![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 'Ton Hotel.html | 2021-04-09 11:12 | 3.3K | |
| 1st Force Recon Company Log.html | 2021-04-09 11:12 | 1.1K | |
| 5.56mm M404 Heavy Rifle.html | 2021-04-09 11:12 | 284 | |
| 10mm Cartel Special.html | 2021-04-09 11:12 | 1.7K | |
| 10mm pistol.html | 2021-04-09 11:12 | 205 | |
| 80-X Boxguard.html | 2021-04-09 11:12 | 4.0K | |
| 240-Series BMRS.html | 2021-04-09 11:12 | 1.3K | |
| 241-Series MRS.html | 2021-04-09 11:12 | 1.0K | |
| 329-Series MPRS.html | 2021-04-09 11:12 | 124 | |
| 2007 Deus Ex 3 Trailer.html | 2021-04-09 11:12 | 8.5K | |
| 2052.html | 2021-04-09 11:12 | 123 | |
| 2072.html | 2021-04-09 11:12 | 123 | |
| 100101 small security bot.html | 2021-04-09 11:12 | 4.9K | |
| A Coalition For Liberty (eBook).html | 2021-04-09 11:12 | 1.5K | |
| A Frontier Too Far (eBook).html | 2021-04-09 11:12 | 2.2K | |
| AI.html | 2021-04-09 11:12 | 660 | |
| AJ09-0921 Patient X (eBook).html | 2021-04-09 11:12 | 240 | |
| AJ09-0921 Patient X.html | 2021-04-09 11:12 | 2.6K | |
| AJacobson.html | 2021-04-09 11:12 | 210 | |
| A Matter of Discretion.html | 2021-04-09 11:12 | 2.1K | |
| ANavarre.html | 2021-04-09 11:12 | 207 | |
| APR.html | 2021-04-09 11:12 | 21K | |
| Abana Khodair.html | 2021-04-09 11:12 | 1.3K | |
| Abandoned Gas Station.html | 2021-04-09 11:12 | 2.3K | |
| Accord de Contrat.html | 2021-04-09 11:12 | 911 | |
| Achievements (Deus Ex The Fall).html | 2021-04-09 11:12 | 6.0K | |
| Achievements and Trophies (DX3).html | 2021-04-09 11:12 | 14K | |
| Acquaintances Forgotten (achievement).html | 2021-04-09 11:12 | 2.6K | |
| Acquaintances Forgotten.html | 2021-04-09 11:12 | 8.9K | |
| Adam Jensen's apartment.html | 2021-04-09 11:12 | 15K | |
| Adam Jensen.html | 2021-04-09 11:12 | 41K | |
| Adam Weishaupt.html | 2021-04-09 11:12 | 7.7K | |
| Adept 34501.html | 2021-04-09 11:12 | 1.4K | |
| Advanced Clock Building.html | 2021-04-09 11:12 | 2.3K | |
| Affaires le France.html | 2021-04-09 11:12 | 1.4K | |
| Agent Hela.html | 2021-04-09 11:12 | 1.7K | |
| Aggressive Defense System.html | 2021-04-09 11:12 | 4.0K | |
| Al Goulem.html | 2021-04-09 11:12 | 6.8K | |
| Alain Bourges-Manoury.html | 2021-04-09 11:12 | 240 | |
| Alain Bourges-Maunoury.html | 2021-04-09 11:12 | 1.0K | |
| Alarm.html | 2021-04-09 11:12 | 11K | |
| Alex D.html | 2021-04-09 11:12 | 203 | |
| Alex Denton.html | 2021-04-09 11:12 | 12K | |
| Alex Jacobson's computer.html | 2021-04-09 11:12 | 3.7K | |
| Alex Jacobson.html | 2021-04-09 11:12 | 5.3K | |
| Alex Vega.html | 2021-04-09 11:12 | 6.6K | |
| Alexander Brandon.html | 2021-04-09 11:12 | 855 | |
| Alice Garden Pods.html | 2021-04-09 11:12 | 14K | |
| Alice Priest's computer.html | 2021-04-09 11:12 | 1.2K | |
| All of the Above.html | 2021-04-09 11:12 | 1.9K | |
| Ambrosia.html | 2021-04-09 11:12 | 3.4K | |
| Ambrosia vial.html | 2021-04-09 11:12 | 6.2K | |
| America.html | 2021-04-09 11:12 | 230 | |
| Ammo.html | 2021-04-09 11:12 | 375 | |
| Ammo scavenger.html | 2021-04-09 11:12 | 4.2K | |
| Ammunition (DX).html | 2021-04-09 11:12 | 5.7K | |
| Ammunition (DX1).html | 2021-04-09 11:12 | 3.0K | |
| Ammunition (DX3).html | 2021-04-09 11:12 | 9.9K | |
| Ammunition.html | 2021-04-09 11:12 | 11K | |
| Andrea Mantegna.html | 2021-04-09 11:12 | 2.7K | |
| Andreas Apergis.html | 2021-04-09 11:12 | 14K | |
| Anna Kelso.html | 2021-04-09 11:12 | 2.9K | |
| Anna Navarre's computer.html | 2021-04-09 11:12 | 5.6K | |
| Anna Navarre.html | 2021-04-09 11:12 | 9.7K | |
| Anonymous X.html | 2021-04-09 11:12 | 2.4K | |
| Antarctica.html | 2021-04-09 11:12 | 6.0K | |
| A personal invitation to AlexD, from Tarsus Academies.html | 2021-04-09 11:12 | 4.8K | |
| Apex Predator.html | 2021-04-09 11:12 | 4.1K | |
| ApostleCorp.html | 2021-04-09 11:12 | 5.7K | |
| Aqualung.html | 2021-04-09 11:12 | 1.7K | |
| Aquatic security bot.html | 2021-04-09 11:12 | 512 | |
| Aquinas.html | 2021-04-09 11:12 | 8.4K | |
| Aquinas Hub protocol.html | 2021-04-09 11:12 | 4.8K | |
| Archie Reynmann.html | 2021-04-09 11:12 | 27K | |
| ArchiveMain Page.html | 2021-04-09 11:12 | 6.2K | |
| Area 51.html | 2021-04-09 11:12 | 5.3K | |
| Arie van Bruggen.html | 2021-04-09 11:12 | 11K | |
| Arms (and Legs) for Man The Structure of Cybernetic Limbs.html | 2021-04-09 11:12 | 4.6K | |
| Arthur Holden.html | 2021-04-09 11:12 | 1.2K | |
| Artifical Muscles.html | 2021-04-09 11:12 | 228 | |
| Artificial Intelligence.html | 2021-04-09 11:12 | 2.3K | |
| Artificial Muscles.html | 2021-04-09 11:12 | 2.2K | |
| Art of War.html | 2021-04-09 11:12 | 1.0K | |
| Assassin Pistol.html | 2021-04-09 11:12 | 853 | |
| Assault rifle (DX3).html | 2021-04-09 11:12 | 1.4K | |
| Assault rifle (DXHR).html | 2021-04-09 11:12 | 152 | |
| Assault rifle.html | 2021-04-09 11:12 | 214 | |
| Assault shotgun.html | 2021-04-09 11:12 | 153 | |
| Aston Greer.html | 2021-04-09 11:12 | 656 | |
| Athene Margoulis.html | 2021-04-09 11:12 | 12K | |
| Aucun Dites Motel.html | 2021-04-09 11:12 | 1.6K | |
| Aug.html | 2021-04-09 11:12 | 1.4K | |
| Augmentation.html | 2021-04-09 11:12 | 6.1K | |
| Augmentation canister.html | 2021-04-09 11:12 | 3.3K | |
| Augmentation psychosis.html | 2021-04-09 11:12 | 18K | |
| Augmentations (DX).html | 2021-04-09 11:12 | 12K | |
| Augmentations(DX).html | 2021-04-09 11:12 | 781 | |
| Augmentations (DX2).html | 2021-04-09 11:12 | 11K | |
| Augmentations(DX2).html | 2021-04-09 11:12 | 125 | |
| Augmentations (DX3).html | 2021-04-09 11:12 | 57K | |
| Augmentations(DX3).html | 2021-04-09 11:12 | 125 | |
| Augmentations.html | 2021-04-09 11:12 | 8.0K | |
| Augmentations guide (DX3).html | 2021-04-09 11:12 | 14K | |
| Augmentations guide (Deus Ex Human Revolution).html | 2021-04-09 11:12 | 159 | |
| Augmentation upgrade canister.html | 2021-04-09 11:12 | 1.7K | |
| Augmented.html | 2021-04-09 11:12 | 7.8K | |
| Augmented Reality.html | 2021-04-09 11:12 | 1.4K | |
| Australian Civil War.html | 2021-04-09 11:12 | 3.3K | |
| Automated security bot.html | 2021-04-09 11:12 | 22K | |
| Automatic Unlocking Device.html | 2021-04-09 11:12 | 4.7K | |
| Ava Johnson.html | 2021-04-09 11:12 | 3.0K | |
| B13 Antimatter Reactors.html | 2021-04-09 11:12 | 4.6K | |
| BT F-28 Sanction Combat Rifle.html | 2021-04-09 11:12 | 1.6K | |
| Back Stage Pass(Achievement).html | 2021-04-09 11:12 | 3.8K | |
| Back Stage Pass(Avievement).html | 2021-04-09 11:12 | 211 | |
| Back Stage Pass (achievement).html | 2021-04-09 11:12 | 146 | |
| Back in the Saddle.html | 2021-04-09 11:12 | 4.3K | |
| Ballistic Protection.html | 2021-04-09 11:12 | 2.7K | |
| Ballistic armor.html | 2021-04-09 11:12 | 3.0K | |
| Balls (achievement).html | 2021-04-09 11:12 | 4.1K | |
| Balls.html | 2021-04-09 11:12 | 179 | |
| Bar Tab.html | 2021-04-09 11:12 | 6.7K | |
| Barrett.html | 2021-04-09 11:12 | 1.2K | |
| Baton (DX).html | 2021-04-09 11:12 | 4.6K | |
| Baton (DX2).html | 2021-04-09 11:12 | 3.9K | |
| Baton.html | 2021-04-09 11:12 | 1.4K | |
| Battery Park.html | 2021-04-09 11:12 | 2.6K | |
| Battle of Liberty Island.html | 2021-04-09 11:12 | 1.7K | |
| Bee-K.html | 2021-04-09 11:12 | 1.8K | |
| Beer (DX2).html | 2021-04-09 11:12 | 1.1K | |
| Beer (DX3).html | 2021-04-09 11:12 | 4.1K | |
| Beer.html | 2021-04-09 11:12 | 562 | |
| Bell Tower.html | 2021-04-09 11:12 | 2.6K | |
| Bell Tower Associates.html | 2021-04-09 11:12 | 1.1K | |
| Belltower.html | 2021-04-09 11:12 | 1.0K | |
| Belltower Associates.html | 2021-04-09 11:12 | 8.6K | |
| Belltower Group.html | 2021-04-09 11:12 | 2.2K | |
| Belltower dock.html | 2021-04-09 11:12 | 4.4K | |
| Belltower dockyard.html | 2021-04-09 11:12 | 392 | |
| Ben Saxon.html | 2021-04-09 11:12 | 18K | |
| Beth DuClare.html | 2021-04-09 11:12 | 6.3K | |
| Better Than Nature.html | 2021-04-09 11:12 | 2.5K | |
| Big Bro Surveilance.html | 2021-04-09 11:12 | 710 | |
| Big Bro Surveillance.html | 2021-04-09 11:12 | 1.0K | |
| Big cleaner bot.html | 2021-04-09 11:12 | 1.7K | |
| Bilderberg Group.html | 2021-04-09 11:12 | 1.7K | |
| Bill Green.html | 2021-04-09 11:12 | 6.8K | |
| Bill Taggart.html | 2021-04-09 11:12 | 4.5K | |
| Billie Adams.html | 2021-04-09 11:12 | 4.9K | |
| Binoculars.html | 2021-04-09 11:12 | 22K | |
| Biochips.html | 2021-04-09 11:12 | 18K | |
| Bioelectric cell (DX).html | 2021-04-09 11:12 | 2.1K | |
| Bioenergy.html | 2021-04-09 11:12 | 2.6K | |
| Biomod (unofficial mod).html | 2021-04-09 11:12 | 5.4K | |
| Biomod.html | 2021-04-09 11:12 | 180 | |
| Biomods.html | 2021-04-09 11:12 | 27K | |
| Black Echo.html | 2021-04-09 11:12 | 1.6K | |
| Black Gate.html | 2021-04-09 11:12 | 2.2K | |
| Black helicopter.html | 2021-04-09 11:12 | 779 | |
| Blackmailer.html | 2021-04-09 11:12 | 16K | |
| Blade.html | 2021-04-09 11:12 | 6.0K | |
| Blade of Shintaro.html | 2021-04-09 11:12 | 1.7K | |
| BlogRecent posts.html | 2021-04-09 11:12 | 4.5K | |
| Blue Fusion Reactor.html | 2021-04-09 11:12 | 2.1K | |
| Blurring The Boundaries between Man and Machine.html | 2021-04-09 11:12 | 4.9K | |
| Bob Page.html | 2021-04-09 11:12 | 9.1K | |
| Bobby Bao.html | 2021-04-09 11:12 | 3.7K | |
| Bobby Tindall.html | 2021-04-09 11:12 | 214 | |
| Bobson Synthetics Group.html | 2021-04-09 11:12 | 3.1K | |
| Boltcaster.html | 2021-04-09 11:12 | 1.6K | |
| Book.html | 2021-04-09 11:12 | 3.7K | |
| Books.html | 2021-04-09 11:12 | 305 | |
| Bot.html | 2021-04-09 11:12 | 4.5K | |
| Boulangerie Centrale.html | 2021-04-09 11:12 | 761 | |
| Bread.html | 2021-04-09 11:12 | 1.1K | |
| Brent Radford.html | 2021-04-09 11:12 | 5.9K | |
| Brett Steed.html | 2021-04-09 11:12 | 1.5K | |
| Brian Tindall.html | 2021-04-09 11:12 | 3.6K | |
| Brooklyn Naval Shipyard.html | 2021-04-09 11:12 | 2.6K | |
| Bruce Dinsmore.html | 2021-04-09 11:12 | 821 | |
| Building Wings A Better Tomorrow.html | 2021-04-09 11:12 | 3.3K | |
| Burke.html | 2021-04-09 11:12 | 4.3K | |
| Buzzkill TND.html | 2021-04-09 11:12 | 203 | |
| CASIE.html | 2021-04-09 11:12 | 1.3K | |
| CC-75 Security bot.html | 2021-04-09 11:12 | 2.9K | |
| CD.html | 2021-04-09 11:12 | 1.4K | |
| CIA Factbook 2050 Hong Kong.html | 2021-04-09 11:12 | 1.7K | |
| Cairo.html | 2021-04-09 11:12 | 3.4K | |
| Cairo Arcology.html | 2021-04-09 11:12 | 7.1K | |
| Cairo Arcology Corporate Suites.html | 2021-04-09 11:12 | 2.5K | |
| Cairo Medina.html | 2021-04-09 11:12 | 205 | |
| Canada.html | 2021-04-09 11:12 | 13K | |
| Candy bar.html | 2021-04-09 11:12 | 2.1K | |
| Carla Brown.html | 2021-04-09 11:12 | 955 | |
| Carmela.html | 2021-04-09 11:12 | 683 | |
| Cashing in Old Favors.html | 2021-04-09 11:12 | 11K | |
| Cassandra Reed.html | 2021-04-09 11:12 | 2.0K | |
| Category talkAugmented characters.html | 2021-04-09 11:12 | 3.5K | |
| Category talkCandidates for deletion.html | 2021-04-09 11:12 | 12K | |
| Category talkDeus Ex Human Revolution characters.html | 2021-04-09 11:12 | 4.5K | |
| Category talkDeus Ex Human Revolution main quests.html | 2021-04-09 11:12 | 7.9K | |
| Category talkDeus Ex Human Revolution side quests.html | 2021-04-09 11:12 | 8.5K | |
| Category talkMechanical-augmented characters.html | 2021-04-09 11:12 | 1.4K | |
| Category talkMechanically Augmented Characters.html | 2021-04-09 11:12 | 648 | |
| Category talkMods.html | 2021-04-09 11:12 | 1.0K | |
| Category talkTransgenic species.html | 2021-04-09 11:12 | 1.2K | |
| Category talkWalkthroughs.html | 2021-04-09 11:12 | 7.2K | |
| Category talkWeapons in Deus Ex.html | 2021-04-09 11:12 | 3.2K | |
| Cathedral.html | 2021-04-09 11:12 | 157 | |
| Cathedrale de Payens.html | 2021-04-09 11:12 | 2.4K | |
| Ceolacanth.html | 2021-04-09 11:12 | 5.5K | |
| Cerebral Implants.html | 2021-04-09 11:12 | 1.9K | |
| Chad Dumier.html | 2021-04-09 11:12 | 9.6K | |
| Charlie Fann.html | 2021-04-09 11:12 | 2.1K | |
| Chase.html | 2021-04-09 11:12 | 2.5K | |
| Chateau DuClare.html | 2021-04-09 11:12 | 2.2K | |
| Cheat.html | 2021-04-09 11:12 | 228 | |
| Cheats.html | 2021-04-09 11:12 | 20K | |
| Chet Wagner.html | 2021-04-09 11:12 | 4.6K | |
| Chiang.html | 2021-04-09 11:12 | 1.8K | |
| Chiang Arcbot M2.html | 2021-04-09 11:12 | 166 | |
| Chiang Arcbot M5.html | 2021-04-09 11:12 | 261 | |
| Chiang Arcbot Model 2.html | 2021-04-09 11:12 | 2.6K | |
| Chiang Arcbot Model 5.html | 2021-04-09 11:12 | 1.7K | |
| Chicago.html | 2021-04-09 11:12 | 1.7K | |
| China.html | 2021-04-09 11:12 | 13K | |
| Chinese Military Police.html | 2021-04-09 11:12 | 2.0K | |
| Chiron Building.html | 2021-04-09 11:12 | 3.1K | |
| Chlorine and Water Treatment Report for the New York City Council, 2053.html | 2021-04-09 11:12 | 1.9K | |
| Choices, Choices.html | 2021-04-09 11:12 | 6.6K | |
| Chris Ubair.html | 2021-04-09 11:12 | 220 | |
| Christopher Sabat.html | 2021-04-09 11:12 | 1.5K | |
| Christopher Ubair.html | 2021-04-09 11:12 | 2.4K | |
| Chuanli.html | 2021-04-09 11:12 | 4.0K | |
| Cigarettes.html | 2021-04-09 11:12 | 2.3K | |
| Cindy Martinez.html | 2021-04-09 11:12 | 2.3K | |
| Clayton Green.html | 2021-04-09 11:12 | 721 | |
| Cleaner bot.html | 2021-04-09 11:12 | 1.7K | |
| Cliff Stephens.html | 2021-04-09 11:12 | 873 | |
| Cloak & Daggers.html | 2021-04-09 11:12 | 18K | |
| Cloak.html | 2021-04-09 11:12 | 2.2K | |
| Club Vox.html | 2021-04-09 11:12 | 1.9K | |
| Cocktails.html | 2021-04-09 11:12 | 28K | |
| Collapse.html | 2021-04-09 11:12 | 8.9K | |
| Collins.html | 2021-04-09 11:12 | 1.7K | |
| Combat Strength.html | 2021-04-09 11:12 | 2.5K | |
| Combat knife (DX2).html | 2021-04-09 11:12 | 8.8K | |
| Combat knife.html | 2021-04-09 11:12 | 211 | |
| Combat rifle (DX3).html | 2021-04-09 11:12 | 283 | |
| Combat rifle.html | 2021-04-09 11:12 | 5.6K | |
| Common Sense.html | 2021-04-09 11:12 | 1.8K | |
| Composite Study 07121969 -- FINAL TEST RESULTS.html | 2021-04-09 11:12 | 2.1K | |
| Computer skill.html | 2021-04-09 11:12 | 217 | |
| Computer usernames and passwords (DX3).html | 2021-04-09 11:12 | 141 | |
| Concussion Grenade.html | 2021-04-09 11:12 | 281 | |
| Concussion grenade (DX2).html | 2021-04-09 11:12 | 1.2K | |
| Concussion grenade (DX3).html | 2021-04-09 11:12 | 7.5K | |
| Concussion prox mine.html | 2021-04-09 11:12 | 1.6K | |
| Confronting Eliza Cassan.html | 2021-04-09 11:12 | 17K | |
| Confronting Sarif.html | 2021-04-09 11:12 | 4.5K | |
| Connaught.html | 2021-04-09 11:12 | 1.2K | |
| Consciousness is Over-rated.html | 2021-04-09 11:12 | 4.4K | |
| Containment Shield.html | 2021-04-09 11:12 | 1.4K | |
| Coq au Vin.html | 2021-04-09 11:12 | 942 | |
| Corporate Warfare.html | 2021-04-09 11:12 | 4.5K | |
| Craig Tyler.html | 2021-04-09 11:12 | 1.9K | |
| Credit.html | 2021-04-09 11:12 | 4.6K | |
| Credits.html | 2021-04-09 11:12 | 194 | |
| Crossbow.html | 2021-04-09 11:12 | 3.2K | |
| Crowbar.html | 2021-04-09 11:12 | 1.8K | |
| Curly's journal.html | 2021-04-09 11:12 | 1.3K | |
| Cyberboost Proenergy Bar.html | 2021-04-09 11:12 | 1.0K | |
| Cyberboost Proenergy Jar.html | 2021-04-09 11:12 | 2.0K | |
| Cyberboost Proenergy Pack.html | 2021-04-09 11:12 | 1.2K | |
| Cyberdog.html | 2021-04-09 11:12 | 888 | |
| Cybernetic Arm Prosthesis.html | 2021-04-09 11:12 | 6.4K | |
| Cybernetic Leg Prosthesis.html | 2021-04-09 11:12 | 49K | |
| D. Moreau's computer.html | 2021-04-09 11:12 | 1.7K | |
| DX2.html | 2021-04-09 11:12 | 3.0K | |
| DX3.html | 2021-04-09 11:12 | 37K | |
| Daedalus.html | 2021-04-09 11:12 | 7.1K | |
| Daedalus Complex.html | 2021-04-09 11:12 | 2.3K | |
| Daigong.html | 2021-04-09 11:12 | 159 | |
| Daigong district.html | 2021-04-09 11:12 | 1.3K | |
| Damage Types (DX).html | 2021-04-09 11:12 | 6.5K | |
| Danny Blanco Hall.html | 2021-04-09 11:12 | 904 | |
| Darker Shades.html | 2021-04-09 11:12 | 5.9K | |
| Darrow.html | 2021-04-09 11:12 | 203 | |
| Datacube.html | 2021-04-09 11:12 | 1.9K | |
| Data storage devices.html | 2021-04-09 11:12 | 12K | |
| Datavault.html | 2021-04-09 11:12 | 5.5K | |
| David Kurzec.html | 2021-04-09 11:12 | 16K | |
| David Sarif.html | 2021-04-09 11:12 | 10K | |
| Declan Faherty.html | 2021-04-09 11:12 | 3.2K | |
| Defoe.html | 2021-04-09 11:12 | 4.5K | |
| Delgado and the Stimoceiver.html | 2021-04-09 11:12 | 2.2K | |
| Demolition.html | 2021-04-09 11:12 | 233 | |
| Denfert-Rochereau.html | 2021-04-09 11:12 | 2.7K | |
| Denis Akiyama.html | 2021-04-09 11:12 | 5.5K | |
| Der Blutende Rabe.html | 2021-04-09 11:12 | 1.9K | |
| Derelict Row.html | 2021-04-09 11:12 | 2.6K | |
| Derelict Row Ballers.html | 2021-04-09 11:12 | 2.3K | |
| Dermal Modification Processes.html | 2021-04-09 11:12 | 2.3K | |
| Destiny Savannah.html | 2021-04-09 11:12 | 2.2K | |
| Detective Chase.html | 2021-04-09 11:12 | 2.1K | |
| Detective Wagner.html | 2021-04-09 11:12 | 2.5K | |
| Detroit.html | 2021-04-09 11:12 | 8.0K | |
| Detroit Convention Center.html | 2021-04-09 11:12 | 9.0K | |
| Detroit Downtown Apartments.html | 2021-04-09 11:12 | 1.9K | |
| Detroit Police Station.html | 2021-04-09 11:12 | 33K | |
| Deus Ex (series).html | 2021-04-09 11:12 | 555 | |
| Deus Ex.html | 2021-04-09 11:12 | 196 | |
| Deus Ex 2.html | 2021-04-09 11:12 | 228 | |
| Deus Ex 3.html | 2021-04-09 11:12 | 377 | |
| Deus Ex 4.html | 2021-04-09 11:12 | 13K | |
| Deus Ex Bible.html | 2021-04-09 11:12 | 1.3K | |
| Deus Ex Game of the Year Edition.html | 2021-04-09 11:12 | 2.2K | |
| Deus Ex Human Defiance.html | 2021-04-09 11:12 | 4.6K | |
| Deus Ex Human Revolution (comics).html | 2021-04-09 11:12 | 7.9K | |
| Deus Ex Human Revolution - Assassination Run.html | 2021-04-09 11:12 | 1.8K | |
| Deus Ex Human Revolution - Daemonicus Ex.html | 2021-04-09 11:12 | 3.4K | |
| Deus Ex Human Revolution - Director's Cut.html | 2021-04-09 11:12 | 21K | |
| Deus Ex Human Revolution - Shoot to Kill.html | 2021-04-09 11:12 | 1.5K | |
| Deus Ex Human Revolution - The Extinction Agenda.html | 2021-04-09 11:12 | 1.2K | |
| Deus Ex Human Revolution - The Ghost in the Machine.html | 2021-04-09 11:12 | 1.3K | |
| Deus Ex Human Revolution - Ultimate Edition.html | 2021-04-09 11:12 | 3.2K | |
| Deus Ex Human Revolution. The Missing Link walkthrough.html | 2021-04-09 11:12 | 1.2K | |
| Deus Ex Human Revolution.html | 2021-04-09 11:12 | 61K | |
| Deus Ex Human Revolution Comic.html | 2021-04-09 11:12 | 1.7K | |
| Deus Ex Human Revolution E3 trailer.html | 2021-04-09 11:12 | 22K | |
| Deus Ex Human Revolution Preorder Packs.html | 2021-04-09 11:12 | 9.4K | |
| Deus Ex Human Revolution Soundtrack.html | 2021-04-09 11:12 | 29K | |
| Deus Ex Human Revolution comics.html | 2021-04-09 11:12 | 153 | |
| Deus Ex Human Revolution endings.html | 2021-04-09 11:12 | 7.3K | |
| Deus Ex Human Revolution walkthrough.html | 2021-04-09 11:12 | 282 | |
| Deus Ex Human Revolution weapons.html | 2021-04-09 11:12 | 2.7K | |
| Deus Ex Icarus Effect.html | 2021-04-09 11:12 | 25K | |
| Deus Ex Invisible War.html | 2021-04-09 11:12 | 29K | |
| Deus ExInvisible War.html | 2021-04-09 11:12 | 172 | |
| Deus Ex Invisible War Walkthrough.html | 2021-04-09 11:12 | 1.1K | |
| Deus Ex Invisible War cut content.html | 2021-04-09 11:12 | 797 | |
| Deus Ex Invisible War endings.html | 2021-04-09 11:12 | 2.7K | |
| Deus Ex Machina.html | 2021-04-09 11:12 | 1.9K | |
| Deus Ex Soundtrack.html | 2021-04-09 11:12 | 16K | |
| Deus Ex The Conspiracy.html | 2021-04-09 11:12 | 2.9K | |
| Deus Ex The Fall.html | 2021-04-09 11:12 | 31K | |
| Deus Ex The Fall weapons.html | 2021-04-09 11:12 | 16K | |
| Deus Ex Wiki talkCommunity Portal.html | 2021-04-09 11:12 | 19K | |
| Deus Ex Wiki talkPolicies and guidelines.html | 2021-04-09 11:12 | 7.3K | |
| Deus Ex Wiki talkTemplates.html | 2021-04-09 11:12 | 624 | |
| Deus Ex beta release.html | 2021-04-09 11:12 | 6.7K | |
| Deus Ex console commands.html | 2021-04-09 11:12 | 44K | |
| Deus Ex endings.html | 2021-04-09 11:12 | 2.5K | |
| Deus Ex series.html | 2021-04-09 11:12 | 6.0K | |
| Deus Ex walkthrough.html | 2021-04-09 11:12 | 232 | |
| Diamond Back .357 (DX3).html | 2021-04-09 11:12 | 3.9K | |
| Diamond Back .357.html | 2021-04-09 11:12 | 195 | |
| Diamond Chan.html | 2021-04-09 11:12 | 2.1K | |
| Difficulty Level and Health and Damage (DX3).html | 2021-04-09 11:12 | 5.0K | |
| Dirty Business.html | 2021-04-09 11:12 | 15K | |
| Doberman Pinscher.html | 2021-04-09 11:12 | 6.0K | |
| Doctorate.html | 2021-04-09 11:12 | 16K | |
| Donna Morgan.html | 2021-04-09 11:12 | 3.0K | |
| Door codes (Deus Ex Human Revolution).html | 2021-04-09 11:12 | 206 | |
| Double-T.html | 2021-04-09 11:12 | 5.4K | |
| Double-barrel shotgun.html | 2021-04-09 11:12 | 2.9K | |
| Downloadable content.html | 2021-04-09 11:12 | 7.9K | |
| Dr. Leila Nassif.html | 2021-04-09 11:12 | 8.9K | |
| Dr. Nassif.html | 2021-04-09 11:12 | 209 | |
| Dr Todd.html | 2021-04-09 11:12 | 1.0K | |
| Dragon's Tooth.html | 2021-04-09 11:12 | 589 | |
| Dragon's Tooth Sword.html | 2021-04-09 11:12 | 367 | |
| Dragon's Tooth sword (DX).html | 2021-04-09 11:12 | 3.4K | |
| Dragon's Tooth sword (DX2).html | 2021-04-09 11:12 | 2.8K | |
| Dragon Tooth Sword (DX2).html | 2021-04-09 11:12 | 3.3K | |
| E3 2010 demo.html | 2021-04-09 11:12 | 1.0K | |
| EMP Shield.html | 2021-04-09 11:12 | 2.7K | |
| EMP converter.html | 2021-04-09 11:12 | 4.2K | |
| EMP grenade (DX).html | 2021-04-09 11:12 | 2.2K | |
| EMP grenade (DX2).html | 2021-04-09 11:12 | 482 | |
| EMP grenade (DX3).html | 2021-04-09 11:12 | 2.5K | |
| EMP grenade.html | 2021-04-09 11:12 | 141 | |
| EMP grenades.html | 2021-04-09 11:12 | 3.1K | |
| EMP prox mine.html | 2021-04-09 11:12 | 1.9K | |
| Ebook.html | 2021-04-09 11:12 | 825 | |
| Edgar Lee.html | 2021-04-09 11:12 | 104K | |
| Eeva Nassif.html | 2021-04-09 11:12 | 1.7K | |
| Egypt.html | 2021-04-09 11:12 | 7.7K | |
| Eidos Interactive.html | 2021-04-09 11:12 | 18K | |
| Eidos Montréal.html | 2021-04-09 11:12 | 9.0K | |
| Eidos Montreal.html | 2021-04-09 11:12 | 329 | |
| El Niño.html | 2021-04-09 11:12 | 933 | |
| El Rey.html | 2021-04-09 11:12 | 2.8K | |
| Electrogravific Technology Applications.html | 2021-04-09 11:12 | 8.8K | |
| Electrogravitic Technology Applications.html | 2021-04-09 11:12 | 1.7K | |
| Electronics skill.html | 2021-04-09 11:12 | 226 | |
| Elias Toufexis.html | 2021-04-09 11:12 | 3.1K | |
| Eliza.html | 2021-04-09 11:12 | 3.1K | |
| Eliza Cassan.html | 2021-04-09 11:12 | 7.9K | |
| Elizabeth DuClare.html | 2021-04-09 11:12 | 2.0K | |
| Emerald Suites.html | 2021-04-09 11:12 | 2.0K | |
| Energy Shield.html | 2021-04-09 11:12 | 2.5K | |
| Energy blade.html | 2021-04-09 11:12 | 1.5K | |
| Energy cell (DX2).html | 2021-04-09 11:12 | 11K | |
| Enfant Terrible.html | 2021-04-09 11:12 | 1.1K | |
| Entering the Dragon's Lair.html | 2021-04-09 11:12 | 9.1K | |
| Environmental Resistance.html | 2021-04-09 11:12 | 4.2K | |
| Environmental Training.html | 2021-04-09 11:12 | 253 | |
| Environmental Training skill.html | 2021-04-09 11:12 | 1.2K | |
| Eric Koss.html | 2021-04-09 11:12 | 3.0K | |
| Erin Todd's computer.html | 2021-04-09 11:12 | 1.4K | |
| Everett.html | 2021-04-09 11:12 | 143 | |
| Experience by Area.html | 2021-04-09 11:12 | 3.7K | |
| Experience by area (DX3).html | 2021-04-09 11:12 | 162K | |
| Experience by area (DX3ML).html | 2021-04-09 11:12 | 24K | |
| Explosive Mission Pack.html | 2021-04-09 11:12 | 299 | |
| Explosives (DX3).html | 2021-04-09 11:12 | 13K | |
| Extraction (2).html | 2021-04-09 11:12 | 2.0K | |
| Extraction.html | 2021-04-09 11:12 | 6.0K | |
| Ezekiel Sanders.html | 2021-04-09 11:12 | 8.4K | |
| F-29 S.C.R. Spetsnaz.html | 2021-04-09 11:12 | 1.7K | |
| FEMA.html | 2021-04-09 11:12 | 249 | |
| FR-27 SFR.html | 2021-04-09 11:12 | 141 | |
| Factory Zero (Achievement).html | 2021-04-09 11:12 | 15K | |
| Factory Zero (Avievement).html | 2021-04-09 11:12 | 224 | |
| Factory Zero.html | 2021-04-09 11:12 | 4.5K | |
| Family News Network.html | 2021-04-09 11:12 | 1.4K | |
| Farida Malik.html | 2021-04-09 11:12 | 653 | |
| Faridah Malik.html | 2021-04-09 11:12 | 7.2K | |
| Fashion (DX3).html | 2021-04-09 11:12 | 13K | |
| Federal Emergency Management Agency.html | 2021-04-09 11:12 | 31K | |
| Federal Emergency Mobilisation Administration.html | 2021-04-09 11:12 | 5.5K | |
| Fedorova.html | 2021-04-09 11:12 | 146 | |
| Feng's journal.html | 2021-04-09 11:12 | 2.4K | |
| File talkAlexD female.jpg.html | 2021-04-09 11:12 | 1.9K | |
| File talkConventioncenter.png.html | 2021-04-09 11:12 | 18K | |
| File talkHehe.jpg.html | 2021-04-09 11:12 | 7.0K | |
| File talkHolocommDXHR.png.html | 2021-04-09 11:12 | 5.1K | |
| File talkMj12trooper.jpg.html | 2021-04-09 11:12 | 267 | |
| File talkNYCCop.png.html | 2021-04-09 11:12 | 5.0K | |
| File talkScene zeke.png.html | 2021-04-09 11:12 | 387 | |
| File talkScubadiver.jpg.html | 2021-04-09 11:12 | 382 | |
| Find Vasili Sevchenko's GPL Device.html | 2021-04-09 11:12 | 14K | |
| Finding Isaias Sandoval.html | 2021-04-09 11:12 | 12K | |
| Fire extinguisher.html | 2021-04-09 11:12 | 1.3K | |
| First Hack.html | 2021-04-09 11:12 | 2.2K | |
| First Takedown.html | 2021-04-09 11:12 | 852 | |
| Flamethrower (DX2).html | 2021-04-09 11:12 | 1.6K | |
| Flamethrower.html | 2021-04-09 11:12 | 2.4K | |
| Flame turret.html | 2021-04-09 11:12 | 132 | |
| Flare.html | 2021-04-09 11:12 | 3.5K | |
| Flashbomb.html | 2021-04-09 11:12 | 3.4K | |
| Following the Clues in Highland Park.html | 2021-04-09 11:12 | 10K | |
| Ford Schick.html | 2021-04-09 11:12 | 3.1K | |
| Forgotten Acquaintances.html | 2021-04-09 11:12 | 1.0K | |
| Forty.html | 2021-04-09 11:12 | 2.2K | |
| Foxiest of the Hounds.html | 2021-04-09 11:12 | 5.1K | |
| Foxon.html | 2021-04-09 11:12 | 1.9K | |
| Fragmentary round.html | 2021-04-09 11:12 | 2.4K | |
| Fragmentation grenade.html | 2021-04-09 11:12 | 2.1K | |
| France.html | 2021-04-09 11:12 | 3.9K | |
| Francis Frank Pritchard.html | 2021-04-09 11:12 | 165 | |
| Francis Pritchard.html | 2021-04-09 11:12 | 8.7K | |
| Frank Prichard.html | 2021-04-09 11:12 | 1.8K | |
| Frank Pritchard.html | 2021-04-09 11:12 | 224 | |
| Frankenstein.html | 2021-04-09 11:12 | 790 | |
| Free Clinic.html | 2021-04-09 11:12 | 5.6K | |
| FriendshipSeven's Place.html | 2021-04-09 11:12 | 4.5K | |
| GEP gun.html | 2021-04-09 11:12 | 196 | |
| GHermann.html | 2021-04-09 11:12 | 213 | |
| Gaining Access to Tai Yong Medical.html | 2021-04-09 11:12 | 7.5K | |
| Gale Bergama.html | 2021-04-09 11:12 | 23K | |
| Gang.html | 2021-04-09 11:12 | 16K | |
| Garvin Quinn.html | 2021-04-09 11:12 | 9.0K | |
| Gary Savage.html | 2021-04-09 11:12 | 6.5K | |
| Gas grenade (DX).html | 2021-04-09 11:12 | 1.5K | |
| Gas grenade (DX2).html | 2021-04-09 11:12 | 558 | |
| Gas grenade (DX3).html | 2021-04-09 11:12 | 764 | |
| Gas grenade.html | 2021-04-09 11:12 | 272 | |
| Gas grenades.html | 2021-04-09 11:12 | 142 | |
| Gerald Campbell.html | 2021-04-09 11:12 | 8.3K | |
| Germany.html | 2021-04-09 11:12 | 3.7K | |
| Gerta Mueller.html | 2021-04-09 11:12 | 2.5K | |
| Getting out of the frying pan.html | 2021-04-09 11:12 | 17K | |
| Ghost (achievement).html | 2021-04-09 11:12 | 7.5K | |
| Ghost (bonus).html | 2021-04-09 11:12 | 14K | |
| Ghost.html | 2021-04-09 11:12 | 20K | |
| Gilbert Renton.html | 2021-04-09 11:12 | 3.7K | |
| Glass-Shield Cloaking System.html | 2021-04-09 11:12 | 6.8K | |
| Glass Shield Cloaking System.html | 2021-04-09 11:12 | 5.1K | |
| Glass destabilizer.html | 2021-04-09 11:12 | 3.9K | |
| Global Politics Review (2026 Edition).html | 2021-04-09 11:12 | 4.2K | |
| Good Samaritan.html | 2021-04-09 11:12 | 1.0K | |
| Good Soul.html | 2021-04-09 11:12 | 9.2K | |
| Gordon Quick.html | 2021-04-09 11:12 | 3.0K | |
| Gray.html | 2021-04-09 11:12 | 3.8K | |
| Gray Death.html | 2021-04-09 11:12 | 6.5K | |
| Grayson.html | 2021-04-09 11:12 | 1.8K | |
| Grayve Times.html | 2021-04-09 11:12 | 928 | |
| Greasel.html | 2021-04-09 11:12 | 5.1K | |
| Greasel Pit Bar.html | 2021-04-09 11:12 | 2.2K | |
| Greasels.html | 2021-04-09 11:12 | 197 | |
| Greg Thorpe.html | 2021-04-09 11:12 | 3.2K | |
| Grenade launcher.html | 2021-04-09 11:12 | 3.0K | |
| Guardian Angel.html | 2021-04-09 11:12 | 1.2K | |
| Gun Nut.html | 2021-04-09 11:12 | 14K | |
| Gunther Hermann's computer.html | 2021-04-09 11:12 | 3.5K | |
| Gunther Hermann.html | 2021-04-09 11:12 | 15K | |
| Guy.html | 2021-04-09 11:12 | 1.3K | |
| HS-66 Hunter-Seeker bot.html | 2021-04-09 11:12 | 1.9K | |
| HUD (DX3).html | 2021-04-09 11:12 | 5.1K | |
| Hacking (DX3).html | 2021-04-09 11:12 | 21K | |
| Hacking Analyze.html | 2021-04-09 11:12 | 2.3K | |
| Hacking Capture.html | 2021-04-09 11:12 | 17K | |
| Hacking Fortify.html | 2021-04-09 11:12 | 4.9K | |
| Hacking Stealth.html | 2021-04-09 11:12 | 2.5K | |
| Hacking Stealth Add-on.html | 2021-04-09 11:12 | 10K | |
| Hangar 18.html | 2021-04-09 11:12 | 23K | |
| Harley Filben.html | 2021-04-09 11:12 | 4.2K | |
| Harrier.html | 2021-04-09 11:12 | 1.0K | |
| Harrison.html | 2021-04-09 11:12 | 673 | |
| Harry Jarvis.html | 2021-04-09 11:12 | 4.7K | |
| Harvester.html | 2021-04-09 11:12 | 1.7K | |
| Harvester hideout.html | 2021-04-09 11:12 | 12K | |
| Harvesters' hideout.html | 2021-04-09 11:12 | 874 | |
| Harvesters.html | 2021-04-09 11:12 | 3.4K | |
| HawkEye Xbow XH-II.html | 2021-04-09 11:12 | 1.0K | |
| Hax0r1.html | 2021-04-09 11:12 | 1.9K | |
| Hazmat suit.html | 2021-04-09 11:12 | 1.7K | |
| Healing Thyself - Health Perservation Implants.html | 2021-04-09 11:12 | 1.4K | |
| Healing Thyself - Health Preservation Implants.html | 2021-04-09 11:12 | 9.8K | |
| Hearts of Steel.html | 2021-04-09 11:12 | 3.2K | |
| Heather Kafka.html | 2021-04-09 11:12 | 2.0K | |
| Heavy (Weapon skill).html | 2021-04-09 11:12 | 233 | |
| Heavy.html | 2021-04-09 11:12 | 151 | |
| Heavy rifle.html | 2021-04-09 11:12 | 7.9K | |
| Heavy weapon skill.html | 2021-04-09 11:12 | 231 | |
| Hei Zhen Zhu.html | 2021-04-09 11:12 | 2.5K | |
| Helios.html | 2021-04-09 11:12 | 9.2K | |
| Hell's Kitchen.html | 2021-04-09 11:12 | 4.6K | |
| Hell's Kitchen bulletin terminal.html | 2021-04-09 11:12 | 7.2K | |
| Hellfire Boltcaster.html | 2021-04-09 11:12 | 1.3K | |
| Heng Sha.html | 2021-04-09 11:12 | 24K | |
| Hengsha.html | 2021-04-09 11:12 | 6.6K | |
| Hengsha Court Gardens.html | 2021-04-09 11:12 | 4.0K | |
| Heron's Loft Apartments.html | 2021-04-09 11:12 | 4.6K | |
| Hi-NRG2 Plasma Lance.html | 2021-04-09 11:12 | 1.4K | |
| Hi-NRG3 Plasma Lance.html | 2021-04-09 11:12 | 1.4K | |
| Hi-NRG Plasma Lance.html | 2021-04-09 11:12 | 200 | |
| Hi- NRG plasma rifle (DX3).html | 2021-04-09 11:12 | 3.3K | |
| Highland Park.html | 2021-04-09 11:12 | 14K | |
| Hive.html | 2021-04-09 11:12 | 195 | |
| Holocomm.html | 2021-04-09 11:12 | 6.5K | |
| Hologram.html | 2021-04-09 11:12 | 4.6K | |
| Hong Kong.html | 2021-04-09 11:12 | 4.3K | |
| Hong Kong Canals.html | 2021-04-09 11:12 | 3.1K | |
| Hong Kong Standard.html | 2021-04-09 11:12 | 2.2K | |
| Hong Kong VersaLife facility.html | 2021-04-09 11:12 | 5.4K | |
| Howard Strong.html | 2021-04-09 11:12 | 3.8K | |
| Huang Ling.html | 2021-04-09 11:12 | 1.3K | |
| Hugh Darrow's computer.html | 2021-04-09 11:12 | 2.8K | |
| Hugh Darrow.html | 2021-04-09 11:12 | 11K | |
| Human Powered - Autonomous Energy Reclamation Systems.html | 2021-04-09 11:12 | 4.5K | |
| Human Revolution.html | 2021-04-09 11:12 | 174 | |
| Human Revolution Achivements.html | 2021-04-09 11:12 | 779 | |
| Human Revolution comic 16.html | 2021-04-09 11:12 | 211 | |
| Human Revolution comic 26.html | 2021-04-09 11:12 | 232 | |
| Human Revolution comic 36.html | 2021-04-09 11:12 | 221 | |
| Human Revolution comic 46.html | 2021-04-09 11:12 | 225 | |
| Human Revolution comic 56.html | 2021-04-09 11:12 | 230 | |
| Human Revolution comic 66.html | 2021-04-09 11:12 | 40K | |
| Humanist Gameplay.html | 2021-04-09 11:12 | 4.0K | |
| Humanity Front.html | 2021-04-09 11:12 | 3.4K | |
| Hung Hua Hotel.html | 2021-04-09 11:12 | 190 | |
| Hung hu hotel.html | 2021-04-09 11:12 | 329 | |
| Hunting the Hacker.html | 2021-04-09 11:12 | 8.9K | |
| Huntsman Silverback.html | 2021-04-09 11:12 | 236 | |
| Hurricane TMP-18.html | 2021-04-09 11:12 | 356 | |
| Hypostim.html | 2021-04-09 11:12 | 1.7K | |
| Hyron Project.html | 2021-04-09 11:12 | 13K | |
| IET.html | 2021-04-09 11:12 | 226 | |
| IFF.html | 2021-04-09 11:12 | 1.4K | |
| IMM Austin.html | 2021-04-09 11:12 | 176 | |
| Ian Hilton.html | 2021-04-09 11:12 | 1.1K | |
| Icarus.html | 2021-04-09 11:12 | 7.4K | |
| Icarus Landing System.html | 2021-04-09 11:12 | 5.6K | |
| Il Metamorfoso.html | 2021-04-09 11:12 | 12K | |
| Illuminati.html | 2021-04-09 11:12 | 13K | |
| Illuminati Commando.html | 2021-04-09 11:12 | 242 | |
| Illuminati Elite Trooper.html | 2021-04-09 11:12 | 2.2K | |
| Inclinator.html | 2021-04-09 11:12 | 2.0K | |
| Increased damage.html | 2021-04-09 11:12 | 3.4K | |
| Increased range.html | 2021-04-09 11:12 | 4.1K | |
| Infolink.html | 2021-04-09 11:12 | 11K | |
| Inspector Gabily.html | 2021-04-09 11:12 | 548 | |
| Insurgent.html | 2021-04-09 11:12 | 1.2K | |
| In the belly of the beast.html | 2021-04-09 11:12 | 27K | |
| Invasive Brain Machine Interfaces.html | 2021-04-09 11:12 | 2.4K | |
| Investigating the Suicide Terrorist.html | 2021-04-09 11:12 | 3.9K | |
| Invisible War.html | 2021-04-09 11:12 | 11K | |
| Ion Storm.html | 2021-04-09 11:12 | 6.7K | |
| Ion Storm Inc.html | 2021-04-09 11:12 | 2.2K | |
| Isaac.html | 2021-04-09 11:12 | 2.5K | |
| Isaias Sandoval.html | 2021-04-09 11:12 | 20K | |
| Ishanti.html | 2021-04-09 11:12 | 1.7K | |
| Items in Deus Ex.html | 2021-04-09 11:12 | 235 | |
| Items in Deus Ex Invisible War.html | 2021-04-09 11:12 | 222 | |
| J. Allred's computer.html | 2021-04-09 11:12 | 2.1K | |
| J. Allred.html | 2021-04-09 11:12 | 1.5K | |
| J.C. Denton's computer.html | 2021-04-09 11:12 | 6.3K | |
| J. Steward's computer.html | 2021-04-09 11:12 | 2.5K | |
| JC Denton's Sanctuary.html | 2021-04-09 11:12 | 3.9K | |
| JC Denton.html | 2021-04-09 11:12 | 17K | |
| JCDenton.html | 2021-04-09 11:12 | 134 | |
| JReyes.html | 2021-04-09 11:12 | 136 | |
| Jack O'Malley.html | 2021-04-09 11:12 | 5.3K | |
| Jacob's Shadow.html | 2021-04-09 11:12 | 7.8K | |
| Jacob White.html | 2021-04-09 11:12 | 7.1K | |
| Jaime Reyes' computer.html | 2021-04-09 11:12 | 6.5K | |
| Jaime Reyes.html | 2021-04-09 11:12 | 4.5K | |
| Jake Dredger.html | 2021-04-09 11:12 | 9.8K | |
| Jane Luk.html | 2021-04-09 11:12 | 23K | |
| Janey.html | 2021-04-09 11:12 | 1.6K | |
| Janice Reed's computer.html | 2021-04-09 11:12 | 1.4K | |
| Janice Reed.html | 2021-04-09 11:12 | 3.4K | |
| Janus.html | 2021-04-09 11:12 | 22K | |
| Jaron Namir.html | 2021-04-09 11:12 | 13K | |
| Jay Anthony Franke.html | 2021-04-09 11:12 | 3.6K | |
| Jaya.html | 2021-04-09 11:12 | 5.6K | |
| Jc.html | 2021-04-09 11:12 | 9.6K | |
| Jeff Groteboer.html | 2021-04-09 11:12 | 3.8K | |
| Jennifer McAllister.html | 2021-04-09 11:12 | 766 | |
| Jennifer McCallister.html | 2021-04-09 11:12 | 166 | |
| Jenny Alexander.html | 2021-04-09 11:12 | 2.4K | |
| Jensen.html | 2021-04-09 11:12 | 136 | |
| Jiu Schichang.html | 2021-04-09 11:12 | 3.9K | |
| Jiu Schichang district.html | 2021-04-09 11:12 | 5.8K | |
| JoJo.html | 2021-04-09 11:12 | 3.6K | |
| JoJo Fine.html | 2021-04-09 11:12 | 202 | |
| Jock's apartment.html | 2021-04-09 11:12 | 2.4K | |
| Jock.html | 2021-04-09 11:12 | 6.4K | |
| Joe Greene.html | 2021-04-09 11:12 | 6.5K | |
| Joe Wexler.html | 2021-04-09 11:12 | 914 | |
| John Dodson.html | 2021-04-09 11:12 | 3.1K | |
| John Gault.html | 2021-04-09 11:12 | 709 | |
| John Smith.html | 2021-04-09 11:12 | 1.3K | |
| Johnny.html | 2021-04-09 11:12 | 961 | |
| Jordan Shea.html | 2021-04-09 11:12 | 4.1K | |
| Joseph Manderley's computer.html | 2021-04-09 11:12 | 4.1K | |
| Joseph Manderley.html | 2021-04-09 11:12 | 7.1K | |
| Joshua Korbin.html | 2021-04-09 11:12 | 1.6K | |
| Josie Thorpe.html | 2021-04-09 11:12 | 2.0K | |
| Journal of Hung Kwan Gordon Quick.html | 2021-04-09 11:12 | 1.2K | |
| Juan Lebedev.html | 2021-04-09 11:12 | 5.4K | |
| Juggernaut Collective.html | 2021-04-09 11:12 | 60K | |
| K. Lloyd's computer.html | 2021-04-09 11:12 | 2.4K | |
| Kaiga 5.56mm M404 Heavy Rifle.html | 2021-04-09 11:12 | 357 | |
| Kaiga Incorporated.html | 2021-04-09 11:12 | 1.1K | |
| Kaplan.html | 2021-04-09 11:12 | 1.8K | |
| Karkian.html | 2021-04-09 11:12 | 2.7K | |
| Karkians.html | 2021-04-09 11:12 | 2.0K | |
| Katrina Sutherland.html | 2021-04-09 11:12 | 5.2K | |
| Kevin O'Rourke.html | 2021-04-09 11:12 | 1.3K | |
| Kevorkian Complex.html | 2021-04-09 11:12 | 1.3K | |
| Keycodes (DX3).html | 2021-04-09 11:12 | 15K | |
| Keycodes (Deus Ex Human Revolution).html | 2021-04-09 11:12 | 582 | |
| Keyring.html | 2021-04-09 11:12 | 1.7K | |
| Killphrase.html | 2021-04-09 11:12 | 7.2K | |
| Killswitch.html | 2021-04-09 11:12 | 1.9K | |
| Klara Sparks.html | 2021-04-09 11:12 | 4.1K | |
| Knights Templar.html | 2021-04-09 11:12 | 8.9K | |
| Kuaigan.html | 2021-04-09 11:12 | 214 | |
| Kuaigan district.html | 2021-04-09 11:12 | 456 | |
| Kubrick.html | 2021-04-09 11:12 | 5.4K | |
| L.I.M.B. International.html | 2021-04-09 11:12 | 891 | |
| LAM.html | 2021-04-09 11:12 | 5.4K | |
| LAW.html | 2021-04-09 11:12 | 3.0K | |
| LEO shuttle.html | 2021-04-09 11:12 | 55K | |
| LGTM Linebacker G-87.html | 2021-04-09 11:12 | 160 | |
| LIMB.html | 2021-04-09 11:12 | 1.3K | |
| LIMB International.html | 2021-04-09 11:12 | 3.0K | |
| LIMB clinic.html | 2021-04-09 11:12 | 141 | |
| LIMB clinics.html | 2021-04-09 11:12 | 3.2K | |
| LS-66 Sabre Direct Energy Rifle (DER).html | 2021-04-09 11:12 | 5.2K | |
| LaGuardia Airport.html | 2021-04-09 11:12 | 47K | |
| La Porte de l'Enfer.html | 2021-04-09 11:12 | 6.7K | |
| Lab Notes, Dr. Moreau.html | 2021-04-09 11:12 | 1.6K | |
| Ladies Man.html | 2021-04-09 11:12 | 2.8K | |
| Laredo Manufacturing.html | 2021-04-09 11:12 | 492 | |
| Laser Tripwire.html | 2021-04-09 11:12 | 4.1K | |
| Laser rifle.html | 2021-04-09 11:12 | 5.4K | |
| Laura Bailey.html | 2021-04-09 11:12 | 3.1K | |
| Lawrence Barrett.html | 2021-04-09 11:12 | 9.5K | |
| Lazarus.html | 2021-04-09 11:12 | 3.4K | |
| Lee Hong.html | 2021-04-09 11:12 | 2.5K | |
| Legend.html | 2021-04-09 11:12 | 3.6K | |
| Leila Nassif.html | 2021-04-09 11:12 | 3.8K | |
| Leni Parker.html | 2021-04-09 11:12 | 921 | |
| Lenny.html | 2021-04-09 11:12 | 22K | |
| Leo.html | 2021-04-09 11:12 | 610 | |
| Leo Gold.html | 2021-04-09 11:12 | 1.3K | |
| Leo Jankowski.html | 2021-04-09 11:12 | 6.1K | |
| Lesser Evil.html | 2021-04-09 11:12 | 343 | |
| Lesser Evils.html | 2021-04-09 11:12 | 6.4K | |
| Letitia.html | 2021-04-09 11:12 | 15K | |
| Li Li.html | 2021-04-09 11:12 | 610 | |
| Liberate Yourself.html | 2021-04-09 11:12 | 4.9K | |
| Liberty Island.html | 2021-04-09 11:12 | 4.8K | |
| Liberty Island MJ12 lab.html | 2021-04-09 11:12 | 16K | |
| Light.html | 2021-04-09 11:12 | 8.2K | |
| Light spider bot.html | 2021-04-09 11:12 | 30K | |
| Lin-May Chen.html | 2021-04-09 11:12 | 4.0K | |
| Lin Fu Ren.html | 2021-04-09 11:12 | 2.0K | |
| Lionel.html | 2021-04-09 11:12 | 1.6K | |
| Liquor.html | 2021-04-09 11:12 | 957 | |
| ListBooks.html | 2021-04-09 11:12 | 436 | |
| List of exploit in Deus Ex.html | 2021-04-09 11:12 | 15K | |
| Lloyd.html | 2021-04-09 11:12 | 2.0K | |
| Location.html | 2021-04-09 11:12 | 7.8K | |
| Locations.html | 2021-04-09 11:12 | 200 | |
| Lock.html | 2021-04-09 11:12 | 3.8K | |
| Lockpick.html | 2021-04-09 11:12 | 1.9K | |
| Lockpicking.html | 2021-04-09 11:12 | 220 | |
| Lockpicking skill.html | 2021-04-09 11:12 | 1.0K | |
| Lone Wolf.html | 2021-04-09 11:12 | 4.6K | |
| Lone Wolf Beer.html | 2021-04-09 11:12 | 509 | |
| Longsword 202 'ERaSeR'.html | 2021-04-09 11:12 | 1.4K | |
| Longsword Whisperhead.html | 2021-04-09 11:12 | 54K | |
| Louis.html | 2021-04-09 11:12 | 1.3K | |
| Louis Pan.html | 2021-04-09 11:12 | 1.7K | |
| Low-Tech (Weapon skill).html | 2021-04-09 11:12 | 594 | |
| Low-Tech.html | 2021-04-09 11:12 | 160 | |
| Lower East Side Cemetery.html | 2021-04-09 11:12 | 7.7K | |
| Lower Seattle.html | 2021-04-09 11:12 | 2.4K | |
| Lu Pin Rong.html | 2021-04-09 11:12 | 7.0K | |
| Lucinda Davis.html | 2021-04-09 11:12 | 3.0K | |
| Lucius DeBeers.html | 2021-04-09 11:12 | 5.5K | |
| Lucky Guess.html | 2021-04-09 11:12 | 2.1K | |
| Lucky Money.html | 2021-04-09 11:12 | 4.4K | |
| Luminon Saman.html | 2021-04-09 11:12 | 131 | |
| Luminous Path.html | 2021-04-09 11:12 | 4.6K | |
| Lumpath compound cookbook.html | 2021-04-09 11:12 | 928 | |
| Lyle Rogers.html | 2021-04-09 11:12 | 1.2K | |
| M-28 Remote explosive.html | 2021-04-09 11:12 | 228 | |
| M1-A Frag.html | 2021-04-09 11:12 | 17K | |
| M404 Heavy Rifle.html | 2021-04-09 11:12 | 277 | |
| MCB Gang Leader.html | 2021-04-09 11:12 | 1.8K | |
| MILNET.html | 2021-04-09 11:12 | 1.3K | |
| MJ-12.html | 2021-04-09 11:12 | 135 | |
| MJ-12 Commando.html | 2021-04-09 11:12 | 3.9K | |
| MJ-12 Obsidian power armor.html | 2021-04-09 11:12 | 1.7K | |
| MJ12.html | 2021-04-09 11:12 | 720 | |
| MJ12 Commando.html | 2021-04-09 11:12 | 38K | |
| MJ12 Compromised Individuals List.html | 2021-04-09 11:12 | 1.6K | |
| MJ12 Frogman.html | 2021-04-09 11:12 | 3.1K | |
| MJ12 Helibase.html | 2021-04-09 11:12 | 2.3K | |
| MJ12 Missile Silo.html | 2021-04-09 11:12 | 7.7K | |
| MJ12 Nano-Augmentation Experiment Series 3-C.html | 2021-04-09 11:12 | 2.2K | |
| MJ12 Ocean Lab.html | 2021-04-09 11:12 | 1.4K | |
| MJ12 Trooper.html | 2021-04-09 11:12 | 4.7K | |
| Machine pistol.html | 2021-04-09 11:12 | 4.9K | |
| Mag Rail.html | 2021-04-09 11:12 | 3.5K | |
| Maggie Chow.html | 2021-04-09 11:12 | 7.7K | |
| Main Page.html | 2021-04-09 11:12 | 208 | |
| Majestic-12.html | 2021-04-09 11:12 | 9.1K | |
| Majestic 12.html | 2021-04-09 11:12 | 1.0K | |
| Mako.html | 2021-04-09 11:12 | 209 | |
| Mako Ballistics.html | 2021-04-09 11:12 | 2.7K | |
| Mako Ballistics 10mm pistol.html | 2021-04-09 11:12 | 910 | |
| Mako Ballistics Assault Rifle.html | 2021-04-09 11:12 | 41K | |
| Mako Ballistics Headquarters.html | 2021-04-09 11:12 | 1.0K | |
| Malik.html | 2021-04-09 11:12 | 139 | |
| Manderley.html | 2021-04-09 11:12 | 3.6K | |
| Man in Black.html | 2021-04-09 11:12 | 141 | |
| Marcel Jeannin.html | 2021-04-09 11:12 | 828 | |
| Mari Hela.html | 2021-04-09 11:12 | 2.3K | |
| Martin Darrow.html | 2021-04-09 11:12 | 35K | |
| Maskini Nassif.html | 2021-04-09 11:12 | 2.1K | |
| Matsu-Gravas GV-4 Nightingale medical bot.html | 2021-04-09 11:12 | 2.8K | |
| Matsu-Gravas R-118 Repair bot.html | 2021-04-09 11:12 | 2.4K | |
| Matt Holland.html | 2021-04-09 11:12 | 903 | |
| Matter of Discretion.html | 2021-04-09 11:12 | 408 | |
| Max Chen.html | 2021-04-09 11:12 | 4.1K | |
| Mechanical-augmentation.html | 2021-04-09 11:12 | 3.3K | |
| Mechanical-augmented.html | 2021-04-09 11:12 | 5.6K | |
| Mechanical augmentation.html | 2021-04-09 11:12 | 2.1K | |
| MediaWikiCommon.css.html | 2021-04-09 11:12 | 25K | |
| MediaWikiCommon.js.html | 2021-04-09 11:12 | 5.0K | |
| MediaWikiCommunity-corner.html | 2021-04-09 11:12 | 56K | |
| MediaWikiCopyrightwarning.html | 2021-04-09 11:12 | 1.0K | |
| MediaWikiLicenses.html | 2021-04-09 11:12 | 907 | |
| MediaWikiMainpage.html | 2021-04-09 11:12 | 116 | |
| MediaWikiMonaco-sidebar.html | 2021-04-09 11:12 | 757 | |
| MediaWikiMonobook.css.html | 2021-04-09 11:12 | 3.4K | |
| MediaWikiNewarticletext.html | 2021-04-09 11:12 | 7.4K | |
| MediaWikiRelatedVideosGlobalList.html | 2021-04-09 11:12 | 8.6K | |
| MediaWikiSidebar.html | 2021-04-09 11:12 | 9.6K | |
| MediaWikiSitenotice.html | 2021-04-09 11:12 | 21K | |
| MediaWikiWiki-navigation.html | 2021-04-09 11:12 | 8.4K | |
| MediaWikiWikia.css.html | 2021-04-09 11:12 | 7.0K | |
| Medical Bot.html | 2021-04-09 11:12 | 266 | |
| Medical Management of Biological Casualties Handbook.html | 2021-04-09 11:12 | 1.1K | |
| Medicine.html | 2021-04-09 11:12 | 10K | |
| Medicine skill.html | 2021-04-09 11:12 | 217 | |
| Medina.html | 2021-04-09 11:12 | 132 | |
| Medina Apartments.html | 2021-04-09 11:12 | 1.7K | |
| Medkit.html | 2021-04-09 11:12 | 1.7K | |
| Megan.html | 2021-04-09 11:12 | 133 | |
| Megan Reed.html | 2021-04-09 11:12 | 8.8K | |
| Mei Suen.html | 2021-04-09 11:12 | 2.2K | |
| Mengyao.html | 2021-04-09 11:12 | 1.9K | |
| Men in Black.html | 2021-04-09 11:12 | 5.1K | |
| Merchant (DX3).html | 2021-04-09 11:12 | 1.2K | |
| Merchant.html | 2021-04-09 11:12 | 363 | |
| Mexicantown Massacre.html | 2021-04-09 11:12 | 6.8K | |
| MiB.html | 2021-04-09 11:12 | 4.9K | |
| Michael Berry.html | 2021-04-09 11:12 | 1.6K | |
| Michael Rudder.html | 2021-04-09 11:12 | 754 | |
| Michael Zelazny.html | 2021-04-09 11:12 | 8.4K | |
| Michelle Boback.html | 2021-04-09 11:12 | 1.0K | |
| Michelle Walthers.html | 2021-04-09 11:12 | 9.4K | |
| Microfibral Muscle.html | 2021-04-09 11:12 | 1.5K | |
| Microfibrial Muscle.html | 2021-04-09 11:12 | 3.1K | |
| Midnight Sun.html | 2021-04-09 11:12 | 7.9K | |
| Miguel.html | 2021-04-09 11:12 | 6.2K | |
| Military Arms of Ostrava.html | 2021-04-09 11:12 | 4.8K | |
| Military Arms of Ostravia.html | 2021-04-09 11:12 | 4.9K | |
| Military helicopter.html | 2021-04-09 11:12 | 923 | |
| Milwaukee.html | 2021-04-09 11:12 | 2.0K | |
| Milwaukee Junction.html | 2021-04-09 11:12 | 1.5K | |
| Mine Template.html | 2021-04-09 11:12 | 3.6K | |
| Mini-crossbow.html | 2021-04-09 11:12 | 147 | |
| Mini-sub.html | 2021-04-09 11:12 | 7.3K | |
| Minigun turret.html | 2021-04-09 11:12 | 134 | |
| Mods.html | 2021-04-09 11:12 | 1.6K | |
| Mole People.html | 2021-04-09 11:12 | 3.8K | |
| Mole People Tunnels.html | 2021-04-09 11:12 | 1.4K | |
| Mongoose BT Shotgun.html | 2021-04-09 11:12 | 1.5K | |
| Monica Platz.html | 2021-04-09 11:12 | 1.4K | |
| Montreal.html | 2021-04-09 11:12 | 3.5K | |
| Morgan Everett's Residence.html | 2021-04-09 11:12 | 7.8K | |
| Morgan Everett.html | 2021-04-09 11:12 | 8.0K | |
| Morpheus.html | 2021-04-09 11:12 | 8.5K | |
| Moscow.html | 2021-04-09 11:12 | 5.9K | |
| Motherly Ties.html | 2021-04-09 11:12 | 7.3K | |
| Motokun (Company).html | 2021-04-09 11:12 | 5.3K | |
| Motokun.html | 2021-04-09 11:12 | 6.7K | |
| Motor City Bangers.html | 2021-04-09 11:12 | 1.4K | |
| Mr. Hundley.html | 2021-04-09 11:12 | 3.9K | |
| Multitool (DX).html | 2021-04-09 11:12 | 3.2K | |
| Multitool (DX2).html | 2021-04-09 11:12 | 6.7K | |
| Multitool.html | 2021-04-09 11:12 | 1.5K | |
| Murky's journal.html | 2021-04-09 11:12 | 220 | |
| Mustang Arms.html | 2021-04-09 11:12 | 3.2K | |
| NG Resonance.html | 2021-04-09 11:12 | 3.4K | |
| NSF.html | 2021-04-09 11:12 | 167 | |
| NYC.html | 2021-04-09 11:12 | 137 | |
| Namir.html | 2021-04-09 11:12 | 202 | |
| Nanite.html | 2021-04-09 11:12 | 6.0K | |
| Nanites.html | 2021-04-09 11:12 | 127 | |
| Nano-Augmentation Guidelines.html | 2021-04-09 11:12 | 2.2K | |
| Nano-Augmentation Pipedream, or Theory for The Future.html | 2021-04-09 11:12 | 1.6K | |
| Nano-augmentation.html | 2021-04-09 11:12 | 185 | |
| Nano-augmented.html | 2021-04-09 11:12 | 414 | |
| Nanoformer.html | 2021-04-09 11:12 | 1.7K | |
| Nanotechnological augmentation.html | 2021-04-09 11:12 | 25K | |
| Nanotechnology for Stupid People.html | 2021-04-09 11:12 | 2.3K | |
| Narhari Kahn.html | 2021-04-09 11:12 | 3.7K | |
| Narhari Khan.html | 2021-04-09 11:12 | 1.1K | |
| Nassif Greenhouse.html | 2021-04-09 11:12 | 1.8K | |
| National Secessionist Forces.html | 2021-04-09 11:12 | 12K | |
| Naval Yards sign-in book.html | 2021-04-09 11:12 | 1.0K | |
| Navig.html | 2021-04-09 11:12 | 1.3K | |
| Neil Townsend.html | 2021-04-09 11:12 | 1.8K | |
| NetChurch of God pamphlet.html | 2021-04-09 11:12 | 1.8K | |
| Netanya Keitner.html | 2021-04-09 11:12 | 4.4K | |
| Neural Interface Protocols The PEDOT Revolution.html | 2021-04-09 11:12 | 3.6K | |
| Neuropozyne.html | 2021-04-09 11:12 | 16K | |
| Neutralize the Terrorist Leader.html | 2021-04-09 11:12 | 4.7K | |
| Never Forget.html | 2021-04-09 11:12 | 1.8K | |
| Never Stop Looking (achievement).html | 2021-04-09 11:12 | 219 | |
| New Sons of Freedom.html | 2021-04-09 11:12 | 2.5K | |
| New World Press.html | 2021-04-09 11:12 | 5.6K | |
| New York.html | 2021-04-09 11:12 | 270 | |
| New York City.html | 2021-04-09 11:12 | 1.7K | |
| New York Voice.html | 2021-04-09 11:12 | 1.9K | |
| Nia Colvin.html | 2021-04-09 11:12 | 2.6K | |
| Nicholas.html | 2021-04-09 11:12 | 2.1K | |
| Nick Pausback.html | 2021-04-09 11:12 | 11K | |
| Nicky.html | 2021-04-09 11:12 | 15K | |
| Nicolette DuClare.html | 2021-04-09 11:12 | 8.4K | |
| Nina Sullivan.html | 2021-04-09 11:12 | 3.2K | |
| Nine Worlds Tavern.html | 2021-04-09 11:12 | 1.2K | |
| Ning Tsai.html | 2021-04-09 11:12 | 3.4K | |
| No Better The Myth of Human Augmentation.html | 2021-04-09 11:12 | 2.8K | |
| Noisemaker grenade.html | 2021-04-09 11:12 | 22K | |
| Non-eutactic blade.html | 2021-04-09 11:12 | 131 | |
| Notebook of Giuliano Jordorowsky.html | 2021-04-09 11:12 | 1.3K | |
| Nuke Virus Software.html | 2021-04-09 11:12 | 2.5K | |
| Ny'ashia Akim.html | 2021-04-09 11:12 | 26K | |
| O'Malley.html | 2021-04-09 11:12 | 24K | |
| Ocean Lab.html | 2021-04-09 11:12 | 12K | |
| Ogre.html | 2021-04-09 11:12 | 5.1K | |
| Old Cairo.html | 2021-04-09 11:12 | 4.6K | |
| Old China Hand.html | 2021-04-09 11:12 | 2.1K | |
| Old School Gamer.html | 2021-04-09 11:12 | 5.6K | |
| Omar.html | 2021-04-09 11:12 | 12K | |
| Omar Trader.html | 2021-04-09 11:12 | 2.6K | |
| Omega Ranch.html | 2021-04-09 11:12 | 6.9K | |
| On-View.html | 2021-04-09 11:12 | 1.6K | |
| One Good Turn Deserves Another.html | 2021-04-09 11:12 | 1.6K | |
| Opportunist.html | 2021-04-09 11:12 | 2.3K | |
| Optical Enhancement Functionality.html | 2021-04-09 11:12 | 1.5K | |
| Oracle.html | 2021-04-09 11:12 | 138K | |
| Order.html | 2021-04-09 11:12 | 5.6K | |
| Order Church.html | 2021-04-09 11:12 | 9.0K | |
| Order Mosque.html | 2021-04-09 11:12 | 8.3K | |
| Osgood and Sons Imports.html | 2021-04-09 11:12 | 2.4K | |
| Osgood and Sons Warehouse.html | 2021-04-09 11:12 | 246 | |
| Out of the Frying Pan.html | 2021-04-09 11:12 | 22K | |
| P-Gee.html | 2021-04-09 11:12 | 16K | |
| P.E.P.S..html | 2021-04-09 11:12 | 4.9K | |
| P.E.P.S.html | 2021-04-09 11:12 | 25K | |
| P. Sherman.html | 2021-04-09 11:12 | 1.0K | |
| PAX-22 Tranquilizer Rifle.html | 2021-04-09 11:12 | 1.7K | |
| PEPS.html | 2021-04-09 11:12 | 3.0K | |
| PPD 10mm Service Pistol.html | 2021-04-09 11:12 | 1.8K | |
| PPS SAP Tactical Shotgun.html | 2021-04-09 11:12 | 1.5K | |
| PRCS Wall Cloud.html | 2021-04-09 11:12 | 5.1K | |
| PS20.html | 2021-04-09 11:12 | 3.0K | |
| Pacifist.html | 2021-04-09 11:12 | 5.9K | |
| Page.html | 2021-04-09 11:12 | 195 | |
| Page Bravo-3 Peacebringer.html | 2021-04-09 11:12 | 5.4K | |
| Page Delta-2 Peacebringer.html | 2021-04-09 11:12 | 2.1K | |
| Page Industries.html | 2021-04-09 11:12 | 3.2K | |
| Paging Adam Jensen.html | 2021-04-09 11:12 | 1.6K | |
| Painkiller.html | 2021-04-09 11:12 | 851 | |
| Painkillers.html | 2021-04-09 11:12 | 1.7K | |
| Panama.html | 2021-04-09 11:12 | 1.6K | |
| Panchaea.html | 2021-04-09 11:12 | 11K | |
| Pangu.html | 2021-04-09 11:12 | 7.4K | |
| Panzerwerks.html | 2021-04-09 11:12 | 2.2K | |
| Paris.html | 2021-04-09 11:12 | 12K | |
| Paris Catacombs.html | 2021-04-09 11:12 | 2.3K | |
| Paris Investigateur.html | 2021-04-09 11:12 | 4.8K | |
| Paris Metropolitain bulletin terminal.html | 2021-04-09 11:12 | 3.9K | |
| Pasadena Ocean Lab.html | 2021-04-09 11:12 | 3.4K | |
| Passwords (DX3).html | 2021-04-09 11:12 | 24K | |
| Passwords (Deus Ex Human Revolution).html | 2021-04-09 11:12 | 292 | |
| Patton.html | 2021-04-09 11:12 | 12K | |
| Paul Denton's computer.html | 2021-04-09 11:12 | 4.5K | |
| Paul Denton.html | 2021-04-09 11:12 | 11K | |
| Paula Jean Hixson.html | 2021-04-09 11:12 | 1.4K | |
| Peng Xin Hao.html | 2021-04-09 11:12 | 13K | |
| People's Republic of China.html | 2021-04-09 11:12 | 13K | |
| Peoples Republic of China.html | 2021-04-09 11:12 | 312 | |
| Pepper Spray.html | 2021-04-09 11:12 | 140 | |
| Pepper gun.html | 2021-04-09 11:12 | 138 | |
| Pequod's.html | 2021-04-09 11:12 | 3.0K | |
| Petals Of Twilight.html | 2021-04-09 11:12 | 1.7K | |
| Philip Mead.html | 2021-04-09 11:12 | 8.3K | |
| Philip Riley Mead.html | 2021-04-09 11:12 | 8.6K | |
| Phosphorous flare.html | 2021-04-09 11:12 | 913 | |
| Physiopharmaceutical-augmentation.html | 2021-04-09 11:12 | 382 | |
| Physiopharmaceutical augmentation.html | 2021-04-09 11:12 | 3.2K | |
| Picus.html | 2021-04-09 11:12 | 1.8K | |
| Picus Communications.html | 2021-04-09 11:12 | 2.4K | |
| Picus Communications Group.html | 2021-04-09 11:12 | 20K | |
| Picus TV.html | 2021-04-09 11:12 | 8.0K | |
| Pieter Burke.html | 2021-04-09 11:12 | 7.5K | |
| Piezochem.html | 2021-04-09 11:12 | 3.3K | |
| Piezochem A-V810 Medical bot.html | 2021-04-09 11:12 | 2.1K | |
| Piezochem W31V Repair bot.html | 2021-04-09 11:12 | 3.3K | |
| Pistol (DX).html | 2021-04-09 11:12 | 3.2K | |
| Pistol (DX2).html | 2021-04-09 11:12 | 4.1K | |
| Pistol (DX3).html | 2021-04-09 11:12 | 208 | |
| Pistol (DXHR).html | 2021-04-09 11:12 | 113 | |
| Pistol (Weapon skill).html | 2021-04-09 11:12 | 2.3K | |
| Pistol.html | 2021-04-09 11:12 | 2.9K | |
| Plasma Rifle.html | 2021-04-09 11:12 | 1.9K | |
| Plasma rifle (DX).html | 2021-04-09 11:12 | 5.6K | |
| Plasma rifle (DX3).html | 2021-04-09 11:12 | 30K | |
| Pocket Secretary.html | 2021-04-09 11:12 | 5.0K | |
| Police (DX).html | 2021-04-09 11:12 | 773 | |
| Police.html | 2021-04-09 11:12 | 6.1K | |
| Police boat.html | 2021-04-09 11:12 | 12K | |
| Portal Guide.html | 2021-04-09 11:12 | 8.2K | |
| Power Generator.html | 2021-04-09 11:12 | 1.4K | |
| Power Recirculator.html | 2021-04-09 11:12 | 2.0K | |
| Power armor.html | 2021-04-09 11:12 | 958 | |
| Power cell.html | 2021-04-09 11:12 | 1.4K | |
| Praxis.html | 2021-04-09 11:12 | 7.5K | |
| Praxis Point.html | 2021-04-09 11:12 | 132 | |
| Praxis kit.html | 2021-04-09 11:12 | 1.0K | |
| President Bourges-Manoury.html | 2021-04-09 11:12 | 177 | |
| Pritchard.html | 2021-04-09 11:12 | 4.2K | |
| Project Dibbuk (book).html | 2021-04-09 11:12 | 3.3K | |
| Project Dibbuk Thoughts and Meditations.html | 2021-04-09 11:12 | 8.5K | |
| Project Morpheus Notebook 8-B.html | 2021-04-09 11:12 | 1.5K | |
| Public Banking Terminal.html | 2021-04-09 11:12 | 1.5K | |
| Purity First.html | 2021-04-09 11:12 | 3.8K | |
| Queen's Tower Residential Directory.html | 2021-04-09 11:12 | 1.8K | |
| Queequeg's.html | 2021-04-09 11:12 | 5.9K | |
| Quest items (DX3).html | 2021-04-09 11:12 | 19K | |
| Quicksilver Reflex Booster.html | 2021-04-09 11:12 | 5.6K | |
| Quincy Durant.html | 2021-04-09 11:12 | 24K | |
| RB-76 Military bot.html | 2021-04-09 11:12 | 5.2K | |
| Radar Transparency.html | 2021-04-09 11:12 | 2.2K | |
| Radical Evolution is a Reality.html | 2021-04-09 11:12 | 1.8K | |
| Random House Inc.html | 2021-04-09 11:12 | 2.2K | |
| Rauchstadt.html | 2021-04-09 11:12 | 1.3K | |
| Rebreather.html | 2021-04-09 11:12 | 1.0K | |
| Recycle Military Bill.html | 2021-04-09 11:12 | 2.9K | |
| Red Arrow.html | 2021-04-09 11:12 | 2.3K | |
| Red Greasel Hunter.html | 2021-04-09 11:12 | 1.5K | |
| Reed.html | 2021-04-09 11:12 | 4.0K | |
| Refire rate.html | 2021-04-09 11:12 | 3.4K | |
| Reflex Booster.html | 2021-04-09 11:12 | 174 | |
| Regeneration.html | 2021-04-09 11:12 | 3.8K | |
| Reimagining Retinal Implants Doctor Dobelle's Success.html | 2021-04-09 11:12 | 13K | |
| Remote explosive.html | 2021-04-09 11:12 | 3.2K | |
| Renault.html | 2021-04-09 11:12 | 3.0K | |
| Rescuing Megan and Her Team.html | 2021-04-09 11:12 | 18K | |
| Resist The Machine.html | 2021-04-09 11:12 | 1.3K | |
| Respirocyte Technology & Hazardous Environment Parsing.html | 2021-04-09 11:12 | 1.8K | |
| Revolver.html | 2021-04-09 11:12 | 226 | |
| Rhonda Mitchell.html | 2021-04-09 11:12 | 2.7K | |
| Richard Hundley.html | 2021-04-09 11:12 | 1.2K | |
| Ridley.html | 2021-04-09 11:12 | 1.8K | |
| Riezene.html | 2021-04-09 11:12 | 1.8K | |
| Rifle.html | 2021-04-09 11:12 | 151 | |
| Rifleman Bank Station.html | 2021-04-09 11:12 | 11K | |
| Righteous Angels Perspectives on UNATCO.html | 2021-04-09 11:12 | 1.7K | |
| Riot CS.html | 2021-04-09 11:12 | 2.4K | |
| Riot cop.html | 2021-04-09 11:12 | 258 | |
| Riot prod.html | 2021-04-09 11:12 | 202 | |
| Robert Graham.html | 2021-04-09 11:12 | 3.0K | |
| Robert Newell.html | 2021-04-09 11:12 | 1.4K | |
| Rock.html | 2021-04-09 11:12 | 2.2K | |
| Rocket launcher (DX2).html | 2021-04-09 11:12 | 1.9K | |
| Rocket launcher (DX3).html | 2021-04-09 11:12 | 3.8K | |
| Rocket launcher.html | 2021-04-09 11:12 | 302 | |
| Rocket turret.html | 2021-04-09 11:12 | 133 | |
| Rooks.html | 2021-04-09 11:12 | 2.1K | |
| Rotten Business.html | 2021-04-09 11:12 | 7.0K | |
| Ruck.html | 2021-04-09 11:12 | 237 | |
| Run Silent.html | 2021-04-09 11:12 | 1.9K | |
| SH-187 stealth helicopter.html | 2021-04-09 11:12 | 27K | |
| SMG.html | 2021-04-09 11:12 | 3.2K | |
| SP6975 Aero security bot.html | 2021-04-09 11:12 | 2.1K | |
| SS - AP5.html | 2021-04-09 11:12 | 27K | |
| SSC.html | 2021-04-09 11:12 | 169 | |
| SWAT.html | 2021-04-09 11:12 | 3.3K | |
| SWAT team commander.html | 2021-04-09 11:12 | 2.3K | |
| Sam Carter.html | 2021-04-09 11:12 | 6.5K | |
| Sam Duarte.html | 2021-04-09 11:12 | 9.2K | |
| Saman.html | 2021-04-09 11:12 | 5.3K | |
| Sandoval.html | 2021-04-09 11:12 | 239 | |
| Sandra Renton.html | 2021-04-09 11:12 | 4.9K | |
| Sarif.html | 2021-04-09 11:12 | 135 | |
| Sarif Industries (mission).html | 2021-04-09 11:12 | 880 | |
| Sarif Industries.html | 2021-04-09 11:12 | 15K | |
| Sarif Industries Rising to Tomorrow.html | 2021-04-09 11:12 | 2.5K | |
| Sarif Manufacturing Plant.html | 2021-04-09 11:12 | 772 | |
| Sarif Plant.html | 2021-04-09 11:12 | 1.0K | |
| Sarif Series 8 Energy Converter.html | 2021-04-09 11:12 | 14K | |
| Sawed-off shotgun.html | 2021-04-09 11:12 | 159 | |
| Scott.html | 2021-04-09 11:12 | 1.5K | |
| Scott Hardesty.html | 2021-04-09 11:12 | 2.9K | |
| Scramble grenade.html | 2021-04-09 11:12 | 1.4K | |
| Scrambler Grenade.html | 2021-04-09 11:12 | 1.7K | |
| Scrambler prox mine.html | 2021-04-09 11:12 | 1.0K | |
| Searching for Proof.html | 2021-04-09 11:12 | 336 | |
| Seattle.html | 2021-04-09 11:12 | 2.2K | |
| Seattle Inclinator.html | 2021-04-09 11:12 | 4.8K | |
| Secret Service.html | 2021-04-09 11:12 | 4.3K | |
| Securing Sarif's Manufacturing Plant.html | 2021-04-09 11:12 | 15K | |
| Security Manager Office.html | 2021-04-09 11:12 | 7.6K | |
| Security camera.html | 2021-04-09 11:12 | 26K | |
| Senjin Braeden.html | 2021-04-09 11:12 | 904 | |
| Sentimental Value.html | 2021-04-09 11:12 | 2.2K | |
| Sentinel RX Health System.html | 2021-04-09 11:12 | 3.0K | |
| Seuraat.html | 2021-04-09 11:12 | 1.5K | |
| Seurat.html | 2021-04-09 11:12 | 3.3K | |
| Sevchenko.html | 2021-04-09 11:12 | 149 | |
| Shanghai Justice.html | 2021-04-09 11:12 | 9.9K | |
| Shannon.html | 2021-04-09 11:12 | 1.5K | |
| Sheppard O'Neill.html | 2021-04-09 11:12 | 2.7K | |
| Sherri Ter Horst.html | 2021-04-09 11:12 | 9.6K | |
| Shifter (Mod).html | 2021-04-09 11:12 | 13K | |
| Shifter.html | 2021-04-09 11:12 | 272 | |
| Shop (DX3).html | 2021-04-09 11:12 | 22K | |
| Shotgun (DX2).html | 2021-04-09 11:12 | 2.2K | |
| Shotgun (DX3).html | 2021-04-09 11:12 | 25K | |
| Shotgun (DXHR).html | 2021-04-09 11:12 | 757 | |
| Shotgun.html | 2021-04-09 11:12 | 406 | |
| Shutting Down Darrow's Signal.html | 2021-04-09 11:12 | 17K | |
| Sid Black.html | 2021-04-09 11:12 | 3.1K | |
| Silas Archer.html | 2021-04-09 11:12 | 2.4K | |
| Silenced sniper rifle.html | 2021-04-09 11:12 | 4.7K | |
| Silencer.html | 2021-04-09 11:12 | 3.6K | |
| Silhouette.html | 2021-04-09 11:12 | 4.4K | |
| Singapore.html | 2021-04-09 11:12 | 1.4K | |
| Small security bot.html | 2021-04-09 11:12 | 2.1K | |
| Smart Vision.html | 2021-04-09 11:12 | 7.6K | |
| Smash the State.html | 2021-04-09 11:12 | 9.9K | |
| Smooth Operator.html | 2021-04-09 11:12 | 7.6K | |
| Smuggler's computer.html | 2021-04-09 11:12 | 4.7K | |
| Smuggler.html | 2021-04-09 11:12 | 3.7K | |
| Sneaker.html | 2021-04-09 11:12 | 2.1K | |
| Sniper rifle (DX).html | 2021-04-09 11:12 | 189 | |
| Sniper rifle (DX2).html | 2021-04-09 11:12 | 124 | |
| Sniper rifle (DX3).html | 2021-04-09 11:12 | 7.1K | |
| Sniper rifle (DXHR).html | 2021-04-09 11:12 | 192 | |
| Sniper rifle.html | 2021-04-09 11:12 | 335 | |
| Social Enhancer.html | 2021-04-09 11:12 | 11K | |
| Soda.html | 2021-04-09 11:12 | 2.5K | |
| Soft key.html | 2021-04-09 11:12 | 1.1K | |
| Softkey.html | 2021-04-09 11:12 | 1.8K | |
| Soldier.html | 2021-04-09 11:12 | 2.0K | |
| Soloto.html | 2021-04-09 11:12 | 2.8K | |
| Sophia Sak's Hangar.html | 2021-04-09 11:12 | 1.6K | |
| Sophia Sak.html | 2021-04-09 11:12 | 1.3K | |
| Soy food.html | 2021-04-09 11:12 | 1.2K | |
| Soy packet.html | 2021-04-09 11:12 | 3.6K | |
| Spec Ops Shifter.html | 2021-04-09 11:12 | 6.5K | |
| Spec Ops soldier.html | 2021-04-09 11:12 | 8.3K | |
| Speed Enhancement.html | 2021-04-09 11:12 | 3.2K | |
| Spider Bot (DX2).html | 2021-04-09 11:12 | 831 | |
| Spiderbomb.html | 2021-04-09 11:12 | 2.6K | |
| Spirits.html | 2021-04-09 11:12 | 4.8K | |
| Spy Drone.html | 2021-04-09 11:12 | 3.4K | |
| Squalnomie.html | 2021-04-09 11:12 | 29K | |
| Square Enix.html | 2021-04-09 11:12 | 24K | |
| Square Enix Europe.html | 2021-04-09 11:12 | 14K | |
| Stan Carnegie.html | 2021-04-09 11:12 | 3.6K | |
| Standard Security Corporation.html | 2021-04-09 11:12 | 3.3K | |
| Stanton Dowd.html | 2021-04-09 11:12 | 4.1K | |
| Stasiuk Arms.html | 2021-04-09 11:12 | 797 | |
| Statue of Liberty.html | 2021-04-09 11:12 | 2.7K | |
| Stealth Enhancer.html | 2021-04-09 11:12 | 11K | |
| Stealth pistol.html | 2021-04-09 11:12 | 150 | |
| Steamy Dinkins.html | 2021-04-09 11:12 | 1.2K | |
| Steiner-Bisley.html | 2021-04-09 11:12 | 160 | |
| Steiner-Bisley GmbH.html | 2021-04-09 11:12 | 24K | |
| Steiner Bisley.html | 2021-04-09 11:12 | 11K | |
| Stephanie Maxwell.html | 2021-04-09 11:12 | 1.3K | |
| Stephen Shellen.html | 2021-04-09 11:12 | 1.1K | |
| Stop Worm Software.html | 2021-04-09 11:12 | 165 | |
| Stopping the Transmission.html | 2021-04-09 11:12 | 5.8K | |
| Stowing Away.html | 2021-04-09 11:12 | 8.2K | |
| Stun gun.html | 2021-04-09 11:12 | 5.3K | |
| Stun prod.html | 2021-04-09 11:12 | 1.5K | |
| Super Sleuth.html | 2021-04-09 11:12 | 15K | |
| Supply crate.html | 2021-04-09 11:12 | 1.4K | |
| Susan Glover.html | 2021-04-09 11:12 | 14K | |
| Swimming skill.html | 2021-04-09 11:12 | 867 | |
| Sword.html | 2021-04-09 11:12 | 2.3K | |
| Synthetic Heart.html | 2021-04-09 11:12 | 1.6K | |
| Synthetic Thought The Human AI.html | 2021-04-09 11:12 | 13K | |
| Tactical Enhancement Pack.html | 2021-04-09 11:12 | 213 | |
| Taggart.html | 2021-04-09 11:12 | 145 | |
| Tai-Fun.html | 2021-04-09 11:12 | 1.5K | |
| Tai Yong Medical.html | 2021-04-09 11:12 | 6.6K | |
| Tai Young Medical.html | 2021-04-09 11:12 | 5.1K | |
| Take-down.html | 2021-04-09 11:12 | 5.5K | |
| Take down.html | 2021-04-09 11:12 | 133 | |
| Takedown.html | 2021-04-09 11:12 | 22K | |
| Talion A.D. (achievement).html | 2021-04-09 11:12 | 205 | |
| Talion A. D..html | 2021-04-09 11:12 | 178 | |
| Talion A.D..html | 2021-04-09 11:12 | 9.6K | |
| Talon A. D..html | 2021-04-09 11:12 | 177 | |
| Targeting.html | 2021-04-09 11:12 | 2.3K | |
| Tarsus.html | 2021-04-09 11:12 | 4.2K | |
| Tarsus Academy.html | 2021-04-09 11:12 | 4.7K | |
| Tarsus Cairo.html | 2021-04-09 11:12 | 4.9K | |
| Tarsus SOR Program Billie Adams.html | 2021-04-09 11:12 | 1.4K | |
| Tarsus SOR Program Dr Leila Nassif.html | 2021-04-09 11:12 | 1.4K | |
| Tarsus SOR Program Klara Sparks.html | 2021-04-09 11:12 | 1.4K | |
| Tarsus SOR Program Leo Jankowski.html | 2021-04-09 11:12 | 2.6K | |
| Tarsus apartments.html | 2021-04-09 11:12 | 3.6K | |
| Tarsus recreation.html | 2021-04-09 11:12 | 1.3K | |
| Tech goggles.html | 2021-04-09 11:12 | 1.7K | |
| Ted Bruger.html | 2021-04-09 11:12 | 4.5K | |
| Templar V68A power armor.html | 2021-04-09 11:12 | 8.1K | |
| Template talkCharacter Infobox.html | 2021-04-09 11:12 | 1.3K | |
| Template talkDX3weaponinfobox.html | 2021-04-09 11:12 | 3.2K | |
| Template talkDX3 weapons.html | 2021-04-09 11:12 | 1.8K | |
| Template talkDeus Ex weapon infobox.html | 2021-04-09 11:12 | 2.5K | |
| Template talkInfobox.html | 2021-04-09 11:12 | 19K | |
| Template talkPortalComponentImages.html | 2021-04-09 11:12 | 34K | |
| Template talkT.html | 2021-04-09 11:12 | 5.1K | |
| Template talkWeapon infobox.html | 2021-04-09 11:12 | 5.7K | |
| Template talkWelcome.html | 2021-04-09 11:12 | 30K | |
| Testament of Adept 34501.html | 2021-04-09 11:12 | 1.6K | |
| That Old Adage.html | 2021-04-09 11:12 | 1.7K | |
| The Belltower Way.html | 2021-04-09 11:12 | 1.6K | |
| The Bleeding Raven.html | 2021-04-09 11:12 | 160 | |
| The Bloody Raven.html | 2021-04-09 11:12 | 158 | |
| The Bull.html | 2021-04-09 11:12 | 1.5K | |
| The D Project.html | 2021-04-09 11:12 | 4.9K | |
| The Dentons Myth and Mystery.html | 2021-04-09 11:12 | 1.4K | |
| The Desk Job.html | 2021-04-09 11:12 | 6.3K | |
| The Doctrine of the Mighty.html | 2021-04-09 11:12 | 1.6K | |
| The End.html | 2021-04-09 11:12 | 741 | |
| The Eye of Argon.html | 2021-04-09 11:12 | 1.3K | |
| The Fall.html | 2021-04-09 11:12 | 1.0K | |
| The Final Countdown.html | 2021-04-09 11:12 | 7.9K | |
| The Glitch.html | 2021-04-09 11:12 | 17K | |
| The Hive.html | 2021-04-09 11:12 | 1.9K | |
| The Intelligence Circuit.html | 2021-04-09 11:12 | 1.7K | |
| The Last Straw.html | 2021-04-09 11:12 | 3.7K | |
| The Learn'd Scholar (achievement).html | 2021-04-09 11:12 | 938 | |
| The Man Who Was Thursday.html | 2021-04-09 11:12 | 6.7K | |
| The Mantis.html | 2021-04-09 11:12 | 7.1K | |
| The Missing Link.html | 2021-04-09 11:12 | 9.4K | |
| The Missing Link walkthrough.html | 2021-04-09 11:12 | 26K | |
| The Modern Terrorist's Handbook.html | 2021-04-09 11:12 | 1.4K | |
| The Most Holy Annals Of The Luminous Path That Leads The Righteous To The Fold Of The Inner Celestial Kingdom.html | 2021-04-09 11:12 | 2.4K | |
| The Nameless Mod.html | 2021-04-09 11:12 | 6.1K | |
| The Nature of Neuroplasticity.html | 2021-04-09 11:12 | 2.5K | |
| The Neural Hub - Design For a Next Generation.html | 2021-04-09 11:12 | 5.9K | |
| The Next Three Decades.html | 2021-04-09 11:12 | 1.3K | |
| The Omega Ranch.html | 2021-04-09 11:12 | 212 | |
| The Order.html | 2021-04-09 11:12 | 6.5K | |
| The Picus Daily Standard.html | 2021-04-09 11:12 | 1.6K | |
| The Red Cross.html | 2021-04-09 11:12 | 8.1K | |
| The Reluctant Dictators.html | 2021-04-09 11:12 | 2.2K | |
| The Science and Theory behind Cochlear Implants.html | 2021-04-09 11:12 | 2.1K | |
| The Singularity Church of the MachineGod.html | 2021-04-09 11:12 | 33K | |
| The Sleepwalking World.html | 2021-04-09 11:12 | 5.2K | |
| The Snake.html | 2021-04-09 11:12 | 10K | |
| The Take.html | 2021-04-09 11:12 | 33K | |
| The Threat of Cybernetic Discognition Disorder.html | 2021-04-09 11:12 | 1.8K | |
| The Throwdown.html | 2021-04-09 11:12 | 3.3K | |
| The Transmission.html | 2021-04-09 11:12 | 1.6K | |
| The True Way.html | 2021-04-09 11:12 | 1.1K | |
| The Tyranny of Biology.html | 2021-04-09 11:12 | 2.2K | |
| The US.html | 2021-04-09 11:12 | 162 | |
| The United States.html | 2021-04-09 11:12 | 173 | |
| The United States of America.html | 2021-04-09 11:12 | 184 | |
| The Use of Neuromuscular Facilitation System.html | 2021-04-09 11:12 | 1.8K | |
| The Visual Cortex 2.0 - The Eye, Redesigned.html | 2021-04-09 11:12 | 1.7K | |
| The long way home.html | 2021-04-09 11:12 | 14K | |
| Thermoptic camo.html | 2021-04-09 11:12 | 3.0K | |
| Thomas Mann's will.html | 2021-04-09 11:12 | 1.2K | |
| Thomas Shea.html | 2021-04-09 11:12 | 1.8K | |
| Throwing knife.html | 2021-04-09 11:12 | 152 | |
| Throwing knives.html | 2021-04-09 11:12 | 8.6K | |
| Tiffany Kavanagh.html | 2021-04-09 11:12 | 9.5K | |
| Tiffany Savage.html | 2021-04-09 11:12 | 2.6K | |
| Tim Carella.html | 2021-04-09 11:12 | 5.6K | |
| Timeline.html | 2021-04-09 11:12 | 39K | |
| Toby Atanwe.html | 2021-04-09 11:12 | 1.4K | |
| Todd.html | 2021-04-09 11:12 | 5.9K | |
| Tom Hall.html | 2021-04-09 11:12 | 2.0K | |
| Tommy the Talking Greasel.html | 2021-04-09 11:12 | 7.1K | |
| Tomorrow's Man The Hugh Darrow Story.html | 2021-04-09 11:12 | 2.4K | |
| Tong Jr..html | 2021-04-09 11:12 | 3.4K | |
| Tong Se Hong.html | 2021-04-09 11:12 | 344 | |
| Tong Si Hung.html | 2021-04-09 11:12 | 6.2K | |
| Tonnochi Road.html | 2021-04-09 11:12 | 1.3K | |
| Tony Mares.html | 2021-04-09 11:12 | 5.3K | |
| Toxin Blade.html | 2021-04-09 11:12 | 1.0K | |
| Tracer Tong's laboratory.html | 2021-04-09 11:12 | 2.0K | |
| Tracer Tong.html | 2021-04-09 11:12 | 14K | |
| Track Vasili Sevchenko's GPL.html | 2021-04-09 11:12 | 14K | |
| Tranquilizer.html | 2021-04-09 11:12 | 11K | |
| Tranquilizer rifle.html | 2021-04-09 11:12 | 15K | |
| Transgenic.html | 2021-04-09 11:12 | 6.8K | |
| Transhumanist.html | 2021-04-09 11:12 | 1.5K | |
| Triads.html | 2021-04-09 11:12 | 3.9K | |
| Trier.html | 2021-04-09 11:12 | 3.3K | |
| Trongline.html | 2021-04-09 11:12 | 2.8K | |
| Trooper's journal.html | 2021-04-09 11:12 | 1.4K | |
| Trooper.html | 2021-04-09 11:12 | 6.0K | |
| Turn Table.html | 2021-04-09 11:12 | 136 | |
| Turntable.html | 2021-04-09 11:12 | 3.1K | |
| Turret.html | 2021-04-09 11:12 | 7.8K | |
| Turrets.html | 2021-04-09 11:12 | 127 | |
| Tying Up Loose Ends.html | 2021-04-09 11:12 | 2.5K | |
| Tyler.html | 2021-04-09 11:12 | 20K | |
| Typhoon Explosive System.html | 2021-04-09 11:12 | 12K | |
| Tyrant Jetliner.html | 2021-04-09 11:12 | 4.8K | |
| Tyrants.html | 2021-04-09 11:12 | 11K | |
| UNATCO.html | 2021-04-09 11:12 | 1.6K | |
| UNATCO HQ.html | 2021-04-09 11:12 | 302 | |
| UNATCO Handbook.html | 2021-04-09 11:12 | 6.8K | |
| UNATCO Handbooks.html | 2021-04-09 11:12 | 1.6K | |
| UNATCO Headquarters.html | 2021-04-09 11:12 | 7.3K | |
| UNATCO Training Manual.html | 2021-04-09 11:12 | 2.1K | |
| UNATCO bulletin terminal.html | 2021-04-09 11:12 | 11K | |
| UNATCO trooper.html | 2021-04-09 11:12 | 2.8K | |
| USA.html | 2021-04-09 11:12 | 159 | |
| Understanding Vision (Part 2).html | 2021-04-09 11:12 | 177 | |
| Understanding Vision.html | 2021-04-09 11:12 | 3.3K | |
| Underworld Tavern.html | 2021-04-09 11:12 | 22K | |
| Unforeseen Consequence.html | 2021-04-09 11:12 | 1.9K | |
| Unique e-books (DX3).html | 2021-04-09 11:12 | 6.3K | |
| Unique e-books (Deus Ex Human Revolution).html | 2021-04-09 11:12 | 167 | |
| Unique ebooks (DX3).html | 2021-04-09 11:12 | 316 | |
| United Kingdom.html | 2021-04-09 11:12 | 6.9K | |
| United Nations.html | 2021-04-09 11:12 | 11K | |
| United Nations Anti-Terrorist Coalition.html | 2021-04-09 11:12 | 12K | |
| United Nations Anti-Terrorist Coalition Headquarters.html | 2021-04-09 11:12 | 2.1K | |
| United States.html | 2021-04-09 11:12 | 169 | |
| United States of America.html | 2021-04-09 11:12 | 16K | |
| Uniting the World.html | 2021-04-09 11:12 | 1.4K | |
| Universal Constructor.html | 2021-04-09 11:12 | 5.9K | |
| Universal Constructor Theory, Priciples and Practice.html | 2021-04-09 11:12 | 304 | |
| Universal Constructor Theory, Principles and Practice.html | 2021-04-09 11:12 | 2.4K | |
| Universal ammo.html | 2021-04-09 11:12 | 150 | |
| Upper Seattle.html | 2021-04-09 11:12 | 1.5K | |
| Up the Ante.html | 2021-04-09 11:12 | 2.0K | |
| VTOL.html | 2021-04-09 11:12 | 2.0K | |
| Vagus Nerve Stimulators - Repurposing the Technology.html | 2021-04-09 11:12 | 1.7K | |
| Vandenberg.html | 2021-04-09 11:12 | 4.6K | |
| Vasili Sevchenko.html | 2021-04-09 11:12 | 4.3K | |
| Vehicle.html | 2021-04-09 11:12 | 6.0K | |
| Vendor.html | 2021-04-09 11:12 | 1.4K | |
| Vera Marcovic.html | 2021-04-09 11:12 | 2.9K | |
| Vera Maxwell.html | 2021-04-09 11:12 | 3.7K | |
| VersaLife.html | 2021-04-09 11:12 | 2.0K | |
| Vestibular Augmentation and Enhanced Agility Factoring.html | 2021-04-09 11:12 | 2.3K | |
| Vinny.html | 2021-04-09 11:12 | 1.1K | |
| Vishnu's Fall.html | 2021-04-09 11:12 | 1.6K | |
| Vision Enhancement.html | 2021-04-09 11:12 | 2.1K | |
| Visiting the L.I.M.B. Clinic.html | 2021-04-09 11:12 | 4.2K | |
| Vodka.html | 2021-04-09 11:12 | 2.1K | |
| Voices from the Dark.html | 2021-04-09 11:12 | 3.2K | |
| WTO.html | 2021-04-09 11:12 | 159 | |
| Walkthrough.html | 2021-04-09 11:12 | 53K | |
| Walton Simons.html | 2021-04-09 11:12 | 15K | |
| Wan Chai Market.html | 2021-04-09 11:12 | 8.1K | |
| Warehouse District.html | 2021-04-09 11:12 | 3.2K | |
| Wayfinder Radar System.html | 2021-04-09 11:12 | 3.0K | |
| Wayne Haas.html | 2021-04-09 11:12 | 19K | |
| We Hope For Better Things The Past and Future of Detroit.html | 2021-04-09 11:12 | 1.4K | |
| Weapon.html | 2021-04-09 11:12 | 5.3K | |
| Weapon Modifcations.html | 2021-04-09 11:12 | 133 | |
| Weapon Mods.html | 2021-04-09 11:12 | 430 | |
| Weapon Skills.html | 2021-04-09 11:12 | 145 | |
| Weapon modifications (DX1).html | 2021-04-09 11:12 | 1.6K | |
| Weapon modifications (DX2).html | 2021-04-09 11:12 | 140 | |
| Weapon modifications (DX3).html | 2021-04-09 11:12 | 29K | |
| Weapon modifications.html | 2021-04-09 11:12 | 1.0K | |
| Weapon mods (DX1).html | 2021-04-09 11:12 | 131 | |
| Weapon mods (DX2).html | 2021-04-09 11:12 | 131 | |
| Weapon mods (DX3).html | 2021-04-09 11:12 | 1.6K | |
| Weapon mods (Deus Ex Human Revolution).html | 2021-04-09 11:12 | 152 | |
| Weapons.html | 2021-04-09 11:12 | 1.1K | |
| Weapons Rifle.html | 2021-04-09 11:12 | 421 | |
| Weapons in Deus Ex.html | 2021-04-09 11:12 | 5.8K | |
| Weapons in Deus Ex Human Revolution.html | 2021-04-09 11:12 | 5.5K | |
| Weapons in Deus Ex Invisible War.html | 2021-04-09 11:12 | 224 | |
| Weapons in Deus Ex The Fall.html | 2021-04-09 11:12 | 3.8K | |
| Weapon skill.html | 2021-04-09 11:12 | 26K | |
| Welcome to the Revolution.html | 2021-04-09 11:12 | 6.2K | |
| Whiskey.html | 2021-04-09 11:12 | 2.9K | |
| Whispers of Conspiracy.html | 2021-04-09 11:12 | 4.6K | |
| WiB.html | 2021-04-09 11:12 | 4.4K | |
| Widowmaker SMG.html | 2021-04-09 11:12 | 1.7K | |
| Widowmaker TX.html | 2021-04-09 11:12 | 114 | |
| William Taggart.html | 2021-04-09 11:12 | 8.6K | |
| Wine (DX3).html | 2021-04-09 11:12 | 3.8K | |
| Wine.html | 2021-04-09 11:12 | 1.4K | |
| Wing.html | 2021-04-09 11:12 | 55K | |
| Wing Hui.html | 2021-04-09 11:12 | 1.4K | |
| Woman in Black.html | 2021-04-09 11:12 | 818 | |
| World Trade Organisation.html | 2021-04-09 11:12 | 180 | |
| World Trade Organization.html | 2021-04-09 11:12 | 4.5K | |
| X-51.html | 2021-04-09 11:12 | 14K | |
| XBOX Achievements.html | 2021-04-09 11:12 | 1.5K | |
| XNG Shipping.html | 2021-04-09 11:12 | 4.8K | |
| Xbow BT XH-III.html | 2021-04-09 11:12 | 1.2K | |
| Xbow Viper XH-IV.html | 2021-04-09 11:12 | 1.1K | |
| Xbow XHII.html | 2021-04-09 11:12 | 886 | |
| Yelena Federova.html | 2021-04-09 11:12 | 3.3K | |
| Yelena Fedorova.html | 2021-04-09 11:12 | 8.0K | |
| Yes Boss.html | 2021-04-09 11:12 | 1.9K | |
| You Scratch My Back, I'll Scratch Yours.html | 2021-04-09 11:12 | 15K | |
| Youzhao.html | 2021-04-09 11:12 | 147 | |
| Youzhao District.html | 2021-04-09 11:12 | 19K | |
| Yuen Kong.html | 2021-04-09 11:12 | 1.0K | |
| Yune.html | 2021-04-09 11:12 | 5.0K | |
| ZHL-U1953.html | 2021-04-09 11:12 | 1.7K | |
| Zeke.html | 2021-04-09 11:12 | 2.5K | |
| Zeke Sanders.html | 2021-04-09 11:12 | 150 | |
| Zenith (DX3).html | 2021-04-09 11:12 | 5.9K | |
| Zenith.html | 2021-04-09 11:12 | 1.6K | |
| Zhao.html | 2021-04-09 11:12 | 134 | |
| Zhao Yun.html | 2021-04-09 11:12 | 138 | |
| Zhao Yun Ru.html | 2021-04-09 11:12 | 13K | |
| Zyme.html | 2021-04-09 11:12 | 1.9K | |
| style.css | 2021-04-09 11:12 | 122 | |