[TXT]](/icons/text.gif) | Eli.html | 2021-04-09 11:12 | 129 | |
![[TXT]](/icons/text.gif) | Eli Maxwell.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | Eli Vance.html | 2021-04-09 11:12 | 29K | |
![[TXT]](/icons/text.gif) | Elite.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Elite Combine.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | Elite Metro Cop.html | 2021-04-09 11:12 | 175 | |
![[TXT]](/icons/text.gif) | Elite Metrocop.html | 2021-04-09 11:12 | 174 | |
![[TXT]](/icons/text.gif) | Elite Soldier.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Ellen McLain.html | 2021-04-09 11:12 | 5.2K | |
![[TXT]](/icons/text.gif) | Emergency Flare (cut item).html | 2021-04-09 11:12 | 164 | |
![[TXT]](/icons/text.gif) | Emergency Intelligence Incinerator.html | 2021-04-09 11:12 | 173 | |
![[TXT]](/icons/text.gif) | Emergency flare.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | Emily Naransky.html | 2021-04-09 11:12 | 369 | |
![[TXT]](/icons/text.gif) | Emitter.html | 2021-04-09 11:12 | 757 | |
![[TXT]](/icons/text.gif) | Emplacement Gun.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Employee Daycare Center.html | 2021-04-09 11:12 | 3.2K | |
![[TXT]](/icons/text.gif) | Endgame.html | 2021-04-09 11:12 | 7.1K | |
![[TXT]](/icons/text.gif) | Energy Ball.html | 2021-04-09 11:12 | 5.0K | |
![[TXT]](/icons/text.gif) | Energy Grenade.html | 2021-04-09 11:12 | 1.5K | |
![[TXT]](/icons/text.gif) | Energy Orb.html | 2021-04-09 11:12 | 686 | |
![[TXT]](/icons/text.gif) | Engineer.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Enrichment.html | 2021-04-09 11:12 | 186 | |
![[TXT]](/icons/text.gif) | Enrichment Center.html | 2021-04-09 11:12 | 682 | |
![[TXT]](/icons/text.gif) | Enrichment Center Test Subject Application.html | 2021-04-09 11:12 | 2.4K | |
![[TXT]](/icons/text.gif) | Enrichment Center Test Subject Application Process.html | 2021-04-09 11:12 | 103K | |
![[TXT]](/icons/text.gif) | Enrichment Shaft.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Enrichment Shafts.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Enrichment Sphere.html | 2021-04-09 11:12 | 159 | |
![[TXT]](/icons/text.gif) | Entanglement.html | 2021-04-09 11:12 | 121 | |
![[TXT]](/icons/text.gif) | Episode 1.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | Episode 2.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | Episode 3.html | 2021-04-09 11:12 | 127 | |
![[TXT]](/icons/text.gif) | Episode 4.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Episode Four.html | 2021-04-09 11:12 | 585 | |
![[TXT]](/icons/text.gif) | Episode One.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | Episode Three.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | Episode Two.html | 2021-04-09 11:12 | 716 | |
![[TXT]](/icons/text.gif) | Episode one storyline.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Episodes.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Episode two storyline.html | 2021-04-09 11:12 | 24K | |
![[TXT]](/icons/text.gif) | Eric Kirchmer.html | 2021-04-09 11:12 | 7.1K | |
![[TXT]](/icons/text.gif) | Erik Wolpaw.html | 2021-04-09 11:12 | 3.5K | |
![[TXT]](/icons/text.gif) | Escape.html | 2021-04-09 11:12 | 871 | |
![[TXT]](/icons/text.gif) | Escape from City-17.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | Escape from City 17.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Excursion Funnel.html | 2021-04-09 11:12 | 190 | |
![[TXT]](/icons/text.gif) | Exile Vilify.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | Exit 17.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | Extended Relaxation Annex.html | 2021-04-09 11:12 | 155 | |
![[TXT]](/icons/text.gif) | Extended Relaxation Center.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Eye Scanner.html | 2021-04-09 11:12 | 9.1K | |
![[TXT]](/icons/text.gif) | F-16.html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | F-16 Fighting Falcon.html | 2021-04-09 11:12 | 2.6K | |
![[TXT]](/icons/text.gif) | F-117 Nighthawk.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | F-Stop.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | FIM-92 Stinger.html | 2021-04-09 11:12 | 3.6K | |
![[TXT]](/icons/text.gif) | Fact Core.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Factual Core.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Faith Plate.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | FakeFactory's Cinematic Mod.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | Fakefactory.html | 2021-04-09 11:12 | 939 | |
![[TXT]](/icons/text.gif) | Fase.html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | Fast Headcrab.html | 2021-04-09 11:12 | 5.7K | |
![[TXT]](/icons/text.gif) | Fast Walker.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | Fast Zombie.html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | Fast headcrab zombie.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Fat Lady.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Father Gregori.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Father Grigori.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Featured.html | 2021-04-09 11:12 | 24K | |
![[TXT]](/icons/text.gif) | Featured article.html | 2021-04-09 11:12 | 174 | |
![[TXT]](/icons/text.gif) | Featured article queue.html | 2021-04-09 11:12 | 190 | |
![[TXT]](/icons/text.gif) | Featured articles.html | 2021-04-09 11:12 | 175 | |
![[TXT]](/icons/text.gif) | Female Assassin (disambiguation).html | 2021-04-09 11:12 | 353 | |
![[TXT]](/icons/text.gif) | Female Assassin.html | 2021-04-09 11:12 | 135 | |
![[TXT]](/icons/text.gif) | Field bridge.html | 2021-04-09 11:12 | 2.6K | |
![[TXT]](/icons/text.gif) | Fire Extinguisher.html | 2021-04-09 11:12 | 6.8K | |
![[TXT]](/icons/text.gif) | First Slice.html | 2021-04-09 11:12 | 2.6K | |
![[TXT]](/icons/text.gif) | Fisherman.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Fizzler.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Flare.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Flare Gun.html | 2021-04-09 11:12 | 135 | |
![[TXT]](/icons/text.gif) | Flaregun.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Flash Grenade.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Flashlight (Blue Shift).html | 2021-04-09 11:12 | 7.1K | |
![[TXT]](/icons/text.gif) | Flocking Floater.html | 2021-04-09 11:12 | 6.0K | |
![[TXT]](/icons/text.gif) | Floor Turret.html | 2021-04-09 11:12 | 6.8K | |
![[TXT]](/icons/text.gif) | Flyer.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Focal Point.html | 2021-04-09 11:12 | 135 | |
![[TXT]](/icons/text.gif) | Follow Freeman.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Following.html | 2021-04-09 11:12 | 25K | |
![[TXT]](/icons/text.gif) | Food Dispenser.html | 2021-04-09 11:12 | 5.1K | |
![[TXT]](/icons/text.gif) | Force Field.html | 2021-04-09 11:12 | 3.0K | |
![[TXT]](/icons/text.gif) | Forcefield.html | 2021-04-09 11:12 | 2.3K | |
![[TXT]](/icons/text.gif) | Forcefield Generator.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Ford F-250 (truck001a).html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Forget About Freeman.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Forum.html | 2021-04-09 11:12 | 681 | |
![[TXT]](/icons/text.gif) | ForumA Headcrab in Portal 2.html | 2021-04-09 11:12 | 824 | |
![[TXT]](/icons/text.gif) | ForumAS 1983 Calendar.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | ForumAbout April Fools' Day.html | 2021-04-09 11:12 | 218 | |
![[TXT]](/icons/text.gif) | ForumAbout take-a-wish foundation.html | 2021-04-09 11:12 | 535 | |
![[TXT]](/icons/text.gif) | ForumAbout the game chapters.html | 2021-04-09 11:12 | 488 | |
![[TXT]](/icons/text.gif) | ForumAchievements.html | 2021-04-09 11:12 | 3.5K | |
![[TXT]](/icons/text.gif) | ForumAchievement system.html | 2021-04-09 11:12 | 5.8K | |
![[TXT]](/icons/text.gif) | ForumA couple of style suggestions.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | ForumA different guess on WHAT the G-man is...html | 2021-04-09 11:12 | 4.6K | |
![[TXT]](/icons/text.gif) | ForumAdrian Shepard in HL2 Ep.3.html | 2021-04-09 11:12 | 658 | |
![[TXT]](/icons/text.gif) | ForumA lightbulb just clicked on.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | ForumAlyx's reaction to Zombies and Stalkers.html | 2021-04-09 11:12 | 3.6K | |
![[TXT]](/icons/text.gif) | ForumAn Episode 3 Theory Video.html | 2021-04-09 11:12 | 544 | |
![[TXT]](/icons/text.gif) | ForumAnnabelle's base gun.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | ForumAnnabelle is a Model 1892.html | 2021-04-09 11:12 | 3.0K | |
![[TXT]](/icons/text.gif) | ForumAnyone intrested in Half-Life, Portal, and TF fanon wiki.html | 2021-04-09 11:12 | 69K | |
![[TXT]](/icons/text.gif) | ForumAny suggestions.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | ForumAperture Labs' structure.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | ForumAperture Science CEO.html | 2021-04-09 11:12 | 7.0K | |
![[TXT]](/icons/text.gif) | ForumAperture Timeline Retcon Most are Missing.html | 2021-04-09 11:12 | 8.9K | |
![[TXT]](/icons/text.gif) | ForumAperture and the Combine.html | 2021-04-09 11:12 | 3.5K | |
![[TXT]](/icons/text.gif) | ForumArctic Outpost.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | ForumAre gargantuas sentient.html | 2021-04-09 11:12 | 9.3K | |
![[TXT]](/icons/text.gif) | ForumAren't d3 citadel 02 and ep1 citadel 02 the same map.html | 2021-04-09 11:12 | 697 | |
![[TXT]](/icons/text.gif) | ForumAre the current administrators still around.html | 2021-04-09 11:12 | 2.3K | |
![[TXT]](/icons/text.gif) | ForumArticle Formatting Wiki Clean up.html | 2021-04-09 11:12 | 6.5K | |
![[TXT]](/icons/text.gif) | ForumArticle about online videos.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | ForumArticles of ambiguous canonicity.html | 2021-04-09 11:12 | 830 | |
![[TXT]](/icons/text.gif) | ForumAtlas and P-Body.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | ForumBackground image.html | 2021-04-09 11:12 | 3.1K | |
![[TXT]](/icons/text.gif) | ForumBattle articles.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | ForumBeta Project.html | 2021-04-09 11:12 | 9.8K | |
![[TXT]](/icons/text.gif) | ForumBeta story line, some suggestions.html | 2021-04-09 11:12 | 56K | |
![[TXT]](/icons/text.gif) | ForumBlack Mesa - no more.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | ForumBlack Mesa Scientist.html | 2021-04-09 11:12 | 5.7K | |
![[TXT]](/icons/text.gif) | ForumBlack Mesa can kiss my bankrupt....html | 2021-04-09 11:12 | 4.9K | |
![[TXT]](/icons/text.gif) | ForumBring Beta Back HL2.html | 2021-04-09 11:12 | 3.9K | |
![[TXT]](/icons/text.gif) | ForumBroken images.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | ForumCAN WE GOT THIS SORTED OUT PLEASE.html | 2021-04-09 11:12 | 6.9K | |
![[TXT]](/icons/text.gif) | ForumCMB and its true meaning....html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | ForumCan Anyone help to clean things that I have created the Mod page..html | 2021-04-09 11:12 | 19K | |
![[TXT]](/icons/text.gif) | ForumCanal Skulls.html | 2021-04-09 11:12 | 2.4K | |
![[TXT]](/icons/text.gif) | ForumCan fast headcrabs and poison headcrabs be domesticated.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | ForumCan someone screen-capture the Useless Blueprints V-237.html | 2021-04-09 11:12 | 562 | |
![[TXT]](/icons/text.gif) | ForumCave=Ratman.html | 2021-04-09 11:12 | 3.8K | |
![[TXT]](/icons/text.gif) | ForumChell's origins.html | 2021-04-09 11:12 | 2.6K | |
![[TXT]](/icons/text.gif) | ForumChell IS Cave's daughter.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | ForumChell a possible Prisoner.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | ForumChell being mute.html | 2021-04-09 11:12 | 5.4K | |
![[TXT]](/icons/text.gif) | ForumChell page portrait.html | 2021-04-09 11:12 | 271 | |
![[TXT]](/icons/text.gif) | ForumCleaning administrative house.html | 2021-04-09 11:12 | 2.4K | |
![[TXT]](/icons/text.gif) | ForumCollectibles.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | ForumCombine Hunters may be modified Vortigaunts.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | ForumCombine Overwiki.html | 2021-04-09 11:12 | 461 | |
![[TXT]](/icons/text.gif) | ForumCombine do not use enough human technology.html | 2021-04-09 11:12 | 22K | |
![[TXT]](/icons/text.gif) | ForumCongrats.html | 2021-04-09 11:12 | 369 | |
![[TXT]](/icons/text.gif) | ForumCreepy Cave Johnson quote.html | 2021-04-09 11:12 | 679 | |
![[TXT]](/icons/text.gif) | ForumCreepy Cave Lohnson quote.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | ForumCut,UIdentified car.html | 2021-04-09 11:12 | 3.2K | |
![[TXT]](/icons/text.gif) | ForumCut weapons.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | ForumDaughter of Cave and Caroline.html | 2021-04-09 11:12 | 30K | |
![[TXT]](/icons/text.gif) | ForumDisputing timelines Aperture Science.html | 2021-04-09 11:12 | 5.3K | |
![[TXT]](/icons/text.gif) | ForumDitto.html | 2021-04-09 11:12 | 35K | |
![[TXT]](/icons/text.gif) | ForumDodging the train.html | 2021-04-09 11:12 | 4.6K | |
![[TXT]](/icons/text.gif) | ForumDon't know how to delete my user account.....html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | ForumDoom MODs with HL references..html | 2021-04-09 11:12 | 48K | |
![[TXT]](/icons/text.gif) | ForumDrop-down menus on the wiki.html | 2021-04-09 11:12 | 869 | |
![[TXT]](/icons/text.gif) | ForumEP3 Wishes.html | 2021-04-09 11:12 | 8.7K | |
![[TXT]](/icons/text.gif) | ForumEllen McLain.html | 2021-04-09 11:12 | 924 | |
![[TXT]](/icons/text.gif) | ForumEpisode 2 article info.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | ForumEscape From City 17 - Part One.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | ForumExtremely hard ammo to get.html | 2021-04-09 11:12 | 31K | |
![[TXT]](/icons/text.gif) | ForumFALSE proven theories.html | 2021-04-09 11:12 | 5.9K | |
![[TXT]](/icons/text.gif) | ForumFacebook.html | 2021-04-09 11:12 | 2.6K | |
![[TXT]](/icons/text.gif) | ForumFailure to Preserve Critical Personal.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | ForumFake Episode Three Borealis Demo.html | 2021-04-09 11:12 | 5.3K | |
![[TXT]](/icons/text.gif) | ForumFeatured articles.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | ForumFinal theories on The G-Man.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | ForumFirst Aperture tests took place in the 60's, not 50's.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | ForumFirst Half-Life Experience.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | ForumFormatting.html | 2021-04-09 11:12 | 613 | |
![[TXT]](/icons/text.gif) | ForumFrom Human to Core.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | ForumG-man's own show.html | 2021-04-09 11:12 | 1.5K | |
![[TXT]](/icons/text.gif) | ForumG Man theories.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | ForumGaming wiki chat this Sunday.html | 2021-04-09 11:12 | 826 | |
![[TXT]](/icons/text.gif) | ForumGarry's Mod.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | ForumGman's Purpose.html | 2021-04-09 11:12 | 3.2K | |
![[TXT]](/icons/text.gif) | ForumG man is Gordon.html | 2021-04-09 11:12 | 6.0K | |
![[TXT]](/icons/text.gif) | ForumGmod help.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | ForumGoodbye my only friend.html | 2021-04-09 11:12 | 3.9K | |
![[TXT]](/icons/text.gif) | ForumGordon Freeman Theory.html | 2021-04-09 11:12 | 29K | |
![[TXT]](/icons/text.gif) | ForumGordon Freeman VS Elite Hybrid.html | 2021-04-09 11:12 | 540 | |
![[TXT]](/icons/text.gif) | ForumGordon Freeman better than Master Chief Yes or no.html | 2021-04-09 11:12 | 32K | |
![[TXT]](/icons/text.gif) | ForumGordon Has No Helmet.html | 2021-04-09 11:12 | 8.6K | |
![[TXT]](/icons/text.gif) | ForumGravity Gun Portal Gun Fight and the answer to Chell's background.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | ForumHEV Suit reference.html | 2021-04-09 11:12 | 82K | |
![[TXT]](/icons/text.gif) | ForumHL1 expanison play as Black Op.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | ForumHL2 Questions.html | 2021-04-09 11:12 | 9.8K | |
![[TXT]](/icons/text.gif) | ForumHL3 and the Wiki.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | ForumHLification.html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | ForumHalf-Life ² Beta.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | ForumHalf-Life 2 Deathmatch npc sounds.html | 2021-04-09 11:12 | 637 | |
![[TXT]](/icons/text.gif) | ForumHalf-Life 2 original journey.html | 2021-04-09 11:12 | 6.7K | |
![[TXT]](/icons/text.gif) | ForumHalf-Life ARG.html | 2021-04-09 11:12 | 8.5K | |
![[TXT]](/icons/text.gif) | ForumHalf-Life Forums.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | ForumHalf-Life Groups.html | 2021-04-09 11:12 | 797 | |
![[TXT]](/icons/text.gif) | ForumHalf-Life Manuals.html | 2021-04-09 11:12 | 550 | |
![[TXT]](/icons/text.gif) | ForumHalf-Life Series Mass Runthrough for Episode 3.html | 2021-04-09 11:12 | 1.6K | |
![[TXT]](/icons/text.gif) | ForumHalf Life 2 annoyance.html | 2021-04-09 11:12 | 614 | |
![[TXT]](/icons/text.gif) | ForumHalf Life Source Problems and ideas for Xbox 360 controls.html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | ForumHalf life uplink film.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | ForumHas anyone considered that Gordon Freeman might be....html | 2021-04-09 11:12 | 3.2K | |
![[TXT]](/icons/text.gif) | ForumHelp page on translation.html | 2021-04-09 11:12 | 5.8K | |
![[TXT]](/icons/text.gif) | ForumHow Gordon does carry all his weapons .html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | ForumHow The Thermal Discouragement Beams work.html | 2021-04-09 11:12 | 900 | |
![[TXT]](/icons/text.gif) | ForumHow long 'till I can edit a semi-protected page.html | 2021-04-09 11:12 | 1.5K | |
![[TXT]](/icons/text.gif) | ForumI am confused about lamarr.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | ForumIdea - Recent talk changes.html | 2021-04-09 11:12 | 868 | |
![[TXT]](/icons/text.gif) | ForumImpossible spaces.html | 2021-04-09 11:12 | 5.2K | |
![[TXT]](/icons/text.gif) | ForumIn-universe style or strategy guide style.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | ForumIncindiary Lemons and GLaDOS's Taste for Revenge.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | ForumIndex.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | ForumIndustrial Espionage and the Two Competing Facilities.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | ForumInitial Encounter.html | 2021-04-09 11:12 | 8.5K | |
![[TXT]](/icons/text.gif) | ForumInstitutions in the HLU.html | 2021-04-09 11:12 | 4.7K | |
![[TXT]](/icons/text.gif) | ForumIs Half Life 1 Black Operation possible.html | 2021-04-09 11:12 | 867 | |
![[TXT]](/icons/text.gif) | ForumIs it just me or....html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | ForumI think I know why the G-Man nuked Black Mesa.html | 2021-04-09 11:12 | 6.2K | |
![[TXT]](/icons/text.gif) | ForumJust Wondering....html | 2021-04-09 11:12 | 506 | |
![[TXT]](/icons/text.gif) | ForumJust some Half-Life 3 news to share with you..html | 2021-04-09 11:12 | 656 | |
![[TXT]](/icons/text.gif) | ForumLeadership issues.html | 2021-04-09 11:12 | 2.3K | |
![[TXT]](/icons/text.gif) | ForumLego Half-Life Adaptation .html | 2021-04-09 11:12 | 655 | |
![[TXT]](/icons/text.gif) | ForumLevels category.html | 2021-04-09 11:12 | 4.7K | |
![[TXT]](/icons/text.gif) | ForumLife Weaving.html | 2021-04-09 11:12 | 4.9K | |
![[TXT]](/icons/text.gif) | ForumLogo.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | ForumLong jump.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | ForumMake pages editable only by Registered Users.html | 2021-04-09 11:12 | 2.9K | |
![[TXT]](/icons/text.gif) | ForumMapsheets.html | 2021-04-09 11:12 | 2.1K | |
![[TXT]](/icons/text.gif) | ForumMarch Mayhem.html | 2021-04-09 11:12 | 2.1K | |
![[TXT]](/icons/text.gif) | ForumMilitary Androids really GLaDOS 3.11.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | ForumMilitary conflicts.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | ForumMiller.html | 2021-04-09 11:12 | 555 | |
![[TXT]](/icons/text.gif) | ForumMonaco skin.html | 2021-04-09 11:12 | 3.1K | |
![[TXT]](/icons/text.gif) | ForumMr. Friendly's sexual innuendo.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | ForumName of Machines and Synths.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | ForumNeed help with a cheat.html | 2021-04-09 11:12 | 4.6K | |
![[TXT]](/icons/text.gif) | ForumNew Official Cube found in a Portal 2 Educational walkthrough.html | 2021-04-09 11:12 | 771 | |
![[TXT]](/icons/text.gif) | ForumNew Portal 2 Easter Egg.html | 2021-04-09 11:12 | 434 | |
![[TXT]](/icons/text.gif) | ForumNew Sidebar Element Being Tested.html | 2021-04-09 11:12 | 1.5K | |
![[TXT]](/icons/text.gif) | ForumNew design.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | ForumNew infoboxes.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | ForumNew skin.html | 2021-04-09 11:12 | 8.2K | |
![[TXT]](/icons/text.gif) | ForumNew wiki name.html | 2021-04-09 11:12 | 523 | |
![[TXT]](/icons/text.gif) | ForumNo battles pages.html | 2021-04-09 11:12 | 1.8K | |
![[TXT]](/icons/text.gif) | ForumNo more Sector W.html | 2021-04-09 11:12 | 3.0K | |
![[TXT]](/icons/text.gif) | ForumNotability of the Beta stuff.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | ForumNuclear weapons and HL2.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | ForumObsidian Conflict.html | 2021-04-09 11:12 | 926 | |
![[TXT]](/icons/text.gif) | ForumOpposition or Blue Decay.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | ForumOverwatch Index.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | ForumOverwatch Index archive.html | 2021-04-09 11:12 | 4.6K | |
![[TXT]](/icons/text.gif) | ForumOverwatch Question.html | 2021-04-09 11:12 | 566 | |
![[TXT]](/icons/text.gif) | ForumOverwatch squad names.html | 2021-04-09 11:12 | 3.5K | |
![[TXT]](/icons/text.gif) | ForumPanels.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | ForumPlanetPhillip quiz team.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | ForumPlease Help.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | ForumPlural for combine.html | 2021-04-09 11:12 | 4.9K | |
![[TXT]](/icons/text.gif) | ForumPortal 2 Vids.html | 2021-04-09 11:12 | 5.1K | |
![[TXT]](/icons/text.gif) | ForumPortal 2 Who is the voiceA.I. active before GLaDOS is reactivated.html | 2021-04-09 11:12 | 572 | |
![[TXT]](/icons/text.gif) | ForumPortal 2 chars.html | 2021-04-09 11:12 | 1.8K | |
![[TXT]](/icons/text.gif) | ForumPortal 2 timeline help.html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | ForumPortal Storms.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | ForumPortal Teaser Theory.html | 2021-04-09 11:12 | 4.9K | |
![[TXT]](/icons/text.gif) | ForumPossible Location of the Aperature Science Enrichment Center..html | 2021-04-09 11:12 | 652 | |
![[TXT]](/icons/text.gif) | ForumPossible hint at phone number in episode 2.html | 2021-04-09 11:12 | 792 | |
![[TXT]](/icons/text.gif) | ForumQuotes.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | ForumRace Consistency.html | 2021-04-09 11:12 | 5.5K | |
![[TXT]](/icons/text.gif) | ForumRace X.html | 2021-04-09 11:12 | 4.8K | |
![[TXT]](/icons/text.gif) | ForumReal Or as the Boomer says FAKE.html | 2021-04-09 11:12 | 164 | |
![[TXT]](/icons/text.gif) | ForumReal Or as the Newell says FAKE.html | 2021-04-09 11:12 | 5.0K | |
![[TXT]](/icons/text.gif) | ForumRebel Health.html | 2021-04-09 11:12 | 5.8K | |
![[TXT]](/icons/text.gif) | ForumRedirect portal.wikia.com to here.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | ForumRelation between Aperture Aperture Science and the Xen.html | 2021-04-09 11:12 | 496 | |
![[TXT]](/icons/text.gif) | ForumResistance categories.html | 2021-04-09 11:12 | 3.9K | |
![[TXT]](/icons/text.gif) | ForumReverting back to the Half Life Wiki.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | ForumRock Tree.html | 2021-04-09 11:12 | 1.8K | |
![[TXT]](/icons/text.gif) | ForumScreenshots.html | 2021-04-09 11:12 | 593 | |
![[TXT]](/icons/text.gif) | ForumShould I buy Half Life Blue Shift.html | 2021-04-09 11:12 | 393 | |
![[TXT]](/icons/text.gif) | ForumSo ive been thinking.html | 2021-04-09 11:12 | 19K | |
![[TXT]](/icons/text.gif) | ForumSomething wrong with half life source.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | ForumSplinter Cell Chaos Theory Reference.html | 2021-04-09 11:12 | 856 | |
![[TXT]](/icons/text.gif) | ForumSplit Timeline theory.html | 2021-04-09 11:12 | 31K | |
![[TXT]](/icons/text.gif) | ForumSpoiler Tags.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | ForumSpoilerchell's parent at aperture is her dad.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | ForumSpoilers in infoboxes.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | ForumStandardizing images.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | ForumStandardizing infoboxes and other stuff.html | 2021-04-09 11:12 | 4.6K | |
![[TXT]](/icons/text.gif) | ForumSteam group.html | 2021-04-09 11:12 | 25K | |
![[TXT]](/icons/text.gif) | ForumStrange Portal Update.html | 2021-04-09 11:12 | 760 | |
![[TXT]](/icons/text.gif) | ForumStuff.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | ForumStuff from the Planet Half-Life wiki, written by me.html | 2021-04-09 11:12 | 6.0K | |
![[TXT]](/icons/text.gif) | ForumStyleguide plz.html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | ForumSuppression Fields.html | 2021-04-09 11:12 | 2.4K | |
![[TXT]](/icons/text.gif) | ForumSweet Half-Life & Deliverance.html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | ForumTake your blatant advertising elsewhere.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | ForumTalk page or Message wall.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | ForumTemplate Information.html | 2021-04-09 11:12 | 410 | |
![[TXT]](/icons/text.gif) | ForumTest.html | 2021-04-09 11:12 | 481 | |
![[TXT]](/icons/text.gif) | ForumTest Shaft 09 Investigation.html | 2021-04-09 11:12 | 5.4K | |
![[TXT]](/icons/text.gif) | ForumTest Shaft 9 sealed off in 1991, perhaps.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | ForumThe AR3 What if.html | 2021-04-09 11:12 | 3.2K | |
![[TXT]](/icons/text.gif) | ForumThe Borealis' secret.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | ForumThe Core is a Lie.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | ForumThe First time Login into Fan make Wiki Site.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | ForumThe HeadCrab.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | ForumThe Nihilanth.html | 2021-04-09 11:12 | 5.6K | |
![[TXT]](/icons/text.gif) | ForumThe One Free Bullet.html | 2021-04-09 11:12 | 5.1K | |
![[TXT]](/icons/text.gif) | ForumThe Opposing Force plot makes absolutely no sense to me....html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | ForumThe resemblance probably doesn't mean anything.html | 2021-04-09 11:12 | 24K | |
![[TXT]](/icons/text.gif) | ForumThe role of Advisors within Combine.html | 2021-04-09 11:12 | 4.7K | |
![[TXT]](/icons/text.gif) | ForumTranscript.html | 2021-04-09 11:12 | 422 | |
![[TXT]](/icons/text.gif) | ForumTurning Caroline into GLaDOS.html | 2021-04-09 11:12 | 7.1K | |
![[TXT]](/icons/text.gif) | ForumUnable to upload images.html | 2021-04-09 11:12 | 769 | |
![[TXT]](/icons/text.gif) | ForumUnofficialOfficial Information.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | ForumUsermade Music Video for Want You Gone.html | 2021-04-09 11:12 | 44K | |
![[TXT]](/icons/text.gif) | ForumValve game wikis.html | 2021-04-09 11:12 | 1.8K | |
![[TXT]](/icons/text.gif) | ForumValve needs to speed up.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | ForumVoice actor for Dr. Rosenberg.html | 2021-04-09 11:12 | 765 | |
![[TXT]](/icons/text.gif) | ForumVortigaunt Anatomy.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | ForumWalkthroughs.html | 2021-04-09 11:12 | 5.4K | |
![[TXT]](/icons/text.gif) | ForumWarrior.html | 2021-04-09 11:12 | 1.6K | |
![[TXT]](/icons/text.gif) | ForumWas Cave made into Wheatly.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | ForumWeapons category is in desperate need of a cleanup.html | 2021-04-09 11:12 | 3.5K | |
![[TXT]](/icons/text.gif) | ForumWe have a problem.html | 2021-04-09 11:12 | 3.8K | |
![[TXT]](/icons/text.gif) | ForumWhat Playing Decay Taught Me About Half-Life..html | 2021-04-09 11:12 | 8.6K | |
![[TXT]](/icons/text.gif) | ForumWhat does Vale got against Administrators.html | 2021-04-09 11:12 | 9.1K | |
![[TXT]](/icons/text.gif) | ForumWhat to do with Galleries.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | ForumWhat was the G-Man's motivation to have Shepherd kill the Gene Worm in Opposing Force.html | 2021-04-09 11:12 | 4.9K | |
![[TXT]](/icons/text.gif) | ForumWhat would you do if you were Gordon.html | 2021-04-09 11:12 | 731 | |
![[TXT]](/icons/text.gif) | ForumWhat xen could be.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | ForumWhere are screenshots saved.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | ForumWhere can i find pictures of the claw from portal.html | 2021-04-09 11:12 | 834 | |
![[TXT]](/icons/text.gif) | ForumWho, or what, is Eli Vance.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | ForumWhoah, Whoah, Whoah.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | ForumWho gman is working for and why.html | 2021-04-09 11:12 | 7.7K | |
![[TXT]](/icons/text.gif) | ForumWhy don't we add a Standard Calendar.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | ForumWiki Logo.html | 2021-04-09 11:12 | 646 | |
![[TXT]](/icons/text.gif) | ForumWiki Name.html | 2021-04-09 11:12 | 2.3K | |
![[TXT]](/icons/text.gif) | ForumWiki Policies.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | ForumXen flora.html | 2021-04-09 11:12 | 9.2K | |
![[TXT]](/icons/text.gif) | ForumYabbaMyIcing is repeatedly defacing my edits.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | ForumYou all just discovered girls or something.html | 2021-04-09 11:12 | 5.5K | |
![[TXT]](/icons/text.gif) | ForumZero-point energy (vacuum energy) versus dark energy.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | ForumZombie victims aware I think we need to decide.html | 2021-04-09 11:12 | 2.9K | |
![[TXT]](/icons/text.gif) | Forum talkWho gman is working for and why.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Foxtrot Uniform.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Franken-cube.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Franken-cubes.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Frankenturret.html | 2021-04-09 11:12 | 6.8K | |
![[TXT]](/icons/text.gif) | Fred.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | Freeman's Mind.html | 2021-04-09 11:12 | 54K | |
![[TXT]](/icons/text.gif) | Freeman.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Freeman Pontifex.html | 2021-04-09 11:12 | 185 | |
![[TXT]](/icons/text.gif) | Freemans Mind.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Freight Yard.html | 2021-04-09 11:12 | 4.6K | |
![[TXT]](/icons/text.gif) | Friendly.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Friendly Fire.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Frog.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Frohman.html | 2021-04-09 11:12 | 39K | |
![[TXT]](/icons/text.gif) | Futbol.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Future of the Half-Life and Portal series.html | 2021-04-09 11:12 | 159 | |
![[TXT]](/icons/text.gif) | Future of the Half-Life series.html | 2021-04-09 11:12 | 46K | |
![[TXT]](/icons/text.gif) | Fvox.html | 2021-04-09 11:12 | 5.9K | |
![[TXT]](/icons/text.gif) | G-Man.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | GG-3883.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | GLaDOS' new testing track.html | 2021-04-09 11:12 | 4.9K | |
![[TXT]](/icons/text.gif) | GLaDOS' old testing track.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | GLaDOS's Chamber.html | 2021-04-09 11:12 | 37K | |
![[TXT]](/icons/text.gif) | GLaDOS's Testing Track (Portal).html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | GLaDOS's Testing Track (Portal 2).html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | GLaDOS's new testing track.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | GLaDOS's old testing track.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | GLaDOS' testing track (Portal).html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | GLaDOS' testing track (Portal 2).html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | GLaDOS.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | GLaDOS Chamber.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | GLaDOSScreen images.html | 2021-04-09 11:12 | 29K | |
![[TXT]](/icons/text.gif) | GLaDOSScreens.html | 2021-04-09 11:12 | 161 | |
![[TXT]](/icons/text.gif) | GMC Vandura (van001a).html | 2021-04-09 11:12 | 1.6K | |
![[TXT]](/icons/text.gif) | G Man.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | GMod.html | 2021-04-09 11:12 | 541 | |
![[TXT]](/icons/text.gif) | GR9.html | 2021-04-09 11:12 | 3.2K | |
![[TXT]](/icons/text.gif) | Gabe Newell.html | 2021-04-09 11:12 | 4.8K | |
![[TXT]](/icons/text.gif) | Gaben.html | 2021-04-09 11:12 | 135 | |
![[TXT]](/icons/text.gif) | Gamma Labs.html | 2021-04-09 11:12 | 4.0K | |
![[TXT]](/icons/text.gif) | Garage.html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | Garden Gnome.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Garg.html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | Gargantua.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Garry's Mod.html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | Garrys mod.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Garrysmod.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Gas Trap.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Gasoline Trap.html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | Gate 5.html | 2021-04-09 11:12 | 5.8K | |
![[TXT]](/icons/text.gif) | Gate Five.html | 2021-04-09 11:12 | 852 | |
![[TXT]](/icons/text.gif) | GatewayTest.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | GatewayTest12.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Gauss gun.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Gearbox.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | Gearbox Software.html | 2021-04-09 11:12 | 7.4K | |
![[TXT]](/icons/text.gif) | Gel (disambiguation).html | 2021-04-09 11:12 | 154 | |
![[TXT]](/icons/text.gif) | Gel.html | 2021-04-09 11:12 | 9.0K | |
![[TXT]](/icons/text.gif) | Gels.html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | Gembe.html | 2021-04-09 11:12 | 22K | |
![[TXT]](/icons/text.gif) | Gene Worm.html | 2021-04-09 11:12 | 5.6K | |
![[TXT]](/icons/text.gif) | Generator (disambiguation).html | 2021-04-09 11:12 | 527 | |
![[TXT]](/icons/text.gif) | Generator.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Generator trailer.html | 2021-04-09 11:12 | 159 | |
![[TXT]](/icons/text.gif) | Genetic Lifeform and Disk Operating System.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | Geodome.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Get Your Free TV.html | 2021-04-09 11:12 | 781 | |
![[TXT]](/icons/text.gif) | Get Your Free TVs.html | 2021-04-09 11:12 | 123 | |
![[TXT]](/icons/text.gif) | Gina.html | 2021-04-09 11:12 | 4.9K | |
![[TXT]](/icons/text.gif) | Gina Cross.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Glados' chamber.html | 2021-04-09 11:12 | 159 | |
![[TXT]](/icons/text.gif) | Gladys.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | Glock.html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | Glock 17.html | 2021-04-09 11:12 | 9.5K | |
![[TXT]](/icons/text.gif) | Glock 17 Pistol.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Gluon Gun.html | 2021-04-09 11:12 | 6.3K | |
![[TXT]](/icons/text.gif) | Gman.html | 2021-04-09 11:12 | 127 | |
![[TXT]](/icons/text.gif) | Gnome.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Gold Source.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | Gold Source engine.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | GoldSrc.html | 2021-04-09 11:12 | 8.6K | |
![[TXT]](/icons/text.gif) | Goldsource.html | 2021-04-09 11:12 | 129 | |
![[TXT]](/icons/text.gif) | Goldsrc Engine.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Gonarch's Lair.html | 2021-04-09 11:12 | 170 | |
![[TXT]](/icons/text.gif) | Gonarch.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | Gonome.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | Goose 3.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Goose 7.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | Gordan.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Gordan Freeman.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Gorden.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Gorden Freeman.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Gordon.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Gordon Freeman.html | 2021-04-09 11:12 | 54K | |
![[TXT]](/icons/text.gif) | Gordon Frohman.html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | Grav Gun.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | Gravity gun.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Green.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Greg.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | Greg Coomer.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Grenade (HL1).html | 2021-04-09 11:12 | 113 | |
![[TXT]](/icons/text.gif) | Grenade (HL2).html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Grenade (disambiguation).html | 2021-04-09 11:12 | 682 | |
![[TXT]](/icons/text.gif) | Grenade.html | 2021-04-09 11:12 | 119 | |
![[TXT]](/icons/text.gif) | Grid.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Griggs.html | 2021-04-09 11:12 | 4.9K | |
![[TXT]](/icons/text.gif) | Grigori.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | Grill.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Grub.html | 2021-04-09 11:12 | 5.3K | |
![[TXT]](/icons/text.gif) | Grunt.html | 2021-04-09 11:12 | 179 | |
![[TXT]](/icons/text.gif) | Guard Duty (Blue Shift Source).html | 2021-04-09 11:12 | 119K | |
![[TXT]](/icons/text.gif) | Guard Duty.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Guard tower.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Gulag.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Gunship.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Gunship Bays.html | 2021-04-09 11:12 | 27K | |
![[TXT]](/icons/text.gif) | Gus.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Guthrie (disambiguation).html | 2021-04-09 11:12 | 357 | |
![[TXT]](/icons/text.gif) | Guthrie (scientist).html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | Guthrie (security guard).html | 2021-04-09 11:12 | 1.6K | |
![[TXT]](/icons/text.gif) | Guthrie.html | 2021-04-09 11:12 | 119 | |
![[TXT]](/icons/text.gif) | H&K MP7.html | 2021-04-09 11:12 | 111 | |
![[TXT]](/icons/text.gif) | H.E.V..html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | H.E.V. suit.html | 2021-04-09 11:12 | 132 | |
![[TXT]](/icons/text.gif) | HD.html | 2021-04-09 11:12 | 170 | |
![[TXT]](/icons/text.gif) | HD Pack.html | 2021-04-09 11:12 | 3.2K | |
![[TXT]](/icons/text.gif) | HECU.html | 2021-04-09 11:12 | 175 | |
![[TXT]](/icons/text.gif) | HECU Dam Turret.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | HECU Double Turret.html | 2021-04-09 11:12 | 5.1K | |
![[TXT]](/icons/text.gif) | HECU Engineer.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | HECU Laser Tripmine.html | 2021-04-09 11:12 | 5.9K | |
![[TXT]](/icons/text.gif) | HECU Medic.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | HECU RPG.html | 2021-04-09 11:12 | 6.5K | |
![[TXT]](/icons/text.gif) | HECU Radio.html | 2021-04-09 11:12 | 729 | |
![[TXT]](/icons/text.gif) | HECU SPAS-12.html | 2021-04-09 11:12 | 9.7K | |
![[TXT]](/icons/text.gif) | HECU Sandbag Turret.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | HECU Sentry Gun.html | 2021-04-09 11:12 | 5.3K | |
![[TXT]](/icons/text.gif) | HECU Sentry Turret.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | HECU Sniper.html | 2021-04-09 11:12 | 5.4K | |
![[TXT]](/icons/text.gif) | HECU Sniper Rifle.html | 2021-04-09 11:12 | 8.3K | |
![[TXT]](/icons/text.gif) | HECU Turret.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | HECU vehicles.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | HEV.html | 2021-04-09 11:12 | 127 | |
![[TXT]](/icons/text.gif) | HEV Charger.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | HEV Suit.html | 2021-04-09 11:12 | 132 | |
![[TXT]](/icons/text.gif) | HK-707.html | 2021-04-09 11:12 | 19K | |
![[TXT]](/icons/text.gif) | HL.html | 2021-04-09 11:12 | 128 | |
![[TXT]](/icons/text.gif) | HL2.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | HL2 E1.html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | HL2 E2.html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | HL2 E3.html | 2021-04-09 11:12 | 124 | |
![[TXT]](/icons/text.gif) | HL2 LC.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | HL3.html | 2021-04-09 11:12 | 8.6K | |
![[TXT]](/icons/text.gif) | HLAEAE.html | 2021-04-09 11:12 | 119 | |
![[TXT]](/icons/text.gif) | HLAGF.html | 2021-04-09 11:12 | 175 | |
![[TXT]](/icons/text.gif) | HLBB.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | HLBG.html | 2021-04-09 11:12 | 637 | |
![[TXT]](/icons/text.gif) | HLBITE.html | 2021-04-09 11:12 | 1.5K | |
![[TXT]](/icons/text.gif) | HLBLOCK.html | 2021-04-09 11:12 | 178 | |
![[TXT]](/icons/text.gif) | HL BS.html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | HLBS.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | HLCON.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | HLCONSENSUS.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | HL D.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | HLDBAD.html | 2021-04-09 11:12 | 129 | |
![[TXT]](/icons/text.gif) | HLDDD.html | 2021-04-09 11:12 | 186 | |
![[TXT]](/icons/text.gif) | HLDFTT.html | 2021-04-09 11:12 | 135 | |
![[TXT]](/icons/text.gif) | HLDGTS.html | 2021-04-09 11:12 | 132 | |
![[TXT]](/icons/text.gif) | HLIAR.html | 2021-04-09 11:12 | 901 | |
![[TXT]](/icons/text.gif) | HL LC.html | 2021-04-09 11:12 | 157 | |
![[TXT]](/icons/text.gif) | HLNST.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | HL OF.html | 2021-04-09 11:12 | 176 | |
![[TXT]](/icons/text.gif) | HLRED.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | HL S.html | 2021-04-09 11:12 | 159 | |
![[TXT]](/icons/text.gif) | HLSOCK.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | HLSOCKPUPPET.html | 2021-04-09 11:12 | 171 | |
![[TXT]](/icons/text.gif) | HL U.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | HLUTP.html | 2021-04-09 11:12 | 180 | |
![[TXT]](/icons/text.gif) | HLWikiAdministration.html | 2021-04-09 11:12 | 52K | |
![[TXT]](/icons/text.gif) | HLWikiProjectsPortal.html | 2021-04-09 11:12 | 174 | |
![[TXT]](/icons/text.gif) | HMG.html | 2021-04-09 11:12 | 2.3K | |
![[TXT]](/icons/text.gif) | HMG1.html | 2021-04-09 11:12 | 118 | |
![[TXT]](/icons/text.gif) | Hal Robins.html | 2021-04-09 11:12 | 4.9K | |
![[TXT]](/icons/text.gif) | Half-Life (series).html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | Half-Life.html | 2021-04-09 11:12 | 42K | |
![[TXT]](/icons/text.gif) | Half-Life 1.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Half-Life 1 Alpha.html | 2021-04-09 11:12 | 8.6K | |
![[TXT]](/icons/text.gif) | Half-Life 2.html | 2021-04-09 11:12 | 31K | |
![[TXT]](/icons/text.gif) | Half-Life 2 Aftermath.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Half-Life 2 Alpha.html | 2021-04-09 11:12 | 121 | |
![[TXT]](/icons/text.gif) | Half-Life 2 Beta.html | 2021-04-09 11:12 | 42K | |
![[TXT]](/icons/text.gif) | Half-Life 2 Beta storyline.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Half-Life 2 Deathmatch.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Half-Life 2 Episode 1.html | 2021-04-09 11:12 | 175 | |
![[TXT]](/icons/text.gif) | Half-Life 2 Episode 1 soundtrack.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Half-Life 2 Episode 2.html | 2021-04-09 11:12 | 172 | |
![[TXT]](/icons/text.gif) | Half-Life 2 Episode 2 Soundtrack.html | 2021-04-09 11:12 | 154 | |
![[TXT]](/icons/text.gif) | Half-Life 2 Episode 3.html | 2021-04-09 11:12 | 697 | |
![[TXT]](/icons/text.gif) | Half-Life 2 Episode 4.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Half-Life 2 Episode Four.html | 2021-04-09 11:12 | 5.8K | |
![[TXT]](/icons/text.gif) | Half-Life 2 Episode One.html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | Half-Life 2 Episode One soundtrack.html | 2021-04-09 11:12 | 3.6K | |
![[TXT]](/icons/text.gif) | Half-Life 2 Episode One storyline.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Half-Life 2 Episode Three.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Half-Life 2 Episode Two.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Half-Life 2 Episode Two soundtrack.html | 2021-04-09 11:12 | 4.8K | |
![[TXT]](/icons/text.gif) | Half-Life 2 Episode Two storyline.html | 2021-04-09 11:12 | 19K | |
![[TXT]](/icons/text.gif) | Half-Life 2 Episodes (disambiguation).html | 2021-04-09 11:12 | 2.4K | |
![[TXT]](/icons/text.gif) | Half-Life 2 Episodes.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Half-Life 2 Locations.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Half-Life 2 Lost Coast.html | 2021-04-09 11:12 | 9.4K | |
![[TXT]](/icons/text.gif) | Half-Life 2 Missing Information.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Half-Life 2 Raising the Bar.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Half-Life 2 Survivor.html | 2021-04-09 11:12 | 7.3K | |
![[TXT]](/icons/text.gif) | Half-Life 2 leak.html | 2021-04-09 11:12 | 9.8K | |
![[TXT]](/icons/text.gif) | Half-Life 2 old storyline.html | 2021-04-09 11:12 | 743 | |
![[TXT]](/icons/text.gif) | Half-Life 2 original journey.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Half-Life 2 original plot.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Half-Life 2 original storyline.html | 2021-04-09 11:12 | 26K | |
![[TXT]](/icons/text.gif) | Half-Life 2 soundtrack.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | Half-Life 2 storyline.html | 2021-04-09 11:12 | 23K | |
![[TXT]](/icons/text.gif) | Half-Life 3.html | 2021-04-09 11:12 | 613 | |
![[TXT]](/icons/text.gif) | Half-Life Alpha.html | 2021-04-09 11:12 | 9.0K | |
![[TXT]](/icons/text.gif) | Half-Life Beta.html | 2021-04-09 11:12 | 6.9K | |
![[TXT]](/icons/text.gif) | Half-Life Blue Shift.html | 2021-04-09 11:12 | 27K | |
![[TXT]](/icons/text.gif) | Half-LifeBlue Shift.html | 2021-04-09 11:12 | 1.8K | |
![[TXT]](/icons/text.gif) | Half-Life Blue Shift soundtrack.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | Half-Life Blue Shift storyline.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | Half-Life Day One.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | Half-Life Deathmatch.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Half-Life Deathmatch Source.html | 2021-04-09 11:12 | 3.3K | |
![[TXT]](/icons/text.gif) | Half-Life Decay.html | 2021-04-09 11:12 | 8.2K | |
![[TXT]](/icons/text.gif) | Half-LifeDecay.html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | Half-Life Decay storyline.html | 2021-04-09 11:12 | 8.7K | |
![[TXT]](/icons/text.gif) | Half-Life Episode 3.html | 2021-04-09 11:12 | 4.7K | |
![[TXT]](/icons/text.gif) | Half-Life Episode One.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | Half-Life Escape from City-17.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Half-Life Escape from City 17.html | 2021-04-09 11:12 | 8.6K | |
![[TXT]](/icons/text.gif) | Half-Life Further Data.html | 2021-04-09 11:12 | 3.5K | |
![[TXT]](/icons/text.gif) | Half-Life Further Data V.1.html | 2021-04-09 11:12 | 636 | |
![[TXT]](/icons/text.gif) | Half-Life Generation.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | Half-Life Guard Duty.html | 2021-04-09 11:12 | 168 | |
![[TXT]](/icons/text.gif) | Half-Life High Definition Pack.html | 2021-04-09 11:12 | 8.5K | |
![[TXT]](/icons/text.gif) | Half-Life Initial Encounter.html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | Half-Life Opposing Force.html | 2021-04-09 11:12 | 19K | |
![[TXT]](/icons/text.gif) | Half-LifeOpposing Force.html | 2021-04-09 11:12 | 179 | |
![[TXT]](/icons/text.gif) | Half-Life Opposing Force soundtrack.html | 2021-04-09 11:12 | 3.0K | |
![[TXT]](/icons/text.gif) | Half-Life Opposing Force storyline.html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | Half-Life Preliminary Findings.html | 2021-04-09 11:12 | 3.5K | |
![[TXT]](/icons/text.gif) | Half-Life Preliminary Findings CD.html | 2021-04-09 11:12 | 201 | |
![[TXT]](/icons/text.gif) | Half-Life SDK.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Half-Life Singularity Collapse.html | 2021-04-09 11:12 | 2.9K | |
![[TXT]](/icons/text.gif) | Half-Life Source.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | Half-Life Uplink (film).html | 2021-04-09 11:12 | 5.3K | |
![[TXT]](/icons/text.gif) | Half-Life Uplink.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Half-Life Wiki.html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | Half-Life WikiAWB.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Half-Life WikiAbout.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Half-Life WikiAdministration.html | 2021-04-09 11:12 | 3.6K | |
![[TXT]](/icons/text.gif) | Half-Life WikiAdministrators.html | 2021-04-09 11:12 | 180 | |
![[TXT]](/icons/text.gif) | Half-Life WikiAll editors are equal.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | Half-Life WikiAssume good faith.html | 2021-04-09 11:12 | 165 | |
![[TXT]](/icons/text.gif) | Half-Life WikiAutoconfirmed users.html | 2021-04-09 11:12 | 185 | |
![[TXT]](/icons/text.gif) | Half-Life WikiBe bold.html | 2021-04-09 11:12 | 155 | |
![[TXT]](/icons/text.gif) | Half-Life WikiBlocking guidelines.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | Half-Life WikiBureaucrats.html | 2021-04-09 11:12 | 175 | |
![[TXT]](/icons/text.gif) | Half-Life WikiCanon.html | 2021-04-09 11:12 | 7.8K | |
![[TXT]](/icons/text.gif) | Half-Life WikiChatLogs.html | 2021-04-09 11:12 | 656 | |
![[TXT]](/icons/text.gif) | Half-Life WikiChatLogs18 April 2012.html | 2021-04-09 11:12 | 8.7K | |
![[TXT]](/icons/text.gif) | Half-Life WikiChatLogs19 April 2012.html | 2021-04-09 11:12 | 29K | |
![[TXT]](/icons/text.gif) | Half-Life WikiChatLogs20 April 2012.html | 2021-04-09 11:12 | 8.6K | |
![[TXT]](/icons/text.gif) | Half-Life WikiChatLogs23 April 2012.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | Half-Life WikiChatLogs24 July 2012.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Half-Life WikiChatLogs25 July 2012.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | Half-Life WikiChatLogs26 July 2012.html | 2021-04-09 11:12 | 5.4K | |
![[TXT]](/icons/text.gif) | Half-Life WikiCombine Overwiki.html | 2021-04-09 11:12 | 176 | |
![[TXT]](/icons/text.gif) | Half-Life WikiCommunity Portal.html | 2021-04-09 11:12 | 173 | |
![[TXT]](/icons/text.gif) | Half-Life WikiConsensus.html | 2021-04-09 11:12 | 157 | |
![[TXT]](/icons/text.gif) | Half-Life WikiDon't delete discussions.html | 2021-04-09 11:12 | 172 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue.html | 2021-04-09 11:12 | 7.3K | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue1 2010.html | 2021-04-09 11:12 | 972 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue2 2010.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue3 2010.html | 2021-04-09 11:12 | 604 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue4 2010.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue5 2010.html | 2021-04-09 11:12 | 580 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue6 2010.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue7 2010.html | 2021-04-09 11:12 | 726 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue8 2010.html | 2021-04-09 11:12 | 748 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue9 2010.html | 2021-04-09 11:12 | 579 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue10 2010.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue11 2010.html | 2021-04-09 11:12 | 891 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue12 2010.html | 2021-04-09 11:12 | 851 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue13 2010.html | 2021-04-09 11:12 | 800 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue14 2010.html | 2021-04-09 11:12 | 691 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue15 2010.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue16 2010.html | 2021-04-09 11:12 | 542 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue17 2010.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue18 2010.html | 2021-04-09 11:12 | 608 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue19 2010.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue20 2010.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue21 2009.html | 2021-04-09 11:12 | 880 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue21 2010.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue22 2009.html | 2021-04-09 11:12 | 758 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue22 2010.html | 2021-04-09 11:12 | 652 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue23 2009.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue23 2010.html | 2021-04-09 11:12 | 822 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue24 2009.html | 2021-04-09 11:12 | 702 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue24 2010.html | 2021-04-09 11:12 | 538 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue25 2009.html | 2021-04-09 11:12 | 787 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue25 2010.html | 2021-04-09 11:12 | 263 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue26 2009.html | 2021-04-09 11:12 | 810 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue26 2010.html | 2021-04-09 11:12 | 614 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue27 2009.html | 2021-04-09 11:12 | 954 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue27 2010.html | 2021-04-09 11:12 | 263 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue28 2010.html | 2021-04-09 11:12 | 172 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue29 2009.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue29 2010.html | 2021-04-09 11:12 | 263 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue30 2009.html | 2021-04-09 11:12 | 940 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue30 2010.html | 2021-04-09 11:12 | 262 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue31 2009.html | 2021-04-09 11:12 | 851 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue31 2010.html | 2021-04-09 11:12 | 263 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue32 2009.html | 2021-04-09 11:12 | 825 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue32 2010.html | 2021-04-09 11:12 | 942 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue33 2009.html | 2021-04-09 11:12 | 787 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue33 2010.html | 2021-04-09 11:12 | 263 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue34 2009.html | 2021-04-09 11:12 | 937 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue34 2010.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue35 2009.html | 2021-04-09 11:12 | 831 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue35 2010.html | 2021-04-09 11:12 | 263 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue36 2009.html | 2021-04-09 11:12 | 639 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue36 2010.html | 2021-04-09 11:12 | 869 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue37 2009.html | 2021-04-09 11:12 | 639 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue38 2009.html | 2021-04-09 11:12 | 758 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue38 2010.html | 2021-04-09 11:12 | 851 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue39 2009.html | 2021-04-09 11:12 | 865 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue40 2009.html | 2021-04-09 11:12 | 900 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue40 2010.html | 2021-04-09 11:12 | 664 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue41 2009.html | 2021-04-09 11:12 | 594 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue42 2009.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue42 2010.html | 2021-04-09 11:12 | 535 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue43 2009.html | 2021-04-09 11:12 | 721 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue44 2009.html | 2021-04-09 11:12 | 960 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue45 2009.html | 2021-04-09 11:12 | 915 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue47 2009.html | 2021-04-09 11:12 | 483 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue48 2009.html | 2021-04-09 11:12 | 820 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue49 2009.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue50 2009.html | 2021-04-09 11:12 | 713 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue51 2009.html | 2021-04-09 11:12 | 567 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue52 2009.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured article queue53 2009.html | 2021-04-09 11:12 | 929 | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured articles.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured articlesRandom.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Half-Life WikiFeatured articlesVotes.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Half-Life WikiGood articles.html | 2021-04-09 11:12 | 185 | |
![[TXT]](/icons/text.gif) | Half-Life WikiGood articlesRandom.html | 2021-04-09 11:12 | 7.2K | |
![[TXT]](/icons/text.gif) | Half-Life WikiIRC.html | 2021-04-09 11:12 | 2.4K | |
![[TXT]](/icons/text.gif) | Half-Life WikiIgnore all rules.html | 2021-04-09 11:12 | 164 | |
![[TXT]](/icons/text.gif) | Half-Life WikiImages.html | 2021-04-09 11:12 | 734 | |
![[TXT]](/icons/text.gif) | Half-Life WikiLayout Guide.html | 2021-04-09 11:12 | 174 | |
![[TXT]](/icons/text.gif) | Half-Life WikiManual of Style.html | 2021-04-09 11:12 | 9.4K | |
![[TXT]](/icons/text.gif) | Half-Life WikiOversight.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | Half-Life WikiPolicies.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | Half-Life WikiProjects.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | Half-Life WikiProjectsCleanup.html | 2021-04-09 11:12 | 185 | |
![[TXT]](/icons/text.gif) | Half-Life WikiProjectsPortal.html | 2021-04-09 11:12 | 182 | |
![[TXT]](/icons/text.gif) | Half-Life WikiProtection policy.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | Half-Life WikiRed Links.html | 2021-04-09 11:12 | 157 | |
![[TXT]](/icons/text.gif) | Half-Life WikiRequests for Adminship.html | 2021-04-09 11:12 | 46K | |
![[TXT]](/icons/text.gif) | Half-Life WikiRetcons.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | Half-Life WikiRollback.html | 2021-04-09 11:12 | 154 | |
![[TXT]](/icons/text.gif) | Half-Life WikiSafe articles.html | 2021-04-09 11:12 | 185 | |
![[TXT]](/icons/text.gif) | Half-Life WikiSandbox.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | Half-Life WikiSock puppetry.html | 2021-04-09 11:12 | 161 | |
![[TXT]](/icons/text.gif) | Half-Life WikiTalk page policy.html | 2021-04-09 11:12 | 2.1K | |
![[TXT]](/icons/text.gif) | Half-Life WikiUser treatment policy.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkAbout.html | 2021-04-09 11:12 | 1.8K | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkAdministration.html | 2021-04-09 11:12 | 173 | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkAdministration2.html | 2021-04-09 11:12 | 194 | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkApril Fool's Day 2010.html | 2021-04-09 11:12 | 5.6K | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkApril Fools' Day 2010.html | 2021-04-09 11:12 | 9.2K | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkApril Fools' Day 2010Combine solider.html | 2021-04-09 11:12 | 8.4K | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkApril Fools' Day 2010G-MAN.html | 2021-04-09 11:12 | 614 | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkApril Fools' Day 2010Main Page.html | 2021-04-09 11:12 | 588 | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkCanon.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkCombine OverWiki.html | 2021-04-09 11:12 | 179 | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkFAQ.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkFeatured article queue.html | 2021-04-09 11:12 | 181 | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkFeatured articles.html | 2021-04-09 11:12 | 176 | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkFeatured articlesVotes.html | 2021-04-09 11:12 | 181 | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkImages.html | 2021-04-09 11:12 | 165 | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkLayout Guide.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkManual of Style.html | 2021-04-09 11:12 | 5.7K | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkPoint of view.html | 2021-04-09 11:12 | 1.5K | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkProblemReports10901.html | 2021-04-09 11:12 | 840 | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkProjects.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkProjectsCleanup.html | 2021-04-09 11:12 | 8.6K | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkProjectsPortal.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkProtection policy.html | 2021-04-09 11:12 | 652 | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkRetcons.html | 2021-04-09 11:12 | 401 | |
![[TXT]](/icons/text.gif) | Half-Life Wiki talkSandbox.html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | Half-Life series.html | 2021-04-09 11:12 | 4.9K | |
![[TXT]](/icons/text.gif) | Half-Life soundtrack.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Half-Life storyline.html | 2021-04-09 11:12 | 43K | |
![[TXT]](/icons/text.gif) | Half-Life universe.html | 2021-04-09 11:12 | 42K | |
![[TXT]](/icons/text.gif) | Half Life 2 Aftermath.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Half Life Opposing Force.html | 2021-04-09 11:12 | 874 | |
![[TXT]](/icons/text.gif) | Half life.html | 2021-04-09 11:12 | 132 | |
![[TXT]](/icons/text.gif) | Half life 2 storyline.html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | Half life source.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | Half life storyline.html | 2021-04-09 11:12 | 165 | |
![[TXT]](/icons/text.gif) | Hammer.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | Hand Grenade.html | 2021-04-09 11:12 | 124 | |
![[TXT]](/icons/text.gif) | Hand Scanner.html | 2021-04-09 11:12 | 8.9K | |
![[TXT]](/icons/text.gif) | Handheld Portal Device.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Hard Light Bridge.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Harold.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | Harpoon.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | Harry S. Robbins.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | Harry S. Robins.html | 2021-04-09 11:12 | 4.7K | |
![[TXT]](/icons/text.gif) | Hazard Course (Blue Shift).html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | Hazard Course.html | 2021-04-09 11:12 | 472 | |
![[TXT]](/icons/text.gif) | Hazardous Course.html | 2021-04-09 11:12 | 188 | |
![[TXT]](/icons/text.gif) | Hazardous Environment Combat Unit.html | 2021-04-09 11:12 | 39K | |
![[TXT]](/icons/text.gif) | Head Crab.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | Head Humper.html | 2021-04-09 11:12 | 135 | |
![[TXT]](/icons/text.gif) | Headcrab.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Headcrab Shell.html | 2021-04-09 11:12 | 8.7K | |
![[TXT]](/icons/text.gif) | Headcrab Shell Launcher.html | 2021-04-09 11:12 | 2.4K | |
![[TXT]](/icons/text.gif) | Headhumper.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Healing Pond.html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | Healing Pool.html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | Healing Shower.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Health Charger.html | 2021-04-09 11:12 | 7.3K | |
![[TXT]](/icons/text.gif) | Health Kit.html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | Health Vial.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | Heather.html | 2021-04-09 11:12 | 161 | |
![[TXT]](/icons/text.gif) | Heavy.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | Heavy weapon guy.html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | Heavy weapons.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Heavy weapons character.html | 2021-04-09 11:12 | 159 | |
![[TXT]](/icons/text.gif) | Heavy weapons guy.html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | Hedy.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Hedy Lamarr.html | 2021-04-09 11:12 | 724 | |
![[TXT]](/icons/text.gif) | Heel Springs.html | 2021-04-09 11:12 | 42K | |
![[TXT]](/icons/text.gif) | Heel spring.html | 2021-04-09 11:12 | 5.2K | |
![[TXT]](/icons/text.gif) | Heelsprings.html | 2021-04-09 11:12 | 931 | |
![[TXT]](/icons/text.gif) | Heep.html | 2021-04-09 11:12 | 122 | |
![[TXT]](/icons/text.gif) | Heimlich Counter-Maneuver.html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | Heironimus (disambiguation).html | 2021-04-09 11:12 | 402 | |
![[TXT]](/icons/text.gif) | Heironimus (scientist).html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | Heironimus.html | 2021-04-09 11:12 | 125 | |
![[TXT]](/icons/text.gif) | Helena.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Helena Mossman.html | 2021-04-09 11:12 | 5.4K | |
![[TXT]](/icons/text.gif) | Helicopter (disambiguation).html | 2021-04-09 11:12 | 2.9K | |
![[TXT]](/icons/text.gif) | Helicopter.html | 2021-04-09 11:12 | 125 | |
![[TXT]](/icons/text.gif) | Helmet.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Help.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | HelpAutomatic edit summaries.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | HelpBots.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | HelpContents.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | HelpEditing.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | HelpGiveRollback.html | 2021-04-09 11:12 | 45K | |
![[TXT]](/icons/text.gif) | HelpImages.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | HelpRecent changes.html | 2021-04-09 11:12 | 4.9K | |
![[TXT]](/icons/text.gif) | HelpReferences.html | 2021-04-09 11:12 | 6.9K | |
![[TXT]](/icons/text.gif) | HelpRollback.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | HelpTables.html | 2021-04-09 11:12 | 24K | |
![[TXT]](/icons/text.gif) | HelpTemplates.html | 2021-04-09 11:12 | 178 | |
![[TXT]](/icons/text.gif) | HelpUser access levels.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Help talkContents.html | 2021-04-09 11:12 | 157 | |
![[TXT]](/icons/text.gif) | Help talkEditing.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | Help talkImages.html | 2021-04-09 11:12 | 155 | |
![[TXT]](/icons/text.gif) | Help talkReferences.html | 2021-04-09 11:12 | 159 | |
![[TXT]](/icons/text.gif) | Help talkRollback.html | 2021-04-09 11:12 | 426 | |
![[TXT]](/icons/text.gif) | Help talkTables.html | 2021-04-09 11:12 | 155 | |
![[TXT]](/icons/text.gif) | Help talkTemplates.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Henry.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | Hess.html | 2021-04-09 11:12 | 1.6K | |
![[TXT]](/icons/text.gif) | Hgrunt.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | High-Energy Particle Labs.html | 2021-04-09 11:12 | 190 | |
![[TXT]](/icons/text.gif) | High Altitude Launch Center.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | High Definition Pack.html | 2021-04-09 11:12 | 188 | |
![[TXT]](/icons/text.gif) | High Energy Pellet.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Highway 17 (Chapter).html | 2021-04-09 11:12 | 132 | |
![[TXT]](/icons/text.gif) | Highway 17.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | History of Aperture Science.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Hive Hand.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | Hivegun.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | Hivehand.html | 2021-04-09 11:12 | 7.0K | |
![[TXT]](/icons/text.gif) | Hl1.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Holo.html | 2021-04-09 11:12 | 154 | |
![[TXT]](/icons/text.gif) | Holographic Assistant.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Holographic guide.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | Holographic instructor.html | 2021-04-09 11:12 | 172 | |
![[TXT]](/icons/text.gif) | Hood.html | 2021-04-09 11:12 | 436 | |
![[TXT]](/icons/text.gif) | Hoopie.html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | Hoopy.html | 2021-04-09 11:12 | 125 | |
![[TXT]](/icons/text.gif) | Hoopy the Hoop.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Hopper.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Hopper Mine.html | 2021-04-09 11:12 | 26K | |
![[TXT]](/icons/text.gif) | Hoppermine.html | 2021-04-09 11:12 | 3.4K | |
![[TXT]](/icons/text.gif) | Hopwire.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Hopwire Grenade.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | Hornet Gun.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Horse.html | 2021-04-09 11:12 | 28K | |
![[TXT]](/icons/text.gif) | Hospital.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | Hotel.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Hotrod.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Houndeye.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Hover Turret.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | Howler.html | 2021-04-09 11:12 | 676 | |
![[TXT]](/icons/text.gif) | Hub.html | 2021-04-09 11:12 | 8.6K | |
![[TXT]](/icons/text.gif) | Human Sargeant.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Human Sergeant.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Human Vault.html | 2021-04-09 11:12 | 37K | |
![[TXT]](/icons/text.gif) | Human heavy weapons.html | 2021-04-09 11:12 | 155 | |
![[TXT]](/icons/text.gif) | Hunter-Chopper.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Hunter-Chopper Bomb.html | 2021-04-09 11:12 | 3.4K | |
![[TXT]](/icons/text.gif) | Hunter.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Hunter Chopper.html | 2021-04-09 11:12 | 758 | |
![[TXT]](/icons/text.gif) | Hydra.html | 2021-04-09 11:12 | 7.9K | |
![[TXT]](/icons/text.gif) | Hydro-Electric Dam.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Hyperborea.html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | I.A. Latham (disambiguation).html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | I.A. Latham.html | 2021-04-09 11:12 | 127 | |
![[TXT]](/icons/text.gif) | IA Latham.html | 2021-04-09 11:12 | 709 | |
![[TXT]](/icons/text.gif) | IRC.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | IRifle.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | IRon ants.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | Ice Axe.html | 2021-04-09 11:12 | 30K | |
![[TXT]](/icons/text.gif) | Ichthyosaur.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Ichtyosaur.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Icky.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Ickypop.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Icthyosaur.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Image.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Images.html | 2021-04-09 11:12 | 3.3K | |
![[TXT]](/icons/text.gif) | Immolator.html | 2021-04-09 11:12 | 4.0K | |
![[TXT]](/icons/text.gif) | Incendiary Rifle.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | Incinerator Room.html | 2021-04-09 11:12 | 3.6K | |
![[TXT]](/icons/text.gif) | Incoming.html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | Industrial.html | 2021-04-09 11:12 | 8.7K | |
![[TXT]](/icons/text.gif) | Infirmary.html | 2021-04-09 11:12 | 161 | |
![[TXT]](/icons/text.gif) | Inney.html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | Insect.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Insect Rifle.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | Insecurity.html | 2021-04-09 11:12 | 128 | |
![[TXT]](/icons/text.gif) | Intelligence Dampening Sphere.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Intensity.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | Interloper.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Introduction (Opposing Force).html | 2021-04-09 11:12 | 509 | |
![[TXT]](/icons/text.gif) | Isaac.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | Isaac Kleiner.html | 2021-04-09 11:12 | 26K | |
![[TXT]](/icons/text.gif) | Isabel Teasley.html | 2021-04-09 11:12 | 418 | |
![[TXT]](/icons/text.gif) | Ivan.html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | Ivan the Space Biker.html | 2021-04-09 11:12 | 3.8K | |
![[TXT]](/icons/text.gif) | Ivan the Spacebiker.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | Izzy.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | J. Faulkenbury.html | 2021-04-09 11:12 | 412 | |
![[TXT]](/icons/text.gif) | J.K. Simmons.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | Jackson.html | 2021-04-09 11:12 | 885 | |
![[TXT]](/icons/text.gif) | Jacob.html | 2021-04-09 11:12 | 1.8K | |
![[TXT]](/icons/text.gif) | Jalopy.html | 2021-04-09 11:12 | 5.3K | |
![[TXT]](/icons/text.gif) | James Murray.html | 2021-04-09 11:12 | 363 | |
![[TXT]](/icons/text.gif) | Jamil Giovanni Mullen.html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | Jamil Mullen.html | 2021-04-09 11:12 | 3.0K | |
![[TXT]](/icons/text.gif) | Janitor Bob.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | Jay Pinkerton.html | 2021-04-09 11:12 | 1.8K | |
![[TXT]](/icons/text.gif) | Jay Stelly.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | Jeep Barnett.html | 2021-04-09 11:12 | 2.3K | |
![[TXT]](/icons/text.gif) | Jeremy Bennett.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | Jerry.html | 2021-04-09 11:12 | 307 | |
![[TXT]](/icons/text.gif) | Jessica.html | 2021-04-09 11:12 | 161 | |
![[TXT]](/icons/text.gif) | Jet Ski.html | 2021-04-09 11:12 | 5.5K | |
![[TXT]](/icons/text.gif) | Jetski.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | Jim French.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | Joe.html | 2021-04-09 11:12 | 2.4K | |
![[TXT]](/icons/text.gif) | Joe Michaels.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Joe Romersa.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | Johansen.html | 2021-04-09 11:12 | 132 | |
![[TXT]](/icons/text.gif) | Johanson.html | 2021-04-09 11:12 | 5.9K | |
![[TXT]](/icons/text.gif) | Johanssen.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | John Applegate.html | 2021-04-09 11:12 | 2.9K | |
![[TXT]](/icons/text.gif) | John Aylward.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | John Guthrie.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | John Patrick Lowrie.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | Johnson.html | 2021-04-09 11:12 | 407 | |
![[TXT]](/icons/text.gif) | Jon St. John.html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | Jonathan Coulton.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | Jones (disambiguation).html | 2021-04-09 11:12 | 721 | |
![[TXT]](/icons/text.gif) | Jones (scientist).html | 2021-04-09 11:12 | 417 | |
![[TXT]](/icons/text.gif) | Jones (security guard).html | 2021-04-09 11:12 | 454 | |
![[TXT]](/icons/text.gif) | Jones.html | 2021-04-09 11:12 | 115 | |
![[TXT]](/icons/text.gif) | Judith.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Judith Mossman.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Junkyard.html | 2021-04-09 11:12 | 6.9K | |
![[TXT]](/icons/text.gif) | Kalashnikov.html | 2021-04-09 11:12 | 129 | |
![[TXT]](/icons/text.gif) | Karen Laur.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | Karla the Complainer.html | 2021-04-09 11:12 | 5.3K | |
![[TXT]](/icons/text.gif) | Katharine.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | Kathy Levin.html | 2021-04-09 11:12 | 3.1K | |
![[TXT]](/icons/text.gif) | Keller.html | 2021-04-09 11:12 | 6.5K | |
![[TXT]](/icons/text.gif) | Kelly Bailey.html | 2021-04-09 11:12 | 9.2K | |
![[TXT]](/icons/text.gif) | Ken Birdwell.html | 2021-04-09 11:12 | 8.4K | |
![[TXT]](/icons/text.gif) | Kids.html | 2021-04-09 11:12 | 869 | |
![[TXT]](/icons/text.gif) | Kim Swift.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | King Turret.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Kingpin.html | 2021-04-09 11:12 | 3.0K | |
![[TXT]](/icons/text.gif) | Kleiner's Lab.html | 2021-04-09 11:12 | 22K | |
![[TXT]](/icons/text.gif) | Kleiner.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Klow.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | Knife.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Kooy.html | 2021-04-09 11:12 | 377 | |
![[TXT]](/icons/text.gif) | Kraken.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Kraken Base.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Kraken Base Submarine.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Kristy Junio.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | L.D. Turner.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | L.M..html | 2021-04-09 11:12 | 19K | |
![[TXT]](/icons/text.gif) | L. Montgomery.html | 2021-04-09 11:12 | 411 | |
![[TXT]](/icons/text.gif) | LM.html | 2021-04-09 11:12 | 94 | |
![[TXT]](/icons/text.gif) | Lab Rat.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Labby.html | 2021-04-09 11:12 | 123 | |
![[TXT]](/icons/text.gif) | Laidlaw.html | 2021-04-09 11:12 | 407 | |
![[TXT]](/icons/text.gif) | Lamar.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | Lamarr.html | 2021-04-09 11:12 | 9.9K | |
![[TXT]](/icons/text.gif) | Lambda.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Lambda Complex.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Lambda Core.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | Lambda Incident.html | 2021-04-09 11:12 | 161 | |
![[TXT]](/icons/text.gif) | Lambda Lab.html | 2021-04-09 11:12 | 121 | |
![[TXT]](/icons/text.gif) | Lambda Labs.html | 2021-04-09 11:12 | 122 | |
![[TXT]](/icons/text.gif) | Lambda Reactor Complex.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Lambda Resistance.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Lambda Team.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Lambda cache.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Lambda logo.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | Lambda supply cache.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Lammar.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | Lammarr.html | 2021-04-09 11:12 | 127 | |
![[TXT]](/icons/text.gif) | Land Mine.html | 2021-04-09 11:12 | 3.0K | |
![[TXT]](/icons/text.gif) | Landon.html | 2021-04-09 11:12 | 371 | |
![[TXT]](/icons/text.gif) | Lani Minella.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | Laser Tripmine.html | 2021-04-09 11:12 | 127 | |
![[TXT]](/icons/text.gif) | Laser field.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Laszlo.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Laur.html | 2021-04-09 11:12 | 404 | |
![[TXT]](/icons/text.gif) | Laura.html | 2021-04-09 11:12 | 30K | |
![[TXT]](/icons/text.gif) | Laura Dubuk.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | Lauren.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | Layout.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | Layout guide.html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | Layouts.html | 2021-04-09 11:12 | 4.0K | |
![[TXT]](/icons/text.gif) | Lazarus Grey.html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | Lazslo.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | Leak.html | 2021-04-09 11:12 | 108 | |
![[TXT]](/icons/text.gif) | Leech.html | 2021-04-09 11:12 | 14 | |
![[TXT]](/icons/text.gif) | Leeches.html | 2021-04-09 11:12 | 693 | |
![[TXT]](/icons/text.gif) | Lemon.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Lemons.html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | Leon.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | Leve Rage.html | 2021-04-09 11:12 | 313 | |
![[TXT]](/icons/text.gif) | Level 1 Main Facility Entrance.html | 2021-04-09 11:12 | 171 | |
![[TXT]](/icons/text.gif) | Level 3.html | 2021-04-09 11:12 | 125 | |
![[TXT]](/icons/text.gif) | Level 3 Dormitories.html | 2021-04-09 11:12 | 6.3K | |
![[TXT]](/icons/text.gif) | Lever Bridge.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Light Bridge.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Light Stalk.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Lighthouse Point.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | List of weapons and items in Deathmatch Classic.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Little Odessa.html | 2021-04-09 11:12 | 155 | |
![[TXT]](/icons/text.gif) | Little Rocket Man.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Living Quarters Outbound.html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | Loader.html | 2021-04-09 11:12 | 124 | |
![[TXT]](/icons/text.gif) | Locations.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | Locations in the Half-Life universe.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Lodge.html | 2021-04-09 11:12 | 3.2K | |
![[TXT]](/icons/text.gif) | Lombardi.html | 2021-04-09 11:12 | 440 | |
![[TXT]](/icons/text.gif) | Long Fall Boot.html | 2021-04-09 11:12 | 5.1K | |
![[TXT]](/icons/text.gif) | Long Fall Boots.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Long Jump Module.html | 2021-04-09 11:12 | 7.6K | |
![[TXT]](/icons/text.gif) | Long jump.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Longjump.html | 2021-04-09 11:12 | 25K | |
![[TXT]](/icons/text.gif) | Lost Coast.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | Lost Coast Developer Commentary.html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | Louis Donaldson.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | Louis Gossett Jr..html | 2021-04-09 11:12 | 3.0K | |
![[TXT]](/icons/text.gif) | Lowlife.html | 2021-04-09 11:12 | 128 | |
![[TXT]](/icons/text.gif) | Luna.html | 2021-04-09 11:12 | 369 | |
![[TXT]](/icons/text.gif) | Lundeen.html | 2021-04-09 11:12 | 425 | |
![[TXT]](/icons/text.gif) | M. Wardwell.html | 2021-04-09 11:12 | 409 | |
![[TXT]](/icons/text.gif) | M1A1 Abrams.html | 2021-04-09 11:12 | 4.0K | |
![[TXT]](/icons/text.gif) | M2A3 Bradley.html | 2021-04-09 11:12 | 4.9K | |
![[TXT]](/icons/text.gif) | M2 Bradley.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | M2 Browning Machine Gun.html | 2021-04-09 11:12 | 6.8K | |
![[TXT]](/icons/text.gif) | M4.html | 2021-04-09 11:12 | 116 | |
![[TXT]](/icons/text.gif) | M4A1.html | 2021-04-09 11:12 | 118 | |
![[TXT]](/icons/text.gif) | M4A1 Carbine.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | M9 Pistol.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | M35 cargo truck.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | M40A1 Sniper Rifle.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | M198 Howitzer.html | 2021-04-09 11:12 | 3.0K | |
![[TXT]](/icons/text.gif) | M202A1 FLASH.html | 2021-04-09 11:12 | 2.9K | |
![[TXT]](/icons/text.gif) | M249.html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | M249 Squad Automatic Weapon.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | MI.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | MINERVA.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | MIRT.html | 2021-04-09 11:12 | 120 | |
![[TXT]](/icons/text.gif) | MK3A2.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | MK3A2 Grenade.html | 2021-04-09 11:12 | 9.1K | |
![[TXT]](/icons/text.gif) | MP.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | MP5.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | MP5K.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | MP5SD.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | MP7 (HL2).html | 2021-04-09 11:12 | 123 | |
![[TXT]](/icons/text.gif) | MP7 (cut weapon).html | 2021-04-09 11:12 | 3.6K | |
![[TXT]](/icons/text.gif) | MP7 (disambiguation).html | 2021-04-09 11:12 | 365 | |
![[TXT]](/icons/text.gif) | MP7.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | MTM 8.html | 2021-04-09 11:12 | 3.8K | |
![[TXT]](/icons/text.gif) | Magnade.html | 2021-04-09 11:12 | 921 | |
![[TXT]](/icons/text.gif) | Magnum.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Magnusson (disambiguation).html | 2021-04-09 11:12 | 363 | |
![[TXT]](/icons/text.gif) | Magnusson.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | Magnusson Device.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | Main Page.html | 2021-04-09 11:12 | 132 | |
![[TXT]](/icons/text.gif) | Mambridge.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | Manhack.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Manhack Arcade.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Manhack Matt.html | 2021-04-09 11:12 | 168 | |
![[TXT]](/icons/text.gif) | Manhack dispenser.html | 2021-04-09 11:12 | 159 | |
![[TXT]](/icons/text.gif) | Manta Ray.html | 2021-04-09 11:12 | 909 | |
![[TXT]](/icons/text.gif) | Mantis Man.html | 2021-04-09 11:12 | 22K | |
![[TXT]](/icons/text.gif) | Mantis Men.html | 2021-04-09 11:12 | 6.8K | |
![[TXT]](/icons/text.gif) | Manual of style.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Manufacturing.html | 2021-04-09 11:12 | 161 | |
![[TXT]](/icons/text.gif) | Marc Laidlaw.html | 2021-04-09 11:12 | 6.9K | |
![[TXT]](/icons/text.gif) | Marc Meaux.html | 2021-04-09 11:12 | 361 | |
![[TXT]](/icons/text.gif) | Mark.html | 2021-04-09 11:12 | 422 | |
![[TXT]](/icons/text.gif) | Mark IV Thermonuclear Device.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Martel.html | 2021-04-09 11:12 | 1.5K | |
![[TXT]](/icons/text.gif) | Mary.html | 2021-04-09 11:12 | 319 | |
![[TXT]](/icons/text.gif) | Mary Kae Irvin.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | Material Emancipation Grid.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Material Emancipation Grill.html | 2021-04-09 11:12 | 159 | |
![[TXT]](/icons/text.gif) | Materials Transport.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | Matt.html | 2021-04-09 11:12 | 315 | |
![[TXT]](/icons/text.gif) | Matthew Armstrong.html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | Maxwell.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | May 3.html | 2021-04-09 11:12 | 129 | |
![[TXT]](/icons/text.gif) | May 5.html | 2021-04-09 11:12 | 9.3K | |
![[TXT]](/icons/text.gif) | May 7.html | 2021-04-09 11:12 | 129 | |
![[TXT]](/icons/text.gif) | May 9.html | 2021-04-09 11:12 | 129 | |
![[TXT]](/icons/text.gif) | May 11.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | May 12.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | May 13.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | May 14.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | May 15.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | May 16.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | May 17.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | May 18.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | May 200-.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | McArthur.html | 2021-04-09 11:12 | 1.6K | |
![[TXT]](/icons/text.gif) | Mech.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | MediaWikiAbusefilter-warning-blanking.html | 2021-04-09 11:12 | 22K | |
![[TXT]](/icons/text.gif) | MediaWikiAnswers widget user note.html | 2021-04-09 11:12 | 5.9K | |
![[TXT]](/icons/text.gif) | MediaWikiBlockipsuccesstext.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | MediaWikiCategories.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | MediaWikiChat-user-joined.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | MediaWikiChat-user-parted.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | MediaWikiChat-welcome-message.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | MediaWikiChat.css.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | MediaWikiChat.js.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | MediaWikiChat.jsload.js.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | MediaWikiCommon.js.html | 2021-04-09 11:12 | 6.5K | |
![[TXT]](/icons/text.gif) | MediaWikiCommon.jsajaxrefresh.js.html | 2021-04-09 11:12 | 3.2K | |
![[TXT]](/icons/text.gif) | MediaWikiCommon.jsdisablecommentsblogs.js.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | MediaWikiCommon.jsdisableforumedit.js.html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | MediaWikiCommon.jsdisplaytitle.js.html | 2021-04-09 11:12 | 4.9K | |
![[TXT]](/icons/text.gif) | MediaWikiCommon.jsrollbacktag.js.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | MediaWikiCommunity-corner.html | 2021-04-09 11:12 | 702 | |
![[TXT]](/icons/text.gif) | MediaWikiDeletereason-dropdown.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | MediaWikiDescription.html | 2021-04-09 11:12 | 26K | |
![[TXT]](/icons/text.gif) | MediaWikiEdit.html | 2021-04-09 11:12 | 104 | |
![[TXT]](/icons/text.gif) | MediaWikiEdittools.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | MediaWikiEmoticons.html | 2021-04-09 11:12 | 24K | |
![[TXT]](/icons/text.gif) | MediaWikiEnotif body.html | 2021-04-09 11:12 | 642 | |
![[TXT]](/icons/text.gif) | MediaWikiEnotif body categoryadd-html.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | MediaWikiEnotif body categoryadd.html | 2021-04-09 11:12 | 572 | |
![[TXT]](/icons/text.gif) | MediaWikiFiledelete-reason-dropdown.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | MediaWikiFooter 8.html | 2021-04-09 11:12 | 109 | |
![[TXT]](/icons/text.gif) | MediaWikiFunctions.js.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | MediaWikiGlobalwatchlist-digest-email-body.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | MediaWikiIRC.html | 2021-04-09 11:12 | 5.0K | |
![[TXT]](/icons/text.gif) | MediaWikiImportfreeimages-desc.html | 2021-04-09 11:12 | 304 | |
![[TXT]](/icons/text.gif) | MediaWikiImportfreeimages description.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | MediaWikiIpboptions.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | MediaWikiIpbreason-dropdown.html | 2021-04-09 11:12 | 560 | |
![[TXT]](/icons/text.gif) | MediaWikiIrcgate-channellist.html | 2021-04-09 11:12 | 165 | |
![[TXT]](/icons/text.gif) | MediaWikiLicenses.html | 2021-04-09 11:12 | 391 | |
![[TXT]](/icons/text.gif) | MediaWikiMediaWikiChat-welcome-message.html | 2021-04-09 11:12 | 9.1K | |
![[TXT]](/icons/text.gif) | MediaWikiMonaco-sidebar.html | 2021-04-09 11:12 | 1.5K | |
![[TXT]](/icons/text.gif) | MediaWikiMonaco-toolbox.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | MediaWikiMonaco.css.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | MediaWikiMonaco.js.html | 2021-04-09 11:12 | 4.9K | |
![[TXT]](/icons/text.gif) | MediaWikiMonacoslate.css.html | 2021-04-09 11:12 | 319 | |
![[TXT]](/icons/text.gif) | MediaWikiMonobook.css.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | MediaWikiMultipleupload-text.html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | MediaWikiNoarticletext.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | MediaWikiPhotosblacklist.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | MediaWikiPortal.html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | MediaWikiRecentchangestext.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | MediaWikiRelatedVideosGlobalList.html | 2021-04-09 11:12 | 8.8K | |
![[TXT]](/icons/text.gif) | MediaWikiSf-link-popup.html | 2021-04-09 11:12 | 114 | |
![[TXT]](/icons/text.gif) | MediaWikiSf-link.html | 2021-04-09 11:12 | 108 | |
![[TXT]](/icons/text.gif) | MediaWikiShowHidecode.js.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | MediaWikiSitenotice id.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | MediaWikiTagline.html | 2021-04-09 11:12 | 122 | |
![[TXT]](/icons/text.gif) | MediaWikiTitleedit.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | MediaWikiTwitterWidget.html | 2021-04-09 11:12 | 624 | |
![[TXT]](/icons/text.gif) | MediaWikiUploadtext.html | 2021-04-09 11:12 | 46K | |
![[TXT]](/icons/text.gif) | MediaWikiWelcome-message-anon.html | 2021-04-09 11:12 | 5.0K | |
![[TXT]](/icons/text.gif) | MediaWikiWelcome-message-user.html | 2021-04-09 11:12 | 2.4K | |
![[TXT]](/icons/text.gif) | MediaWikiWelcome-user-page.html | 2021-04-09 11:12 | 519 | |
![[TXT]](/icons/text.gif) | MediaWikiWiki-navigation.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | MediaWikiWikia.css.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | MediaWikiWikia.js.html | 2021-04-09 11:12 | 648 | |
![[TXT]](/icons/text.gif) | MediaWikiWikiaPhotoGallery-upload-intro-first.html | 2021-04-09 11:12 | 5.0K | |
![[TXT]](/icons/text.gif) | MediaWikiWikiaPhotoGallery-upload-intro.html | 2021-04-09 11:12 | 393 | |
![[TXT]](/icons/text.gif) | MediaWikiWmu-uploadtext.html | 2021-04-09 11:12 | 3.5K | |
![[TXT]](/icons/text.gif) | MediaWiki talkAnswers widget user note.html | 2021-04-09 11:12 | 178 | |
![[TXT]](/icons/text.gif) | MediaWiki talkAsk a question-widget.html | 2021-04-09 11:12 | 175 | |
![[TXT]](/icons/text.gif) | MediaWiki talkBlockipsuccesstext.html | 2021-04-09 11:12 | 172 | |
![[TXT]](/icons/text.gif) | MediaWiki talkCommon.css.html | 2021-04-09 11:12 | 164 | |
![[TXT]](/icons/text.gif) | MediaWiki talkCommon.js.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | MediaWiki talkCommunity-corner.html | 2021-04-09 11:12 | 170 | |
![[TXT]](/icons/text.gif) | MediaWiki talkCreatepage-dialog-choose.html | 2021-04-09 11:12 | 178 | |
![[TXT]](/icons/text.gif) | MediaWiki talkCreatepage-dialog-message1.html | 2021-04-09 11:12 | 180 | |
![[TXT]](/icons/text.gif) | MediaWiki talkCreatepage-dialog-message2.html | 2021-04-09 11:12 | 180 | |
![[TXT]](/icons/text.gif) | MediaWiki talkDeletereason-dropdown.html | 2021-04-09 11:12 | 175 | |
![[TXT]](/icons/text.gif) | MediaWiki talkDescription.html | 2021-04-09 11:12 | 165 | |
![[TXT]](/icons/text.gif) | MediaWiki talkFiledelete-reason-dropdown.html | 2021-04-09 11:12 | 180 | |
![[TXT]](/icons/text.gif) | MediaWiki talkFunctions.js.html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | MediaWiki talkIpbreason-dropdown.html | 2021-04-09 11:12 | 172 | |
![[TXT]](/icons/text.gif) | MediaWiki talkLicenses.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | MediaWiki talkMonaco-sidebar.html | 2021-04-09 11:12 | 168 | |
![[TXT]](/icons/text.gif) | MediaWiki talkMonaco-toolbox.html | 2021-04-09 11:12 | 168 | |
![[TXT]](/icons/text.gif) | MediaWiki talkMonaco.css.html | 2021-04-09 11:12 | 164 | |
![[TXT]](/icons/text.gif) | MediaWiki talkMonacoslate.css.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | MediaWiki talkMonobook.css.html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | MediaWiki talkMonobook.js.html | 2021-04-09 11:12 | 165 | |
![[TXT]](/icons/text.gif) | MediaWiki talkMultipleupload-text.html | 2021-04-09 11:12 | 173 | |
![[TXT]](/icons/text.gif) | MediaWiki talkNavlinks.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | MediaWiki talkNewpagelayout.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | MediaWiki talkNoarticletext.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | MediaWiki talkNoimage.html | 2021-04-09 11:12 | 161 | |
![[TXT]](/icons/text.gif) | MediaWiki talkPagetitle-view-mainpage.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | MediaWiki talkPagetitle.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | MediaWiki talkShowHidecode.js.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | MediaWiki talkSidebar.html | 2021-04-09 11:12 | 408 | |
![[TXT]](/icons/text.gif) | MediaWiki talkSitenotice.html | 2021-04-09 11:12 | 7.0K | |
![[TXT]](/icons/text.gif) | MediaWiki talkSitenotice id.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | MediaWiki talkTagline.html | 2021-04-09 11:12 | 161 | |
![[TXT]](/icons/text.gif) | MediaWiki talkTooltip-search.html | 2021-04-09 11:12 | 168 | |
![[TXT]](/icons/text.gif) | MediaWiki talkUploadtext.html | 2021-04-09 11:12 | 164 | |
![[TXT]](/icons/text.gif) | MediaWiki talkVet-title.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | MediaWiki talkWelcome-enabled.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | MediaWiki talkWelcome-message-anon.html | 2021-04-09 11:12 | 174 | |
![[TXT]](/icons/text.gif) | MediaWiki talkWelcome-message-log.html | 2021-04-09 11:12 | 173 | |
![[TXT]](/icons/text.gif) | MediaWiki talkWelcome-message-user.html | 2021-04-09 11:12 | 174 | |
![[TXT]](/icons/text.gif) | MediaWiki talkWelcome-user-page.html | 2021-04-09 11:12 | 171 | |
![[TXT]](/icons/text.gif) | MediaWiki talkWelcome-user.html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | MediaWiki talkWikiaPhotoGallery-photooptions-captionsub.html | 2021-04-09 11:12 | 195 | |
![[TXT]](/icons/text.gif) | MediaWiki talkWikiaPhotoGallery-upload-intro-first.html | 2021-04-09 11:12 | 190 | |
![[TXT]](/icons/text.gif) | MediaWiki talkWikiaPhotoGallery-upload-intro.html | 2021-04-09 11:12 | 184 | |
![[TXT]](/icons/text.gif) | MediaWiki talkWikiaPhotoGallery-viewmode-addphoto.html | 2021-04-09 11:12 | 189 | |
![[TXT]](/icons/text.gif) | MediaWiki talkWmu-uploadtext.html | 2021-04-09 11:12 | 168 | |
![[TXT]](/icons/text.gif) | Medic.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | Med kit.html | 2021-04-09 11:12 | 46K | |
![[TXT]](/icons/text.gif) | Medkit.html | 2021-04-09 11:12 | 6.5K | |
![[TXT]](/icons/text.gif) | Mel.html | 2021-04-09 11:12 | 3.0K | |
![[TXT]](/icons/text.gif) | Memory Replacement.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | Mennet.html | 2021-04-09 11:12 | 424 | |
![[TXT]](/icons/text.gif) | Merkava.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | Merle Dandridge.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | Mertz (disambiguation).html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | Mertz (scientist).html | 2021-04-09 11:12 | 1.6K | |
![[TXT]](/icons/text.gif) | Mertz.html | 2021-04-09 11:12 | 115 | |
![[TXT]](/icons/text.gif) | Mesa Times.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Metro Cop.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Metro Police.html | 2021-04-09 11:12 | 1.5K | |
![[TXT]](/icons/text.gif) | Metrocop.html | 2021-04-09 11:12 | 9.2K | |
![[TXT]](/icons/text.gif) | Metropolice.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Michael Avon Oeming.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | Michael Shapiro.html | 2021-04-09 11:12 | 6.9K | |
![[TXT]](/icons/text.gif) | Michelle Forbes.html | 2021-04-09 11:12 | 8.0K | |
![[TXT]](/icons/text.gif) | Mike Harrington.html | 2021-04-09 11:12 | 5.5K | |
![[TXT]](/icons/text.gif) | Mike Morasky.html | 2021-04-09 11:12 | 39K | |
![[TXT]](/icons/text.gif) | Mike Patton.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | Mike Shapiro.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Mil Mi-8.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | Military Android.html | 2021-04-09 11:12 | 903 | |
![[TXT]](/icons/text.gif) | Military Police.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | Miller.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | Minge Bag.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | MingeBag.html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | Mini Ar3.html | 2021-04-09 11:12 | 122 | |
![[TXT]](/icons/text.gif) | Mini Strider.html | 2021-04-09 11:12 | 132 | |
![[TXT]](/icons/text.gif) | Minigun.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Ministrider.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | Minor Aperture Science employees.html | 2021-04-09 11:12 | 5.5K | |
![[TXT]](/icons/text.gif) | Minor Black Mesa employees.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Minor HECU members.html | 2021-04-09 11:12 | 7.0K | |
![[TXT]](/icons/text.gif) | Minor Resistance members.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | Missile Launcher.html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | Missile defense.html | 2021-04-09 11:12 | 607 | |
![[TXT]](/icons/text.gif) | Missing Information.html | 2021-04-09 11:12 | 6.3K | |
![[TXT]](/icons/text.gif) | Missing in Action.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Mistake of Pythagoras.html | 2021-04-09 11:12 | 7.1K | |
![[TXT]](/icons/text.gif) | Mister Friendly.html | 2021-04-09 11:12 | 6.7K | |
![[TXT]](/icons/text.gif) | Mk 2 Grenade.html | 2021-04-09 11:12 | 112 | |
![[TXT]](/icons/text.gif) | Mobile wall.html | 2021-04-09 11:12 | 9.1K | |
![[TXT]](/icons/text.gif) | Mobility Gel.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Mobility Gels.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | Moby Francke.html | 2021-04-09 11:12 | 7.5K | |
![[TXT]](/icons/text.gif) | Mod.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | Mods.html | 2021-04-09 11:12 | 9.7K | |
![[TXT]](/icons/text.gif) | Molotov.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Molotov Cocktail.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | Momentum.html | 2021-04-09 11:12 | 135 | |
![[TXT]](/icons/text.gif) | Monk.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | Monorail (disambiguation).html | 2021-04-09 11:12 | 264 | |
![[TXT]](/icons/text.gif) | Monorail.html | 2021-04-09 11:12 | 3.4K | |
![[TXT]](/icons/text.gif) | Montague.html | 2021-04-09 11:12 | 373 | |
![[TXT]](/icons/text.gif) | Moon.html | 2021-04-09 11:12 | 22K | |
![[TXT]](/icons/text.gif) | Morality Core.html | 2021-04-09 11:12 | 197 | |
![[TXT]](/icons/text.gif) | Moron.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Mortar Synth.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | Mossman.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Motel.html | 2021-04-09 11:12 | 1.8K | |
![[TXT]](/icons/text.gif) | Mr. Chubby Beak.html | 2021-04-09 11:12 | 23K | |
![[TXT]](/icons/text.gif) | Mr. Friendly.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Mr. Valve.html | 2021-04-09 11:12 | 8.3K | |
![[TXT]](/icons/text.gif) | Mr Friendly.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Mr Valve.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Mud Skipper.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | Muddy.html | 2021-04-09 11:12 | 8.7K | |
![[TXT]](/icons/text.gif) | Mudskipper.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | Multitool.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | Muscle Car.html | 2021-04-09 11:12 | 9.9K | |
![[TXT]](/icons/text.gif) | Myers.html | 2021-04-09 11:12 | 423 | |
![[TXT]](/icons/text.gif) | Myrmidont.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | N.L.O..html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | NECA Gordon Freeman Action Figure.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | NLO.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Nanobot.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | Narbacular.html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | Narbacular Drop.html | 2021-04-09 11:12 | 6.3K | |
![[TXT]](/icons/text.gif) | Nav.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | Navigation.html | 2021-04-09 11:12 | 174 | |
![[TXT]](/icons/text.gif) | NeoTokyo.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Neurotoxin.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Neurotoxin Generator.html | 2021-04-09 11:12 | 168 | |
![[TXT]](/icons/text.gif) | New Little Odessa.html | 2021-04-09 11:12 | 9.3K | |
![[TXT]](/icons/text.gif) | Newell (disambiguation).html | 2021-04-09 11:12 | 356 | |
![[TXT]](/icons/text.gif) | Newell (scientist).html | 2021-04-09 11:12 | 1.8K | |
![[TXT]](/icons/text.gif) | Newell.html | 2021-04-09 11:12 | 117 | |
![[TXT]](/icons/text.gif) | Nexus.html | 2021-04-09 11:12 | 501 | |
![[TXT]](/icons/text.gif) | Nihilanth (Chapter).html | 2021-04-09 11:12 | 9.5K | |
![[TXT]](/icons/text.gif) | Nihilanth.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | Nolan North.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | Noriko.html | 2021-04-09 11:12 | 321 | |
![[TXT]](/icons/text.gif) | Northern Petrol.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | Nova Prospekt (Chapter).html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Nova Prospekt.html | 2021-04-09 11:12 | 23K | |
![[TXT]](/icons/text.gif) | Nova Prospekt Prison Guard.html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | Np.html | 2021-04-09 11:12 | 8.0K | |
![[TXT]](/icons/text.gif) | Nuclear Monkey Software.html | 2021-04-09 11:12 | 161 | |
![[TXT]](/icons/text.gif) | Nuclear bomb.html | 2021-04-09 11:12 | 9.8K | |
![[TXT]](/icons/text.gif) | Nuclear warhead.html | 2021-04-09 11:12 | 179 | |
![[TXT]](/icons/text.gif) | Nugget.html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | O'Conner.html | 2021-04-09 11:12 | 381 | |
![[TXT]](/icons/text.gif) | O'Del.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | O'Dell.html | 2021-04-09 11:12 | 124 | |
![[TXT]](/icons/text.gif) | O. Laurey.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | OF.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | OICW.html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | OSIPR.html | 2021-04-09 11:12 | 129 | |
![[TXT]](/icons/text.gif) | Obsidian Conflict.html | 2021-04-09 11:12 | 7.7K | |
![[TXT]](/icons/text.gif) | Odel.html | 2021-04-09 11:12 | 122 | |
![[TXT]](/icons/text.gif) | Odell.html | 2021-04-09 11:12 | 3.9K | |
![[TXT]](/icons/text.gif) | Odessa.html | 2021-04-09 11:12 | 2.9K | |
![[TXT]](/icons/text.gif) | Odessa Cubbage.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | Office Complex.html | 2021-04-09 11:12 | 176 | |
![[TXT]](/icons/text.gif) | Office Warrens.html | 2021-04-09 11:12 | 44K | |
![[TXT]](/icons/text.gif) | Olga.html | 2021-04-09 11:12 | 128 | |
![[TXT]](/icons/text.gif) | On A Rail.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | Op4.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | Opera.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Operation Black Mesa (Opposing Force Source).html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Operation Black Mesa.html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | Opfor.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Opposing Force.html | 2021-04-09 11:12 | 170 | |
![[TXT]](/icons/text.gif) | Opposing Force 2.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Opposing Force Source.html | 2021-04-09 11:12 | 28K | |
![[TXT]](/icons/text.gif) | Opposing force storyline.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Oracle Turret.html | 2021-04-09 11:12 | 7.7K | |
![[TXT]](/icons/text.gif) | Orange.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Orange Box.html | 2021-04-09 11:12 | 7.6K | |
![[TXT]](/icons/text.gif) | Orange Box Achievements.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Orange Box achievement.html | 2021-04-09 11:12 | 184 | |
![[TXT]](/icons/text.gif) | Orange and Blue.html | 2021-04-09 11:12 | 155 | |
![[TXT]](/icons/text.gif) | Ordinance Storage Facility (disambiguation).html | 2021-04-09 11:12 | 702 | |
![[TXT]](/icons/text.gif) | Ordinance Storage Facility.html | 2021-04-09 11:12 | 157 | |
![[TXT]](/icons/text.gif) | Ordnance Storage Facility.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | Original journey.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Osprey.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | Otis.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Otis Laurey.html | 2021-04-09 11:12 | 4.0K | |
![[TXT]](/icons/text.gif) | Our Benefactors (Chapter).html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Our Benefactors.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Our Mutual Fiend.html | 2021-04-09 11:12 | 788 | |
![[TXT]](/icons/text.gif) | Our Mutual Friend.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Outland.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Outland Mines.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Outlands.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Outlands Forest.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Outside Aperture.html | 2021-04-09 11:12 | 5.3K | |
![[TXT]](/icons/text.gif) | Overwatch.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | Overwatch Elite.html | 2021-04-09 11:12 | 9.6K | |
![[TXT]](/icons/text.gif) | Overwatch Nexus.html | 2021-04-09 11:12 | 7.8K | |
![[TXT]](/icons/text.gif) | Overwatch Prison Guard.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Overwatch Pulse Rifle.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Overwatch Pulse Sniper Rifle.html | 2021-04-09 11:12 | 180 | |
![[TXT]](/icons/text.gif) | Overwatch Sniper.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | Overwatch Sniper Rifle.html | 2021-04-09 11:12 | 6.9K | |
![[TXT]](/icons/text.gif) | Overwatch Standard Issue.html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | Overwatch Standard Issue Pulse Rifle.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Overwatch Voice.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Overwatch soldier.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | Owen.html | 2021-04-09 11:12 | 122 | |
![[TXT]](/icons/text.gif) | Oxygen Bottles.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | P-body.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | P.C.V..html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | P. Deupree.html | 2021-04-09 11:12 | 408 | |
![[TXT]](/icons/text.gif) | PAGE.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | PA system.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | PA systems.html | 2021-04-09 11:12 | 178 | |
![[TXT]](/icons/text.gif) | PCV.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | PCV Suit.html | 2021-04-09 11:12 | 154 | |
![[TXT]](/icons/text.gif) | POTaDOS.html | 2021-04-09 11:12 | 127 | |
![[TXT]](/icons/text.gif) | POTaOS.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | Palace.html | 2021-04-09 11:12 | 129 | |
![[TXT]](/icons/text.gif) | Palmer.html | 2021-04-09 11:12 | 371 | |
![[TXT]](/icons/text.gif) | Panel.html | 2021-04-09 11:12 | 157 | |
![[TXT]](/icons/text.gif) | Panels.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Panther.html | 2021-04-09 11:12 | 5.7K | |
![[TXT]](/icons/text.gif) | Panther Eye.html | 2021-04-09 11:12 | 4.7K | |
![[TXT]](/icons/text.gif) | Panthereye.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Parasitics.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Particle Benchmark.html | 2021-04-09 11:12 | 176 | |
![[TXT]](/icons/text.gif) | Particle Storm.html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | Party Associate.html | 2021-04-09 11:12 | 155 | |
![[TXT]](/icons/text.gif) | Party Escort Bot.html | 2021-04-09 11:12 | 9.2K | |
![[TXT]](/icons/text.gif) | Party escort.html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | Party escort submission position.html | 2021-04-09 11:12 | 172 | |
![[TXT]](/icons/text.gif) | Path of Borealis.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Pauly.html | 2021-04-09 11:12 | 378 | |
![[TXT]](/icons/text.gif) | PeTI.html | 2021-04-09 11:12 | 5.7K | |
![[TXT]](/icons/text.gif) | Peer Review.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | Perpetual Testing Initiative.html | 2021-04-09 11:12 | 14K | |
![[TXT]](/icons/text.gif) | Personality Construct.html | 2021-04-09 11:12 | 3.1K | |
![[TXT]](/icons/text.gif) | Personality Core.html | 2021-04-09 11:12 | 200 | |
![[TXT]](/icons/text.gif) | Peter.html | 2021-04-09 11:12 | 165 | |
![[TXT]](/icons/text.gif) | Peters (Conscript).html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Peters.html | 2021-04-09 11:12 | 3.3K | |
![[TXT]](/icons/text.gif) | Petroleum Station.html | 2021-04-09 11:12 | 8.0K | |
![[TXT]](/icons/text.gif) | Pheropod.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Pheropods.html | 2021-04-09 11:12 | 7.4K | |
![[TXT]](/icons/text.gif) | Phil Konig.html | 2021-04-09 11:12 | 361 | |
![[TXT]](/icons/text.gif) | Phillips.html | 2021-04-09 11:12 | 381 | |
![[TXT]](/icons/text.gif) | Phosphorescent Stalk.html | 2021-04-09 11:12 | 697 | |
![[TXT]](/icons/text.gif) | Physgun.html | 2021-04-09 11:12 | 7.2K | |
![[TXT]](/icons/text.gif) | Phystown.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | Pic.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Pics.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Picture.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Pictures.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Pigeon.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Pigeons.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Pipe Network.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Pipe Wrench.html | 2021-04-09 11:12 | 5.9K | |
![[TXT]](/icons/text.gif) | Pistol (HL1).html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Pistol (HL2).html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | Pistol (disambiguation).html | 2021-04-09 11:12 | 449 | |
![[TXT]](/icons/text.gif) | Pistol.html | 2021-04-09 11:12 | 117 | |
![[TXT]](/icons/text.gif) | Pit Drone.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | Pit Worm's Nest.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Pit Worm.html | 2021-04-09 11:12 | 8.3K | |
![[TXT]](/icons/text.gif) | Pitchford (disambiguation).html | 2021-04-09 11:12 | 399 | |
![[TXT]](/icons/text.gif) | Pitchford (scientist).html | 2021-04-09 11:12 | 386 | |
![[TXT]](/icons/text.gif) | Pitchford.html | 2021-04-09 11:12 | 123 | |
![[TXT]](/icons/text.gif) | Pneumatic Diversity Vent.html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | Pobst.html | 2021-04-09 11:12 | 437 | |
![[TXT]](/icons/text.gif) | Point Insertion.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Poison Headcrab.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Poison Headcrab Zombie.html | 2021-04-09 11:12 | 2.4K | |
![[TXT]](/icons/text.gif) | Poison Zombie.html | 2021-04-09 11:12 | 8.8K | |
![[TXT]](/icons/text.gif) | Police.html | 2021-04-09 11:12 | 943 | |
![[TXT]](/icons/text.gif) | Portable Thumper.html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | Portal (disambiguation).html | 2021-04-09 11:12 | 729 | |
![[TXT]](/icons/text.gif) | Portal (game).html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | Portal (gateway).html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Portal (video game).html | 2021-04-09 11:12 | 8.5K | |
![[TXT]](/icons/text.gif) | Portal.html | 2021-04-09 11:12 | 19K | |
![[TXT]](/icons/text.gif) | Portal 1.5.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | Portal 2.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | Portal 2 Achievements.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Portal 2 Achievements and Trophies.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | Portal 2 Lab Rat.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Portal 2 robots.html | 2021-04-09 11:12 | 155 | |
![[TXT]](/icons/text.gif) | Portal 2 soundtrack.html | 2021-04-09 11:12 | 30K | |
![[TXT]](/icons/text.gif) | Portal 2 storyline.html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | Portal 3 wishlist.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Portal ARG.html | 2021-04-09 11:12 | 54K | |
![[TXT]](/icons/text.gif) | Portal First Slice.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Portal Fizzler.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Portal Gun.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Portal Prelude.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | Portal Project.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Portal Still Alive.html | 2021-04-09 11:12 | 7.0K | |
![[TXT]](/icons/text.gif) | Portal Storm.html | 2021-04-09 11:12 | 3.5K | |
![[TXT]](/icons/text.gif) | Portal Storms.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Portal The Flash Version.html | 2021-04-09 11:12 | 2.9K | |
![[TXT]](/icons/text.gif) | Portal The Flash Version MapPack.html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | Portal soundtrack.html | 2021-04-09 11:12 | 9.4K | |
![[TXT]](/icons/text.gif) | Portal storyline.html | 2021-04-09 11:12 | 22K | |
![[TXT]](/icons/text.gif) | Portal update.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Portal updates.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | PotatOS.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Potato.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | PotatoFoolsDay.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | PotatoFoolsDay ARG.html | 2021-04-09 11:12 | 6.6K | |
![[TXT]](/icons/text.gif) | Potato Sack.html | 2021-04-09 11:12 | 155 | |
![[TXT]](/icons/text.gif) | Potatoes.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Power Combat Vest.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | Power Struggle.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Power Up.html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | Powered Combat Vest.html | 2021-04-09 11:12 | 6.1K | |
![[TXT]](/icons/text.gif) | Power generator.html | 2021-04-09 11:12 | 129 | |
![[TXT]](/icons/text.gif) | Powerup Bottles.html | 2021-04-09 11:12 | 1.8K | |
![[TXT]](/icons/text.gif) | Preliminary Findings.html | 2021-04-09 11:12 | 188 | |
![[TXT]](/icons/text.gif) | Pressure Plate.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Prison Pod.html | 2021-04-09 11:12 | 876 | |
![[TXT]](/icons/text.gif) | Prisoner Pod.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Projected Bridge.html | 2021-04-09 11:12 | 8.7K | |
![[TXT]](/icons/text.gif) | Projects.html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | ProjectsCleanup.html | 2021-04-09 11:12 | 183 | |
![[TXT]](/icons/text.gif) | ProjectsPortal.html | 2021-04-09 11:12 | 180 | |
![[TXT]](/icons/text.gif) | Promethean Turret.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Prometheus turret.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Propane Trap.html | 2021-04-09 11:12 | 2.4K | |
![[TXT]](/icons/text.gif) | Propeller Trap.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | Propulsion.html | 2021-04-09 11:12 | 96K | |
![[TXT]](/icons/text.gif) | Propulsion Gel.html | 2021-04-09 11:12 | 6.0K | |
![[TXT]](/icons/text.gif) | Propulsion Pudding.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Prospero.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Protozoa.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Protozoan.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Prowler.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | Public Announcement.html | 2021-04-09 11:12 | 187 | |
![[TXT]](/icons/text.gif) | Public Announcement System.html | 2021-04-09 11:12 | 194 | |
![[TXT]](/icons/text.gif) | Pulse.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Pulse Gun.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Pulse Rifle.html | 2021-04-09 11:12 | 135 | |
![[TXT]](/icons/text.gif) | Pulse Shield.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | Pulse Weapon.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Pulse cannon.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | Pulse guns.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Pulse technology.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Pulse weapons.html | 2021-04-09 11:12 | 5.3K | |
![[TXT]](/icons/text.gif) | Pump Station Beta.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Pump Station Gamma.html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | Puzzle Maker PTI.html | 2021-04-09 11:12 | 652 | |
![[TXT]](/icons/text.gif) | Python.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Quantum Tunneling Device.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Quarry.html | 2021-04-09 11:12 | 154 | |
![[TXT]](/icons/text.gif) | Quarry town.html | 2021-04-09 11:12 | 159 | |
![[TXT]](/icons/text.gif) | Quarrytown.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Quarytown.html | 2021-04-09 11:12 | 135 | |
![[TXT]](/icons/text.gif) | Questionable Ethics.html | 2021-04-09 11:12 | 179 | |
![[TXT]](/icons/text.gif) | Quiver.html | 2021-04-09 11:12 | 127 | |
![[TXT]](/icons/text.gif) | R-4913.html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | R-4913 and X-8973.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | R. Heironimus.html | 2021-04-09 11:12 | 411 | |
![[TXT]](/icons/text.gif) | R. Pitchford.html | 2021-04-09 11:12 | 410 | |
![[TXT]](/icons/text.gif) | RGrunt.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | RPG (HL1).html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | RPG (HL2).html | 2021-04-09 11:12 | 23K | |
![[TXT]](/icons/text.gif) | RPG (disambiguation).html | 2021-04-09 11:12 | 453 | |
![[TXT]](/icons/text.gif) | RPG.html | 2021-04-09 11:12 | 111 | |
![[TXT]](/icons/text.gif) | RPGGuy.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | Race-X.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | Race X.html | 2021-04-09 11:12 | 8.8K | |
![[TXT]](/icons/text.gif) | Radio (disambiguation).html | 2021-04-09 11:12 | 780 | |
![[TXT]](/icons/text.gif) | Radio.html | 2021-04-09 11:12 | 115 | |
![[TXT]](/icons/text.gif) | Rail-based transport.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | Rail-based transportation.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Rail-based transports.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | Railroad.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Rail transport.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Railway.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Raising the Bar.html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | Randall S. Pitchford II.html | 2021-04-09 11:12 | 161 | |
![[TXT]](/icons/text.gif) | Randy Lundeen.html | 2021-04-09 11:12 | 17K | |
![[TXT]](/icons/text.gif) | Randy Pitchford.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Rat.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Rat Man.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | Ration dispenser.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Ratman.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Ratman Den.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Rats.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Rattman.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Rattmann.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Ravenholm.html | 2021-04-09 11:12 | 31K | |
![[TXT]](/icons/text.gif) | Ravenholm Trap.html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | Ravenholm traps.html | 2021-04-09 11:12 | 9.2K | |
![[TXT]](/icons/text.gif) | Razor Train.html | 2021-04-09 11:12 | 6.9K | |
![[TXT]](/icons/text.gif) | Realm Lovejoy.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | Reardon.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | Reassembly Machine.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | Rebel.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | Rebel Radio.html | 2021-04-09 11:12 | 179 | |
![[TXT]](/icons/text.gif) | Rebellion.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Rebels.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Recon Synth.html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | Red Phone.html | 2021-04-09 11:12 | 799 | |
![[TXT]](/icons/text.gif) | Redemption.html | 2021-04-09 11:12 | 594 | |
![[TXT]](/icons/text.gif) | Redemption Line.html | 2021-04-09 11:12 | 4.7K | |
![[TXT]](/icons/text.gif) | Redemption Lines.html | 2021-04-09 11:12 | 164 | |
![[TXT]](/icons/text.gif) | Redirect.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | RedirectMudskipper.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Redirection Cube.html | 2021-04-09 11:12 | 3.0K | |
![[TXT]](/icons/text.gif) | Ref.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | References.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Refresh Time.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | Refugee.html | 2021-04-09 11:12 | 135 | |
![[TXT]](/icons/text.gif) | Relaxation Center.html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | Relaxation Chamber.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Relaxation Vault.html | 2021-04-09 11:12 | 1.6K | |
![[TXT]](/icons/text.gif) | Repulsion.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Repulsion Gel.html | 2021-04-09 11:12 | 7.6K | |
![[TXT]](/icons/text.gif) | Residue Processing.html | 2021-04-09 11:12 | 186 | |
![[TXT]](/icons/text.gif) | Resistance.html | 2021-04-09 11:12 | 24K | |
![[TXT]](/icons/text.gif) | Resistance Canal Network.html | 2021-04-09 11:12 | 172 | |
![[TXT]](/icons/text.gif) | Resistance Crossbow.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | Resistance RPG.html | 2021-04-09 11:12 | 6.9K | |
![[TXT]](/icons/text.gif) | Resistance Radio.html | 2021-04-09 11:12 | 184 | |
![[TXT]](/icons/text.gif) | Resistance communication.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | Resistance imagery.html | 2021-04-09 11:12 | 249 | |
![[TXT]](/icons/text.gif) | Resonance (Chapter).html | 2021-04-09 11:12 | 172 | |
![[TXT]](/icons/text.gif) | Resonance.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | Resonance Cascade.html | 2021-04-09 11:12 | 4.6K | |
![[TXT]](/icons/text.gif) | Restrictor.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | Retcon.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Retconned.html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | Retcons.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Retinal scanner.html | 2021-04-09 11:12 | 7.4K | |
![[TXT]](/icons/text.gif) | Return to Ravenholm.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Richard Keller.html | 2021-04-09 11:12 | 8.4K | |
![[TXT]](/icons/text.gif) | Rick.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Riding Shotgun.html | 2021-04-09 11:12 | 204 | |
![[TXT]](/icons/text.gif) | Rift.html | 2021-04-09 11:12 | 157 | |
![[TXT]](/icons/text.gif) | Riller.html | 2021-04-09 11:12 | 1.6K | |
![[TXT]](/icons/text.gif) | Road transport.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Rob Heironimus.html | 2021-04-09 11:12 | 938 | |
![[TXT]](/icons/text.gif) | Robert C. Knoll.html | 2021-04-09 11:12 | 366 | |
![[TXT]](/icons/text.gif) | Robert Culp.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | Robert Guillaume.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | Robo.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Robot Enrichment.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Robot Grunt.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Robot Test Subject.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Robotic Loader.html | 2021-04-09 11:12 | 132 | |
![[TXT]](/icons/text.gif) | Robot worker.html | 2021-04-09 11:12 | 178 | |
![[TXT]](/icons/text.gif) | Rocket.html | 2021-04-09 11:12 | 7.2K | |
![[TXT]](/icons/text.gif) | Rocket Launcher.html | 2021-04-09 11:12 | 123 | |
![[TXT]](/icons/text.gif) | Rocket Propelled Grenade Launcher.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | Rocket Sentry.html | 2021-04-09 11:12 | 9.1K | |
![[TXT]](/icons/text.gif) | Roller Wand.html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | Rollerbuddy.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Rollermine.html | 2021-04-09 11:12 | 9.5K | |
![[TXT]](/icons/text.gif) | Rollerwand.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Rosenberg.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Rosenburg.html | 2021-04-09 11:12 | 135 | |
![[TXT]](/icons/text.gif) | Rosencrantz.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Route Kanal.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | RtB.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | S. Bahl.html | 2021-04-09 11:12 | 405 | |
![[TXT]](/icons/text.gif) | S.J. Nye.html | 2021-04-09 11:12 | 312 | |
![[TXT]](/icons/text.gif) | S. Jones.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | S.L.A.M..html | 2021-04-09 11:12 | 192 | |
![[TXT]](/icons/text.gif) | S.L.A.M.html | 2021-04-09 11:12 | 191 | |
![[TXT]](/icons/text.gif) | S. Reardon.html | 2021-04-09 11:12 | 3.1K | |
![[TXT]](/icons/text.gif) | SAW.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | SDK (disambiguation).html | 2021-04-09 11:12 | 441 | |
![[TXT]](/icons/text.gif) | SDK.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | SLAM.html | 2021-04-09 11:12 | 188 | |
![[TXT]](/icons/text.gif) | SMAW Rocket Launcher.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | SMG (HL1).html | 2021-04-09 11:12 | 123 | |
![[TXT]](/icons/text.gif) | SMG (HL2).html | 2021-04-09 11:12 | 123 | |
![[TXT]](/icons/text.gif) | SMG (disambiguation).html | 2021-04-09 11:12 | 421 | |
![[TXT]](/icons/text.gif) | SMG.html | 2021-04-09 11:12 | 111 | |
![[TXT]](/icons/text.gif) | SMG1 (disambiguation).html | 2021-04-09 11:12 | 320 | |
![[TXT]](/icons/text.gif) | SMG2.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | SMOD.html | 2021-04-09 11:12 | 7.2K | |
![[TXT]](/icons/text.gif) | SMOD Tactical.html | 2021-04-09 11:12 | 7.0K | |
![[TXT]](/icons/text.gif) | SPAS-12 (HL1).html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | SPAS-12 (HL2).html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | SPAS-12 (disambiguation).html | 2021-04-09 11:12 | 31K | |
![[TXT]](/icons/text.gif) | SPAS-12.html | 2021-04-09 11:12 | 3.5K | |
![[TXT]](/icons/text.gif) | SPAS-12 Shotgun.html | 2021-04-09 11:12 | 729 | |
![[TXT]](/icons/text.gif) | SS.html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | SUV.html | 2021-04-09 11:12 | 752 | |
![[TXT]](/icons/text.gif) | SVG.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | SVG logos.html | 2021-04-09 11:12 | 9.2K | |
![[TXT]](/icons/text.gif) | Sacktick.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | Saint Olga.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Salt mine.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Samuel.html | 2021-04-09 11:12 | 5.2K | |
![[TXT]](/icons/text.gif) | Sand Barnacle.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | Sandtraps.html | 2021-04-09 11:12 | 118 | |
![[TXT]](/icons/text.gif) | Sandy.html | 2021-04-09 11:12 | 4.6K | |
![[TXT]](/icons/text.gif) | Santego.html | 2021-04-09 11:12 | 157 | |
![[TXT]](/icons/text.gif) | Santego Military Base, Arizona.html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | Santego Military Base.html | 2021-04-09 11:12 | 7.6K | |
![[TXT]](/icons/text.gif) | Sarge.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Sargeant.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Satchel.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Satchel Charge.html | 2021-04-09 11:12 | 5.4K | |
![[TXT]](/icons/text.gif) | Satellite Communications Center.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | Satellite Delivery Rocket.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Sawmill.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Scaling Cube.html | 2021-04-09 11:12 | 3.6K | |
![[TXT]](/icons/text.gif) | Scanner (disambiguation).html | 2021-04-09 11:12 | 879 | |
![[TXT]](/icons/text.gif) | Scanner.html | 2021-04-09 11:12 | 119 | |
![[TXT]](/icons/text.gif) | Scanner Type 1.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Scanner Type 2.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Scanner Type I.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Scanner Type II.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | School Bus.html | 2021-04-09 11:12 | 9.6K | |
![[TXT]](/icons/text.gif) | Science Collaboration Points.html | 2021-04-09 11:12 | 27K | |
![[TXT]](/icons/text.gif) | Scientist.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | Scientists.html | 2021-04-09 11:12 | 164 | |
![[TXT]](/icons/text.gif) | Scott Klintworth.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | Scout Car.html | 2021-04-09 11:12 | 9.1K | |
![[TXT]](/icons/text.gif) | Screenshots.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Sea.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | Seafloor.html | 2021-04-09 11:12 | 134 | |
![[TXT]](/icons/text.gif) | Seagull.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Seagulls.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Section A-17 Prototype Labs.html | 2021-04-09 11:12 | 3.1K | |
![[TXT]](/icons/text.gif) | Sector 17.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | Sector 17 Overwatch.html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | Sector A.html | 2021-04-09 11:12 | 122 | |
![[TXT]](/icons/text.gif) | Sector A Training Facility.html | 2021-04-09 11:12 | 8.8K | |
![[TXT]](/icons/text.gif) | Sector B.html | 2021-04-09 11:12 | 120 | |
![[TXT]](/icons/text.gif) | Sector B Coolant Reserve.html | 2021-04-09 11:12 | 7.8K | |
![[TXT]](/icons/text.gif) | Sector B Line.html | 2021-04-09 11:12 | 132 | |
![[TXT]](/icons/text.gif) | Sector C.html | 2021-04-09 11:12 | 114 | |
![[TXT]](/icons/text.gif) | Sector C Line.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | Sector C Test Labs.html | 2021-04-09 11:12 | 24K | |
![[TXT]](/icons/text.gif) | Sector C Test Labs and Control Facilities.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Sector D.html | 2021-04-09 11:12 | 119 | |
![[TXT]](/icons/text.gif) | Sector D Administration.html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | Sector E.html | 2021-04-09 11:12 | 120 | |
![[TXT]](/icons/text.gif) | Sector E Biodome Complex.html | 2021-04-09 11:12 | 27K | |
![[TXT]](/icons/text.gif) | Sector E Line.html | 2021-04-09 11:12 | 132 | |
![[TXT]](/icons/text.gif) | Sector E Materials Transport.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Sector E Subsurface Transport.html | 2021-04-09 11:12 | 785 | |
![[TXT]](/icons/text.gif) | Sector E Track Control.html | 2021-04-09 11:12 | 3.3K | |
![[TXT]](/icons/text.gif) | Sector F.html | 2021-04-09 11:12 | 119 | |
![[TXT]](/icons/text.gif) | Sector F Lambda Complex.html | 2021-04-09 11:12 | 19K | |
![[TXT]](/icons/text.gif) | Sector G.html | 2021-04-09 11:12 | 119 | |
![[TXT]](/icons/text.gif) | Sector G Hydro Electric.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Sector W.html | 2021-04-09 11:12 | 154 | |
![[TXT]](/icons/text.gif) | Security.html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | Security Complex.html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | Security Guard.html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | Security Officer.html | 2021-04-09 11:12 | 174 | |
![[TXT]](/icons/text.gif) | Security camera (disambiguation).html | 2021-04-09 11:12 | 314 | |
![[TXT]](/icons/text.gif) | Security camera.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Security card.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | Security guards.html | 2021-04-09 11:12 | 173 | |
![[TXT]](/icons/text.gif) | Selectable Lightweight Attack Munition.html | 2021-04-09 11:12 | 5.3K | |
![[TXT]](/icons/text.gif) | Selitto.html | 2021-04-09 11:12 | 1.6K | |
![[TXT]](/icons/text.gif) | Sensor Gate.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | Sentient cloud.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Sentry.html | 2021-04-09 11:12 | 2.6K | |
![[TXT]](/icons/text.gif) | Sentry Gun.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | Sentry King.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Sentry Turret (HL1).html | 2021-04-09 11:12 | 653 | |
![[TXT]](/icons/text.gif) | Sentry Turret (HL2).html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Sentry Turret (Portal).html | 2021-04-09 11:12 | 190 | |
![[TXT]](/icons/text.gif) | Sentry Turret (disambiguation).html | 2021-04-09 11:12 | 182 | |
![[TXT]](/icons/text.gif) | Sentry Turret.html | 2021-04-09 11:12 | 165 | |
![[TXT]](/icons/text.gif) | Sergeant.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Seven Hour War.html | 2021-04-09 11:12 | 4.7K | |
![[TXT]](/icons/text.gif) | Sewer Fauna.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | Sharpe.html | 2021-04-09 11:12 | 4.0K | |
![[TXT]](/icons/text.gif) | Sheckley.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | Shell.html | 2021-04-09 11:12 | 2.1K | |
![[TXT]](/icons/text.gif) | Shepard.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Sheperd.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Shephard.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Shepherd.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Shield Scanner.html | 2021-04-09 11:12 | 7.5K | |
![[TXT]](/icons/text.gif) | Shock Roach.html | 2021-04-09 11:12 | 5.1K | |
![[TXT]](/icons/text.gif) | Shock Trooper.html | 2021-04-09 11:12 | 7.6K | |
![[TXT]](/icons/text.gif) | Shockroach.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Shorepoint.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | Shorepoint Base.html | 2021-04-09 11:12 | 7.2K | |
![[TXT]](/icons/text.gif) | Shotgun (HL1).html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Shotgun (HL2).html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Shotgun (disambiguation).html | 2021-04-09 11:12 | 187 | |
![[TXT]](/icons/text.gif) | Shotgun.html | 2021-04-09 11:12 | 119 | |
![[TXT]](/icons/text.gif) | Shotgun Soldier.html | 2021-04-09 11:12 | 173 | |
![[TXT]](/icons/text.gif) | Shu'ulathoi.html | 2021-04-09 11:12 | 383 | |
![[TXT]](/icons/text.gif) | Shuttle.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | Silo D.html | 2021-04-09 11:12 | 119 | |
![[TXT]](/icons/text.gif) | Simmons.html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | Skitch.html | 2021-04-09 11:12 | 3.4K | |
![[TXT]](/icons/text.gif) | Skyscraper.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Slave.html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | Smg1.html | 2021-04-09 11:12 | 113 | |
![[TXT]](/icons/text.gif) | Smithers.html | 2021-04-09 11:12 | 2.6K | |
![[TXT]](/icons/text.gif) | Snapbug.html | 2021-04-09 11:12 | 1.6K | |
![[TXT]](/icons/text.gif) | Snark.html | 2021-04-09 11:12 | 8.9K | |
![[TXT]](/icons/text.gif) | Snark Mine.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | Snark Trap.html | 2021-04-09 11:12 | 3.3K | |
![[TXT]](/icons/text.gif) | Sniper (HL2).html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | Sniper (disambiguation).html | 2021-04-09 11:12 | 396 | |
![[TXT]](/icons/text.gif) | Sniper.html | 2021-04-09 11:12 | 117 | |
![[TXT]](/icons/text.gif) | Sniper Rifle (cut weapon).html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | Sniper Rifle (disambiguation).html | 2021-04-09 11:12 | 571 | |
![[TXT]](/icons/text.gif) | Sniper Rifle.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | Snitch.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | Socket Wrench.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Soldier (disambiguation).html | 2021-04-09 11:12 | 820 | |
![[TXT]](/icons/text.gif) | Soldier.html | 2021-04-09 11:12 | 119 | |
![[TXT]](/icons/text.gif) | Songs To Test By.html | 2021-04-09 11:12 | 123 | |
![[TXT]](/icons/text.gif) | Sound Dog (disambiguation).html | 2021-04-09 11:12 | 299 | |
![[TXT]](/icons/text.gif) | Sound Dog.html | 2021-04-09 11:12 | 123 | |
![[TXT]](/icons/text.gif) | Soundtrack.html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | Soundtracks.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | Source.html | 2021-04-09 11:12 | 28K | |
![[TXT]](/icons/text.gif) | Source Engine.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | Source Particle Benchmark.html | 2021-04-09 11:12 | 9.4K | |
![[TXT]](/icons/text.gif) | Source SDK.html | 2021-04-09 11:12 | 4.9K | |
![[TXT]](/icons/text.gif) | Space Biker.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | Space Core.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Spacebiker.html | 2021-04-09 11:12 | 710 | |
![[TXT]](/icons/text.gif) | Speaker System.html | 2021-04-09 11:12 | 24K | |
![[TXT]](/icons/text.gif) | Specimen 1176.html | 2021-04-09 11:12 | 8.2K | |
![[TXT]](/icons/text.gif) | Spore.html | 2021-04-09 11:12 | 4.6K | |
![[TXT]](/icons/text.gif) | Spore Launcher.html | 2021-04-09 11:12 | 4.8K | |
![[TXT]](/icons/text.gif) | Spore Missile Launcher.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Sprite.html | 2021-04-09 11:12 | 5.5K | |
![[TXT]](/icons/text.gif) | Squad.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Squad Following.html | 2021-04-09 11:12 | 29K | |
![[TXT]](/icons/text.gif) | St. Olga.html | 2021-04-09 11:12 | 9.5K | |
![[TXT]](/icons/text.gif) | St Olga.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | Stalker.html | 2021-04-09 11:12 | 9.0K | |
![[TXT]](/icons/text.gif) | Stampeder.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | Standard Antlion.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Standard Headcrab.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Standard Ration.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Standard Zombie.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Stanley.html | 2021-04-09 11:12 | 125 | |
![[TXT]](/icons/text.gif) | Stanley Rosenberg.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Stanley Rosenburg.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Stasis Chamber.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | Station 6.html | 2021-04-09 11:12 | 5.6K | |
![[TXT]](/icons/text.gif) | Station 7.html | 2021-04-09 11:12 | 4.7K | |
![[TXT]](/icons/text.gif) | Station 8.html | 2021-04-09 11:12 | 2.3K | |
![[TXT]](/icons/text.gif) | Station 9.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Station 12.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Station 21.html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Station Eight.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Station Seven.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Station Six.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Station Twelve.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Steam.html | 2021-04-09 11:12 | 34K | |
![[TXT]](/icons/text.gif) | Stelly.html | 2021-04-09 11:12 | 406 | |
![[TXT]](/icons/text.gif) | Stenographer's chasm.html | 2021-04-09 11:12 | 204 | |
![[TXT]](/icons/text.gif) | Stenographer chasm.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Stephen Bahl.html | 2021-04-09 11:12 | 4.7K | |
![[TXT]](/icons/text.gif) | Stephen Merchant.html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | Sterilizer.html | 2021-04-09 11:12 | 182 | |
![[TXT]](/icons/text.gif) | Sticking Gel.html | 2021-04-09 11:12 | 3.0K | |
![[TXT]](/icons/text.gif) | Sticky Bomb.html | 2021-04-09 11:12 | 717 | |
![[TXT]](/icons/text.gif) | Sticky Gun.html | 2021-04-09 11:12 | 1.4K | |
![[TXT]](/icons/text.gif) | Sticky Launcher.html | 2021-04-09 11:12 | 3.2K | |
![[TXT]](/icons/text.gif) | Still Alive.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Stinger.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Storyline.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | Strider.html | 2021-04-09 11:12 | 28K | |
![[TXT]](/icons/text.gif) | Strider Buster.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | Stukabat.html | 2021-04-09 11:12 | 3.0K | |
![[TXT]](/icons/text.gif) | Stun Baton.html | 2021-04-09 11:12 | 6.0K | |
![[TXT]](/icons/text.gif) | Stun stick.html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | Stunstick.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Submarine.html | 2021-04-09 11:12 | 28K | |
![[TXT]](/icons/text.gif) | Super 8.html | 2021-04-09 11:12 | 582 | |
![[TXT]](/icons/text.gif) | Super 8 Interactive Teaser.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Super organism.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Superportal.html | 2021-04-09 11:12 | 3.4K | |
![[TXT]](/icons/text.gif) | Supply Crate.html | 2021-04-09 11:12 | 1.5K | |
![[TXT]](/icons/text.gif) | Suppression Device.html | 2021-04-09 11:12 | 159 | |
![[TXT]](/icons/text.gif) | Suppression Field.html | 2021-04-09 11:12 | 5.0K | |
![[TXT]](/icons/text.gif) | Surface Call.html | 2021-04-09 11:12 | 180 | |
![[TXT]](/icons/text.gif) | Surface Tension.html | 2021-04-09 11:12 | 1.6K | |
![[TXT]](/icons/text.gif) | Survey Team.html | 2021-04-09 11:12 | 165 | |
![[TXT]](/icons/text.gif) | Survivor.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Sven Co-op.html | 2021-04-09 11:12 | 516 | |
![[TXT]](/icons/text.gif) | Sven Co-op 2.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Sweepy.html | 2021-04-09 11:12 | 2.4K | |
![[TXT]](/icons/text.gif) | Sweet Half-Life & Deliverance.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Sweet Half-Life.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | Synergy.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | Synth.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Sysop.html | 2021-04-09 11:12 | 157 | |
![[TXT]](/icons/text.gif) | Sysops.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | T-Minus One.html | 2021-04-09 11:12 | 193 | |
![[TXT]](/icons/text.gif) | TBot.html | 2021-04-09 11:12 | 32K | |
![[TXT]](/icons/text.gif) | TBot1.html | 2021-04-09 11:12 | 3.3K | |
![[TXT]](/icons/text.gif) | T Dog.html | 2021-04-09 11:12 | 2.5K | |
![[TXT]](/icons/text.gif) | TS9.html | 2021-04-09 11:12 | 38K | |
![[TXT]](/icons/text.gif) | TV.html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | TV monitor.html | 2021-04-09 11:12 | 3.7K | |
![[TXT]](/icons/text.gif) | Tactical Map.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Tag.html | 2021-04-09 11:12 | 113 | |
![[TXT]](/icons/text.gif) | Tag The Power of Paint.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | Take-A-Wish Foundation.html | 2021-04-09 11:12 | 157 | |
![[TXT]](/icons/text.gif) | Tank (disambiguation).html | 2021-04-09 11:12 | 11K | |
![[TXT]](/icons/text.gif) | Tank.html | 2021-04-09 11:12 | 113 | |
![[TXT]](/icons/text.gif) | Tau Cannon.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Tbot1..html | 2021-04-09 11:12 | 124 | |
![[TXT]](/icons/text.gif) | Teasley.html | 2021-04-09 11:12 | 680 | |
![[TXT]](/icons/text.gif) | Technical.html | 2021-04-09 11:12 | 23K | |
![[TXT]](/icons/text.gif) | Technical Trainstation.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Technics.html | 2021-04-09 11:12 | 660 | |
![[TXT]](/icons/text.gif) | Technology.html | 2021-04-09 11:12 | 154 | |
![[TXT]](/icons/text.gif) | Ted Backman.html | 2021-04-09 11:12 | 15K | |
![[TXT]](/icons/text.gif) | Ted Chort.html | 2021-04-09 11:12 | 165 | |
![[TXT]](/icons/text.gif) | Ted Cohrt.html | 2021-04-09 11:12 | 165 | |
![[TXT]](/icons/text.gif) | Ted Kosmatka.html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | Teleport.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Teleportation.html | 2021-04-09 11:12 | 24K | |
![[TXT]](/icons/text.gif) | Teleporter.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Television.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Tentacle.html | 2021-04-09 11:12 | 20K | |
![[TXT]](/icons/text.gif) | Terminal.html | 2021-04-09 11:12 | 6.8K | |
![[TXT]](/icons/text.gif) | Terminal Plaza.html | 2021-04-09 11:12 | 162 | |
![[TXT]](/icons/text.gif) | Test.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | Test1.html | 2021-04-09 11:12 | 349 | |
![[TXT]](/icons/text.gif) | Test12.html | 2021-04-09 11:12 | 132 | |
![[TXT]](/icons/text.gif) | Test Chamber (disambiguation).html | 2021-04-09 11:12 | 538 | |
![[TXT]](/icons/text.gif) | Test Chamber.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Test Chamber 00.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chamber 01.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chamber 02.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chamber 03.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chamber 04.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chamber 05.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chamber 06.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chamber 07.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chamber 08.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chamber 09.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chamber 3.html | 2021-04-09 11:12 | 174 | |
![[TXT]](/icons/text.gif) | Test Chamber 10.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chamber 11.html | 2021-04-09 11:12 | 2.0K | |
![[TXT]](/icons/text.gif) | Test Chamber 12.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chamber 13.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chamber 14.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chamber 15.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chamber 16.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chamber 17.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chamber 18.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chamber 19.html | 2021-04-09 11:12 | 177 | |
![[TXT]](/icons/text.gif) | Test Chambers.html | 2021-04-09 11:12 | 9.2K | |
![[TXT]](/icons/text.gif) | Test Lab C-33a.html | 2021-04-09 11:12 | 8.2K | |
![[TXT]](/icons/text.gif) | Test Shaft 02.html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | Test Shaft 09.html | 2021-04-09 11:12 | 118K | |
![[TXT]](/icons/text.gif) | Test Shaft 9.html | 2021-04-09 11:12 | 8.6K | |
![[TXT]](/icons/text.gif) | Test Shafts.html | 2021-04-09 11:12 | 576 | |
![[TXT]](/icons/text.gif) | Test Subject.html | 2021-04-09 11:12 | 9.2K | |
![[TXT]](/icons/text.gif) | Test Subject 042.html | 2021-04-09 11:12 | 3.0K | |
![[TXT]](/icons/text.gif) | Test Subject 1.html | 2021-04-09 11:12 | 132 | |
![[TXT]](/icons/text.gif) | Test Subject 42.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Test Subject 234.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | Test Subject 1438.html | 2021-04-09 11:12 | 135 | |
![[TXT]](/icons/text.gif) | Testing Tracks.html | 2021-04-09 11:12 | 8.7K | |
![[TXT]](/icons/text.gif) | Testing track.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | That Long Train Ride.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | The 2003 leak.html | 2021-04-09 11:12 | 117 | |
![[TXT]](/icons/text.gif) | The Administrator.html | 2021-04-09 11:12 | 33K | |
![[TXT]](/icons/text.gif) | The Announcer.html | 2021-04-09 11:12 | 193 | |
![[TXT]](/icons/text.gif) | The Black Mesa Times.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | The Borealis.html | 2021-04-09 11:12 | 650 | |
![[TXT]](/icons/text.gif) | The Cake.html | 2021-04-09 11:12 | 124 | |
![[TXT]](/icons/text.gif) | The Citizen (Modification).html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | The Citizen.html | 2021-04-09 11:12 | 39K | |
![[TXT]](/icons/text.gif) | The Coast.html | 2021-04-09 11:12 | 23K | |
![[TXT]](/icons/text.gif) | The Cold Boot.html | 2021-04-09 11:12 | 6.9K | |
![[TXT]](/icons/text.gif) | The Combine.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | The Consul.html | 2021-04-09 11:12 | 6.9K | |
![[TXT]](/icons/text.gif) | The Courtesy Call.html | 2021-04-09 11:12 | 690 | |
![[TXT]](/icons/text.gif) | The Escape.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | The Fall.html | 2021-04-09 11:12 | 119 | |
![[TXT]](/icons/text.gif) | The Fat Lady Sings.html | 2021-04-09 11:12 | 322 | |
![[TXT]](/icons/text.gif) | The Final Hours of Portal 2.html | 2021-04-09 11:12 | 5.0K | |
![[TXT]](/icons/text.gif) | The Fisherman.html | 2021-04-09 11:12 | 5.6K | |
![[TXT]](/icons/text.gif) | The Flash Version.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | The Flash Version MapPack.html | 2021-04-09 11:12 | 181 | |
![[TXT]](/icons/text.gif) | The G-Man.html | 2021-04-09 11:12 | 62K | |
![[TXT]](/icons/text.gif) | The Hub.html | 2021-04-09 11:12 | 121 | |
![[TXT]](/icons/text.gif) | The Itch.html | 2021-04-09 11:12 | 119 | |
![[TXT]](/icons/text.gif) | The Junk Yard.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | The Lambda Logo.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | The Mesa Times.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | The National.html | 2021-04-09 11:12 | 2.3K | |
![[TXT]](/icons/text.gif) | The Orange Box.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | The Orange Box Achievements.html | 2021-04-09 11:12 | 41K | |
![[TXT]](/icons/text.gif) | The Orange Box Cheats.html | 2021-04-09 11:12 | 6.8K | |
![[TXT]](/icons/text.gif) | The Orange Box Original Soundtrack.html | 2021-04-09 11:12 | 6.7K | |
![[TXT]](/icons/text.gif) | The Outlands.html | 2021-04-09 11:12 | 7.6K | |
![[TXT]](/icons/text.gif) | The Package.html | 2021-04-09 11:12 | 783 | |
![[TXT]](/icons/text.gif) | The Potato Sack.html | 2021-04-09 11:12 | 159 | |
![[TXT]](/icons/text.gif) | The Power of Paint.html | 2021-04-09 11:12 | 128 | |
![[TXT]](/icons/text.gif) | The Radio Tower.html | 2021-04-09 11:12 | 4.6K | |
![[TXT]](/icons/text.gif) | The Resistance.html | 2021-04-09 11:12 | 8.9K | |
![[TXT]](/icons/text.gif) | The Reunion.html | 2021-04-09 11:12 | 125 | |
![[TXT]](/icons/text.gif) | The Specialists.html | 2021-04-09 11:12 | 3.6K | |
![[TXT]](/icons/text.gif) | The Surprise.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | The Terminal.html | 2021-04-09 11:12 | 2.6K | |
![[TXT]](/icons/text.gif) | The Uprising.html | 2021-04-09 11:12 | 30K | |
![[TXT]](/icons/text.gif) | The Valve Guy.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | The Wasteland.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | The White Forest Inn.html | 2021-04-09 11:12 | 6.1K | |
![[TXT]](/icons/text.gif) | The beta.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | The border world.html | 2021-04-09 11:12 | 7.1K | |
![[TXT]](/icons/text.gif) | The cake is a lie.html | 2021-04-09 11:12 | 133 | |
![[TXT]](/icons/text.gif) | Thecakeisalie.html | 2021-04-09 11:12 | 129 | |
![[TXT]](/icons/text.gif) | The leak.html | 2021-04-09 11:12 | 112 | |
![[TXT]](/icons/text.gif) | Theodore.html | 2021-04-09 11:12 | 426 | |
![[TXT]](/icons/text.gif) | Thermal Discouragement.html | 2021-04-09 11:12 | 184 | |
![[TXT]](/icons/text.gif) | Thermal Discouragement Beam.html | 2021-04-09 11:12 | 7.7K | |
![[TXT]](/icons/text.gif) | They Hunger.html | 2021-04-09 11:12 | 19K | |
![[TXT]](/icons/text.gif) | This Vortal Coil.html | 2021-04-09 11:12 | 185 | |
![[TXT]](/icons/text.gif) | Thumper (disambiguation).html | 2021-04-09 11:12 | 1.5K | |
![[TXT]](/icons/text.gif) | Thumper.html | 2021-04-09 11:12 | 4.0K | |
![[TXT]](/icons/text.gif) | Tier 3.html | 2021-04-09 11:12 | 29K | |
![[TXT]](/icons/text.gif) | Time line.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | Timeline.html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | Timeline of Events.html | 2021-04-09 11:12 | 2.1K | |
![[TXT]](/icons/text.gif) | Timeline of the Half-Life series.html | 2021-04-09 11:12 | 154 | |
![[TXT]](/icons/text.gif) | Timeline of the Half-Life universe.html | 2021-04-09 11:12 | 38K | |
![[TXT]](/icons/text.gif) | To The White Forest.html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | To White Forest.html | 2021-04-09 11:12 | 717 | |
![[TXT]](/icons/text.gif) | Tobias.html | 2021-04-09 11:12 | 126 | |
![[TXT]](/icons/text.gif) | Tolman.html | 2021-04-09 11:12 | 359 | |
![[TXT]](/icons/text.gif) | Tony Todd.html | 2021-04-09 11:12 | 1.3K | |
![[TXT]](/icons/text.gif) | Tool.html | 2021-04-09 11:12 | 128 | |
![[TXT]](/icons/text.gif) | Topside Hydro Plant.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Topside Motorpool.html | 2021-04-09 11:12 | 6.8K | |
![[TXT]](/icons/text.gif) | Tower.html | 2021-04-09 11:12 | 295 | |
![[TXT]](/icons/text.gif) | Tower door.html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | Tower guard.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Town.html | 2021-04-09 11:12 | 22K | |
![[TXT]](/icons/text.gif) | Toxic Waste.html | 2021-04-09 11:12 | 1.2K | |
![[TXT]](/icons/text.gif) | Tractor Beam.html | 2021-04-09 11:12 | 186 | |
![[TXT]](/icons/text.gif) | Train.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Training Facility.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Trains.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Trainstation (disambiguation).html | 2021-04-09 11:12 | 639 | |
![[TXT]](/icons/text.gif) | Train station.html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | Trainstation.html | 2021-04-09 11:12 | 3.4K | |
![[TXT]](/icons/text.gif) | Trainstation Plaza.html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | Train stations.html | 2021-04-09 11:12 | 6.2K | |
![[TXT]](/icons/text.gif) | Trainstations.html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | Trainyard.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Trainyards.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Tram.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Trams.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Transhuman.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Transit.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Transit system.html | 2021-04-09 11:12 | 172 | |
![[TXT]](/icons/text.gif) | Transmission Received.html | 2021-04-09 11:12 | 173 | |
![[TXT]](/icons/text.gif) | Transponder.html | 2021-04-09 11:12 | 3.4K | |
![[TXT]](/icons/text.gif) | Trap.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | Traps.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Traptown.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | Tri Nguyen.html | 2021-04-09 11:12 | 2.6K | |
![[TXT]](/icons/text.gif) | Tripmine (disambiguation).html | 2021-04-09 11:12 | 562 | |
![[TXT]](/icons/text.gif) | Tripmine.html | 2021-04-09 11:12 | 121 | |
![[TXT]](/icons/text.gif) | Tripod Hopper.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | Tripwire Grenade.html | 2021-04-09 11:12 | 25K | |
![[TXT]](/icons/text.gif) | Tristan Reidford.html | 2021-04-09 11:12 | 3.6K | |
![[TXT]](/icons/text.gif) | Trock.html | 2021-04-09 11:12 | 378 | |
![[TXT]](/icons/text.gif) | Troop Carrier.html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | Truck.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Turret.html | 2021-04-09 11:12 | 507 | |
![[TXT]](/icons/text.gif) | Turret Incinerator.html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | Turret King.html | 2021-04-09 11:12 | 141 | |
![[TXT]](/icons/text.gif) | Turret Manufacturing.html | 2021-04-09 11:12 | 7.8K | |
![[TXT]](/icons/text.gif) | Turret Opera.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Turret Quartet.html | 2021-04-09 11:12 | 7.5K | |
![[TXT]](/icons/text.gif) | Turret Redemption.html | 2021-04-09 11:12 | 165 | |
![[TXT]](/icons/text.gif) | Turret Redemption Line.html | 2021-04-09 11:12 | 170 | |
![[TXT]](/icons/text.gif) | Turret Redemption Lines.html | 2021-04-09 11:12 | 171 | |
![[TXT]](/icons/text.gif) | Turret Sentry.html | 2021-04-09 11:12 | 165 | |
![[TXT]](/icons/text.gif) | Turret Sentry Opera.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Turret Wife.html | 2021-04-09 11:12 | 26K | |
![[TXT]](/icons/text.gif) | Turret Wife Serenade.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Two Bots, One Wrench.html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | USP.html | 2021-04-09 11:12 | 1.9K | |
![[TXT]](/icons/text.gif) | USP Match.html | 2021-04-09 11:12 | 8.9K | |
![[TXT]](/icons/text.gif) | USP Match Pistol.html | 2021-04-09 11:12 | 142 | |
![[TXT]](/icons/text.gif) | USS Darkstar.html | 2021-04-09 11:12 | 3.5K | |
![[TXT]](/icons/text.gif) | Uknown Red Personality Core.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Underground Railroad.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | Under the Radar.html | 2021-04-09 11:12 | 209 | |
![[TXT]](/icons/text.gif) | Undue Alarm.html | 2021-04-09 11:12 | 138 | |
![[TXT]](/icons/text.gif) | Unforeseen Consequences.html | 2021-04-09 11:12 | 195 | |
![[TXT]](/icons/text.gif) | Unforseen Consequences.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Unidentified Aperture Science Gel.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | Unidentified Synth.html | 2021-04-09 11:12 | 170 | |
![[TXT]](/icons/text.gif) | Unidentified Test Shaft.html | 2021-04-09 11:12 | 163 | |
![[TXT]](/icons/text.gif) | Unidentified cut Synth.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | Unidentified deaf character.html | 2021-04-09 11:12 | 3.4K | |
![[TXT]](/icons/text.gif) | Unnamed red Personality Construct.html | 2021-04-09 11:12 | 217 | |
![[TXT]](/icons/text.gif) | Unstationary Scaffold.html | 2021-04-09 11:12 | 205 | |
![[TXT]](/icons/text.gif) | Uplink.html | 2021-04-09 11:12 | 146 | |
![[TXT]](/icons/text.gif) | Uprising.html | 2021-04-09 11:12 | 315 | |
![[TXT]](/icons/text.gif) | Urban Flight.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Uriah.html | 2021-04-09 11:12 | 3.5K | |
![[TXT]](/icons/text.gif) | V-22 Osprey.html | 2021-04-09 11:12 | 6.9K | |
![[TXT]](/icons/text.gif) | Valve.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Valve Corporation.html | 2021-04-09 11:12 | 28K | |
![[TXT]](/icons/text.gif) | Valve Guy.html | 2021-04-09 11:12 | 135 | |
![[TXT]](/icons/text.gif) | Valve Hammer Editor.html | 2021-04-09 11:12 | 6.1K | |
![[TXT]](/icons/text.gif) | Valve PotatoFoolsDay ARG.html | 2021-04-09 11:12 | 168 | |
![[TXT]](/icons/text.gif) | Valve Software.html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | Van Buren.html | 2021-04-09 11:12 | 360 | |
![[TXT]](/icons/text.gif) | VanDolen.html | 2021-04-09 11:12 | 373 | |
![[TXT]](/icons/text.gif) | Vance (disambiguation).html | 2021-04-09 11:12 | 627 | |
![[TXT]](/icons/text.gif) | Vance.html | 2021-04-09 11:12 | 3.9K | |
![[TXT]](/icons/text.gif) | Vance HQ.html | 2021-04-09 11:12 | 152 | |
![[TXT]](/icons/text.gif) | VanceHQ.html | 2021-04-09 11:12 | 151 | |
![[TXT]](/icons/text.gif) | Vance Headquarters.html | 2021-04-09 11:12 | 6.4K | |
![[TXT]](/icons/text.gif) | Vault.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Vectors.html | 2021-04-09 11:12 | 5.3K | |
![[TXT]](/icons/text.gif) | Veevaert.html | 2021-04-09 11:12 | 440 | |
![[TXT]](/icons/text.gif) | Vending machine.html | 2021-04-09 11:12 | 4.2K | |
![[TXT]](/icons/text.gif) | Vertigo.html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | Vicarious Reality.html | 2021-04-09 11:12 | 1.5K | |
![[TXT]](/icons/text.gif) | Victor.html | 2021-04-09 11:12 | 300 | |
![[TXT]](/icons/text.gif) | Victory Lift.html | 2021-04-09 11:12 | 2.1K | |
![[TXT]](/icons/text.gif) | Victory Mine.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Victory Mine Vortigaunt.html | 2021-04-09 11:12 | 6.0K | |
![[TXT]](/icons/text.gif) | Viktor Antonov.html | 2021-04-09 11:12 | 12K | |
![[TXT]](/icons/text.gif) | Vital Apparatus Vent.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Vocoder.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | Voice actors.html | 2021-04-09 11:12 | 160 | |
![[TXT]](/icons/text.gif) | Voltigore.html | 2021-04-09 11:12 | 4.7K | |
![[TXT]](/icons/text.gif) | Vort.html | 2021-04-09 11:12 | 24K | |
![[TXT]](/icons/text.gif) | Vortessence.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Vortex Hopwire.html | 2021-04-09 11:12 | 4.3K | |
![[TXT]](/icons/text.gif) | Vorti-Cell.html | 2021-04-09 11:12 | 2.4K | |
![[TXT]](/icons/text.gif) | Vorticell.html | 2021-04-09 11:12 | 47K | |
![[TXT]](/icons/text.gif) | Vortigaunt.html | 2021-04-09 11:12 | 40K | |
![[TXT]](/icons/text.gif) | Vortigaunt Antlion trainer.html | 2021-04-09 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | Vortigaunt Camp.html | 2021-04-09 11:12 | 5.7K | |
![[TXT]](/icons/text.gif) | Vortigaunt Shepherd.html | 2021-04-09 11:12 | 283 | |
![[TXT]](/icons/text.gif) | Vortigese.html | 2021-04-09 11:12 | 4.4K | |
![[TXT]](/icons/text.gif) | Vox.html | 2021-04-09 11:12 | 171 | |
![[TXT]](/icons/text.gif) | WC map pack.html | 2021-04-09 11:12 | 121 | |
![[TXT]](/icons/text.gif) | WC mappack.html | 2021-04-09 11:12 | 633 | |
![[TXT]](/icons/text.gif) | WF.html | 2021-04-09 11:12 | 13K | |
![[TXT]](/icons/text.gif) | Walker.html | 2021-04-09 11:12 | 424 | |
![[TXT]](/icons/text.gif) | Wallace Breen.html | 2021-04-09 11:12 | 35K | |
![[TXT]](/icons/text.gif) | Walter's World.html | 2021-04-09 11:12 | 25K | |
![[TXT]](/icons/text.gif) | Walter.html | 2021-04-09 11:12 | 140 | |
![[TXT]](/icons/text.gif) | Walter Bennet.html | 2021-04-09 11:12 | 6.5K | |
![[TXT]](/icons/text.gif) | Walter Bennett.html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | Want You Gone.html | 2021-04-09 11:12 | 4.7K | |
![[TXT]](/icons/text.gif) | Wardwell.html | 2021-04-09 11:12 | 5.4K | |
![[TXT]](/icons/text.gif) | Warhead.html | 2021-04-09 11:12 | 171 | |
![[TXT]](/icons/text.gif) | Waste Processing Area 3.html | 2021-04-09 11:12 | 8.2K | |
![[TXT]](/icons/text.gif) | Wasteland.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Wasteland Scanner.html | 2021-04-09 11:12 | 4.8K | |
![[TXT]](/icons/text.gif) | Wasteland Train.html | 2021-04-09 11:12 | 136 | |
![[TXT]](/icons/text.gif) | Watchtower.html | 2021-04-09 11:12 | 16K | |
![[TXT]](/icons/text.gif) | Water Hazard.html | 2021-04-09 11:12 | 128 | |
![[TXT]](/icons/text.gif) | We've Got Hostiles.html | 2021-04-09 11:12 | 574 | |
![[TXT]](/icons/text.gif) | We Are Not Alone.html | 2021-04-09 11:12 | 155 | |
![[TXT]](/icons/text.gif) | We Are Pulling Out.html | 2021-04-09 11:12 | 161 | |
![[TXT]](/icons/text.gif) | We Don't Go To Ravenholm....html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | Weapon Box.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | Weapon Stripper.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Weapons.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | Weapons cut from Half-Life 2.html | 2021-04-09 11:12 | 21K | |
![[TXT]](/icons/text.gif) | Weather Control.html | 2021-04-09 11:12 | 8.3K | |
![[TXT]](/icons/text.gif) | Weatley.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | We don't go to Ravenholm ....html | 2021-04-09 11:12 | 167 | |
![[TXT]](/icons/text.gif) | We don't go to Ravenholm.html | 2021-04-09 11:12 | 439 | |
![[TXT]](/icons/text.gif) | Weekday Warrior.html | 2021-04-09 11:12 | 60K | |
![[TXT]](/icons/text.gif) | Weighted Companion Cube.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | Weighted Pivot Cube.html | 2021-04-09 11:12 | 143 | |
![[TXT]](/icons/text.gif) | Weighted Storage Ball.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | Weighted Storage Ball Bucket.html | 2021-04-09 11:12 | 164 | |
![[TXT]](/icons/text.gif) | Weighted Storage Cube.html | 2021-04-09 11:12 | 147 | |
![[TXT]](/icons/text.gif) | Welcome to Black Mesa.html | 2021-04-09 11:12 | 157 | |
![[TXT]](/icons/text.gif) | Welding Torch.html | 2021-04-09 11:12 | 3.0K | |
![[TXT]](/icons/text.gif) | West.html | 2021-04-09 11:12 | 298 | |
![[TXT]](/icons/text.gif) | Whale.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | Wheatley's testing track.html | 2021-04-09 11:12 | 180 | |
![[TXT]](/icons/text.gif) | Wheatley.html | 2021-04-09 11:12 | 38K | |
![[TXT]](/icons/text.gif) | Wheatley Laboratories.html | 2021-04-09 11:12 | 9.0K | |
![[TXT]](/icons/text.gif) | Wheatly.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | Wheelchair.html | 2021-04-09 11:12 | 28K | |
![[TXT]](/icons/text.gif) | White Forest (region).html | 2021-04-09 11:12 | 153 | |
![[TXT]](/icons/text.gif) | White Forest.html | 2021-04-09 11:12 | 44K | |
![[TXT]](/icons/text.gif) | White Forest Caves.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | White Forest Inn.html | 2021-04-09 11:12 | 164 | |
![[TXT]](/icons/text.gif) | White Forest Mines.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | White Forest Mines Vortigaunt.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | White Forest base.html | 2021-04-09 11:12 | 149 | |
![[TXT]](/icons/text.gif) | White Forest rocket.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Whitley.html | 2021-04-09 11:12 | 131 | |
![[TXT]](/icons/text.gif) | Wiki.html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | William D. Kent.html | 2021-04-09 11:12 | 366 | |
![[TXT]](/icons/text.gif) | Winston.html | 2021-04-09 11:12 | 361 | |
![[TXT]](/icons/text.gif) | Witley.html | 2021-04-09 11:12 | 130 | |
![[TXT]](/icons/text.gif) | Won.html | 2021-04-09 11:12 | 129 | |
![[TXT]](/icons/text.gif) | Wood.html | 2021-04-09 11:12 | 404 | |
![[TXT]](/icons/text.gif) | Worlds Collide.html | 2021-04-09 11:12 | 144 | |
![[TXT]](/icons/text.gif) | Wrench.html | 2021-04-09 11:12 | 1.0K | |
![[TXT]](/icons/text.gif) | X-8973.html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | XM29 OICW.html | 2021-04-09 11:12 | 6.4K | |
![[TXT]](/icons/text.gif) | Xen (Chapter).html | 2021-04-09 11:12 | 154 | |
![[TXT]](/icons/text.gif) | Xen.html | 2021-04-09 11:12 | 24K | |
![[TXT]](/icons/text.gif) | Xen Attacks (bonus chapter).html | 2021-04-09 11:12 | 4.1K | |
![[TXT]](/icons/text.gif) | Xen Attacks.html | 2021-04-09 11:12 | 148 | |
![[TXT]](/icons/text.gif) | Xen Ceiling Turret.html | 2021-04-09 11:12 | 2.7K | |
![[TXT]](/icons/text.gif) | Xen Controller.html | 2021-04-09 11:12 | 154 | |
![[TXT]](/icons/text.gif) | Xen Fungi.html | 2021-04-09 11:12 | 137 | |
![[TXT]](/icons/text.gif) | Xen Fungus.html | 2021-04-09 11:12 | 4.0K | |
![[TXT]](/icons/text.gif) | Xen Grunt.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Xen Healing Pond.html | 2021-04-09 11:12 | 156 | |
![[TXT]](/icons/text.gif) | Xen Healing Pool.html | 2021-04-09 11:12 | 4.7K | |
![[TXT]](/icons/text.gif) | Xen Healing Shower.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | Xen Protozoa.html | 2021-04-09 11:12 | 1.7K | |
![[TXT]](/icons/text.gif) | Xen Protozoan.html | 2021-04-09 11:12 | 139 | |
![[TXT]](/icons/text.gif) | Xen Sentry Cannon.html | 2021-04-09 11:12 | 3.3K | |
![[TXT]](/icons/text.gif) | Xen Sentry Turret.html | 2021-04-09 11:12 | 166 | |
![[TXT]](/icons/text.gif) | Xen Slave.html | 2021-04-09 11:12 | 23K | |
![[TXT]](/icons/text.gif) | Xen Survey Team.html | 2021-04-09 11:12 | 169 | |
![[TXT]](/icons/text.gif) | Xen Thumper.html | 2021-04-09 11:12 | 2.2K | |
![[TXT]](/icons/text.gif) | Xen Trampoline.html | 2021-04-09 11:12 | 2.8K | |
![[TXT]](/icons/text.gif) | Xen Tree.html | 2021-04-09 11:12 | 3.6K | |
![[TXT]](/icons/text.gif) | Xen Turret.html | 2021-04-09 11:12 | 159 | |
![[TXT]](/icons/text.gif) | Xen crystal.html | 2021-04-09 11:12 | 10K | |
![[TXT]](/icons/text.gif) | Xenotherus icthycanthus.html | 2021-04-09 11:12 | 308 | |
![[TXT]](/icons/text.gif) | Yatsze Mark.html | 2021-04-09 11:12 | 6.4K | |
![[TXT]](/icons/text.gif) | ZPEFM.html | 2021-04-09 11:12 | 8.1K | |
![[TXT]](/icons/text.gif) | Zen.html | 2021-04-09 11:12 | 2.6K | |
![[TXT]](/icons/text.gif) | Zentraedi Tactical Battle Pod.html | 2021-04-09 11:12 | 2.1K | |
![[TXT]](/icons/text.gif) | Zero-Point Energy Field Manipulator.html | 2021-04-09 11:12 | 158 | |
![[TXT]](/icons/text.gif) | Zero Point Energy Field Manipulator.html | 2021-04-09 11:12 | 18K | |
![[TXT]](/icons/text.gif) | Zero Point Generator.html | 2021-04-09 11:12 | 1.1K | |
![[TXT]](/icons/text.gif) | Zombie.html | 2021-04-09 11:12 | 7.8K | |
![[TXT]](/icons/text.gif) | Zombie Assassin.html | 2021-04-09 11:12 | 1.5K | |
![[TXT]](/icons/text.gif) | Zombie Panic.html | 2021-04-09 11:12 | 4.0K | |
![[TXT]](/icons/text.gif) | Zombie Panic Source.html | 2021-04-09 11:12 | 4.8K | |
![[TXT]](/icons/text.gif) | Zombie Torso.html | 2021-04-09 11:12 | 150 | |
![[TXT]](/icons/text.gif) | Zombie Town.html | 2021-04-09 11:12 | 159 | |
![[TXT]](/icons/text.gif) | Zombine.html | 2021-04-09 11:12 | 8.9K | |
![[TXT]](/icons/text.gif) | Zulu Bunsen.html | 2021-04-09 11:12 | 145 | |
![[TXT]](/icons/text.gif) | style.css | 2021-04-09 11:12 | 122 | |
|